import

For users with multiple accounts we need to specify the account to use.

.devcontainer/Dockerfile

@@ -0,0 +1,27 @@
+FROM ubuntu:24.04
+
+ARG DEBIAN_FRONTEND=noninteractive
+# enable 'universe' because musl-tools & clang live there
+RUN apt-get update && \
+    apt-get install -y --no-install-recommends \
+    software-properties-common && \
+    add-apt-repository --yes universe
+
+# now install build deps
+RUN apt-get update && \
+    apt-get install -y --no-install-recommends \
+    build-essential curl git ca-certificates \
+    pkg-config clang musl-tools libssl-dev just && \
+    rm -rf /var/lib/apt/lists/*
+
+# Ubuntu 24.04 ships with user 'ubuntu' already created with UID 1000.
+USER ubuntu
+
+# install Rust + musl target as dev user
+RUN curl -sSf https://sh.rustup.rs | sh -s -- -y --profile minimal && \
+    ~/.cargo/bin/rustup target add aarch64-unknown-linux-musl && \
+    ~/.cargo/bin/rustup component add clippy rustfmt
+
+ENV PATH="/home/ubuntu/.cargo/bin:${PATH}"
+
+WORKDIR /workspace

.devcontainer/README.md

@@ -0,0 +1,30 @@
+# Containerized Development
+
+We provide the following options to facilitate Codex development in a container. This is particularly useful for verifying the Linux build when working on a macOS host.
+
+## Docker
+
+To build the Docker image locally for x64 and then run it with the repo mounted under `/workspace`:
+
+```shell
+CODEX_DOCKER_IMAGE_NAME=codex-linux-dev
+docker build --platform=linux/amd64 -t "$CODEX_DOCKER_IMAGE_NAME" ./.devcontainer
+docker run --platform=linux/amd64 --rm -it -e CARGO_TARGET_DIR=/workspace/codex-rs/target-amd64 -v "$PWD":/workspace -w /workspace/codex-rs "$CODEX_DOCKER_IMAGE_NAME"
+```
+
+Note that `/workspace/target` will contain the binaries built for your host platform, so we include `-e CARGO_TARGET_DIR=/workspace/codex-rs/target-amd64` in the `docker run` command so that the binaries built inside your container are written to a separate directory.
+
+For arm64, specify `--platform=linux/amd64` instead for both `docker build` and `docker run`.
+
+Currently, the `Dockerfile` works for both x64 and arm64 Linux, though you need to run `rustup target add x86_64-unknown-linux-musl` yourself to install the musl toolchain for x64.
+
+## VS Code
+
+VS Code recognizes the `devcontainer.json` file and gives you the option to develop Codex in a container. Currently, `devcontainer.json` builds and runs the `arm64` flavor of the container.
+
+From the integrated terminal in VS Code, you can build either flavor of the `arm64` build (GNU or musl):
+
+```shell
+cargo build --target aarch64-unknown-linux-musl
+cargo build --target aarch64-unknown-linux-gnu
+```

.devcontainer/devcontainer.json

@@ -0,0 +1,27 @@
+{
+  "name": "Codex",
+  "build": {
+    "dockerfile": "Dockerfile",
+    "context": "..",
+    "platform": "linux/arm64"
+  },
+
+  /* Force VS Code to run the container as arm64 in
+     case your host is x86 (or vice-versa). */
+  "runArgs": ["--platform=linux/arm64"],
+
+  "containerEnv": {
+    "RUST_BACKTRACE": "1",
+    "CARGO_TARGET_DIR": "${containerWorkspaceFolder}/codex-rs/target-arm64"
+  },
+
+  "remoteUser": "ubuntu",
+  "customizations": {
+    "vscode": {
+      "settings": {
+        "terminal.integrated.defaultProfile.linux": "bash"
+      },
+      "extensions": ["rust-lang.rust-analyzer", "tamasfe.even-better-toml"]
+    }
+  }
+}

.github/actions/codex/.gitignore

@@ -0,0 +1 @@
+/node_modules/

.github/actions/codex/.prettierrc.toml

@@ -0,0 +1,8 @@
+printWidth = 80
+quoteProps = "consistent"
+semi = true
+tabWidth = 2
+trailingComma = "all"
+
+# Preserve existing behavior for markdown/text wrapping.
+proseWrap = "preserve"

.github/actions/codex/README.md

@@ -0,0 +1,140 @@
+# openai/codex-action
+
+`openai/codex-action` is a GitHub Action that facilitates the use of [Codex](https://github.com/openai/codex) on GitHub issues and pull requests. Using the action, associate **labels** to run Codex with the appropriate prompt for the given context. Codex will respond by posting comments or creating PRs, whichever you specify!
+
+Here is a sample workflow that uses `openai/codex-action`:
+
+```yaml
+name: Codex
+
+on:
+  issues:
+    types: [opened, labeled]
+  pull_request:
+    branches: [main]
+    types: [labeled]
+
+jobs:
+  codex:
+    if: ... # optional, but can be effective in conserving CI resources
+    runs-on: ubuntu-latest
+    # TODO(mbolin): Need to verify if/when `write` is necessary.
+    permissions:
+      contents: write
+      issues: write
+      pull-requests: write
+    steps:
+      # By default, Codex runs network disabled using --full-auto, so perform
+      # any setup that requires network (such as installing dependencies)
+      # before openai/codex-action.
+      - name: Checkout repository
+        uses: actions/checkout@v4
+
+      - name: Run Codex
+        uses: openai/codex-action@latest
+        with:
+          openai_api_key: ${{ secrets.CODEX_OPENAI_API_KEY }}
+          github_token: ${{ secrets.GITHUB_TOKEN }}
+```
+
+See sample usage in [`codex.yml`](../../workflows/codex.yml).
+
+## Triggering the Action
+
+Using the sample workflow above, we have:
+
+```yaml
+on:
+  issues:
+    types: [opened, labeled]
+  pull_request:
+    branches: [main]
+    types: [labeled]
+```
+
+which means our workflow will be triggered when any of the following events occur:
+
+- a label is added to an issue
+- a label is added to a pull request against the `main` branch
+
+### Label-Based Triggers
+
+To define a GitHub label that should trigger Codex, create a file named `.github/codex/labels/LABEL-NAME.md` in your repository where `LABEL-NAME` is the name of the label. The content of the file is the prompt template to use when the label is added (see more on [Prompt Template Variables](#prompt-template-variables) below).
+
+For example, if the file `.github/codex/labels/codex-review.md` exists, then:
+
+- Adding the `codex-review` label will trigger the workflow containing the `openai/codex-action` GitHub Action.
+- When `openai/codex-action` starts, it will replace the `codex-review` label with `codex-review-in-progress`.
+- When `openai/codex-action` is finished, it will replace the `codex-review-in-progress` label with `codex-review-completed`.
+
+If Codex sees that either `codex-review-in-progress` or `codex-review-completed` is already present, it will not perform the action.
+
+As determined by the [default config](./src/default-label-config.ts), Codex will act on the following labels by default:
+
+- Adding the `codex-review` label to a pull request will have Codex review the PR and add it to the PR as a comment.
+- Adding the `codex-triage` label to an issue will have Codex investigate the issue and report its findings as a comment.
+- Adding the `codex-issue-fix` label to an issue will have Codex attempt to fix the issue and create a PR wit the fix, if any.
+
+## Action Inputs
+
+The `openai/codex-action` GitHub Action takes the following inputs
+
+### `openai_api_key` (required)
+
+Set your `OPENAI_API_KEY` as a [repository secret](https://docs.github.com/en/actions/security-for-github-actions/security-guides/using-secrets-in-github-actions). See **Secrets and varaibles** then **Actions** in the settings for your GitHub repo.
+
+Note that the secret name does not have to be `OPENAI_API_KEY`. For example, you might want to name it `CODEX_OPENAI_API_KEY` and then configure it on `openai/codex-action` as follows:
+
+```yaml
+openai_api_key: ${{ secrets.CODEX_OPENAI_API_KEY }}
+```
+
+### `github_token` (required)
+
+This is required so that Codex can post a comment or create a PR. Set this value on the action as follows:
+
+```yaml
+github_token: ${{ secrets.GITHUB_TOKEN }}
+```
+
+### `codex_args`
+
+A whitespace-delimited list of arguments to pass to Codex. Defaults to `--full-auto`, but if you want to override the default model to use `o3`:
+
+```yaml
+codex_args: "--full-auto --model o3"
+```
+
+For more complex configurations, use the `codex_home` input.
+
+### `codex_home`
+
+If set, the value to use for the `$CODEX_HOME` environment variable when running Codex. As explained [in the docs](https://github.com/openai/codex/tree/main/codex-rs#readme), this folder can contain the `config.toml` to configure Codex, custom instructions, and log files.
+
+This should be a relative path within your repo.
+
+## Prompt Template Variables
+
+As shown above, `"prompt"` and `"promptPath"` are used to define prompt templates that will be populated and passed to Codex in response to certain events. All template variables are of the form `{CODEX_ACTION_...}` and the supported values are defined below.
+
+### `CODEX_ACTION_ISSUE_TITLE`
+
+If the action was triggered on a GitHub issue, this is the issue title.
+
+Specifically it is read as the `.issue.title` from the `$GITHUB_EVENT_PATH`.
+
+### `CODEX_ACTION_ISSUE_BODY`
+
+If the action was triggered on a GitHub issue, this is the issue body.
+
+Specifically it is read as the `.issue.body` from the `$GITHUB_EVENT_PATH`.
+
+### `CODEX_ACTION_GITHUB_EVENT_PATH`
+
+The value of the `$GITHUB_EVENT_PATH` environment variable, which is the path to the file that contains the JSON payload for the event that triggered the workflow. Codex can use `jq` to read only the fields of interest from this file.
+
+### `CODEX_ACTION_PR_DIFF`
+
+If the action was triggered on a pull request, this is the diff between the base and head commits of the PR. It is the output from `git diff`.
+
+Note that the content of the diff could be quite large, so is generally safer to point Codex at `CODEX_ACTION_GITHUB_EVENT_PATH` and let it decide how it wants to explore the change.

.github/actions/codex/action.yml

@@ -0,0 +1,127 @@
+name: "Codex [reusable action]"
+description: "A reusable action that runs a Codex model."
+
+inputs:
+  openai_api_key:
+    description: "The value to use as the OPENAI_API_KEY environment variable when running Codex."
+    required: true
+  trigger_phrase:
+    description: "Text to trigger Codex from a PR/issue body or comment."
+    required: false
+    default: ""
+  github_token:
+    description: "Token so Codex can comment on the PR or issue."
+    required: true
+  codex_args:
+    description: "A whitespace-delimited list of arguments to pass to Codex. Due to limitations in YAML, arguments with spaces are not supported. For more complex configurations, use the `codex_home` input."
+    required: false
+    default: "--config hide_agent_reasoning=true --full-auto"
+  codex_home:
+    description: "Value to use as the CODEX_HOME environment variable when running Codex."
+    required: false
+  codex_release_tag:
+    description: "The release tag of the Codex model to run, e.g., 'rust-v0.3.0'. Defaults to the latest release."
+    required: false
+    default: ""
+
+runs:
+  using: "composite"
+  steps:
+    # Do this in Bash so we do not even bother to install Bun if the sender does
+    # not have write access to the repo.
+    - name: Verify user has write access to the repo.
+      env:
+        GH_TOKEN: ${{ github.token }}
+      shell: bash
+      run: |
+        set -euo pipefail
+
+        PERMISSION=$(gh api \
+          "/repos/${GITHUB_REPOSITORY}/collaborators/${{ github.event.sender.login }}/permission" \
+          | jq -r '.permission')
+
+        if [[ "$PERMISSION" != "admin" && "$PERMISSION" != "write" ]]; then
+          exit 1
+        fi
+
+    - name: Download Codex
+      env:
+        GH_TOKEN: ${{ github.token }}
+      shell: bash
+      run: |
+        set -euo pipefail
+
+        # Determine OS/arch and corresponding Codex artifact name.
+        uname_s=$(uname -s)
+        uname_m=$(uname -m)
+
+        case "$uname_s" in
+          Linux*)   os="linux" ;;
+          Darwin*)  os="apple-darwin" ;;
+          *) echo "Unsupported operating system: $uname_s"; exit 1 ;;
+        esac
+
+        case "$uname_m" in
+          x86_64*) arch="x86_64" ;;
+          arm64*|aarch64*) arch="aarch64" ;;
+          *) echo "Unsupported architecture: $uname_m"; exit 1 ;;
+        esac
+
+        # linux builds differentiate between musl and gnu.
+        if [[ "$os" == "linux" ]]; then
+          if [[ "$arch" == "x86_64" ]]; then
+            triple="${arch}-unknown-linux-musl"
+          else
+            # Only other supported linux build is aarch64 gnu.
+            triple="${arch}-unknown-linux-gnu"
+          fi
+        else
+          # macOS
+          triple="${arch}-apple-darwin"
+        fi
+
+        # Note that if we start baking version numbers into the artifact name,
+        # we will need to update this action.yml file to match.
+        artifact="codex-exec-${triple}.tar.gz"
+
+        TAG_ARG="${{ inputs.codex_release_tag }}"
+        # The usage is `gh release download [<tag>] [flags]`, so if TAG_ARG
+        # is empty, we do not pass it so we can default to the latest release.
+        gh release download ${TAG_ARG:+$TAG_ARG} --repo openai/codex \
+          --pattern "$artifact" --output - \
+        | tar xzO > /usr/local/bin/codex-exec
+        chmod +x /usr/local/bin/codex-exec
+
+        # Display Codex version to confirm binary integrity; ensure we point it
+        # at the checked-out repository via --cd so that any subsequent commands
+        # use the correct working directory.
+        codex-exec --cd "$GITHUB_WORKSPACE" --version
+
+    - name: Install Bun
+      uses: oven-sh/setup-bun@v2
+      with:
+        bun-version: 1.2.11
+
+    - name: Install dependencies
+      shell: bash
+      run: |
+        cd ${{ github.action_path }}
+        bun install --production
+
+    - name: Run Codex
+      shell: bash
+      run: bun run ${{ github.action_path }}/src/main.ts
+      # Process args plus environment variables often have a max of 128 KiB,
+      # so we should fit within that limit?
+      env:
+        INPUT_CODEX_ARGS: ${{ inputs.codex_args || '' }}
+        INPUT_CODEX_HOME: ${{ inputs.codex_home || ''}}
+        INPUT_TRIGGER_PHRASE: ${{ inputs.trigger_phrase || '' }}
+        OPENAI_API_KEY: ${{ inputs.openai_api_key }}
+        GITHUB_TOKEN: ${{ inputs.github_token }}
+        GITHUB_EVENT_ACTION: ${{ github.event.action || '' }}
+        GITHUB_EVENT_LABEL_NAME: ${{ github.event.label.name || '' }}
+        GITHUB_EVENT_ISSUE_NUMBER: ${{ github.event.issue.number || '' }}
+        GITHUB_EVENT_ISSUE_BODY: ${{ github.event.issue.body || '' }}
+        GITHUB_EVENT_REVIEW_BODY: ${{ github.event.review.body || '' }}
+        GITHUB_EVENT_COMMENT_BODY: ${{ github.event.comment.body || '' }}

.github/actions/codex/bun.lock

@@ -0,0 +1,91 @@
+{
+  "lockfileVersion": 1,
+  "workspaces": {
+    "": {
+      "name": "codex-action",
+      "dependencies": {
+        "@actions/core": "^1.11.1",
+        "@actions/github": "^6.0.1",
+      },
+      "devDependencies": {
+        "@types/bun": "^1.2.19",
+        "@types/node": "^24.1.0",
+        "prettier": "^3.6.2",
+        "typescript": "^5.8.3",
+      },
+    },
+  },
+  "packages": {
+    "@actions/core": ["@actions/core@1.11.1", "", { "dependencies": { "@actions/exec": "^1.1.1", "@actions/http-client": "^2.0.1" } }, "sha512-hXJCSrkwfA46Vd9Z3q4cpEpHB1rL5NG04+/rbqW9d3+CSvtB1tYe8UTpAlixa1vj0m/ULglfEK2UKxMGxCxv5A=="],
+
+    "@actions/exec": ["@actions/exec@1.1.1", "", { "dependencies": { "@actions/io": "^1.0.1" } }, "sha512-+sCcHHbVdk93a0XT19ECtO/gIXoxvdsgQLzb2fE2/5sIZmWQuluYyjPQtrtTHdU1YzTZ7bAPN4sITq2xi1679w=="],
+
+    "@actions/github": ["@actions/github@6.0.1", "", { "dependencies": { "@actions/http-client": "^2.2.0", "@octokit/core": "^5.0.1", "@octokit/plugin-paginate-rest": "^9.2.2", "@octokit/plugin-rest-endpoint-methods": "^10.4.0", "@octokit/request": "^8.4.1", "@octokit/request-error": "^5.1.1", "undici": "^5.28.5" } }, "sha512-xbZVcaqD4XnQAe35qSQqskb3SqIAfRyLBrHMd/8TuL7hJSz2QtbDwnNM8zWx4zO5l2fnGtseNE3MbEvD7BxVMw=="],
+
+    "@actions/http-client": ["@actions/http-client@2.2.3", "", { "dependencies": { "tunnel": "^0.0.6", "undici": "^5.25.4" } }, "sha512-mx8hyJi/hjFvbPokCg4uRd4ZX78t+YyRPtnKWwIl+RzNaVuFpQHfmlGVfsKEJN8LwTCvL+DfVgAM04XaHkm6bA=="],
+
+    "@actions/io": ["@actions/io@1.1.3", "", {}, "sha512-wi9JjgKLYS7U/z8PPbco+PvTb/nRWjeoFlJ1Qer83k/3C5PHQi28hiVdeE2kHXmIL99mQFawx8qt/JPjZilJ8Q=="],
+
+    "@fastify/busboy": ["@fastify/busboy@2.1.1", "", {}, "sha512-vBZP4NlzfOlerQTnba4aqZoMhE/a9HY7HRqoOPaETQcSQuWEIyZMHGfVu6w9wGtGK5fED5qRs2DteVCjOH60sA=="],
+
+    "@octokit/auth-token": ["@octokit/auth-token@4.0.0", "", {}, "sha512-tY/msAuJo6ARbK6SPIxZrPBms3xPbfwBrulZe0Wtr/DIY9lje2HeV1uoebShn6mx7SjCHif6EjMvoREj+gZ+SA=="],
+
+    "@octokit/core": ["@octokit/core@5.2.1", "", { "dependencies": { "@octokit/auth-token": "^4.0.0", "@octokit/graphql": "^7.1.0", "@octokit/request": "^8.4.1", "@octokit/request-error": "^5.1.1", "@octokit/types": "^13.0.0", "before-after-hook": "^2.2.0", "universal-user-agent": "^6.0.0" } }, "sha512-dKYCMuPO1bmrpuogcjQ8z7ICCH3FP6WmxpwC03yjzGfZhj9fTJg6+bS1+UAplekbN2C+M61UNllGOOoAfGCrdQ=="],
+
+    "@octokit/endpoint": ["@octokit/endpoint@9.0.6", "", { "dependencies": { "@octokit/types": "^13.1.0", "universal-user-agent": "^6.0.0" } }, "sha512-H1fNTMA57HbkFESSt3Y9+FBICv+0jFceJFPWDePYlR/iMGrwM5ph+Dd4XRQs+8X+PUFURLQgX9ChPfhJ/1uNQw=="],
+
+    "@octokit/graphql": ["@octokit/graphql@7.1.1", "", { "dependencies": { "@octokit/request": "^8.4.1", "@octokit/types": "^13.0.0", "universal-user-agent": "^6.0.0" } }, "sha512-3mkDltSfcDUoa176nlGoA32RGjeWjl3K7F/BwHwRMJUW/IteSa4bnSV8p2ThNkcIcZU2umkZWxwETSSCJf2Q7g=="],
+
+    "@octokit/openapi-types": ["@octokit/openapi-types@24.2.0", "", {}, "sha512-9sIH3nSUttelJSXUrmGzl7QUBFul0/mB8HRYl3fOlgHbIWG+WnYDXU3v/2zMtAvuzZ/ed00Ei6on975FhBfzrg=="],
+
+    "@octokit/plugin-paginate-rest": ["@octokit/plugin-paginate-rest@9.2.2", "", { "dependencies": { "@octokit/types": "^12.6.0" }, "peerDependencies": { "@octokit/core": "5" } }, "sha512-u3KYkGF7GcZnSD/3UP0S7K5XUFT2FkOQdcfXZGZQPGv3lm4F2Xbf71lvjldr8c1H3nNbF+33cLEkWYbokGWqiQ=="],
+
+    "@octokit/plugin-rest-endpoint-methods": ["@octokit/plugin-rest-endpoint-methods@10.4.1", "", { "dependencies": { "@octokit/types": "^12.6.0" }, "peerDependencies": { "@octokit/core": "5" } }, "sha512-xV1b+ceKV9KytQe3zCVqjg+8GTGfDYwaT1ATU5isiUyVtlVAO3HNdzpS4sr4GBx4hxQ46s7ITtZrAsxG22+rVg=="],
+
+    "@octokit/request": ["@octokit/request@8.4.1", "", { "dependencies": { "@octokit/endpoint": "^9.0.6", "@octokit/request-error": "^5.1.1", "@octokit/types": "^13.1.0", "universal-user-agent": "^6.0.0" } }, "sha512-qnB2+SY3hkCmBxZsR/MPCybNmbJe4KAlfWErXq+rBKkQJlbjdJeS85VI9r8UqeLYLvnAenU8Q1okM/0MBsAGXw=="],
+
+    "@octokit/request-error": ["@octokit/request-error@5.1.1", "", { "dependencies": { "@octokit/types": "^13.1.0", "deprecation": "^2.0.0", "once": "^1.4.0" } }, "sha512-v9iyEQJH6ZntoENr9/yXxjuezh4My67CBSu9r6Ve/05Iu5gNgnisNWOsoJHTP6k0Rr0+HQIpnH+kyammu90q/g=="],
+
+    "@octokit/types": ["@octokit/types@13.10.0", "", { "dependencies": { "@octokit/openapi-types": "^24.2.0" } }, "sha512-ifLaO34EbbPj0Xgro4G5lP5asESjwHracYJvVaPIyXMuiuXLlhic3S47cBdTb+jfODkTE5YtGCLt3Ay3+J97sA=="],
+
+    "@types/bun": ["@types/bun@1.2.19", "", { "dependencies": { "bun-types": "1.2.19" } }, "sha512-d9ZCmrH3CJ2uYKXQIUuZ/pUnTqIvLDS0SK7pFmbx8ma+ziH/FRMoAq5bYpRG7y+w1gl+HgyNZbtqgMq4W4e2Lg=="],
+
+    "@types/node": ["@types/node@24.1.0", "", { "dependencies": { "undici-types": "~7.8.0" } }, "sha512-ut5FthK5moxFKH2T1CUOC6ctR67rQRvvHdFLCD2Ql6KXmMuCrjsSsRI9UsLCm9M18BMwClv4pn327UvB7eeO1w=="],
+
+    "@types/react": ["@types/react@19.1.8", "", { "dependencies": { "csstype": "^3.0.2" } }, "sha512-AwAfQ2Wa5bCx9WP8nZL2uMZWod7J7/JSplxbTmBQ5ms6QpqNYm672H0Vu9ZVKVngQ+ii4R/byguVEUZQyeg44g=="],
+
+    "before-after-hook": ["before-after-hook@2.2.3", "", {}, "sha512-NzUnlZexiaH/46WDhANlyR2bXRopNg4F/zuSA3OpZnllCUgRaOF2znDioDWrmbNVsuZk6l9pMquQB38cfBZwkQ=="],
+
+    "bun-types": ["bun-types@1.2.19", "", { "dependencies": { "@types/node": "*" }, "peerDependencies": { "@types/react": "^19" } }, "sha512-uAOTaZSPuYsWIXRpj7o56Let0g/wjihKCkeRqUBhlLVM/Bt+Fj9xTo+LhC1OV1XDaGkz4hNC80et5xgy+9KTHQ=="],
+
+    "csstype": ["csstype@3.1.3", "", {}, "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw=="],
+
+    "deprecation": ["deprecation@2.3.1", "", {}, "sha512-xmHIy4F3scKVwMsQ4WnVaS8bHOx0DmVwRywosKhaILI0ywMDWPtBSku2HNxRvF7jtwDRsoEwYQSfbxj8b7RlJQ=="],
+
+    "once": ["once@1.4.0", "", { "dependencies": { "wrappy": "1" } }, "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w=="],
+
+    "prettier": ["prettier@3.6.2", "", { "bin": { "prettier": "bin/prettier.cjs" } }, "sha512-I7AIg5boAr5R0FFtJ6rCfD+LFsWHp81dolrFD8S79U9tb8Az2nGrJncnMSnys+bpQJfRUzqs9hnA81OAA3hCuQ=="],
+
+    "tunnel": ["tunnel@0.0.6", "", {}, "sha512-1h/Lnq9yajKY2PEbBadPXj3VxsDDu844OnaAo52UVmIzIvwwtBPIuNvkjuzBlTWpfJyUbG3ez0KSBibQkj4ojg=="],
+
+    "typescript": ["typescript@5.8.3", "", { "bin": { "tsc": "bin/tsc", "tsserver": "bin/tsserver" } }, "sha512-p1diW6TqL9L07nNxvRMM7hMMw4c5XOo/1ibL4aAIGmSAt9slTE1Xgw5KWuof2uTOvCg9BY7ZRi+GaF+7sfgPeQ=="],
+
+    "undici": ["undici@5.29.0", "", { "dependencies": { "@fastify/busboy": "^2.0.0" } }, "sha512-raqeBD6NQK4SkWhQzeYKd1KmIG6dllBOTt55Rmkt4HtI9mwdWtJljnrXjAFUBLTSN67HWrOIZ3EPF4kjUw80Bg=="],
+
+    "undici-types": ["undici-types@7.8.0", "", {}, "sha512-9UJ2xGDvQ43tYyVMpuHlsgApydB8ZKfVYTsLDhXkFL/6gfkp+U8xTGdh8pMJv1SpZna0zxG1DwsKZsreLbXBxw=="],
+
+    "universal-user-agent": ["universal-user-agent@6.0.1", "", {}, "sha512-yCzhz6FN2wU1NiiQRogkTQszlQSlpWaw8SvVegAc+bDxbzHgh1vX8uIe8OYyMH6DwH+sdTJsgMl36+mSMdRJIQ=="],
+
+    "wrappy": ["wrappy@1.0.2", "", {}, "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ=="],
+
+    "@octokit/plugin-paginate-rest/@octokit/types": ["@octokit/types@12.6.0", "", { "dependencies": { "@octokit/openapi-types": "^20.0.0" } }, "sha512-1rhSOfRa6H9w4YwK0yrf5faDaDTb+yLyBUKOCV4xtCDB5VmIPqd/v9yr9o6SAzOAlRxMiRiCic6JVM1/kunVkw=="],
+
+    "@octokit/plugin-rest-endpoint-methods/@octokit/types": ["@octokit/types@12.6.0", "", { "dependencies": { "@octokit/openapi-types": "^20.0.0" } }, "sha512-1rhSOfRa6H9w4YwK0yrf5faDaDTb+yLyBUKOCV4xtCDB5VmIPqd/v9yr9o6SAzOAlRxMiRiCic6JVM1/kunVkw=="],
+
+    "bun-types/@types/node": ["@types/node@24.0.13", "", { "dependencies": { "undici-types": "~7.8.0" } }, "sha512-Qm9OYVOFHFYg3wJoTSrz80hoec5Lia/dPp84do3X7dZvLikQvM1YpmvTBEdIr/e+U8HTkFjLHLnl78K/qjf+jQ=="],
+
+    "@octokit/plugin-paginate-rest/@octokit/types/@octokit/openapi-types": ["@octokit/openapi-types@20.0.0", "", {}, "sha512-EtqRBEjp1dL/15V7WiX5LJMIxxkdiGJnabzYx5Apx4FkQIFgAfKumXeYAqqJCj1s+BMX4cPFIFC4OLCR6stlnA=="],
+
+    "@octokit/plugin-rest-endpoint-methods/@octokit/types/@octokit/openapi-types": ["@octokit/openapi-types@20.0.0", "", {}, "sha512-EtqRBEjp1dL/15V7WiX5LJMIxxkdiGJnabzYx5Apx4FkQIFgAfKumXeYAqqJCj1s+BMX4cPFIFC4OLCR6stlnA=="],
+  }
+}

.github/actions/codex/package.json

@@ -0,0 +1,21 @@
+{
+    "name": "codex-action",
+    "version": "0.0.0",
+    "private": true,
+    "scripts": {
+        "format": "prettier --check src",
+        "format:fix": "prettier --write src",
+        "test": "bun test",
+        "typecheck": "tsc"
+    },
+    "dependencies": {
+        "@actions/core": "^1.11.1",
+        "@actions/github": "^6.0.1"
+    },
+    "devDependencies": {
+        "@types/bun": "^1.2.19",
+        "@types/node": "^24.1.0",
+        "prettier": "^3.6.2",
+        "typescript": "^5.8.3"
+    }
+}

.github/actions/codex/src/add-reaction.ts

@@ -0,0 +1,85 @@
+import * as github from "@actions/github";
+import type { EnvContext } from "./env-context";
+
+/**
+ * Add an "eyes" reaction to the entity (issue, issue comment, or pull request
+ * review comment) that triggered the current Codex invocation.
+ *
+ * The purpose is to provide immediate feedback to the user – similar to the
+ * *-in-progress label flow – indicating that the bot has acknowledged the
+ * request and is working on it.
+ *
+ * We attempt to add the reaction best suited for the current GitHub event:
+ *
+ *   • issues              → POST /repos/{owner}/{repo}/issues/{issue_number}/reactions
+ *   • issue_comment       → POST /repos/{owner}/{repo}/issues/comments/{comment_id}/reactions
+ *   • pull_request_review_comment → POST /repos/{owner}/{repo}/pulls/comments/{comment_id}/reactions
+ *
+ * If the specific target is unavailable (e.g. unexpected payload shape) we
+ * silently skip instead of failing the whole action because the reaction is
+ * merely cosmetic.
+ */
+export async function addEyesReaction(ctx: EnvContext): Promise<void> {
+  const octokit = ctx.getOctokit();
+  const { owner, repo } = github.context.repo;
+  const eventName = github.context.eventName;
+
+  try {
+    switch (eventName) {
+      case "issue_comment": {
+        const commentId = (github.context.payload as any)?.comment?.id;
+        if (commentId) {
+          await octokit.rest.reactions.createForIssueComment({
+            owner,
+            repo,
+            comment_id: commentId,
+            content: "eyes",
+          });
+          return;
+        }
+        break;
+      }
+      case "pull_request_review_comment": {
+        const commentId = (github.context.payload as any)?.comment?.id;
+        if (commentId) {
+          await octokit.rest.reactions.createForPullRequestReviewComment({
+            owner,
+            repo,
+            comment_id: commentId,
+            content: "eyes",
+          });
+          return;
+        }
+        break;
+      }
+      case "issues": {
+        const issueNumber = github.context.issue.number;
+        if (issueNumber) {
+          await octokit.rest.reactions.createForIssue({
+            owner,
+            repo,
+            issue_number: issueNumber,
+            content: "eyes",
+          });
+          return;
+        }
+        break;
+      }
+      default: {
+        // Fallback: try to react to the issue/PR if we have a number.
+        const issueNumber = github.context.issue.number;
+        if (issueNumber) {
+          await octokit.rest.reactions.createForIssue({
+            owner,
+            repo,
+            issue_number: issueNumber,
+            content: "eyes",
+          });
+        }
+      }
+    }
+  } catch (error) {
+    // Do not fail the action if reaction creation fails – log and continue.
+    console.warn(`Failed to add \"eyes\" reaction: ${error}`);
+  }
+}

.github/actions/codex/src/comment.ts

@@ -0,0 +1,53 @@
+import type { EnvContext } from "./env-context";
+import { runCodex } from "./run-codex";
+import { postComment } from "./post-comment";
+import { addEyesReaction } from "./add-reaction";
+
+/**
+ * Handle `issue_comment` and `pull_request_review_comment` events once we know
+ * the action is supported.
+ */
+export async function onComment(ctx: EnvContext): Promise<void> {
+  const triggerPhrase = ctx.tryGet("INPUT_TRIGGER_PHRASE");
+  if (!triggerPhrase) {
+    console.warn("Empty trigger phrase: skipping.");
+    return;
+  }
+
+  // Attempt to get the body of the comment from the environment. Depending on
+  // the event type either `GITHUB_EVENT_COMMENT_BODY` (issue & PR comments) or
+  // `GITHUB_EVENT_REVIEW_BODY` (PR reviews) is set.
+  const commentBody =
+    ctx.tryGetNonEmpty("GITHUB_EVENT_COMMENT_BODY") ??
+    ctx.tryGetNonEmpty("GITHUB_EVENT_REVIEW_BODY") ??
+    ctx.tryGetNonEmpty("GITHUB_EVENT_ISSUE_BODY");
+
+  if (!commentBody) {
+    console.warn("Comment body not found in environment: skipping.");
+    return;
+  }
+
+  // Check if the trigger phrase is present.
+  if (!commentBody.includes(triggerPhrase)) {
+    console.log(
+      `Trigger phrase '${triggerPhrase}' not found: nothing to do for this comment.`,
+    );
+    return;
+  }
+
+  // Derive the prompt by removing the trigger phrase. Remove only the first
+  // occurrence to keep any additional occurrences that might be meaningful.
+  const prompt = commentBody.replace(triggerPhrase, "").trim();
+
+  if (prompt.length === 0) {
+    console.warn("Prompt is empty after removing trigger phrase: skipping");
+    return;
+  }
+
+  // Provide immediate feedback that we are working on the request.
+  await addEyesReaction(ctx);
+
+  // Run Codex and post the response as a new comment.
+  const lastMessage = await runCodex(prompt, ctx);
+  await postComment(lastMessage, ctx);
+}

.github/actions/codex/src/config.ts

@@ -0,0 +1,11 @@
+import { readdirSync, statSync } from "fs";
+import * as path from "path";
+
+export interface Config {
+  labels: Record<string, LabelConfig>;
+}
+
+export interface LabelConfig {
+  /** Returns the prompt template. */
+  getPromptTemplate(): string;
+}

.github/actions/codex/src/default-label-config.ts

@@ -0,0 +1,44 @@
+import type { Config } from "./config";
+
+export function getDefaultConfig(): Config {
+  return {
+    labels: {
+      "codex-investigate-issue": {
+        getPromptTemplate: () =>
+          `
+Troubleshoot whether the reported issue is valid.
+
+Provide a concise and respectful comment summarizing the findings.
+
+### {CODEX_ACTION_ISSUE_TITLE}
+
+{CODEX_ACTION_ISSUE_BODY}
+`.trim(),
+      },
+      "codex-code-review": {
+        getPromptTemplate: () =>
+          `
+Review this PR and respond with a very concise final message, formatted in Markdown.
+
+There should be a summary of the changes (1-2 sentences) and a few bullet points if necessary.
+
+Then provide the **review** (1-2 sentences plus bullet points, friendly tone).
+
+{CODEX_ACTION_GITHUB_EVENT_PATH} contains the JSON that triggered this GitHub workflow. It contains the \`base\` and \`head\` refs that define this PR. Both refs are available locally.
+`.trim(),
+      },
+      "codex-attempt-fix": {
+        getPromptTemplate: () =>
+          `
+Attempt to solve the reported issue.
+
+If a code change is required, create a new branch, commit the fix, and open a pull-request that resolves the problem.
+
+### {CODEX_ACTION_ISSUE_TITLE}
+
+{CODEX_ACTION_ISSUE_BODY}
+`.trim(),
+      },
+    },
+  };
+}

.github/actions/codex/src/env-context.ts

@@ -0,0 +1,116 @@
+/*
+ * Centralised access to environment variables used by the Codex GitHub
+ * Action.
+ *
+ * To enable proper unit-testing we avoid reading from `process.env` at module
+ * initialisation time.  Instead a `EnvContext` object is created (usually from
+ * the real `process.env`) and passed around explicitly or – where that is not
+ * yet practical – imported as the shared `defaultContext` singleton. Tests can
+ * create their own context backed by a stubbed map of variables without having
+ * to mutate global state.
+ */
+
+import { fail } from "./fail";
+import * as github from "@actions/github";
+
+export interface EnvContext {
+  /**
+   * Return the value for a given environment variable or terminate the action
+   * via `fail` if it is missing / empty.
+   */
+  get(name: string): string;
+
+  /**
+   * Attempt to read an environment variable. Returns the value when present;
+   * otherwise returns undefined (does not call `fail`).
+   */
+  tryGet(name: string): string | undefined;
+
+  /**
+   * Attempt to read an environment variable. Returns non-empty string value or
+   * null if unset or empty string.
+   */
+  tryGetNonEmpty(name: string): string | null;
+
+  /**
+   * Return a memoised Octokit instance authenticated via the token resolved
+   * from the provided argument (when defined) or the environment variables
+   * `GITHUB_TOKEN`/`GH_TOKEN`.
+   *
+   * Subsequent calls return the same cached instance to avoid spawning
+   * multiple REST clients within a single action run.
+   */
+  getOctokit(token?: string): ReturnType<typeof github.getOctokit>;
+}
+
+/** Internal helper – *not* exported. */
+function _getRequiredEnv(
+  name: string,
+  env: Record<string, string | undefined>,
+): string | undefined {
+  const value = env[name];
+
+  // Avoid leaking secrets into logs while still logging non-secret variables.
+  if (name.endsWith("KEY") || name.endsWith("TOKEN")) {
+    if (value) {
+      console.log(`value for ${name} was found`);
+    }
+  } else {
+    console.log(`${name}=${value}`);
+  }
+
+  return value;
+}
+
+/** Create a context backed by the supplied environment map (defaults to `process.env`). */
+export function createEnvContext(
+  env: Record<string, string | undefined> = process.env,
+): EnvContext {
+  // Lazily instantiated Octokit client – shared across this context.
+  let cachedOctokit: ReturnType<typeof github.getOctokit> | null = null;
+
+  return {
+    get(name: string): string {
+      const value = _getRequiredEnv(name, env);
+      if (value == null) {
+        fail(`Missing required environment variable: ${name}`);
+      }
+      return value;
+    },
+
+    tryGet(name: string): string | undefined {
+      return _getRequiredEnv(name, env);
+    },
+
+    tryGetNonEmpty(name: string): string | null {
+      const value = _getRequiredEnv(name, env);
+      return value == null || value === "" ? null : value;
+    },
+
+    getOctokit(token?: string) {
+      if (cachedOctokit) {
+        return cachedOctokit;
+      }
+
+      // Determine the token to authenticate with.
+      const githubToken = token ?? env["GITHUB_TOKEN"] ?? env["GH_TOKEN"];
+
+      if (!githubToken) {
+        fail(
+          "Unable to locate a GitHub token. `github_token` should have been set on the action.",
+        );
+      }
+
+      cachedOctokit = github.getOctokit(githubToken!);
+      return cachedOctokit;
+    },
+  };
+}
+
+/**
+ * Shared context built from the actual `process.env`.  Production code that is
+ * not yet refactored to receive a context explicitly may import and use this
+ * singleton.  Tests should avoid the singleton and instead pass their own
+ * context to the functions they exercise.
+ */
+export const defaultContext: EnvContext = createEnvContext();

.github/actions/codex/src/fail.ts

@@ -0,0 +1,4 @@
+export function fail(message: string): never {
+  console.error(message);
+  process.exit(1);
+}

.github/actions/codex/src/git-helpers.ts

@@ -0,0 +1,149 @@
+import { spawnSync } from "child_process";
+import * as github from "@actions/github";
+import { EnvContext } from "./env-context";
+
+function runGit(args: string[], silent = true): string {
+  console.info(`Running git ${args.join(" ")}`);
+  const res = spawnSync("git", args, {
+    encoding: "utf8",
+    stdio: silent ? ["ignore", "pipe", "pipe"] : "inherit",
+  });
+  if (res.error) {
+    throw res.error;
+  }
+  if (res.status !== 0) {
+    // Return stderr so caller may handle; else throw.
+    throw new Error(
+      `git ${args.join(" ")} failed with code ${res.status}: ${res.stderr}`,
+    );
+  }
+  return res.stdout.trim();
+}
+
+function stageAllChanges() {
+  runGit(["add", "-A"]);
+}
+
+function hasStagedChanges(): boolean {
+  const res = spawnSync("git", ["diff", "--cached", "--quiet", "--exit-code"]);
+  return res.status !== 0;
+}
+
+function ensureOnBranch(
+  issueNumber: number,
+  protectedBranches: string[],
+  suggestedSlug?: string,
+): string {
+  let branch = "";
+  try {
+    branch = runGit(["symbolic-ref", "--short", "-q", "HEAD"]);
+  } catch {
+    branch = "";
+  }
+
+  // If detached HEAD or on a protected branch, create a new branch.
+  if (!branch || protectedBranches.includes(branch)) {
+    if (suggestedSlug) {
+      const safeSlug = suggestedSlug
+        .toLowerCase()
+        .replace(/[^\w\s-]/g, "")
+        .trim()
+        .replace(/\s+/g, "-");
+      branch = `codex-fix-${issueNumber}-${safeSlug}`;
+    } else {
+      branch = `codex-fix-${issueNumber}-${Date.now()}`;
+    }
+    runGit(["switch", "-c", branch]);
+  }
+  return branch;
+}
+
+function commitIfNeeded(issueNumber: number) {
+  if (hasStagedChanges()) {
+    runGit([
+      "commit",
+      "-m",
+      `fix: automated fix for #${issueNumber} via Codex`,
+    ]);
+  }
+}
+
+function pushBranch(branch: string, githubToken: string, ctx: EnvContext) {
+  const repoSlug = ctx.get("GITHUB_REPOSITORY"); // owner/repo
+  const remoteUrl = `https://x-access-token:${githubToken}@github.com/${repoSlug}.git`;
+
+  runGit(["push", "--force-with-lease", "-u", remoteUrl, `HEAD:${branch}`]);
+}
+
+/**
+ * If this returns a string, it is the URL of the created PR.
+ */
+export async function maybePublishPRForIssue(
+  issueNumber: number,
+  lastMessage: string,
+  ctx: EnvContext,
+): Promise<string | undefined> {
+  // Only proceed if GITHUB_TOKEN available.
+  const githubToken =
+    ctx.tryGetNonEmpty("GITHUB_TOKEN") ?? ctx.tryGetNonEmpty("GH_TOKEN");
+  if (!githubToken) {
+    console.warn("No GitHub token - skipping PR creation.");
+    return undefined;
+  }
+
+  // Print `git status` for debugging.
+  runGit(["status"]);
+
+  // Stage any remaining changes so they can be committed and pushed.
+  stageAllChanges();
+
+  const octokit = ctx.getOctokit(githubToken);
+
+  const { owner, repo } = github.context.repo;
+
+  // Determine default branch to treat as protected.
+  let defaultBranch = "main";
+  try {
+    const repoInfo = await octokit.rest.repos.get({ owner, repo });
+    defaultBranch = repoInfo.data.default_branch ?? "main";
+  } catch (e) {
+    console.warn(`Failed to get default branch, assuming 'main': ${e}`);
+  }
+
+  const sanitizedMessage = lastMessage.replace(/\u2022/g, "-");
+  const [summaryLine] = sanitizedMessage.split(/\r?\n/);
+  const branch = ensureOnBranch(issueNumber, [defaultBranch, "master"], summaryLine);
+  commitIfNeeded(issueNumber);
+  pushBranch(branch, githubToken, ctx);
+
+  // Try to find existing PR for this branch
+  const headParam = `${owner}:${branch}`;
+  const existing = await octokit.rest.pulls.list({
+    owner,
+    repo,
+    head: headParam,
+    state: "open",
+  });
+  if (existing.data.length > 0) {
+    return existing.data[0].html_url;
+  }
+
+  // Determine base branch (default to main)
+  let baseBranch = "main";
+  try {
+    const repoInfo = await octokit.rest.repos.get({ owner, repo });
+    baseBranch = repoInfo.data.default_branch ?? "main";
+  } catch (e) {
+    console.warn(`Failed to get default branch, assuming 'main': ${e}`);
+  }
+
+  const pr = await octokit.rest.pulls.create({
+    owner,
+    repo,
+    title: summaryLine,
+    head: branch,
+    base: baseBranch,
+    body: sanitizedMessage,
+  });
+  return pr.data.html_url;
+}

.github/actions/codex/src/git-user.ts

@@ -0,0 +1,16 @@
+export function setGitHubActionsUser(): void {
+  const commands = [
+    ["git", "config", "--global", "user.name", "github-actions[bot]"],
+    [
+      "git",
+      "config",
+      "--global",
+      "user.email",
+      "41898282+github-actions[bot]@users.noreply.github.com",
+    ],
+  ];
+
+  for (const command of commands) {
+    Bun.spawnSync(command);
+  }
+}

.github/actions/codex/src/github-workspace.ts

@@ -0,0 +1,11 @@
+import * as pathMod from "path";
+import { EnvContext } from "./env-context";
+
+export function resolveWorkspacePath(path: string, ctx: EnvContext): string {
+  if (pathMod.isAbsolute(path)) {
+    return path;
+  } else {
+    const workspace = ctx.get("GITHUB_WORKSPACE");
+    return pathMod.join(workspace, path);
+  }
+}

.github/actions/codex/src/load-config.ts

@@ -0,0 +1,56 @@
+import type { Config, LabelConfig } from "./config";
+
+import { getDefaultConfig } from "./default-label-config";
+import { readFileSync, readdirSync, statSync } from "fs";
+import * as path from "path";
+
+/**
+ * Build an in-memory configuration object by scanning the repository for
+ * Markdown templates located in `.github/codex/labels`.
+ *
+ * Each `*.md` file in that directory represents a label that can trigger the
+ * Codex GitHub Action. The filename **without** the extension is interpreted
+ * as the label name, e.g. `codex-review.md` ➜ `codex-review`.
+ *
+ * For every such label we derive the corresponding `doneLabel` by appending
+ * the suffix `-completed`.
+ */
+export function loadConfig(workspace: string): Config {
+  const labelsDir = path.join(workspace, ".github", "codex", "labels");
+
+  let entries: string[];
+  try {
+    entries = readdirSync(labelsDir);
+  } catch {
+    // If the directory is missing, return the default configuration.
+    return getDefaultConfig();
+  }
+
+  const labels: Record<string, LabelConfig> = {};
+
+  for (const entry of entries) {
+    if (!entry.endsWith(".md")) {
+      continue;
+    }
+
+    const fullPath = path.join(labelsDir, entry);
+
+    if (!statSync(fullPath).isFile()) {
+      continue;
+    }
+
+    const labelName = entry.slice(0, -3); // trim ".md"
+
+    labels[labelName] = new FileLabelConfig(fullPath);
+  }
+
+  return { labels };
+}
+
+class FileLabelConfig implements LabelConfig {
+  constructor(private readonly promptPath: string) {}
+
+  getPromptTemplate(): string {
+    return readFileSync(this.promptPath, "utf8");
+  }
+}

.github/actions/codex/src/main.ts

@@ -0,0 +1,80 @@
+#!/usr/bin/env bun
+
+import type { Config } from "./config";
+
+import { defaultContext, EnvContext } from "./env-context";
+import { loadConfig } from "./load-config";
+import { setGitHubActionsUser } from "./git-user";
+import { onLabeled } from "./process-label";
+import { ensureBaseAndHeadCommitsForPRAreAvailable } from "./prompt-template";
+import { performAdditionalValidation } from "./verify-inputs";
+import { onComment } from "./comment";
+import { onReview } from "./review";
+
+async function main(): Promise<void> {
+  const ctx: EnvContext = defaultContext;
+
+  // Build the configuration dynamically by scanning `.github/codex/labels`.
+  const GITHUB_WORKSPACE = ctx.get("GITHUB_WORKSPACE");
+  const config: Config = loadConfig(GITHUB_WORKSPACE);
+
+  // Optionally perform additional validation of prompt template files.
+  performAdditionalValidation(config, GITHUB_WORKSPACE);
+
+  const GITHUB_EVENT_NAME = ctx.get("GITHUB_EVENT_NAME");
+  const GITHUB_EVENT_ACTION = ctx.get("GITHUB_EVENT_ACTION");
+
+  // Set user.name and user.email to a bot before Codex runs, just in case it
+  // creates a commit.
+  setGitHubActionsUser();
+
+  switch (GITHUB_EVENT_NAME) {
+    case "issues": {
+      if (GITHUB_EVENT_ACTION === "labeled") {
+        await onLabeled(config, ctx);
+        return;
+      } else if (GITHUB_EVENT_ACTION === "opened") {
+        await onComment(ctx);
+        return;
+      }
+      break;
+    }
+    case "issue_comment": {
+      if (GITHUB_EVENT_ACTION === "created") {
+        await onComment(ctx);
+        return;
+      }
+      break;
+    }
+    case "pull_request": {
+      if (GITHUB_EVENT_ACTION === "labeled") {
+        await ensureBaseAndHeadCommitsForPRAreAvailable(ctx);
+        await onLabeled(config, ctx);
+        return;
+      }
+      break;
+    }
+    case "pull_request_review": {
+      await ensureBaseAndHeadCommitsForPRAreAvailable(ctx);
+      if (GITHUB_EVENT_ACTION === "submitted") {
+        await onReview(ctx);
+        return;
+      }
+      break;
+    }
+    case "pull_request_review_comment": {
+      await ensureBaseAndHeadCommitsForPRAreAvailable(ctx);
+      if (GITHUB_EVENT_ACTION === "created") {
+        await onComment(ctx);
+        return;
+      }
+      break;
+    }
+  }
+
+  console.warn(
+    `Unsupported action '${GITHUB_EVENT_ACTION}' for event '${GITHUB_EVENT_NAME}'.`,
+  );
+}
+
+main();

.github/actions/codex/src/post-comment.ts

@@ -0,0 +1,62 @@
+import { fail } from "./fail";
+import * as github from "@actions/github";
+import { EnvContext } from "./env-context";
+
+/**
+ * Post a comment to the issue / pull request currently in scope.
+ *
+ * Provide the environment context so that token lookup (inside getOctokit) does
+ * not rely on global state.
+ */
+export async function postComment(
+  commentBody: string,
+  ctx: EnvContext,
+): Promise<void> {
+  // Append a footer with a link back to the workflow run, if available.
+  const footer = buildWorkflowRunFooter(ctx);
+  const bodyWithFooter = footer ? `${commentBody}${footer}` : commentBody;
+
+  const octokit = ctx.getOctokit();
+  console.info("Got Octokit instance for posting comment");
+  const { owner, repo } = github.context.repo;
+  const issueNumber = github.context.issue.number;
+
+  if (!issueNumber) {
+    console.warn(
+      "No issue or pull_request number found in GitHub context; skipping comment creation.",
+    );
+    return;
+  }
+
+  try {
+    console.info("Calling octokit.rest.issues.createComment()");
+    await octokit.rest.issues.createComment({
+      owner,
+      repo,
+      issue_number: issueNumber,
+      body: bodyWithFooter,
+    });
+  } catch (error) {
+    fail(`Failed to create comment via GitHub API: ${error}`);
+  }
+}
+
+/**
+ * Helper to build a Markdown fragment linking back to the workflow run that
+ * generated the current comment. Returns `undefined` if required environment
+ * variables are missing – e.g. when running outside of GitHub Actions – so we
+ * can gracefully skip the footer in those cases.
+ */
+function buildWorkflowRunFooter(ctx: EnvContext): string | undefined {
+  const serverUrl =
+    ctx.tryGetNonEmpty("GITHUB_SERVER_URL") ?? "https://github.com";
+  const repository = ctx.tryGetNonEmpty("GITHUB_REPOSITORY");
+  const runId = ctx.tryGetNonEmpty("GITHUB_RUN_ID");
+
+  if (!repository || !runId) {
+    return undefined;
+  }
+
+  const url = `${serverUrl}/${repository}/actions/runs/${runId}`;
+  return `\n\n---\n*[_View workflow run_](${url})*`;
+}

.github/actions/codex/src/process-label.ts

@@ -0,0 +1,195 @@
+import { fail } from "./fail";
+import { EnvContext } from "./env-context";
+import { renderPromptTemplate } from "./prompt-template";
+
+import { postComment } from "./post-comment";
+import { runCodex } from "./run-codex";
+
+import * as github from "@actions/github";
+import { Config, LabelConfig } from "./config";
+import { maybePublishPRForIssue } from "./git-helpers";
+
+export async function onLabeled(
+  config: Config,
+  ctx: EnvContext,
+): Promise<void> {
+  const GITHUB_EVENT_LABEL_NAME = ctx.get("GITHUB_EVENT_LABEL_NAME");
+  const labelConfig = config.labels[GITHUB_EVENT_LABEL_NAME] as
+    | LabelConfig
+    | undefined;
+  if (!labelConfig) {
+    fail(
+      `Label \`${GITHUB_EVENT_LABEL_NAME}\` not found in config: ${JSON.stringify(config)}`,
+    );
+  }
+
+  await processLabelConfig(ctx, GITHUB_EVENT_LABEL_NAME, labelConfig);
+}
+
+/**
+ * Wrapper that handles `-in-progress` and `-completed` semantics around the core lint/fix/review
+ * processing. It will:
+ *
+ * - Skip execution if the `-in-progress` or `-completed` label is already present.
+ * - Mark the PR/issue as `-in-progress`.
+ * - After successful execution, mark the PR/issue as `-completed`.
+ */
+async function processLabelConfig(
+  ctx: EnvContext,
+  label: string,
+  labelConfig: LabelConfig,
+): Promise<void> {
+  const octokit = ctx.getOctokit();
+  const { owner, repo, issueNumber, labelNames } =
+    await getCurrentLabels(octokit);
+
+  const inProgressLabel = `${label}-in-progress`;
+  const completedLabel = `${label}-completed`;
+  for (const markerLabel of [inProgressLabel, completedLabel]) {
+    if (labelNames.includes(markerLabel)) {
+      console.log(
+        `Label '${markerLabel}' already present on issue/PR #${issueNumber}. Skipping Codex action.`,
+      );
+
+      // Clean up: remove the triggering label to avoid confusion and re-runs.
+      await addAndRemoveLabels(octokit, {
+        owner,
+        repo,
+        issueNumber,
+        remove: markerLabel,
+      });
+
+      return;
+    }
+  }
+
+  // Mark the PR/issue as in progress.
+  await addAndRemoveLabels(octokit, {
+    owner,
+    repo,
+    issueNumber,
+    add: inProgressLabel,
+    remove: label,
+  });
+
+  // Run the core Codex processing.
+  await processLabel(ctx, label, labelConfig);
+
+  // Mark the PR/issue as completed.
+  await addAndRemoveLabels(octokit, {
+    owner,
+    repo,
+    issueNumber,
+    add: completedLabel,
+    remove: inProgressLabel,
+  });
+}
+
+async function processLabel(
+  ctx: EnvContext,
+  label: string,
+  labelConfig: LabelConfig,
+): Promise<void> {
+  const template = labelConfig.getPromptTemplate();
+  const populatedTemplate = await renderPromptTemplate(template, ctx);
+
+  // Always run Codex and post the resulting message as a comment.
+  let commentBody = await runCodex(populatedTemplate, ctx);
+
+  // Current heuristic: only try to create a PR if "attempt" or "fix" is in the
+  // label name. (Yes, we plan to evolve this.)
+  if (label.indexOf("fix") !== -1 || label.indexOf("attempt") !== -1) {
+    console.info(`label ${label} indicates we should attempt to create a PR`);
+    const prUrl = await maybeFixIssue(ctx, commentBody);
+    if (prUrl) {
+      commentBody += `\n\n---\nOpened pull request: ${prUrl}`;
+    }
+  } else {
+    console.info(
+      `label ${label} does not indicate we should attempt to create a PR`,
+    );
+  }
+
+  await postComment(commentBody, ctx);
+}
+
+async function maybeFixIssue(
+  ctx: EnvContext,
+  lastMessage: string,
+): Promise<string | undefined> {
+  // Attempt to create a PR out of any changes Codex produced.
+  const issueNumber = github.context.issue.number!; // exists for issues triggering this path
+  try {
+    return await maybePublishPRForIssue(issueNumber, lastMessage, ctx);
+  } catch (e) {
+    console.warn(`Failed to publish PR: ${e}`);
+  }
+}
+
+async function getCurrentLabels(
+  octokit: ReturnType<typeof github.getOctokit>,
+): Promise<{
+  owner: string;
+  repo: string;
+  issueNumber: number;
+  labelNames: Array<string>;
+}> {
+  const { owner, repo } = github.context.repo;
+  const issueNumber = github.context.issue.number;
+
+  if (!issueNumber) {
+    fail("No issue or pull_request number found in GitHub context.");
+  }
+
+  const { data: issueData } = await octokit.rest.issues.get({
+    owner,
+    repo,
+    issue_number: issueNumber,
+  });
+
+  const labelNames =
+    issueData.labels?.map((label: any) =>
+      typeof label === "string" ? label : label.name,
+    ) ?? [];
+
+  return { owner, repo, issueNumber, labelNames };
+}
+
+async function addAndRemoveLabels(
+  octokit: ReturnType<typeof github.getOctokit>,
+  opts: {
+    owner: string;
+    repo: string;
+    issueNumber: number;
+    add?: string;
+    remove?: string;
+  },
+): Promise<void> {
+  const { owner, repo, issueNumber, add, remove } = opts;
+
+  if (add) {
+    try {
+      await octokit.rest.issues.addLabels({
+        owner,
+        repo,
+        issue_number: issueNumber,
+        labels: [add],
+      });
+    } catch (error) {
+      console.warn(`Failed to add label '${add}': ${error}`);
+    }
+  }
+
+  if (remove) {
+    try {
+      await octokit.rest.issues.removeLabel({
+        owner,
+        repo,
+        issue_number: issueNumber,
+        name: remove,
+      });
+    } catch (error) {
+      console.warn(`Failed to remove label '${remove}': ${error}`);
+    }
+  }
+}

.github/actions/codex/src/prompt-template.ts

@@ -0,0 +1,284 @@
+/*
+ * Utilities to render Codex prompt templates.
+ *
+ * A template is a Markdown (or plain-text) file that may contain one or more
+ * placeholders of the form `{CODEX_ACTION_<NAME>}`. At runtime these
+ * placeholders are substituted with dynamically generated content. Each
+ * placeholder is resolved **exactly once** even if it appears multiple times
+ * in the same template.
+ */
+
+import { readFile } from "fs/promises";
+
+import { EnvContext } from "./env-context";
+
+// ---------------------------------------------------------------------------
+// Helpers
+// ---------------------------------------------------------------------------
+
+/**
+ * Lazily caches parsed `$GITHUB_EVENT_PATH` contents keyed by the file path so
+ * we only hit the filesystem once per unique event payload.
+ */
+const githubEventDataCache: Map<string, Promise<any>> = new Map();
+
+function getGitHubEventData(ctx: EnvContext): Promise<any> {
+  const eventPath = ctx.get("GITHUB_EVENT_PATH");
+  let cached = githubEventDataCache.get(eventPath);
+  if (!cached) {
+    cached = readFile(eventPath, "utf8").then((raw) => JSON.parse(raw));
+    githubEventDataCache.set(eventPath, cached);
+  }
+  return cached;
+}
+
+async function runCommand(args: Array<string>): Promise<string> {
+  const result = Bun.spawnSync(args, {
+    stdout: "pipe",
+    stderr: "pipe",
+  });
+
+  if (result.success) {
+    return result.stdout.toString();
+  }
+
+  console.error(`Error running ${JSON.stringify(args)}: ${result.stderr}`);
+  return "";
+}
+
+// ---------------------------------------------------------------------------
+// Public API
+// ---------------------------------------------------------------------------
+
+// Regex that captures the variable name without the surrounding { } braces.
+const VAR_REGEX = /\{(CODEX_ACTION_[A-Z0-9_]+)\}/g;
+
+// Cache individual placeholder values so each one is resolved at most once per
+// process even if many templates reference it.
+const placeholderCache: Map<string, Promise<string>> = new Map();
+
+/**
+ * Parse a template string, resolve all placeholders and return the rendered
+ * result.
+ */
+export async function renderPromptTemplate(
+  template: string,
+  ctx: EnvContext,
+): Promise<string> {
+  // ---------------------------------------------------------------------
+  // 1) Gather all *unique* placeholders present in the template.
+  // ---------------------------------------------------------------------
+  const variables = new Set<string>();
+  for (const match of template.matchAll(VAR_REGEX)) {
+    variables.add(match[1]);
+  }
+
+  // ---------------------------------------------------------------------
+  // 2) Kick off (or reuse) async resolution for each variable.
+  // ---------------------------------------------------------------------
+  for (const variable of variables) {
+    if (!placeholderCache.has(variable)) {
+      placeholderCache.set(variable, resolveVariable(variable, ctx));
+    }
+  }
+
+  // ---------------------------------------------------------------------
+  // 3) Await completion so we can perform a simple synchronous replace below.
+  // ---------------------------------------------------------------------
+  const resolvedEntries: [string, string][] = [];
+  for (const [key, promise] of placeholderCache.entries()) {
+    resolvedEntries.push([key, await promise]);
+  }
+  const resolvedMap = new Map<string, string>(resolvedEntries);
+
+  // ---------------------------------------------------------------------
+  // 4) Replace each occurrence.  We use replace with a callback to ensure
+  //    correct substitution even if variable names overlap (they shouldn't,
+  //    but better safe than sorry).
+  // ---------------------------------------------------------------------
+  return template.replace(VAR_REGEX, (_, varName: string) => {
+    return resolvedMap.get(varName) ?? "";
+  });
+}
+
+export async function ensureBaseAndHeadCommitsForPRAreAvailable(
+  ctx: EnvContext,
+): Promise<{ baseSha: string; headSha: string } | null> {
+  const prShas = await getPrShas(ctx);
+  if (prShas == null) {
+    console.warn("Unable to resolve PR branches");
+    return null;
+  }
+
+  const event = await getGitHubEventData(ctx);
+  const pr = event.pull_request;
+  if (!pr) {
+    console.warn("event.pull_request is not defined - unexpected");
+    return null;
+  }
+
+  const workspace = ctx.get("GITHUB_WORKSPACE");
+
+  // Refs (branch names)
+  const baseRef: string | undefined = pr.base?.ref;
+  const headRef: string | undefined = pr.head?.ref;
+
+  // Clone URLs
+  const baseRemoteUrl: string | undefined = pr.base?.repo?.clone_url;
+  const headRemoteUrl: string | undefined = pr.head?.repo?.clone_url;
+
+  if (!baseRef || !headRef || !baseRemoteUrl || !headRemoteUrl) {
+    console.warn(
+      "Missing PR ref or remote URL information - cannot fetch commits",
+    );
+    return null;
+  }
+
+  // Ensure we have the base branch.
+  await runCommand([
+    "git",
+    "-C",
+    workspace,
+    "fetch",
+    "--no-tags",
+    "origin",
+    baseRef,
+  ]);
+
+  // Ensure we have the head branch.
+  if (headRemoteUrl === baseRemoteUrl) {
+    // Same repository – the commit is available from `origin`.
+    await runCommand([
+      "git",
+      "-C",
+      workspace,
+      "fetch",
+      "--no-tags",
+      "origin",
+      headRef,
+    ]);
+  } else {
+    // Fork – make sure a `pr` remote exists that points at the fork. Attempting
+    // to add a remote that already exists causes git to error, so we swallow
+    // any non-zero exit codes from that specific command.
+    await runCommand([
+      "git",
+      "-C",
+      workspace,
+      "remote",
+      "add",
+      "pr",
+      headRemoteUrl,
+    ]);
+
+    // Whether adding succeeded or the remote already existed, attempt to fetch
+    // the head ref from the `pr` remote.
+    await runCommand([
+      "git",
+      "-C",
+      workspace,
+      "fetch",
+      "--no-tags",
+      "pr",
+      headRef,
+    ]);
+  }
+
+  return prShas;
+}
+
+// ---------------------------------------------------------------------------
+// Internal helpers – still exported for use by other modules.
+// ---------------------------------------------------------------------------
+
+export async function resolvePrDiff(ctx: EnvContext): Promise<string> {
+  const prShas = await ensureBaseAndHeadCommitsForPRAreAvailable(ctx);
+  if (prShas == null) {
+    console.warn("Unable to resolve PR branches");
+    return "";
+  }
+
+  const workspace = ctx.get("GITHUB_WORKSPACE");
+  const { baseSha, headSha } = prShas;
+  return runCommand([
+    "git",
+    "-C",
+    workspace,
+    "diff",
+    "--color=never",
+    `${baseSha}..${headSha}`,
+  ]);
+}
+
+// ---------------------------------------------------------------------------
+// Placeholder resolution
+// ---------------------------------------------------------------------------
+
+async function resolveVariable(name: string, ctx: EnvContext): Promise<string> {
+  switch (name) {
+    case "CODEX_ACTION_ISSUE_TITLE": {
+      const event = await getGitHubEventData(ctx);
+      const issue = event.issue ?? event.pull_request;
+      return issue?.title ?? "";
+    }
+
+    case "CODEX_ACTION_ISSUE_BODY": {
+      const event = await getGitHubEventData(ctx);
+      const issue = event.issue ?? event.pull_request;
+      return issue?.body ?? "";
+    }
+
+    case "CODEX_ACTION_GITHUB_EVENT_PATH": {
+      return ctx.get("GITHUB_EVENT_PATH");
+    }
+
+    case "CODEX_ACTION_BASE_REF": {
+      const event = await getGitHubEventData(ctx);
+      return event?.pull_request?.base?.ref ?? "";
+    }
+
+    case "CODEX_ACTION_HEAD_REF": {
+      const event = await getGitHubEventData(ctx);
+      return event?.pull_request?.head?.ref ?? "";
+    }
+
+    case "CODEX_ACTION_PR_DIFF": {
+      return resolvePrDiff(ctx);
+    }
+
+    // -------------------------------------------------------------------
+    // Add new template variables here.
+    // -------------------------------------------------------------------
+
+    default: {
+      // Unknown variable – leave it blank to avoid leaking placeholders to the
+      // final prompt.  The alternative would be to `fail()` here, but silently
+      // ignoring unknown placeholders is more forgiving and better matches the
+      // behaviour of typical template engines.
+      console.warn(`Unknown template variable: ${name}`);
+      return "";
+    }
+  }
+}
+
+async function getPrShas(
+  ctx: EnvContext,
+): Promise<{ baseSha: string; headSha: string } | null> {
+  const event = await getGitHubEventData(ctx);
+  const pr = event.pull_request;
+  if (!pr) {
+    console.warn("event.pull_request is not defined");
+    return null;
+  }
+
+  // Prefer explicit SHAs if available to avoid relying on local branch names.
+  const baseSha: string | undefined = pr.base?.sha;
+  const headSha: string | undefined = pr.head?.sha;
+
+  if (!baseSha || !headSha) {
+    console.warn("one of base or head is not defined on event.pull_request");
+    return null;
+  }
+
+  return { baseSha, headSha };
+}

.github/actions/codex/src/review.ts

@@ -0,0 +1,42 @@
+import type { EnvContext } from "./env-context";
+import { runCodex } from "./run-codex";
+import { postComment } from "./post-comment";
+import { addEyesReaction } from "./add-reaction";
+
+/**
+ * Handle `pull_request_review` events. We treat the review body the same way
+ * as a normal comment.
+ */
+export async function onReview(ctx: EnvContext): Promise<void> {
+  const triggerPhrase = ctx.tryGet("INPUT_TRIGGER_PHRASE");
+  if (!triggerPhrase) {
+    console.warn("Empty trigger phrase: skipping.");
+    return;
+  }
+
+  const reviewBody = ctx.tryGet("GITHUB_EVENT_REVIEW_BODY");
+
+  if (!reviewBody) {
+    console.warn("Review body not found in environment: skipping.");
+    return;
+  }
+
+  if (!reviewBody.includes(triggerPhrase)) {
+    console.log(
+      `Trigger phrase '${triggerPhrase}' not found: nothing to do for this review.`,
+    );
+    return;
+  }
+
+  const prompt = reviewBody.replace(triggerPhrase, "").trim();
+
+  if (prompt.length === 0) {
+    console.warn("Prompt is empty after removing trigger phrase: skipping.");
+    return;
+  }
+
+  await addEyesReaction(ctx);
+
+  const lastMessage = await runCodex(prompt, ctx);
+  await postComment(lastMessage, ctx);
+}

.github/actions/codex/src/run-codex.ts

@@ -0,0 +1,56 @@
+import { fail } from "./fail";
+import { EnvContext } from "./env-context";
+import { tmpdir } from "os";
+import { join } from "node:path";
+import { readFile, mkdtemp } from "fs/promises";
+import { resolveWorkspacePath } from "./github-workspace";
+
+/**
+ * Runs the Codex CLI with the provided prompt and returns the output written
+ * to the "last message" file.
+ */
+export async function runCodex(
+  prompt: string,
+  ctx: EnvContext,
+): Promise<string> {
+  const OPENAI_API_KEY = ctx.get("OPENAI_API_KEY");
+
+  const tempDirPath = await mkdtemp(join(tmpdir(), "codex-"));
+  const lastMessageOutput = join(tempDirPath, "codex-prompt.md");
+
+  const args = ["/usr/local/bin/codex-exec"];
+
+  const inputCodexArgs = ctx.tryGet("INPUT_CODEX_ARGS")?.trim();
+  if (inputCodexArgs) {
+    args.push(...inputCodexArgs.split(/\s+/));
+  }
+
+  args.push("--output-last-message", lastMessageOutput, prompt);
+
+  const env: Record<string, string> = { ...process.env, OPENAI_API_KEY };
+  const INPUT_CODEX_HOME = ctx.tryGet("INPUT_CODEX_HOME");
+  if (INPUT_CODEX_HOME) {
+    env.CODEX_HOME = resolveWorkspacePath(INPUT_CODEX_HOME, ctx);
+  }
+
+  console.log(`Running Codex: ${JSON.stringify(args)}`);
+  const result = Bun.spawnSync(args, {
+    stdout: "inherit",
+    stderr: "inherit",
+    env,
+  });
+
+  if (!result.success) {
+    fail(`Codex failed: see above for details.`);
+  }
+
+  // Read the output generated by Codex.
+  let lastMessage: string;
+  try {
+    lastMessage = await readFile(lastMessageOutput, "utf8");
+  } catch (err) {
+    fail(`Failed to read Codex output at '${lastMessageOutput}': ${err}`);
+  }
+
+  return lastMessage;
+}

.github/actions/codex/src/verify-inputs.ts

@@ -0,0 +1,33 @@
+// Validate the inputs passed to the composite action.
+// The script currently ensures that the provided configuration file exists and
+// matches the expected schema.
+
+import type { Config } from "./config";
+
+import { existsSync } from "fs";
+import * as path from "path";
+import { fail } from "./fail";
+
+export function performAdditionalValidation(config: Config, workspace: string) {
+  // Additional validation: ensure referenced prompt files exist and are Markdown.
+  for (const [label, details] of Object.entries(config.labels)) {
+    // Determine which prompt key is present (the schema guarantees exactly one).
+    const promptPathStr =
+      (details as any).prompt ?? (details as any).promptPath;
+
+    if (promptPathStr) {
+      const promptPath = path.isAbsolute(promptPathStr)
+        ? promptPathStr
+        : path.join(workspace, promptPathStr);
+
+      if (!existsSync(promptPath)) {
+        fail(`Prompt file for label '${label}' not found: ${promptPath}`);
+      }
+      if (!promptPath.endsWith(".md")) {
+        fail(
+          `Prompt file for label '${label}' must be a .md file (got ${promptPathStr}).`,
+        );
+      }
+    }
+  }
+}

.github/actions/codex/tsconfig.json

@@ -0,0 +1,15 @@
+{
+  "compilerOptions": {
+    "lib": ["ESNext"],
+    "target": "ESNext",
+    "module": "ESNext",
+    "moduleDetection": "force",
+    "moduleResolution": "bundler",
+
+    "noEmit": true,
+    "strict": true,
+    "skipLibCheck": true
+  },
+
+  "include": ["src"]
+}

.github/codex/home/config.toml

@@ -0,0 +1,3 @@
+model = "o3"
+
+# Consider setting [mcp_servers] here!

.github/codex/labels/codex-attempt.md

@@ -0,0 +1,9 @@
+Attempt to solve the reported issue.
+
+If a code change is required, create a new branch, commit the fix, and open a pull request that resolves the problem.
+
+Here is the original GitHub issue that triggered this run:
+
+### {CODEX_ACTION_ISSUE_TITLE}
+
+{CODEX_ACTION_ISSUE_BODY}

.github/codex/labels/codex-review.md

@@ -0,0 +1,7 @@
+Review this PR and respond with a very concise final message, formatted in Markdown.
+
+There should be a summary of the changes (1-2 sentences) and a few bullet points if necessary.
+
+Then provide the **review** (1-2 sentences plus bullet points, friendly tone).
+
+{CODEX_ACTION_GITHUB_EVENT_PATH} contains the JSON that triggered this GitHub workflow. It contains the `base` and `head` refs that define this PR. Both refs are available locally.

.github/codex/labels/codex-rust-review.md

@@ -0,0 +1,23 @@
+Review this PR and respond with a very concise final message, formatted in Markdown.
+
+There should be a summary of the changes (1-2 sentences) and a few bullet points if necessary.
+
+Then provide the **review** (1-2 sentences plus bullet points, friendly tone).
+
+Things to look out for when doing the review:
+
+- **Make sure the pull request body explains the motivation behind the change.** If the author has failed to do this, call it out, and if you think you can deduce the motivation behind the change, propose copy.
+- Ideally, the PR body also contains a small summary of the change. For small changes, the PR title may be sufficient.
+- Each PR should ideally do one conceptual thing. For example, if a PR does a refactoring as well as introducing a new feature, push back and suggest the refactoring be done in a separate PR. This makes things easier for the reviewer, as refactoring changes can often be far-reaching, yet quick to review.
+- If the nature of the change seems to have a visual component (which is often the case for changes to `codex-rs/tui`), recommend including a screenshot or video to demonstrate the change, if appropriate.
+- Rust files should generally be organized such that the public parts of the API appear near the top of the file and helper functions go below. This is analagous to the "inverted pyramid" structure that is favored in journalism.
+- Encourage the use of small enums or the newtype pattern in Rust if it helps readability without adding significant cognitive load or lines of code.
+- Be wary of large files and offer suggestions for how to break things into more reasonably-sized files.
+- When modifying a `Cargo.toml` file, make sure that dependency lists stay alphabetically sorted. Also consider whether a new dependency is added to the appropriate place (e.g., `[dependencies]` versus `[dev-dependencies]`)
+- If you see opportunities for the changes in a diff to use more idiomatic Rust, please make specific recommendations. For example, favor the use of expressions over `return`.
+- When introducing new code, be on the lookout for code that duplicates existing code. When found, propose a way to refactor the existing code such that it should be reused.
+- Each create in the Cargo workspace in `codex-rs` has a specific purpose: make a note if you believe new code is not introduced in the correct crate.
+- When possible, try to keep the `core` crate as small as possible. Non-core but shared logic is often a good candidate for `codex-rs/common`.
+- References to existing GitHub issues and PRs are encouraged, where appropriate, though you likely do not have network access, so may not be able to help here.
+
+{CODEX_ACTION_GITHUB_EVENT_PATH} contains the JSON that triggered this GitHub workflow. It contains the `base` and `head` refs that define this PR. Both refs are available locally.

.github/codex/labels/codex-triage.md

@@ -0,0 +1,7 @@
+Troubleshoot whether the reported issue is valid.
+
+Provide a concise and respectful comment summarizing the findings.
+
+### {CODEX_ACTION_ISSUE_TITLE}
+
+{CODEX_ACTION_ISSUE_BODY}

.github/dependabot.yaml

@@ -0,0 +1,26 @@
+# https://docs.github.com/en/code-security/dependabot/working-with-dependabot/dependabot-options-reference#package-ecosystem-
+
+version: 2
+updates:
+  - package-ecosystem: bun
+    directory: .github/actions/codex
+    schedule:
+      interval: weekly
+  - package-ecosystem: cargo
+    directories:
+      - codex-rs
+      - codex-rs/*
+    schedule:
+      interval: weekly
+  - package-ecosystem: devcontainers
+    directory: /
+    schedule:
+      interval: weekly
+  - package-ecosystem: docker
+    directory: codex-cli
+    schedule:
+      interval: weekly
+  - package-ecosystem: github-actions
+    directory: /
+    schedule:
+      interval: weekly

.github/dotslash-config.json

@@ -5,7 +5,7 @@
         "macos-aarch64":  { "regex": "^codex-exec-aarch64-apple-darwin\\.zst$",          "path": "codex-exec" },
         "macos-x86_64":   { "regex": "^codex-exec-x86_64-apple-darwin\\.zst$",           "path": "codex-exec" },
         "linux-x86_64":   { "regex": "^codex-exec-x86_64-unknown-linux-musl\\.zst$",     "path": "codex-exec" },
-        "linux-aarch64":  { "regex": "^codex-exec-aarch64-unknown-linux-gnu\\.zst$",     "path": "codex-exec" }
+        "linux-aarch64":  { "regex": "^codex-exec-aarch64-unknown-linux-musl\\.zst$",     "path": "codex-exec" }
       }
     },
 
@@ -14,14 +14,14 @@
         "macos-aarch64":  { "regex": "^codex-aarch64-apple-darwin\\.zst$",          "path": "codex" },
         "macos-x86_64":   { "regex": "^codex-x86_64-apple-darwin\\.zst$",           "path": "codex" },
         "linux-x86_64":   { "regex": "^codex-x86_64-unknown-linux-musl\\.zst$",     "path": "codex" },
-        "linux-aarch64":  { "regex": "^codex-aarch64-unknown-linux-gnu\\.zst$",     "path": "codex" }
+        "linux-aarch64":  { "regex": "^codex-aarch64-unknown-linux-musl\\.zst$",     "path": "codex" }
       }
     },
 
     "codex-linux-sandbox": {
       "platforms": {
         "linux-x86_64":   { "regex": "^codex-linux-sandbox-x86_64-unknown-linux-musl\\.zst$",     "path": "codex-linux-sandbox" },
-        "linux-aarch64":  { "regex": "^codex-linux-sandbox-aarch64-unknown-linux-gnu\\.zst$",     "path": "codex-linux-sandbox" }
+        "linux-aarch64":  { "regex": "^codex-linux-sandbox-aarch64-unknown-linux-musl\\.zst$",     "path": "codex-linux-sandbox" }
       }
     }
   }

.github/workflows/ci.yml

@@ -74,7 +74,12 @@ jobs:
           GH_TOKEN: ${{ github.token }}
         run: pnpm stage-release
 
-      - name: Ensure README.md contains only ASCII and certain Unicode code points
+      - name: Ensure root README.md contains only ASCII and certain Unicode code points
         run: ./scripts/asciicheck.py README.md
-      - name: Check README ToC
+      - name: Check root README ToC
         run: python3 scripts/readme_toc.py README.md
+
+      - name: Ensure codex-cli/README.md contains only ASCII and certain Unicode code points
+        run: ./scripts/asciicheck.py codex-cli/README.md
+      - name: Check codex-cli/README ToC
+        run: python3 scripts/readme_toc.py codex-cli/README.md

.github/workflows/codex.yml

@@ -0,0 +1,95 @@
+name: Codex
+
+on:
+  issues:
+    types: [opened, labeled]
+  pull_request:
+    branches: [main]
+    types: [labeled]
+
+jobs:
+  codex:
+    # This `if` check provides complex filtering logic to avoid running Codex
+    # on every PR. Admittedly, one thing this does not verify is whether the
+    # sender has write access to the repo: that must be done as part of a
+    # runtime step.
+    #
+    # Note the label values should match the ones in the .github/codex/labels
+    # folder.
+    if: |
+      (github.event_name == 'issues' && (
+        (github.event.action == 'labeled' && (github.event.label.name == 'codex-attempt' || github.event.label.name == 'codex-triage'))
+      )) ||
+      (github.event_name == 'pull_request' && github.event.action == 'labeled' && (github.event.label.name == 'codex-review' || github.event.label.name == 'codex-rust-review'))
+    runs-on: ubuntu-latest
+    permissions:
+      contents: write # can push or create branches
+      issues: write # for comments + labels on issues/PRs
+      pull-requests: write # for PR comments/labels
+    steps:
+      # TODO: Consider adding an optional mode (--dry-run?) to actions/codex
+      # that verifies whether Codex should actually be run for this event.
+      # (For example, it may be rejected because the sender does not have
+      # write access to the repo.) The benefit would be two-fold:
+      # 1. As the first step of this job, it gives us a chance to add a reaction
+      #    or comment to the PR/issue ASAP to "ack" the request.
+      # 2. It saves resources by skipping the clone and setup steps below if
+      #    Codex is not going to run.
+
+      - name: Checkout repository
+        uses: actions/checkout@v4
+
+      # We install the dependencies like we would for an ordinary CI job,
+      # particularly because Codex will not have network access to install
+      # these dependencies.
+      - name: Setup Node.js
+        uses: actions/setup-node@v4
+        with:
+          node-version: 22
+
+      - name: Setup pnpm
+        uses: pnpm/action-setup@v4
+        with:
+          version: 10.8.1
+          run_install: false
+
+      - name: Get pnpm store directory
+        id: pnpm-cache
+        shell: bash
+        run: |
+          echo "store_path=$(pnpm store path --silent)" >> $GITHUB_OUTPUT
+
+      - name: Setup pnpm cache
+        uses: actions/cache@v4
+        with:
+          path: ${{ steps.pnpm-cache.outputs.store_path }}
+          key: ${{ runner.os }}-pnpm-store-${{ hashFiles('**/pnpm-lock.yaml') }}
+          restore-keys: |
+            ${{ runner.os }}-pnpm-store-
+
+      - name: Install dependencies
+        run: pnpm install
+
+      - uses: dtolnay/rust-toolchain@1.88
+        with:
+          targets: x86_64-unknown-linux-gnu
+          components: clippy
+
+      - uses: actions/cache@v4
+        with:
+          path: |
+            ~/.cargo/bin/
+            ~/.cargo/registry/index/
+            ~/.cargo/registry/cache/
+            ~/.cargo/git/db/
+            ${{ github.workspace }}/codex-rs/target/
+          key: cargo-ubuntu-24.04-x86_64-unknown-linux-gnu-${{ hashFiles('**/Cargo.lock') }}
+
+      # Note it is possible that the `verify` step internal to Run Codex will
+      # fail, in which case the work to setup the repo was worthless :(
+      - name: Run Codex
+        uses: ./.github/actions/codex
+        with:
+          openai_api_key: ${{ secrets.CODEX_OPENAI_API_KEY }}
+          github_token: ${{ secrets.GITHUB_TOKEN }}
+          codex_home: ./.github/codex/home

.github/workflows/rust-ci.yml

@@ -26,7 +26,7 @@ jobs:
 
     steps:
       - uses: actions/checkout@v4
-      - uses: dtolnay/rust-toolchain@1.87
+      - uses: dtolnay/rust-toolchain@1.88
         with:
           components: rustfmt
       - name: cargo fmt
@@ -55,12 +55,16 @@ jobs:
             target: x86_64-unknown-linux-musl
           - runner: ubuntu-24.04
             target: x86_64-unknown-linux-gnu
+          - runner: ubuntu-24.04-arm
+            target: aarch64-unknown-linux-musl
+          - runner: ubuntu-24.04-arm
+            target: aarch64-unknown-linux-gnu
           - runner: windows-latest
             target: x86_64-pc-windows-msvc
 
     steps:
       - uses: actions/checkout@v4
-      - uses: dtolnay/rust-toolchain@1.87
+      - uses: dtolnay/rust-toolchain@1.88
         with:
           targets: ${{ matrix.target }}
           components: clippy
@@ -75,7 +79,7 @@ jobs:
             ${{ github.workspace }}/codex-rs/target/
           key: cargo-${{ matrix.runner }}-${{ matrix.target }}-${{ hashFiles('**/Cargo.lock') }}
 
-      - if: ${{ matrix.target == 'x86_64-unknown-linux-musl' }}
+      - if: ${{ matrix.target == 'x86_64-unknown-linux-musl' || matrix.target == 'aarch64-unknown-linux-musl'}}
         name: Install musl build tools
         run: |
           sudo apt install -y musl-tools pkg-config

.github/workflows/rust-release.yml

@@ -15,9 +15,6 @@ concurrency:
   group: ${{ github.workflow }}
   cancel-in-progress: true
 
-env:
-  TAG_REGEX: '^rust-v[0-9]+\.[0-9]+\.[0-9]+$'
-
 jobs:
   tag-check:
     runs-on: ubuntu-latest
@@ -33,8 +30,8 @@ jobs:
           # 1. Must be a tag and match the regex
           [[ "${GITHUB_REF_TYPE}" == "tag" ]] \
             || { echo "❌  Not a tag push"; exit 1; }
-          [[ "${GITHUB_REF_NAME}" =~ ${TAG_REGEX} ]] \
-            || { echo "❌  Tag '${GITHUB_REF_NAME}' != ${TAG_REGEX}"; exit 1; }
+          [[ "${GITHUB_REF_NAME}" =~ ^rust-v[0-9]+\.[0-9]+\.[0-9]+(-(alpha|beta)(\.[0-9]+)?)?$ ]] \
+            || { echo "❌  Tag '${GITHUB_REF_NAME}' doesn't match expected format"; exit 1; }
 
           # 2. Extract versions
           tag_ver="${GITHUB_REF_NAME#rust-v}"
@@ -69,12 +66,14 @@ jobs:
             target: x86_64-unknown-linux-musl
           - runner: ubuntu-24.04
             target: x86_64-unknown-linux-gnu
+          - runner: ubuntu-24.04-arm
+            target: aarch64-unknown-linux-musl
           - runner: ubuntu-24.04-arm
             target: aarch64-unknown-linux-gnu
 
     steps:
       - uses: actions/checkout@v4
-      - uses: dtolnay/rust-toolchain@1.87
+      - uses: dtolnay/rust-toolchain@1.88
         with:
           targets: ${{ matrix.target }}
 
@@ -88,13 +87,13 @@ jobs:
             ${{ github.workspace }}/codex-rs/target/
           key: cargo-release-${{ matrix.runner }}-${{ matrix.target }}-${{ hashFiles('**/Cargo.lock') }}
 
-      - if: ${{ matrix.target == 'x86_64-unknown-linux-musl' }}
+      - if: ${{ matrix.target == 'x86_64-unknown-linux-musl' || matrix.target == 'aarch64-unknown-linux-musl'}}
         name: Install musl build tools
         run: |
           sudo apt install -y musl-tools pkg-config
 
       - name: Cargo build
-        run: cargo build --target ${{ matrix.target }} --release --all-targets --all-features
+        run: cargo build --target ${{ matrix.target }} --release --bin codex --bin codex-exec --bin codex-linux-sandbox
 
       - name: Stage artifacts
         shell: bash
@@ -105,7 +104,10 @@ jobs:
           cp target/${{ matrix.target }}/release/codex-exec "$dest/codex-exec-${{ matrix.target }}"
           cp target/${{ matrix.target }}/release/codex "$dest/codex-${{ matrix.target }}"
 
-      - if: ${{ matrix.target == 'x86_64-unknown-linux-musl' || matrix.target == 'x86_64-unknown-linux-gnu' || matrix.target == 'aarch64-unknown-linux-gnu' }}
+        # After https://github.com/openai/codex/pull/1228 is merged and a new
+        # release is cut with an artifacts built after that PR, the `-gnu`
+        # variants can go away as we will only use the `-musl` variants.
+      - if: ${{ matrix.target == 'x86_64-unknown-linux-musl' || matrix.target == 'x86_64-unknown-linux-gnu' || matrix.target == 'aarch64-unknown-linux-gnu' || matrix.target == 'aarch64-unknown-linux-musl' }}
         name: Stage Linux-only artifacts
         shell: bash
         run: |
@@ -155,9 +157,7 @@ jobs:
   release:
     needs: build
     name: release
-    runs-on: ubuntu-24.04
-    env:
-      RELEASE_TAG: codex-rs-${{ github.sha }}-${{ github.run_attempt }}-${{ github.ref_name }}
+    runs-on: ubuntu-latest
 
     steps:
       - uses: actions/download-artifact@v4
@@ -167,9 +167,19 @@ jobs:
       - name: List
         run: ls -R dist/
 
-      - uses: softprops/action-gh-release@v2
+      - name: Define release name
+        id: release_name
+        run: |
+          # Extract the version from the tag name, which is in the format
+          # "rust-v0.1.0".
+          version="${GITHUB_REF_NAME#rust-v}"
+          echo "name=${version}" >> $GITHUB_OUTPUT
+
+      - name: Create GitHub Release
+        uses: softprops/action-gh-release@v2
         with:
-          tag_name: ${{ env.RELEASE_TAG }}
+          name: ${{ steps.release_name.outputs.name }}
+          tag_name: ${{ github.ref_name }}
           files: dist/**
           # For now, tag releases as "prerelease" because we are not claiming
           # the Rust CLI is stable yet.
@@ -179,5 +189,5 @@ jobs:
         env:
           GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
         with:
-          tag: ${{ env.RELEASE_TAG }}
+          tag: ${{ github.ref_name }}
           config: .github/dotslash-config.json

.vscode/extensions.json

@@ -0,0 +1,5 @@
+{
+    "recommendations": [
+        "tamasfe.even-better-toml",
+    ]
+}

.vscode/launch.json

@@ -0,0 +1,18 @@
+{
+    "version": "0.2.0",
+    "configurations": [
+        {
+            "type": "lldb",
+            "request": "launch",
+            "name": "Cargo launch",
+            "cargo": {
+                "cwd": "${workspaceFolder}/codex-rs",
+                "args": [
+                    "build",
+                    "--bin=codex-tui"
+                ]
+            },
+            "args": []
+        }
+    ]
+}

.vscode/settings.json

@@ -0,0 +1,16 @@
+{
+    "rust-analyzer.checkOnSave": true,
+    "rust-analyzer.check.command": "clippy",
+    "rust-analyzer.check.extraArgs": ["--all-features", "--tests"],
+    "rust-analyzer.rustfmt.extraArgs": ["--config", "imports_granularity=Item"],
+    "[rust]": {
+        "editor.defaultFormatter": "rust-lang.rust-analyzer",
+        "editor.formatOnSave": true,
+    },
+    "[toml]": {
+        "editor.defaultFormatter": "tamasfe.even-better-toml",
+        "editor.formatOnSave": true,
+    },
+    "evenBetterToml.formatter.reorderArrays": true,
+    "evenBetterToml.formatter.reorderKeys": true,
+}

AGENTS.md

@@ -3,3 +3,7 @@
 In the codex-rs folder where the rust code lives:
 
 - Never add or modify any code related to `CODEX_SANDBOX_NETWORK_DISABLED_ENV_VAR`. You operate in a sandbox where `CODEX_SANDBOX_NETWORK_DISABLED=1` will be set whenever you use the `shell` tool. Any existing code that uses `CODEX_SANDBOX_NETWORK_DISABLED_ENV_VAR` was authored with this fact in mind. It is often used to early exit out of tests that the author knew you would not be able to run given your sandbox limitations.
+
+Before creating a pull request with changes to `codex-rs`, run `just fmt` (in `codex-rs` directory) to format the code and `just fix` (in `codex-rs` directory) to fix any linter issues in the code, ensure the test suite passes by running `cargo test --all-features` in the `codex-rs` directory.
+
+When making individual changes prefer running tests on individual files or projects first.

NOTICE

@@ -1,2 +1,6 @@
 OpenAI Codex
 Copyright 2025 OpenAI
+
+This project includes code derived from [Ratatui](https://github.com/ratatui/ratatui), licensed under the MIT license.
+Copyright (c) 2016-2022 Florian Dehau
+Copyright (c) 2023-2025 The Ratatui Developers

README.md

@@ -1,9 +1,11 @@
 <h1 align="center">OpenAI Codex CLI</h1>
 <p align="center">Lightweight coding agent that runs in your terminal</p>
 
-<p align="center"><code>npm i -g @openai/codex</code></p>
+<p align="center"><code>npm i -g @openai/codex</code><br />or <code>brew install codex</code></p>
 
-![Codex demo GIF using: codex "explain this codebase to me"](./.github/demo.gif)
+This is the home of the **Codex CLI**, which is a coding agent from OpenAI that runs locally on your computer. If you are looking for the _cloud-based agent_ from OpenAI, **Codex [Web]**, see <https://chatgpt.com/codex>.
+
+<!-- ![Codex demo GIF using: codex "explain this codebase to me"](./.github/demo.gif) -->
 
 ---
 
@@ -14,6 +16,8 @@
 
 - [Experimental technology disclaimer](#experimental-technology-disclaimer)
 - [Quickstart](#quickstart)
+  - [OpenAI API Users](#openai-api-users)
+  - [OpenAI Plus/Pro Users](#openai-pluspro-users)
 - [Why Codex?](#why-codex)
 - [Security model & permissions](#security-model--permissions)
   - [Platform sandboxing details](#platform-sandboxing-details)
@@ -21,24 +25,17 @@
 - [CLI reference](#cli-reference)
 - [Memory & project docs](#memory--project-docs)
 - [Non-interactive / CI mode](#non-interactive--ci-mode)
+- [Model Context Protocol (MCP)](#model-context-protocol-mcp)
 - [Tracing / verbose logging](#tracing--verbose-logging)
 - [Recipes](#recipes)
 - [Installation](#installation)
-- [Configuration guide](#configuration-guide)
-  - [Basic configuration parameters](#basic-configuration-parameters)
-  - [Custom AI provider configuration](#custom-ai-provider-configuration)
-  - [History configuration](#history-configuration)
-  - [Configuration examples](#configuration-examples)
-  - [Full configuration example](#full-configuration-example)
-  - [Custom instructions](#custom-instructions)
-  - [Environment variables setup](#environment-variables-setup)
+  - [DotSlash](#dotslash)
+- [Configuration](#configuration)
 - [FAQ](#faq)
 - [Zero data retention (ZDR) usage](#zero-data-retention-zdr-usage)
 - [Codex open source fund](#codex-open-source-fund)
 - [Contributing](#contributing)
   - [Development workflow](#development-workflow)
-  - [Git hooks with Husky](#git-hooks-with-husky)
-  - [Debugging](#debugging)
   - [Writing high-impact code changes](#writing-high-impact-code-changes)
   - [Opening a pull request](#opening-a-pull-request)
   - [Review process](#review-process)
@@ -47,8 +44,6 @@
   - [Contributor license agreement (CLA)](#contributor-license-agreement-cla)
     - [Quick fixes](#quick-fixes)
   - [Releasing `codex`](#releasing-codex)
-  - [Alternative build options](#alternative-build-options)
-    - [Nix flake development](#nix-flake-development)
 - [Security & responsible AI](#security--responsible-ai)
 - [License](#license)
 
@@ -71,54 +66,100 @@ Help us improve by filing issues or submitting PRs (see the section below for ho
 
 ## Quickstart
 
-Install globally:
+Install globally with your preferred package manager:
 
 ```shell
-npm install -g @openai/codex
+npm install -g @openai/codex  # Alternatively: `brew install codex`
 ```
 
+Or go to the [latest GitHub Release](https://github.com/openai/codex/releases/latest) and download the appropriate binary for your platform.
+
+### OpenAI API Users
+
 Next, set your OpenAI API key as an environment variable:
 
 ```shell
 export OPENAI_API_KEY="your-api-key-here"
 ```
 
-> **Note:** This command sets the key only for your current terminal session. You can add the `export` line to your shell's configuration file (e.g., `~/.zshrc`) but we recommend setting for the session. **Tip:** You can also place your API key into a `.env` file at the root of your project:
->
-> ```env
-> OPENAI_API_KEY=your-api-key-here
-> ```
->
-> The CLI will automatically load variables from `.env` (via `dotenv/config`).
+> [!NOTE]
+> This command sets the key only for your current terminal session. You can add the `export` line to your shell's configuration file (e.g., `~/.zshrc`), but we recommend setting it for the session.
+
+### OpenAI Plus/Pro Users
+
+If you have a paid OpenAI account, run the following to start the login process:
+
+```
+codex login
+```
+
+If you complete the process successfully, you should have a `~/.codex/auth.json` file that contains the credentials that Codex will use.
+
+To verify whether you are currently logged in, run:
+
+```
+codex login status
+```
+
+If you encounter problems with the login flow, please comment on <https://github.com/openai/codex/issues/1243>.
 
 <details>
-<summary><strong>Use <code>--provider</code> to use other models</strong></summary>
+<summary><strong>Use <code>--profile</code> to use other models</strong></summary>
 
-> Codex also allows you to use other providers that support the OpenAI Chat Completions API. You can set the provider in the config file or use the `--provider` flag. The possible options for `--provider` are:
->
-> - openai (default)
-> - openrouter
-> - azure
-> - gemini
-> - ollama
-> - mistral
-> - deepseek
-> - xai
-> - groq
-> - arceeai
-> - any other provider that is compatible with the OpenAI API
->
-> If you use a provider other than OpenAI, you will need to set the API key for the provider in the config file or in the environment variable as:
->
-> ```shell
-> export <provider>_API_KEY="your-api-key-here"
-> ```
->
-> If you use a provider not listed above, you must also set the base URL for the provider:
->
-> ```shell
-> export <provider>_BASE_URL="https://your-provider-api-base-url"
-> ```
+Codex also allows you to use other providers that support the OpenAI Chat Completions (or Responses) API.
+
+To do so, you must first define custom [providers](./config.md#model_providers) in `~/.codex/config.toml`. For example, the provider for a standard Ollama setup would be defined as follows:
+
+```toml
+[model_providers.ollama]
+name = "Ollama"
+base_url = "http://localhost:11434/v1"
+```
+
+The `base_url` will have `/chat/completions` appended to it to build the full URL for the request.
+
+For providers that also require an `Authorization` header of the form `Bearer: SECRET`, an `env_key` can be specified, which indicates the environment variable to read to use as the value of `SECRET` when making a request:
+
+```toml
+[model_providers.openrouter]
+name = "OpenRouter"
+base_url = "https://openrouter.ai/api/v1"
+env_key = "OPENROUTER_API_KEY"
+```
+
+Providers that speak the Responses API are also supported by adding `wire_api = "responses"` as part of the definition. Accessing OpenAI models via Azure is an example of such a provider, though it also requires specifying additional `query_params` that need to be appended to the request URL:
+
+```toml
+[model_providers.azure]
+name = "Azure"
+# Make sure you set the appropriate subdomain for this URL.
+base_url = "https://YOUR_PROJECT_NAME.openai.azure.com/openai"
+env_key = "AZURE_OPENAI_API_KEY"  # Or "OPENAI_API_KEY", whichever you use.
+# Newer versions appear to support the responses API, see https://github.com/openai/codex/pull/1321
+query_params = { api-version = "2025-04-01-preview" }
+wire_api = "responses"
+```
+
+Once you have defined a provider you wish to use, you can configure it as your default provider as follows:
+
+```toml
+model_provider = "azure"
+```
+
+> [!TIP]
+> If you find yourself experimenting with a variety of models and providers, then you likely want to invest in defining a _profile_ for each configuration like so:
+
+```toml
+[profiles.o3]
+model_provider = "azure"
+model = "o3"
+
+[profiles.mistral]
+model_provider = "ollama"
+model = "mistral"
+```
+
+This way, you can specify one command-line argument (.e.g., `--profile o3`, `--profile mistral`) to override multiple settings together.
 
 </details>
 <br />
@@ -136,7 +177,7 @@ codex "explain this codebase to me"
 ```
 
 ```shell
-codex --approval-mode full-auto "create the fanciest todo-list app"
+codex --full-auto "create the fanciest todo-list app"
 ```
 
 That's it - Codex will scaffold a file, run it inside a sandbox, install any
@@ -162,41 +203,35 @@ And it's **fully open-source** so you can see and contribute to how it develops!
 
 ## Security model & permissions
 
-Codex lets you decide _how much autonomy_ the agent receives and auto-approval policy via the
-`--approval-mode` flag (or the interactive onboarding prompt):
+Codex lets you decide _how much autonomy_ you want to grant the agent. The following options can be configured independently:
 
-| Mode                      | What the agent may do without asking                                                                | Still requires approval                                                                         |
-| ------------------------- | --------------------------------------------------------------------------------------------------- | ----------------------------------------------------------------------------------------------- |
-| **Suggest** <br>(default) | <li>Read any file in the repo                                                                       | <li>**All** file writes/patches<li> **Any** arbitrary shell commands (aside from reading files) |
-| **Auto Edit**             | <li>Read **and** apply-patch writes to files                                                        | <li>**All** shell commands                                                                      |
-| **Full Auto**             | <li>Read/write files <li> Execute shell commands (network disabled, writes limited to your workdir) | -                                                                                               |
+- [`approval_policy`](./codex-rs/config.md#approval_policy) determines when you should be prompted to approve whether Codex can execute a command
+- [`sandbox`](./codex-rs/config.md#sandbox) determines the _sandbox policy_ that Codex uses to execute untrusted commands
 
-In **Full Auto** every command is run **network-disabled** and confined to the
-current working directory (plus temporary files) for defense-in-depth. Codex
-will also show a warning/confirmation if you start in **auto-edit** or
-**full-auto** while the directory is _not_ tracked by Git, so you always have a
-safety net.
+By default, Codex runs with `--ask-for-approval untrusted` and `--sandbox read-only`, which means that:
 
-Coming soon: you'll be able to whitelist specific commands to auto-execute with
-the network enabled, once we're confident in additional safeguards.
+- The user is prompted to approve every command not on the set of "trusted" commands built into Codex (`cat`, `ls`, etc.)
+- Approved commands are run outside of a sandbox because user approval implies "trust," in this case.
+
+Running Codex with the `--full-auto` convenience flag changes the configuration to `--ask-for-approval on-failure` and `--sandbox workspace-write`, which means that:
+
+- Codex does not initially ask for user approval before running an individual command.
+- Though when it runs a command, it is run under a sandbox in which:
+  - It can read any file on the system.
+  - It can only write files under the current directory (or the directory specified via `--cd`).
+  - Network requests are completely disabled.
+- Only if the command exits with a non-zero exit code will it ask the user for approval. If granted, it will re-attempt the command outside of the sandbox. (A common case is when Codex cannot `npm install` a dependency because that requires network access.)
+
+Again, these two options can be configured independently. For example, if you want Codex to perform an "exploration" where you are happy for it to read anything it wants but you never want to be prompted, you could run Codex with `--ask-for-approval never` and `--sandbox read-only`.
 
 ### Platform sandboxing details
 
-The hardening mechanism Codex uses depends on your OS:
+The mechanism Codex uses to implement the sandbox policy depends on your OS:
 
-- **macOS 12+** - commands are wrapped with **Apple Seatbelt** (`sandbox-exec`).
+- **macOS 12+** uses **Apple Seatbelt** and runs commands using `sandbox-exec` with a profile (`-p`) that corresponds to the `--sandbox` that was specified.
+- **Linux** uses a combination of Landlock/seccomp APIs to enforce the `sandbox` configuration.
 
-  - Everything is placed in a read-only jail except for a small set of
-    writable roots (`$PWD`, `$TMPDIR`, `~/.codex`, etc.).
-  - Outbound network is _fully blocked_ by default - even if a child process
-    tries to `curl` somewhere it will fail.
-
-- **Linux** - there is no sandboxing by default.
-  We recommend using Docker for sandboxing, where Codex launches itself inside a **minimal
-  container image** and mounts your repo _read/write_ at the same path. A
-  custom `iptables`/`ipset` firewall script denies all egress except the
-  OpenAI API. This gives you deterministic, reproducible runs without needing
-  root on the host. You can use the [`run_in_container.sh`](./codex-cli/scripts/run_in_container.sh) script to set up the sandbox.
+Note that when running Linux in a containerized environment such as Docker, sandboxing may not work if the host/container configuration does not support the necessary Landlock/seccomp APIs. In such cases, we recommend configuring your Docker container so that it provides the sandbox guarantees you are looking for and then running `codex` with `--sandbox danger-full-access` (or, more simply, the `--dangerously-bypass-approvals-and-sandbox` flag) within your container.
 
 ---
 
@@ -205,24 +240,20 @@ The hardening mechanism Codex uses depends on your OS:
 | Requirement                 | Details                                                         |
 | --------------------------- | --------------------------------------------------------------- |
 | Operating systems           | macOS 12+, Ubuntu 20.04+/Debian 10+, or Windows 11 **via WSL2** |
-| Node.js                     | **22 or newer** (LTS recommended)                               |
 | Git (optional, recommended) | 2.23+ for built-in PR helpers                                   |
 | RAM                         | 4-GB minimum (8-GB recommended)                                 |
 
-> Never run `sudo npm install -g`; fix npm permissions instead.
-
 ---
 
 ## CLI reference
 
-| Command                              | Purpose                             | Example                              |
-| ------------------------------------ | ----------------------------------- | ------------------------------------ |
-| `codex`                              | Interactive REPL                    | `codex`                              |
-| `codex "..."`                        | Initial prompt for interactive REPL | `codex "fix lint errors"`            |
-| `codex -q "..."`                     | Non-interactive "quiet mode"        | `codex -q --json "explain utils.ts"` |
-| `codex completion <bash\|zsh\|fish>` | Print shell completion script       | `codex completion bash`              |
+| Command            | Purpose                            | Example                         |
+| ------------------ | ---------------------------------- | ------------------------------- |
+| `codex`            | Interactive TUI                    | `codex`                         |
+| `codex "..."`      | Initial prompt for interactive TUI | `codex "fix lint errors"`       |
+| `codex exec "..."` | Non-interactive "automation mode"  | `codex exec "explain utils.ts"` |
 
-Key flags: `--model/-m`, `--approval-mode/-a`, `--quiet/-q`, and `--notify`.
+Key flags: `--model/-m`, `--ask-for-approval/-a`.
 
 ---
 
@@ -234,8 +265,6 @@ You can give Codex extra instructions and guidance using `AGENTS.md` files. Code
 2. `AGENTS.md` at repo root - shared project notes
 3. `AGENTS.md` in the current working directory - sub-folder/feature specifics
 
-Disable loading of these files with `--no-project-doc` or the environment variable `CODEX_DISABLE_PROJECT_DOC=1`.
-
 ---
 
 ## Non-interactive / CI mode
@@ -247,18 +276,37 @@ Run Codex head-less in pipelines. Example GitHub Action step:
   run: |
     npm install -g @openai/codex
     export OPENAI_API_KEY="${{ secrets.OPENAI_KEY }}"
-    codex -a auto-edit --quiet "update CHANGELOG for next release"
+    codex exec --full-auto "update CHANGELOG for next release"
 ```
 
-Set `CODEX_QUIET_MODE=1` to silence interactive UI noise.
+## Model Context Protocol (MCP)
+
+The Codex CLI can be configured to leverage MCP servers by defining an [`mcp_servers`](./codex-rs/config.md#mcp_servers) section in `~/.codex/config.toml`. It is intended to mirror how tools such as Claude and Cursor define `mcpServers` in their respective JSON config files, though the Codex format is slightly different since it uses TOML rather than JSON, e.g.:
+
+```toml
+# IMPORTANT: the top-level key is `mcp_servers` rather than `mcpServers`.
+[mcp_servers.server-name]
+command = "npx"
+args = ["-y", "mcp-server"]
+env = { "API_KEY" = "value" }
+```
+
+> [!TIP]
+> It is somewhat experimental, but the Codex CLI can also be run as an MCP _server_ via `codex mcp`. If you launch it with an MCP client such as `npx @modelcontextprotocol/inspector codex mcp` and send it a `tools/list` request, you will see that there is only one tool, `codex`, that accepts a grab-bag of inputs, including a catch-all `config` map for anything you might want to override. Feel free to play around with it and provide feedback via GitHub issues.
 
 ## Tracing / verbose logging
 
-Setting the environment variable `DEBUG=true` prints full API request and response details:
+Because Codex is written in Rust, it honors the `RUST_LOG` environment variable to configure its logging behavior.
+
+The TUI defaults to `RUST_LOG=codex_core=info,codex_tui=info` and log messages are written to `~/.codex/log/codex-tui.log`, so you can leave the following running in a separate terminal to monitor log messages as they are written:
 
-```shell
-DEBUG=true codex
 ```
+tail -F ~/.codex/log/codex-tui.log
+```
+
+By comparison, the non-interactive mode (`codex exec`) defaults to `RUST_LOG=error`, but messages are printed inline, so there is no need to monitor a separate file.
+
+See the Rust documentation on [`RUST_LOG`](https://docs.rs/env_logger/latest/env_logger/#enabling-logging) for more information on the configuration options.
 
 ---
 
@@ -281,201 +329,78 @@ Below are a few bite-size examples you can copy-paste. Replace the text in quote
 ## Installation
 
 <details open>
-<summary><strong>From npm (Recommended)</strong></summary>
+<summary><strong>Install Codex CLI using your preferred package manager.</strong></summary>
+
+From `brew` (recommended, downloads only the binary for your platform):
 
 ```bash
-npm install -g @openai/codex
-# or
-yarn global add @openai/codex
-# or
-bun install -g @openai/codex
-# or
-pnpm add -g @openai/codex
+brew install codex
 ```
 
+From `npm` (generally more readily available, but downloads binaries for all supported platforms):
+
+```bash
+npm i -g @openai/codex
+```
+
+Or go to the [latest GitHub Release](https://github.com/openai/codex/releases/latest) and download the appropriate binary for your platform.
+
+Admittedly, each GitHub Release contains many executables, but in practice, you likely want one of these:
+
+- macOS
+  - Apple Silicon/arm64: `codex-aarch64-apple-darwin.tar.gz`
+  - x86_64 (older Mac hardware): `codex-x86_64-apple-darwin.tar.gz`
+- Linux
+  - x86_64: `codex-x86_64-unknown-linux-musl.tar.gz`
+  - arm64: `codex-aarch64-unknown-linux-musl.tar.gz`
+
+Each archive contains a single entry with the platform baked into the name (e.g., `codex-x86_64-unknown-linux-musl`), so you likely want to rename it to `codex` after extracting it.
+
+### DotSlash
+
+The GitHub Release also contains a [DotSlash](https://dotslash-cli.com/) file for the Codex CLI named `codex`. Using a DotSlash file makes it possible to make a lightweight commit to source control to ensure all contributors use the same version of an executable, regardless of what platform they use for development.
+
 </details>
 
 <details>
 <summary><strong>Build from source</strong></summary>
 
 ```bash
-# Clone the repository and navigate to the CLI package
+# Clone the repository and navigate to the root of the Cargo workspace.
 git clone https://github.com/openai/codex.git
-cd codex/codex-cli
+cd codex/codex-rs
 
-# Enable corepack
-corepack enable
+# Install the Rust toolchain, if necessary.
+curl --proto '=https' --tlsv1.2 -sSf https://sh.rustup.rs | sh -s -- -y
+source "$HOME/.cargo/env"
+rustup component add rustfmt
+rustup component add clippy
 
-# Install dependencies and build
-pnpm install
-pnpm build
+# Build Codex.
+cargo build
 
-# Linux-only: download prebuilt sandboxing binaries (requires gh and zstd).
-./scripts/install_native_deps.sh
+# Launch the TUI with a sample prompt.
+cargo run --bin codex -- "explain this codebase to me"
 
-# Get the usage and the options
-node ./dist/cli.js --help
+# After making changes, ensure the code is clean.
+cargo fmt -- --config imports_granularity=Item
+cargo clippy --tests
 
-# Run the locally-built CLI directly
-node ./dist/cli.js
-
-# Or link the command globally for convenience
-pnpm link
+# Run the tests.
+cargo test
 ```
 
 </details>
 
 ---
 
-## Configuration guide
+## Configuration
 
-Codex configuration files can be placed in the `~/.codex/` directory, supporting both YAML and JSON formats.
+Codex supports a rich set of configuration options documented in [`codex-rs/config.md`](./codex-rs/config.md).
 
-### Basic configuration parameters
+By default, Codex loads its configuration from `~/.codex/config.toml`.
 
-| Parameter           | Type    | Default    | Description                      | Available Options                                                                              |
-| ------------------- | ------- | ---------- | -------------------------------- | ---------------------------------------------------------------------------------------------- |
-| `model`             | string  | `o4-mini`  | AI model to use                  | Any model name supporting OpenAI API                                                           |
-| `approvalMode`      | string  | `suggest`  | AI assistant's permission mode   | `suggest` (suggestions only)<br>`auto-edit` (automatic edits)<br>`full-auto` (fully automatic) |
-| `fullAutoErrorMode` | string  | `ask-user` | Error handling in full-auto mode | `ask-user` (prompt for user input)<br>`ignore-and-continue` (ignore and proceed)               |
-| `notify`            | boolean | `true`     | Enable desktop notifications     | `true`/`false`                                                                                 |
-
-### Custom AI provider configuration
-
-In the `providers` object, you can configure multiple AI service providers. Each provider requires the following parameters:
-
-| Parameter | Type   | Description                             | Example                       |
-| --------- | ------ | --------------------------------------- | ----------------------------- |
-| `name`    | string | Display name of the provider            | `"OpenAI"`                    |
-| `baseURL` | string | API service URL                         | `"https://api.openai.com/v1"` |
-| `envKey`  | string | Environment variable name (for API key) | `"OPENAI_API_KEY"`            |
-
-### History configuration
-
-In the `history` object, you can configure conversation history settings:
-
-| Parameter           | Type    | Description                                            | Example Value |
-| ------------------- | ------- | ------------------------------------------------------ | ------------- |
-| `maxSize`           | number  | Maximum number of history entries to save              | `1000`        |
-| `saveHistory`       | boolean | Whether to save history                                | `true`        |
-| `sensitivePatterns` | array   | Patterns of sensitive information to filter in history | `[]`          |
-
-### Configuration examples
-
-1. YAML format (save as `~/.codex/config.yaml`):
-
-```yaml
-model: o4-mini
-approvalMode: suggest
-fullAutoErrorMode: ask-user
-notify: true
-```
-
-2. JSON format (save as `~/.codex/config.json`):
-
-```json
-{
-  "model": "o4-mini",
-  "approvalMode": "suggest",
-  "fullAutoErrorMode": "ask-user",
-  "notify": true
-}
-```
-
-### Full configuration example
-
-Below is a comprehensive example of `config.json` with multiple custom providers:
-
-```json
-{
-  "model": "o4-mini",
-  "provider": "openai",
-  "providers": {
-    "openai": {
-      "name": "OpenAI",
-      "baseURL": "https://api.openai.com/v1",
-      "envKey": "OPENAI_API_KEY"
-    },
-    "azure": {
-      "name": "AzureOpenAI",
-      "baseURL": "https://YOUR_PROJECT_NAME.openai.azure.com/openai",
-      "envKey": "AZURE_OPENAI_API_KEY"
-    },
-    "openrouter": {
-      "name": "OpenRouter",
-      "baseURL": "https://openrouter.ai/api/v1",
-      "envKey": "OPENROUTER_API_KEY"
-    },
-    "gemini": {
-      "name": "Gemini",
-      "baseURL": "https://generativelanguage.googleapis.com/v1beta/openai",
-      "envKey": "GEMINI_API_KEY"
-    },
-    "ollama": {
-      "name": "Ollama",
-      "baseURL": "http://localhost:11434/v1",
-      "envKey": "OLLAMA_API_KEY"
-    },
-    "mistral": {
-      "name": "Mistral",
-      "baseURL": "https://api.mistral.ai/v1",
-      "envKey": "MISTRAL_API_KEY"
-    },
-    "deepseek": {
-      "name": "DeepSeek",
-      "baseURL": "https://api.deepseek.com",
-      "envKey": "DEEPSEEK_API_KEY"
-    },
-    "xai": {
-      "name": "xAI",
-      "baseURL": "https://api.x.ai/v1",
-      "envKey": "XAI_API_KEY"
-    },
-    "groq": {
-      "name": "Groq",
-      "baseURL": "https://api.groq.com/openai/v1",
-      "envKey": "GROQ_API_KEY"
-    },
-    "arceeai": {
-      "name": "ArceeAI",
-      "baseURL": "https://conductor.arcee.ai/v1",
-      "envKey": "ARCEEAI_API_KEY"
-    }
-  },
-  "history": {
-    "maxSize": 1000,
-    "saveHistory": true,
-    "sensitivePatterns": []
-  }
-}
-```
-
-### Custom instructions
-
-You can create a `~/.codex/AGENTS.md` file to define custom guidance for the agent:
-
-```markdown
-- Always respond with emojis
-- Only use git commands when explicitly requested
-```
-
-### Environment variables setup
-
-For each AI provider, you need to set the corresponding API key in your environment variables. For example:
-
-```bash
-# OpenAI
-export OPENAI_API_KEY="your-api-key-here"
-
-# Azure OpenAI
-export AZURE_OPENAI_API_KEY="your-azure-api-key-here"
-export AZURE_OPENAI_API_VERSION="2025-03-01-preview" (Optional)
-
-# OpenRouter
-export OPENROUTER_API_KEY="your-openrouter-key-here"
-
-# Similarly for other providers
-```
+Though `--config` can be used to set/override ad-hoc config values for individual invocations of `codex`.
 
 ---
 
@@ -524,7 +449,13 @@ Codex CLI **does** support OpenAI organizations with [Zero Data Retention (ZDR)]
 OpenAI rejected the request. Error details: Status: 400, Code: unsupported_parameter, Type: invalid_request_error, Message: 400 Previous response cannot be used for this organization due to Zero Data Retention.
 ```
 
-You may need to upgrade to a more recent version with: `npm i -g @openai/codex@latest`
+Ensure you are running `codex` with `--config disable_response_storage=true` or add this line to `~/.codex/config.toml` to avoid specifying the command line option each time:
+
+```toml
+disable_response_storage = true
+```
+
+See [the configuration documentation on `disable_response_storage`](./codex-rs/config.md#disable_response_storage) for details.
 
 ---
 
@@ -549,51 +480,7 @@ More broadly we welcome contributions - whether you are opening your very first
 
 - Create a _topic branch_ from `main` - e.g. `feat/interactive-prompt`.
 - Keep your changes focused. Multiple unrelated fixes should be opened as separate PRs.
-- Use `pnpm test:watch` during development for super-fast feedback.
-- We use **Vitest** for unit tests, **ESLint** + **Prettier** for style, and **TypeScript** for type-checking.
-- Before pushing, run the full test/type/lint suite:
-
-### Git hooks with Husky
-
-This project uses [Husky](https://typicode.github.io/husky/) to enforce code quality checks:
-
-- **Pre-commit hook**: Automatically runs lint-staged to format and lint files before committing
-- **Pre-push hook**: Runs tests and type checking before pushing to the remote
-
-These hooks help maintain code quality and prevent pushing code with failing tests. For more details, see [HUSKY.md](./codex-cli/HUSKY.md).
-
-```bash
-pnpm test && pnpm run lint && pnpm run typecheck
-```
-
-- If you have **not** yet signed the Contributor License Agreement (CLA), add a PR comment containing the exact text
-
-  ```text
-  I have read the CLA Document and I hereby sign the CLA
-  ```
-
-  The CLA-Assistant bot will turn the PR status green once all authors have signed.
-
-```bash
-# Watch mode (tests rerun on change)
-pnpm test:watch
-
-# Type-check without emitting files
-pnpm typecheck
-
-# Automatically fix lint + prettier issues
-pnpm lint:fix
-pnpm format:fix
-```
-
-### Debugging
-
-To debug the CLI with a visual debugger, do the following in the `codex-cli` folder:
-
-- Run `pnpm run build` to build the CLI, which will generate `cli.js.map` alongside `cli.js` in the `dist` folder.
-- Run the CLI with `node --inspect-brk ./dist/cli.js` The program then waits until a debugger is attached before proceeding. Options:
-  - In VS Code, choose **Debug: Attach to Node Process** from the command palette and choose the option in the dropdown with debug port `9229` (likely the first option)
-  - Go to <chrome://inspect> in Chrome and find **localhost:9229** and click **trace**
+- Following the [development setup](#development-workflow) instructions above, ensure your change is free of lint warnings and test failures.
 
 ### Writing high-impact code changes
 
@@ -605,7 +492,7 @@ To debug the CLI with a visual debugger, do the following in the `codex-cli` fol
 ### Opening a pull request
 
 - Fill in the PR template (or include similar information) - **What? Why? How?**
-- Run **all** checks locally (`npm test && npm run lint && npm run typecheck`). CI failures that could have been caught locally slow down the process.
+- Run **all** checks locally (`cargo test && cargo clippy --tests && cargo fmt -- --config imports_granularity=Item`). CI failures that could have been caught locally slow down the process.
 - Make sure your branch is up-to-date with `main` and that you have resolved merge conflicts.
 - Mark the PR as **Ready for review** only when you believe it is in a merge-able state.
 
@@ -652,73 +539,22 @@ The **DCO check** blocks merges until every commit in the PR carries the footer
 
 ### Releasing `codex`
 
-To publish a new version of the CLI you first need to stage the npm package. A
-helper script in `codex-cli/scripts/` does all the heavy lifting. Inside the
-`codex-cli` folder run:
+_For admins only._
 
-```bash
-# Classic, JS implementation that includes small, native binaries for Linux sandboxing.
-pnpm stage-release
+Make sure you are on `main` and have no local changes. Then run:
 
-# Optionally specify the temp directory to reuse between runs.
-RELEASE_DIR=$(mktemp -d)
-pnpm stage-release --tmp "$RELEASE_DIR"
-
-# "Fat" package that additionally bundles the native Rust CLI binaries for
-# Linux. End-users can then opt-in at runtime by setting CODEX_RUST=1.
-pnpm stage-release --native
+```shell
+VERSION=0.2.0  # Can also be 0.2.0-alpha.1 or any valid Rust version.
+./codex-rs/scripts/create_github_release.sh "$VERSION"
 ```
 
-Go to the folder where the release is staged and verify that it works as intended. If so, run the following from the temp folder:
+This will make a local commit on top of `main` with `version` set to `$VERSION` in `codex-rs/Cargo.toml` (note that on `main`, we leave the version as `version = "0.0.0"`).
 
-```
-cd "$RELEASE_DIR"
-npm publish
-```
+This will push the commit using the tag `rust-v${VERSION}`, which in turn kicks off [the release workflow](.github/workflows/rust-release.yml). This will create a new GitHub Release named `$VERSION`.
 
-### Alternative build options
+If everything looks good in the generated GitHub Release, uncheck the **pre-release** box so it is the latest release.
 
-#### Nix flake development
-
-Prerequisite: Nix >= 2.4 with flakes enabled (`experimental-features = nix-command flakes` in `~/.config/nix/nix.conf`).
-
-Enter a Nix development shell:
-
-```bash
-# Use either one of the commands according to which implementation you want to work with
-nix develop .#codex-cli # For entering codex-cli specific shell
-nix develop .#codex-rs # For entering codex-rs specific shell
-```
-
-This shell includes Node.js, installs dependencies, builds the CLI, and provides a `codex` command alias.
-
-Build and run the CLI directly:
-
-```bash
-# Use either one of the commands according to which implementation you want to work with
-nix build .#codex-cli # For building codex-cli
-nix build .#codex-rs # For building codex-rs
-./result/bin/codex --help
-```
-
-Run the CLI via the flake app:
-
-```bash
-# Use either one of the commands according to which implementation you want to work with
-nix run .#codex-cli # For running codex-cli
-nix run .#codex-rs # For running codex-rs
-```
-
-Use direnv with flakes
-
-If you have direnv installed, you can use the following `.envrc` to automatically enter the Nix shell when you `cd` into the project directory:
-
-```bash
-cd codex-rs
-echo "use flake ../flake.nix#codex-cli" >> .envrc && direnv allow
-cd codex-cli
-echo "use flake ../flake.nix#codex-rs" >> .envrc && direnv allow
-```
+Create a PR to update [`Formula/c/codex.rb`](https://github.com/Homebrew/homebrew-core/blob/main/Formula/c/codex.rb) on Homebrew.
 
 ---
 

codex-cli/.gitignore

@@ -1,3 +1,7 @@
 # Added by ./scripts/install_native_deps.sh
+/bin/codex-aarch64-apple-darwin
+/bin/codex-aarch64-unknown-linux-musl
 /bin/codex-linux-sandbox-arm64
 /bin/codex-linux-sandbox-x64
+/bin/codex-x86_64-apple-darwin
+/bin/codex-x86_64-unknown-linux-musl

codex-cli/Dockerfile

@@ -1,4 +1,4 @@
-FROM node:20-slim
+FROM node:24-slim
 
 ARG TZ
 ENV TZ="$TZ"

codex-cli/README.md

@@ -0,0 +1,736 @@
+<h1 align="center">OpenAI Codex CLI</h1>
+<p align="center">Lightweight coding agent that runs in your terminal</p>
+
+<p align="center"><code>npm i -g @openai/codex</code></p>
+
+> [!IMPORTANT]
+> This is the documentation for the _legacy_ TypeScript implementation of the Codex CLI. It has been superseded by the _Rust_ implementation. See the [README in the root of the Codex repository](https://github.com/openai/codex/blob/main/README.md) for details.
+
+![Codex demo GIF using: codex "explain this codebase to me"](../.github/demo.gif)
+
+---
+
+<details>
+<summary><strong>Table of contents</strong></summary>
+
+<!-- Begin ToC -->
+
+- [Experimental technology disclaimer](#experimental-technology-disclaimer)
+- [Quickstart](#quickstart)
+- [Why Codex?](#why-codex)
+- [Security model & permissions](#security-model--permissions)
+  - [Platform sandboxing details](#platform-sandboxing-details)
+- [System requirements](#system-requirements)
+- [CLI reference](#cli-reference)
+- [Memory & project docs](#memory--project-docs)
+- [Non-interactive / CI mode](#non-interactive--ci-mode)
+- [Tracing / verbose logging](#tracing--verbose-logging)
+- [Recipes](#recipes)
+- [Installation](#installation)
+- [Configuration guide](#configuration-guide)
+  - [Basic configuration parameters](#basic-configuration-parameters)
+  - [Custom AI provider configuration](#custom-ai-provider-configuration)
+  - [History configuration](#history-configuration)
+  - [Configuration examples](#configuration-examples)
+  - [Full configuration example](#full-configuration-example)
+  - [Custom instructions](#custom-instructions)
+  - [Environment variables setup](#environment-variables-setup)
+- [FAQ](#faq)
+- [Zero data retention (ZDR) usage](#zero-data-retention-zdr-usage)
+- [Codex open source fund](#codex-open-source-fund)
+- [Contributing](#contributing)
+  - [Development workflow](#development-workflow)
+  - [Git hooks with Husky](#git-hooks-with-husky)
+  - [Debugging](#debugging)
+  - [Writing high-impact code changes](#writing-high-impact-code-changes)
+  - [Opening a pull request](#opening-a-pull-request)
+  - [Review process](#review-process)
+  - [Community values](#community-values)
+  - [Getting help](#getting-help)
+  - [Contributor license agreement (CLA)](#contributor-license-agreement-cla)
+    - [Quick fixes](#quick-fixes)
+  - [Releasing `codex`](#releasing-codex)
+  - [Alternative build options](#alternative-build-options)
+    - [Nix flake development](#nix-flake-development)
+- [Security & responsible AI](#security--responsible-ai)
+- [License](#license)
+
+<!-- End ToC -->
+
+</details>
+
+---
+
+## Experimental technology disclaimer
+
+Codex CLI is an experimental project under active development. It is not yet stable, may contain bugs, incomplete features, or undergo breaking changes. We're building it in the open with the community and welcome:
+
+- Bug reports
+- Feature requests
+- Pull requests
+- Good vibes
+
+Help us improve by filing issues or submitting PRs (see the section below for how to contribute)!
+
+## Quickstart
+
+Install globally:
+
+```shell
+npm install -g @openai/codex
+```
+
+Next, set your OpenAI API key as an environment variable:
+
+```shell
+export OPENAI_API_KEY="your-api-key-here"
+```
+
+> **Note:** This command sets the key only for your current terminal session. You can add the `export` line to your shell's configuration file (e.g., `~/.zshrc`) but we recommend setting for the session. **Tip:** You can also place your API key into a `.env` file at the root of your project:
+>
+> ```env
+> OPENAI_API_KEY=your-api-key-here
+> ```
+>
+> The CLI will automatically load variables from `.env` (via `dotenv/config`).
+
+<details>
+<summary><strong>Use <code>--provider</code> to use other models</strong></summary>
+
+> Codex also allows you to use other providers that support the OpenAI Chat Completions API. You can set the provider in the config file or use the `--provider` flag. The possible options for `--provider` are:
+>
+> - openai (default)
+> - openrouter
+> - azure
+> - gemini
+> - ollama
+> - mistral
+> - deepseek
+> - xai
+> - groq
+> - arceeai
+> - any other provider that is compatible with the OpenAI API
+>
+> If you use a provider other than OpenAI, you will need to set the API key for the provider in the config file or in the environment variable as:
+>
+> ```shell
+> export <provider>_API_KEY="your-api-key-here"
+> ```
+>
+> If you use a provider not listed above, you must also set the base URL for the provider:
+>
+> ```shell
+> export <provider>_BASE_URL="https://your-provider-api-base-url"
+> ```
+
+</details>
+<br />
+
+Run interactively:
+
+```shell
+codex
+```
+
+Or, run with a prompt as input (and optionally in `Full Auto` mode):
+
+```shell
+codex "explain this codebase to me"
+```
+
+```shell
+codex --approval-mode full-auto "create the fanciest todo-list app"
+```
+
+That's it - Codex will scaffold a file, run it inside a sandbox, install any
+missing dependencies, and show you the live result. Approve the changes and
+they'll be committed to your working directory.
+
+---
+
+## Why Codex?
+
+Codex CLI is built for developers who already **live in the terminal** and want
+ChatGPT-level reasoning **plus** the power to actually run code, manipulate
+files, and iterate - all under version control. In short, it's _chat-driven
+development_ that understands and executes your repo.
+
+- **Zero setup** - bring your OpenAI API key and it just works!
+- **Full auto-approval, while safe + secure** by running network-disabled and directory-sandboxed
+- **Multimodal** - pass in screenshots or diagrams to implement features ✨
+
+And it's **fully open-source** so you can see and contribute to how it develops!
+
+---
+
+## Security model & permissions
+
+Codex lets you decide _how much autonomy_ the agent receives and auto-approval policy via the
+`--approval-mode` flag (or the interactive onboarding prompt):
+
+| Mode                      | What the agent may do without asking                                                                | Still requires approval                                                                         |
+| ------------------------- | --------------------------------------------------------------------------------------------------- | ----------------------------------------------------------------------------------------------- |
+| **Suggest** <br>(default) | <li>Read any file in the repo                                                                       | <li>**All** file writes/patches<li> **Any** arbitrary shell commands (aside from reading files) |
+| **Auto Edit**             | <li>Read **and** apply-patch writes to files                                                        | <li>**All** shell commands                                                                      |
+| **Full Auto**             | <li>Read/write files <li> Execute shell commands (network disabled, writes limited to your workdir) | -                                                                                               |
+
+In **Full Auto** every command is run **network-disabled** and confined to the
+current working directory (plus temporary files) for defense-in-depth. Codex
+will also show a warning/confirmation if you start in **auto-edit** or
+**full-auto** while the directory is _not_ tracked by Git, so you always have a
+safety net.
+
+Coming soon: you'll be able to whitelist specific commands to auto-execute with
+the network enabled, once we're confident in additional safeguards.
+
+### Platform sandboxing details
+
+The hardening mechanism Codex uses depends on your OS:
+
+- **macOS 12+** - commands are wrapped with **Apple Seatbelt** (`sandbox-exec`).
+
+  - Everything is placed in a read-only jail except for a small set of
+    writable roots (`$PWD`, `$TMPDIR`, `~/.codex`, etc.).
+  - Outbound network is _fully blocked_ by default - even if a child process
+    tries to `curl` somewhere it will fail.
+
+- **Linux** - there is no sandboxing by default.
+  We recommend using Docker for sandboxing, where Codex launches itself inside a **minimal
+  container image** and mounts your repo _read/write_ at the same path. A
+  custom `iptables`/`ipset` firewall script denies all egress except the
+  OpenAI API. This gives you deterministic, reproducible runs without needing
+  root on the host. You can use the [`run_in_container.sh`](../codex-cli/scripts/run_in_container.sh) script to set up the sandbox.
+
+---
+
+## System requirements
+
+| Requirement                 | Details                                                         |
+| --------------------------- | --------------------------------------------------------------- |
+| Operating systems           | macOS 12+, Ubuntu 20.04+/Debian 10+, or Windows 11 **via WSL2** |
+| Node.js                     | **22 or newer** (LTS recommended)                               |
+| Git (optional, recommended) | 2.23+ for built-in PR helpers                                   |
+| RAM                         | 4-GB minimum (8-GB recommended)                                 |
+
+> Never run `sudo npm install -g`; fix npm permissions instead.
+
+---
+
+## CLI reference
+
+| Command                              | Purpose                             | Example                              |
+| ------------------------------------ | ----------------------------------- | ------------------------------------ |
+| `codex`                              | Interactive REPL                    | `codex`                              |
+| `codex "..."`                        | Initial prompt for interactive REPL | `codex "fix lint errors"`            |
+| `codex -q "..."`                     | Non-interactive "quiet mode"        | `codex -q --json "explain utils.ts"` |
+| `codex completion <bash\|zsh\|fish>` | Print shell completion script       | `codex completion bash`              |
+
+Key flags: `--model/-m`, `--approval-mode/-a`, `--quiet/-q`, and `--notify`.
+
+---
+
+## Memory & project docs
+
+You can give Codex extra instructions and guidance using `AGENTS.md` files. Codex looks for `AGENTS.md` files in the following places, and merges them top-down:
+
+1. `~/.codex/AGENTS.md` - personal global guidance
+2. `AGENTS.md` at repo root - shared project notes
+3. `AGENTS.md` in the current working directory - sub-folder/feature specifics
+
+Disable loading of these files with `--no-project-doc` or the environment variable `CODEX_DISABLE_PROJECT_DOC=1`.
+
+---
+
+## Non-interactive / CI mode
+
+Run Codex head-less in pipelines. Example GitHub Action step:
+
+```yaml
+- name: Update changelog via Codex
+  run: |
+    npm install -g @openai/codex
+    export OPENAI_API_KEY="${{ secrets.OPENAI_KEY }}"
+    codex -a auto-edit --quiet "update CHANGELOG for next release"
+```
+
+Set `CODEX_QUIET_MODE=1` to silence interactive UI noise.
+
+## Tracing / verbose logging
+
+Setting the environment variable `DEBUG=true` prints full API request and response details:
+
+```shell
+DEBUG=true codex
+```
+
+---
+
+## Recipes
+
+Below are a few bite-size examples you can copy-paste. Replace the text in quotes with your own task. See the [prompting guide](https://github.com/openai/codex/blob/main/codex-cli/examples/prompting_guide.md) for more tips and usage patterns.
+
+| ✨  | What you type                                                                   | What happens                                                               |
+| --- | ------------------------------------------------------------------------------- | -------------------------------------------------------------------------- |
+| 1   | `codex "Refactor the Dashboard component to React Hooks"`                       | Codex rewrites the class component, runs `npm test`, and shows the diff.   |
+| 2   | `codex "Generate SQL migrations for adding a users table"`                      | Infers your ORM, creates migration files, and runs them in a sandboxed DB. |
+| 3   | `codex "Write unit tests for utils/date.ts"`                                    | Generates tests, executes them, and iterates until they pass.              |
+| 4   | `codex "Bulk-rename *.jpeg -> *.jpg with git mv"`                               | Safely renames files and updates imports/usages.                           |
+| 5   | `codex "Explain what this regex does: ^(?=.*[A-Z]).{8,}$"`                      | Outputs a step-by-step human explanation.                                  |
+| 6   | `codex "Carefully review this repo, and propose 3 high impact well-scoped PRs"` | Suggests impactful PRs in the current codebase.                            |
+| 7   | `codex "Look for vulnerabilities and create a security review report"`          | Finds and explains security bugs.                                          |
+
+---
+
+## Installation
+
+<details open>
+<summary><strong>From npm (Recommended)</strong></summary>
+
+```bash
+npm install -g @openai/codex
+# or
+yarn global add @openai/codex
+# or
+bun install -g @openai/codex
+# or
+pnpm add -g @openai/codex
+```
+
+</details>
+
+<details>
+<summary><strong>Build from source</strong></summary>
+
+```bash
+# Clone the repository and navigate to the CLI package
+git clone https://github.com/openai/codex.git
+cd codex/codex-cli
+
+# Enable corepack
+corepack enable
+
+# Install dependencies and build
+pnpm install
+pnpm build
+
+# Linux-only: download prebuilt sandboxing binaries (requires gh and zstd).
+./scripts/install_native_deps.sh
+
+# Get the usage and the options
+node ./dist/cli.js --help
+
+# Run the locally-built CLI directly
+node ./dist/cli.js
+
+# Or link the command globally for convenience
+pnpm link
+```
+
+</details>
+
+---
+
+## Configuration guide
+
+Codex configuration files can be placed in the `~/.codex/` directory, supporting both YAML and JSON formats.
+
+### Basic configuration parameters
+
+| Parameter           | Type    | Default    | Description                      | Available Options                                                                              |
+| ------------------- | ------- | ---------- | -------------------------------- | ---------------------------------------------------------------------------------------------- |
+| `model`             | string  | `o4-mini`  | AI model to use                  | Any model name supporting OpenAI API                                                           |
+| `approvalMode`      | string  | `suggest`  | AI assistant's permission mode   | `suggest` (suggestions only)<br>`auto-edit` (automatic edits)<br>`full-auto` (fully automatic) |
+| `fullAutoErrorMode` | string  | `ask-user` | Error handling in full-auto mode | `ask-user` (prompt for user input)<br>`ignore-and-continue` (ignore and proceed)               |
+| `notify`            | boolean | `true`     | Enable desktop notifications     | `true`/`false`                                                                                 |
+
+### Custom AI provider configuration
+
+In the `providers` object, you can configure multiple AI service providers. Each provider requires the following parameters:
+
+| Parameter | Type   | Description                             | Example                       |
+| --------- | ------ | --------------------------------------- | ----------------------------- |
+| `name`    | string | Display name of the provider            | `"OpenAI"`                    |
+| `baseURL` | string | API service URL                         | `"https://api.openai.com/v1"` |
+| `envKey`  | string | Environment variable name (for API key) | `"OPENAI_API_KEY"`            |
+
+### History configuration
+
+In the `history` object, you can configure conversation history settings:
+
+| Parameter           | Type    | Description                                            | Example Value |
+| ------------------- | ------- | ------------------------------------------------------ | ------------- |
+| `maxSize`           | number  | Maximum number of history entries to save              | `1000`        |
+| `saveHistory`       | boolean | Whether to save history                                | `true`        |
+| `sensitivePatterns` | array   | Patterns of sensitive information to filter in history | `[]`          |
+
+### Configuration examples
+
+1. YAML format (save as `~/.codex/config.yaml`):
+
+```yaml
+model: o4-mini
+approvalMode: suggest
+fullAutoErrorMode: ask-user
+notify: true
+```
+
+2. JSON format (save as `~/.codex/config.json`):
+
+```json
+{
+  "model": "o4-mini",
+  "approvalMode": "suggest",
+  "fullAutoErrorMode": "ask-user",
+  "notify": true
+}
+```
+
+### Full configuration example
+
+Below is a comprehensive example of `config.json` with multiple custom providers:
+
+```json
+{
+  "model": "o4-mini",
+  "provider": "openai",
+  "providers": {
+    "openai": {
+      "name": "OpenAI",
+      "baseURL": "https://api.openai.com/v1",
+      "envKey": "OPENAI_API_KEY"
+    },
+    "azure": {
+      "name": "AzureOpenAI",
+      "baseURL": "https://YOUR_PROJECT_NAME.openai.azure.com/openai",
+      "envKey": "AZURE_OPENAI_API_KEY"
+    },
+    "openrouter": {
+      "name": "OpenRouter",
+      "baseURL": "https://openrouter.ai/api/v1",
+      "envKey": "OPENROUTER_API_KEY"
+    },
+    "gemini": {
+      "name": "Gemini",
+      "baseURL": "https://generativelanguage.googleapis.com/v1beta/openai",
+      "envKey": "GEMINI_API_KEY"
+    },
+    "ollama": {
+      "name": "Ollama",
+      "baseURL": "http://localhost:11434/v1",
+      "envKey": "OLLAMA_API_KEY"
+    },
+    "mistral": {
+      "name": "Mistral",
+      "baseURL": "https://api.mistral.ai/v1",
+      "envKey": "MISTRAL_API_KEY"
+    },
+    "deepseek": {
+      "name": "DeepSeek",
+      "baseURL": "https://api.deepseek.com",
+      "envKey": "DEEPSEEK_API_KEY"
+    },
+    "xai": {
+      "name": "xAI",
+      "baseURL": "https://api.x.ai/v1",
+      "envKey": "XAI_API_KEY"
+    },
+    "groq": {
+      "name": "Groq",
+      "baseURL": "https://api.groq.com/openai/v1",
+      "envKey": "GROQ_API_KEY"
+    },
+    "arceeai": {
+      "name": "ArceeAI",
+      "baseURL": "https://conductor.arcee.ai/v1",
+      "envKey": "ARCEEAI_API_KEY"
+    }
+  },
+  "history": {
+    "maxSize": 1000,
+    "saveHistory": true,
+    "sensitivePatterns": []
+  }
+}
+```
+
+### Custom instructions
+
+You can create a `~/.codex/AGENTS.md` file to define custom guidance for the agent:
+
+```markdown
+- Always respond with emojis
+- Only use git commands when explicitly requested
+```
+
+### Environment variables setup
+
+For each AI provider, you need to set the corresponding API key in your environment variables. For example:
+
+```bash
+# OpenAI
+export OPENAI_API_KEY="your-api-key-here"
+
+# Azure OpenAI
+export AZURE_OPENAI_API_KEY="your-azure-api-key-here"
+export AZURE_OPENAI_API_VERSION="2025-04-01-preview" (Optional)
+
+# OpenRouter
+export OPENROUTER_API_KEY="your-openrouter-key-here"
+
+# Similarly for other providers
+```
+
+---
+
+## FAQ
+
+<details>
+<summary>OpenAI released a model called Codex in 2021 - is this related?</summary>
+
+In 2021, OpenAI released Codex, an AI system designed to generate code from natural language prompts. That original Codex model was deprecated as of March 2023 and is separate from the CLI tool.
+
+</details>
+
+<details>
+<summary>Which models are supported?</summary>
+
+Any model available with [Responses API](https://platform.openai.com/docs/api-reference/responses). The default is `o4-mini`, but pass `--model gpt-4.1` or set `model: gpt-4.1` in your config file to override.
+
+</details>
+<details>
+<summary>Why does <code>o3</code> or <code>o4-mini</code> not work for me?</summary>
+
+It's possible that your [API account needs to be verified](https://help.openai.com/en/articles/10910291-api-organization-verification) in order to start streaming responses and seeing chain of thought summaries from the API. If you're still running into issues, please let us know!
+
+</details>
+
+<details>
+<summary>How do I stop Codex from editing my files?</summary>
+
+Codex runs model-generated commands in a sandbox. If a proposed command or file change doesn't look right, you can simply type **n** to deny the command or give the model feedback.
+
+</details>
+<details>
+<summary>Does it work on Windows?</summary>
+
+Not directly. It requires [Windows Subsystem for Linux (WSL2)](https://learn.microsoft.com/en-us/windows/wsl/install) - Codex has been tested on macOS and Linux with Node 22.
+
+</details>
+
+---
+
+## Zero data retention (ZDR) usage
+
+Codex CLI **does** support OpenAI organizations with [Zero Data Retention (ZDR)](https://platform.openai.com/docs/guides/your-data#zero-data-retention) enabled. If your OpenAI organization has Zero Data Retention enabled and you still encounter errors such as:
+
+```
+OpenAI rejected the request. Error details: Status: 400, Code: unsupported_parameter, Type: invalid_request_error, Message: 400 Previous response cannot be used for this organization due to Zero Data Retention.
+```
+
+You may need to upgrade to a more recent version with: `npm i -g @openai/codex@latest`
+
+---
+
+## Codex open source fund
+
+We're excited to launch a **$1 million initiative** supporting open source projects that use Codex CLI and other OpenAI models.
+
+- Grants are awarded up to **$25,000** API credits.
+- Applications are reviewed **on a rolling basis**.
+
+**Interested? [Apply here](https://openai.com/form/codex-open-source-fund/).**
+
+---
+
+## Contributing
+
+This project is under active development and the code will likely change pretty significantly. We'll update this message once that's complete!
+
+More broadly we welcome contributions - whether you are opening your very first pull request or you're a seasoned maintainer. At the same time we care about reliability and long-term maintainability, so the bar for merging code is intentionally **high**. The guidelines below spell out what "high-quality" means in practice and should make the whole process transparent and friendly.
+
+### Development workflow
+
+- Create a _topic branch_ from `main` - e.g. `feat/interactive-prompt`.
+- Keep your changes focused. Multiple unrelated fixes should be opened as separate PRs.
+- Use `pnpm test:watch` during development for super-fast feedback.
+- We use **Vitest** for unit tests, **ESLint** + **Prettier** for style, and **TypeScript** for type-checking.
+- Before pushing, run the full test/type/lint suite:
+
+### Git hooks with Husky
+
+This project uses [Husky](https://typicode.github.io/husky/) to enforce code quality checks:
+
+- **Pre-commit hook**: Automatically runs lint-staged to format and lint files before committing
+- **Pre-push hook**: Runs tests and type checking before pushing to the remote
+
+These hooks help maintain code quality and prevent pushing code with failing tests. For more details, see [HUSKY.md](./HUSKY.md).
+
+```bash
+pnpm test && pnpm run lint && pnpm run typecheck
+```
+
+- If you have **not** yet signed the Contributor License Agreement (CLA), add a PR comment containing the exact text
+
+  ```text
+  I have read the CLA Document and I hereby sign the CLA
+  ```
+
+  The CLA-Assistant bot will turn the PR status green once all authors have signed.
+
+```bash
+# Watch mode (tests rerun on change)
+pnpm test:watch
+
+# Type-check without emitting files
+pnpm typecheck
+
+# Automatically fix lint + prettier issues
+pnpm lint:fix
+pnpm format:fix
+```
+
+### Debugging
+
+To debug the CLI with a visual debugger, do the following in the `codex-cli` folder:
+
+- Run `pnpm run build` to build the CLI, which will generate `cli.js.map` alongside `cli.js` in the `dist` folder.
+- Run the CLI with `node --inspect-brk ./dist/cli.js` The program then waits until a debugger is attached before proceeding. Options:
+  - In VS Code, choose **Debug: Attach to Node Process** from the command palette and choose the option in the dropdown with debug port `9229` (likely the first option)
+  - Go to <chrome://inspect> in Chrome and find **localhost:9229** and click **trace**
+
+### Writing high-impact code changes
+
+1. **Start with an issue.** Open a new one or comment on an existing discussion so we can agree on the solution before code is written.
+2. **Add or update tests.** Every new feature or bug-fix should come with test coverage that fails before your change and passes afterwards. 100% coverage is not required, but aim for meaningful assertions.
+3. **Document behaviour.** If your change affects user-facing behaviour, update the README, inline help (`codex --help`), or relevant example projects.
+4. **Keep commits atomic.** Each commit should compile and the tests should pass. This makes reviews and potential rollbacks easier.
+
+### Opening a pull request
+
+- Fill in the PR template (or include similar information) - **What? Why? How?**
+- Run **all** checks locally (`npm test && npm run lint && npm run typecheck`). CI failures that could have been caught locally slow down the process.
+- Make sure your branch is up-to-date with `main` and that you have resolved merge conflicts.
+- Mark the PR as **Ready for review** only when you believe it is in a merge-able state.
+
+### Review process
+
+1. One maintainer will be assigned as a primary reviewer.
+2. We may ask for changes - please do not take this personally. We value the work, we just also value consistency and long-term maintainability.
+3. When there is consensus that the PR meets the bar, a maintainer will squash-and-merge.
+
+### Community values
+
+- **Be kind and inclusive.** Treat others with respect; we follow the [Contributor Covenant](https://www.contributor-covenant.org/).
+- **Assume good intent.** Written communication is hard - err on the side of generosity.
+- **Teach & learn.** If you spot something confusing, open an issue or PR with improvements.
+
+### Getting help
+
+If you run into problems setting up the project, would like feedback on an idea, or just want to say _hi_ - please open a Discussion or jump into the relevant issue. We are happy to help.
+
+Together we can make Codex CLI an incredible tool. **Happy hacking!** :rocket:
+
+### Contributor license agreement (CLA)
+
+All contributors **must** accept the CLA. The process is lightweight:
+
+1. Open your pull request.
+2. Paste the following comment (or reply `recheck` if you've signed before):
+
+   ```text
+   I have read the CLA Document and I hereby sign the CLA
+   ```
+
+3. The CLA-Assistant bot records your signature in the repo and marks the status check as passed.
+
+No special Git commands, email attachments, or commit footers required.
+
+#### Quick fixes
+
+| Scenario          | Command                                          |
+| ----------------- | ------------------------------------------------ |
+| Amend last commit | `git commit --amend -s --no-edit && git push -f` |
+
+The **DCO check** blocks merges until every commit in the PR carries the footer (with squash this is just the one).
+
+### Releasing `codex`
+
+To publish a new version of the CLI you first need to stage the npm package. A
+helper script in `codex-cli/scripts/` does all the heavy lifting. Inside the
+`codex-cli` folder run:
+
+```bash
+# Classic, JS implementation that includes small, native binaries for Linux sandboxing.
+pnpm stage-release
+
+# Optionally specify the temp directory to reuse between runs.
+RELEASE_DIR=$(mktemp -d)
+pnpm stage-release --tmp "$RELEASE_DIR"
+
+# "Fat" package that additionally bundles the native Rust CLI binaries for
+# Linux. End-users can then opt-in at runtime by setting CODEX_RUST=1.
+pnpm stage-release --native
+```
+
+Go to the folder where the release is staged and verify that it works as intended. If so, run the following from the temp folder:
+
+```
+cd "$RELEASE_DIR"
+npm publish
+```
+
+### Alternative build options
+
+#### Nix flake development
+
+Prerequisite: Nix >= 2.4 with flakes enabled (`experimental-features = nix-command flakes` in `~/.config/nix/nix.conf`).
+
+Enter a Nix development shell:
+
+```bash
+# Use either one of the commands according to which implementation you want to work with
+nix develop .#codex-cli # For entering codex-cli specific shell
+nix develop .#codex-rs # For entering codex-rs specific shell
+```
+
+This shell includes Node.js, installs dependencies, builds the CLI, and provides a `codex` command alias.
+
+Build and run the CLI directly:
+
+```bash
+# Use either one of the commands according to which implementation you want to work with
+nix build .#codex-cli # For building codex-cli
+nix build .#codex-rs # For building codex-rs
+./result/bin/codex --help
+```
+
+Run the CLI via the flake app:
+
+```bash
+# Use either one of the commands according to which implementation you want to work with
+nix run .#codex-cli # For running codex-cli
+nix run .#codex-rs # For running codex-rs
+```
+
+Use direnv with flakes
+
+If you have direnv installed, you can use the following `.envrc` to automatically enter the Nix shell when you `cd` into the project directory:
+
+```bash
+cd codex-rs
+echo "use flake ../flake.nix#codex-cli" >> .envrc && direnv allow
+cd codex-cli
+echo "use flake ../flake.nix#codex-rs" >> .envrc && direnv allow
+```
+
+---
+
+## Security & responsible AI
+
+Have you discovered a vulnerability or have concerns about model output? Please e-mail **security@openai.com** and we will respond promptly.
+
+---
+
+## License
+
+This repository is licensed under the [Apache-2.0 License](LICENSE).

codex-cli/bin/codex.js

@@ -15,7 +15,6 @@
  *      current platform / architecture, an error is thrown.
  */
 
-import { spawnSync } from "child_process";
 import fs from "fs";
 import path from "path";
 import { fileURLToPath, pathToFileURL } from "url";
@@ -35,18 +34,19 @@ const wantsNative = fs.existsSync(path.join(__dirname, "use-native")) ||
     : false);
 
 // Try native binary if requested.
-if (wantsNative) {
+if (wantsNative && process.platform !== 'win32') {
   const { platform, arch } = process;
 
   let targetTriple = null;
   switch (platform) {
     case "linux":
+    case "android":
       switch (arch) {
         case "x64":
           targetTriple = "x86_64-unknown-linux-musl";
           break;
         case "arm64":
-          targetTriple = "aarch64-unknown-linux-gnu";
+          targetTriple = "aarch64-unknown-linux-musl";
           break;
         default:
           break;
@@ -73,22 +73,76 @@ if (wantsNative) {
   }
 
   const binaryPath = path.join(__dirname, "..", "bin", `codex-${targetTriple}`);
-  const result = spawnSync(binaryPath, process.argv.slice(2), {
+
+  // Use an asynchronous spawn instead of spawnSync so that Node is able to
+  // respond to signals (e.g. Ctrl-C / SIGINT) while the native binary is
+  // executing. This allows us to forward those signals to the child process
+  // and guarantees that when either the child terminates or the parent
+  // receives a fatal signal, both processes exit in a predictable manner.
+  const { spawn } = await import("child_process");
+
+  const child = spawn(binaryPath, process.argv.slice(2), {
     stdio: "inherit",
   });
 
-  const exitCode = typeof result.status === "number" ? result.status : 1;
-  process.exit(exitCode);
-}
+  child.on("error", (err) => {
+    // Typically triggered when the binary is missing or not executable.
+    // Re-throwing here will terminate the parent with a non-zero exit code
+    // while still printing a helpful stack trace.
+    // eslint-disable-next-line no-console
+    console.error(err);
+    process.exit(1);
+  });
 
-// Fallback: execute the original JavaScript CLI.
+  // Forward common termination signals to the child so that it shuts down
+  // gracefully. In the handler we temporarily disable the default behavior of
+  // exiting immediately; once the child has been signaled we simply wait for
+  // its exit event which will in turn terminate the parent (see below).
+  const forwardSignal = (signal) => {
+    if (child.killed) {
+      return;
+    }
+    try {
+      child.kill(signal);
+    } catch {
+      /* ignore */
+    }
+  };
 
-// Resolve the path to the compiled CLI bundle
-const cliPath = path.resolve(__dirname, "../dist/cli.js");
-const cliUrl = pathToFileURL(cliPath).href;
+  ["SIGINT", "SIGTERM", "SIGHUP"].forEach((sig) => {
+    process.on(sig, () => forwardSignal(sig));
+  });
 
-// Load and execute the CLI
-(async () => {
+  // When the child exits, mirror its termination reason in the parent so that
+  // shell scripts and other tooling observe the correct exit status.
+  // Wrap the lifetime of the child process in a Promise so that we can await
+  // its termination in a structured way. The Promise resolves with an object
+  // describing how the child exited: either via exit code or due to a signal.
+  const childResult = await new Promise((resolve) => {
+    child.on("exit", (code, signal) => {
+      if (signal) {
+        resolve({ type: "signal", signal });
+      } else {
+        resolve({ type: "code", exitCode: code ?? 1 });
+      }
+    });
+  });
+
+  if (childResult.type === "signal") {
+    // Re-emit the same signal so that the parent terminates with the expected
+    // semantics (this also sets the correct exit code of 128 + n).
+    process.kill(process.pid, childResult.signal);
+  } else {
+    process.exit(childResult.exitCode);
+  }
+} else {
+  // Fallback: execute the original JavaScript CLI.
+
+  // Resolve the path to the compiled CLI bundle
+  const cliPath = path.resolve(__dirname, "../dist/cli.js");
+  const cliUrl = pathToFileURL(cliPath).href;
+
+  // Load and execute the CLI
   try {
     await import(cliUrl);
   } catch (err) {
@@ -96,4 +150,4 @@ const cliUrl = pathToFileURL(cliPath).href;
     console.error(err);
     process.exit(1);
   }
-})();
+}

codex-cli/package.json

@@ -84,6 +84,6 @@
   },
   "repository": {
     "type": "git",
-    "url": "https://github.com/openai/codex"
+    "url": "git+https://github.com/openai/codex.git"
   }
 }

codex-cli/scripts/README.md

@@ -0,0 +1,9 @@
+# npm releases
+
+Run the following:
+
+To build the 0.2.x or later version of the npm module, which runs the Rust version of the CLI, build it as follows:
+
+```bash
+./codex-cli/scripts/stage_rust_release.py --release-version 0.6.0
+```

codex-cli/scripts/install_native_deps.sh

@@ -8,7 +8,7 @@
 # the native implementation when users set CODEX_RUST=1.
 #
 # Usage
-#   install_native_deps.sh [RELEASE_ROOT] [--full-native]
+#   install_native_deps.sh [--full-native] [--workflow-url URL] [CODEX_CLI_ROOT]
 #
 # The optional RELEASE_ROOT is the path that contains package.json.  Omitting
 # it installs the binaries into the repository's own bin/ folder to support
@@ -20,32 +20,43 @@ set -euo pipefail
 # Parse arguments
 # ------------------
 
-DEST_DIR=""
+CODEX_CLI_ROOT=""
 INCLUDE_RUST=0
 
-for arg in "$@"; do
-  case "$arg" in
+# Until we start publishing stable GitHub releases, we have to grab the binaries
+# from the GitHub Action that created them. Update the URL below to point to the
+# appropriate workflow run:
+WORKFLOW_URL="https://github.com/openai/codex/actions/runs/15981617627"
+
+while [[ $# -gt 0 ]]; do
+  case "$1" in
     --full-native)
       INCLUDE_RUST=1
       ;;
+    --workflow-url)
+      shift || { echo "--workflow-url requires an argument"; exit 1; }
+      if [ -n "$1" ]; then
+        WORKFLOW_URL="$1"
+      fi
+      ;;
     *)
-      if [[ -z "$DEST_DIR" ]]; then
-        DEST_DIR="$arg"
+      if [[ -z "$CODEX_CLI_ROOT" ]]; then
+        CODEX_CLI_ROOT="$1"
       else
-        echo "Unexpected argument: $arg" >&2
+        echo "Unexpected argument: $1" >&2
         exit 1
       fi
       ;;
   esac
+  shift
 done
 
 # ----------------------------------------------------------------------------
 # Determine where the binaries should be installed.
 # ----------------------------------------------------------------------------
 
-if [[ $# -gt 0 ]]; then
+if [ -n "$CODEX_CLI_ROOT" ]; then
   # The caller supplied a release root directory.
-  CODEX_CLI_ROOT="$1"
   BIN_DIR="$CODEX_CLI_ROOT/bin"
 else
   # No argument; fall back to the repo’s own bin directory.
@@ -62,10 +73,6 @@ mkdir -p "$BIN_DIR"
 # Download and decompress the artifacts from the GitHub Actions workflow.
 # ----------------------------------------------------------------------------
 
-# Until we start publishing stable GitHub releases, we have to grab the binaries
-# from the GitHub Action that created them. Update the URL below to point to the
-# appropriate workflow run:
-WORKFLOW_URL="https://github.com/openai/codex/actions/runs/15334411824"
 WORKFLOW_ID="${WORKFLOW_URL##*/}"
 
 ARTIFACTS_DIR="$(mktemp -d)"
@@ -78,7 +85,7 @@ gh run download --dir "$ARTIFACTS_DIR" --repo openai/codex "$WORKFLOW_ID"
 zstd -d "$ARTIFACTS_DIR/x86_64-unknown-linux-musl/codex-linux-sandbox-x86_64-unknown-linux-musl.zst" \
      -o "$BIN_DIR/codex-linux-sandbox-x64"
 
-zstd -d "$ARTIFACTS_DIR/aarch64-unknown-linux-gnu/codex-linux-sandbox-aarch64-unknown-linux-gnu.zst" \
+zstd -d "$ARTIFACTS_DIR/aarch64-unknown-linux-musl/codex-linux-sandbox-aarch64-unknown-linux-musl.zst" \
      -o "$BIN_DIR/codex-linux-sandbox-arm64"
 
 if [[ "$INCLUDE_RUST" -eq 1 ]]; then
@@ -86,8 +93,8 @@ if [[ "$INCLUDE_RUST" -eq 1 ]]; then
   zstd -d "$ARTIFACTS_DIR/x86_64-unknown-linux-musl/codex-x86_64-unknown-linux-musl.zst" \
       -o "$BIN_DIR/codex-x86_64-unknown-linux-musl"
   # ARM64 Linux
-  zstd -d "$ARTIFACTS_DIR/aarch64-unknown-linux-gnu/codex-aarch64-unknown-linux-gnu.zst" \
-      -o "$BIN_DIR/codex-aarch64-unknown-linux-gnu"
+  zstd -d "$ARTIFACTS_DIR/aarch64-unknown-linux-musl/codex-aarch64-unknown-linux-musl.zst" \
+      -o "$BIN_DIR/codex-aarch64-unknown-linux-musl"
   # x64 macOS
   zstd -d "$ARTIFACTS_DIR/x86_64-apple-darwin/codex-x86_64-apple-darwin.zst" \
       -o "$BIN_DIR/codex-x86_64-apple-darwin"

codex-cli/scripts/stage_release.sh

@@ -4,10 +4,7 @@
 # -----------------------------------------------------------------------------
 # Stages an npm release for @openai/codex.
 #
-# The script used to accept a single optional positional argument that indicated
-# the temporary directory in which to stage the package.  We now support a
-# flag-based interface so that we can extend the command with further options
-# without breaking the call-site contract.
+# Usage:
 #
 #   --tmp <dir>  : Use <dir> instead of a freshly created temp directory.
 #   --native     : Bundle the pre-built Rust CLI binaries for Linux alongside
@@ -17,7 +14,7 @@
 # When --native is supplied we copy the linux-sandbox binaries (as before) and
 # additionally fetch / unpack the two Rust targets that we currently support:
 #   - x86_64-unknown-linux-musl
-#   - aarch64-unknown-linux-gnu
+#   - aarch64-unknown-linux-musl
 #
 # NOTE: This script is intended to be run from the repository root via
 #       `pnpm --filter codex-cli stage-release ...` or inside codex-cli with the
@@ -30,11 +27,12 @@ set -euo pipefail
 
 usage() {
   cat <<EOF
-Usage: $(basename "$0") [--tmp DIR] [--native]
+Usage: $(basename "$0") [--tmp DIR] [--native] [--version VERSION]
 
 Options
   --tmp DIR   Use DIR to stage the release (defaults to a fresh mktemp dir)
   --native    Bundle Rust binaries for Linux (fat package)
+  --version   Specify the version to release (defaults to a timestamp-based version)
   -h, --help  Show this help
 
 Legacy positional argument: the first non-flag argument is still interpreted
@@ -45,6 +43,9 @@ EOF
 
 TMPDIR=""
 INCLUDE_NATIVE=0
+# Default to a timestamp-based version (keep same scheme as before)
+VERSION="$(printf '0.1.%d' "$(date +%y%m%d%H%M)")"
+WORKFLOW_URL=""
 
 # Manual flag parser - Bash getopts does not handle GNU long options well.
 while [[ $# -gt 0 ]]; do
@@ -59,6 +60,14 @@ while [[ $# -gt 0 ]]; do
     --native)
       INCLUDE_NATIVE=1
       ;;
+    --version)
+      shift || { echo "--version requires an argument"; usage 1; }
+      VERSION="$1"
+      ;;
+    --workflow-url)
+      shift || { echo "--workflow-url requires an argument"; exit 1; }
+      WORKFLOW_URL="$1"
+      ;;
     -h|--help)
       usage 0
       ;;
@@ -108,9 +117,6 @@ cp -r dist "$TMPDIR/dist"
 cp -r src "$TMPDIR/src" # keep source for TS sourcemaps
 cp ../README.md "$TMPDIR" || true # README is one level up - ignore if missing
 
-# Derive a timestamp-based version (keep same scheme as before)
-VERSION="$(printf '0.1.%d' "$(date +%y%m%d%H%M)")"
-
 # Modify package.json - bump version and optionally add the native directory to
 # the files array so that the binaries are published to npm.
 
@@ -121,7 +127,7 @@ jq --arg version "$VERSION" \
 # 2. Native runtime deps (sandbox plus optional Rust binaries)
 
 if [[ "$INCLUDE_NATIVE" -eq 1 ]]; then
-  ./scripts/install_native_deps.sh "$TMPDIR" --full-native
+  ./scripts/install_native_deps.sh --full-native --workflow-url "$WORKFLOW_URL" "$TMPDIR"
   touch "${TMPDIR}/bin/use-native"
 else
   ./scripts/install_native_deps.sh "$TMPDIR"
@@ -132,7 +138,8 @@ popd >/dev/null
 echo "Staged version $VERSION for release in $TMPDIR"
 
 if [[ "$INCLUDE_NATIVE" -eq 1 ]]; then
-  echo "Test Rust:"
+  echo "Verify the CLI:"
+  echo "    node ${TMPDIR}/bin/codex.js --version"
   echo "    node ${TMPDIR}/bin/codex.js --help"
 else
   echo "Test Node:"

codex-cli/scripts/stage_rust_release.py

@@ -0,0 +1,62 @@
+#!/usr/bin/env python3
+
+import json
+import subprocess
+import sys
+import argparse
+from pathlib import Path
+
+
+def main() -> int:
+    parser = argparse.ArgumentParser(
+        description="""Stage a release for the npm module.
+
+Run this after the GitHub Release has been created and use
+`--release-version` to specify the version to release.
+"""
+    )
+    parser.add_argument(
+        "--release-version", required=True, help="Version to release, e.g., 0.3.0"
+    )
+    args = parser.parse_args()
+    version = args.release_version
+
+    gh_run = subprocess.run(
+        [
+            "gh",
+            "run",
+            "list",
+            "--branch",
+            f"rust-v{version}",
+            "--json",
+            "workflowName,url,headSha",
+            "--jq",
+            'first(.[] | select(.workflowName == "rust-release"))',
+        ],
+        stdout=subprocess.PIPE,
+        check=True,
+    )
+    gh_run.check_returncode()
+    workflow = json.loads(gh_run.stdout)
+    sha = workflow["headSha"]
+
+    print(f"should `git checkout {sha}`")
+
+    current_dir = Path(__file__).parent.resolve()
+    stage_release = subprocess.run(
+        [
+            current_dir / "stage_release.sh",
+            "--version",
+            version,
+            "--workflow-url",
+            workflow["url"],
+            "--native",
+        ]
+    )
+    stage_release.check_returncode()
+
+    return 0
+
+
+if __name__ == "__main__":
+    sys.exit(main())

codex-cli/src/approvals.ts

@@ -370,11 +370,26 @@ export function isSafeCommand(
         reason: "View file with line numbers",
         group: "Reading files",
       };
-    case "rg":
+    case "rg": {
+      // Certain ripgrep options execute external commands or invoke other
+      // processes, so we must reject them.
+      const isUnsafe = command.some(
+        (arg: string) =>
+          UNSAFE_OPTIONS_FOR_RIPGREP_WITHOUT_ARGS.has(arg) ||
+          [...UNSAFE_OPTIONS_FOR_RIPGREP_WITH_ARGS].some(
+            (opt) => arg === opt || arg.startsWith(`${opt}=`),
+          ),
+      );
+
+      if (isUnsafe) {
+        break;
+      }
+
       return {
         reason: "Ripgrep search",
         group: "Searching",
       };
+    }
     case "find": {
       // Certain options to `find` allow executing arbitrary processes, so we
       // cannot auto-approve them.
@@ -495,6 +510,22 @@ const UNSAFE_OPTIONS_FOR_FIND_COMMAND: ReadonlySet<string> = new Set([
   "-fprintf",
 ]);
 
+// Ripgrep options that are considered unsafe because they may execute
+// arbitrary commands or spawn auxiliary processes.
+const UNSAFE_OPTIONS_FOR_RIPGREP_WITH_ARGS: ReadonlySet<string> = new Set([
+  // Executes an arbitrary command for each matching file.
+  "--pre",
+  // Allows custom hostname command which could leak environment details.
+  "--hostname-bin",
+]);
+
+const UNSAFE_OPTIONS_FOR_RIPGREP_WITHOUT_ARGS: ReadonlySet<string> = new Set([
+  // Enables searching inside archives which triggers external decompression
+  // utilities – reject out of an abundance of caution.
+  "--search-zip",
+  "-z",
+]);
+
 // ---------------- Helper utilities for complex shell expressions -----------------
 
 // A conservative allow-list of bash operators that do not, on their own, cause

codex-cli/src/cli.tsx

@@ -45,6 +45,7 @@ import { createInputItem } from "./utils/input-utils";
 import { initLogger } from "./utils/logger/log";
 import { isModelSupportedForResponses } from "./utils/model-utils.js";
 import { parseToolCall } from "./utils/parsers";
+import { providers } from "./utils/providers";
 import { onExit, setInkRenderer } from "./utils/terminal";
 import chalk from "chalk";
 import { spawnSync } from "child_process";
@@ -327,26 +328,44 @@ try {
   // ignore errors
 }
 
-if (cli.flags.login) {
-  apiKey = await fetchApiKey(client.issuer, client.client_id);
-  try {
-    const home = os.homedir();
-    const authDir = path.join(home, ".codex");
-    const authFile = path.join(authDir, "auth.json");
-    if (fs.existsSync(authFile)) {
-      const data = JSON.parse(fs.readFileSync(authFile, "utf-8"));
-      savedTokens = data.tokens;
+// Get provider-specific API key if not OpenAI
+if (provider.toLowerCase() !== "openai") {
+  const providerInfo = providers[provider.toLowerCase()];
+  if (providerInfo) {
+    const providerApiKey = process.env[providerInfo.envKey];
+    if (providerApiKey) {
+      apiKey = providerApiKey;
     }
-  } catch {
-    /* ignore */
   }
-} else if (!apiKey) {
-  apiKey = await fetchApiKey(client.issuer, client.client_id);
 }
+
+// Only proceed with OpenAI auth flow if:
+// 1. Provider is OpenAI and no API key is set, or
+// 2. Login flag is explicitly set
+if (provider.toLowerCase() === "openai" && !apiKey) {
+  if (cli.flags.login) {
+    apiKey = await fetchApiKey(client.issuer, client.client_id);
+    try {
+      const home = os.homedir();
+      const authDir = path.join(home, ".codex");
+      const authFile = path.join(authDir, "auth.json");
+      if (fs.existsSync(authFile)) {
+        const data = JSON.parse(fs.readFileSync(authFile, "utf-8"));
+        savedTokens = data.tokens;
+      }
+    } catch {
+      /* ignore */
+    }
+  } else {
+    apiKey = await fetchApiKey(client.issuer, client.client_id);
+  }
+}
+
 // Ensure the API key is available as an environment variable for legacy code
 process.env["OPENAI_API_KEY"] = apiKey;
 
-if (cli.flags.free) {
+// Only attempt credit redemption for OpenAI provider
+if (cli.flags.free && provider.toLowerCase() === "openai") {
   // eslint-disable-next-line no-console
   console.log(`${chalk.bold("codex --free")} attempting to redeem credits...`);
   if (!savedTokens?.refresh_token) {
@@ -379,13 +398,18 @@ if (!apiKey && !NO_API_KEY_REQUIRED.has(provider.toLowerCase())) {
           ? `You can create a key here: ${chalk.bold(
               chalk.underline("https://platform.openai.com/account/api-keys"),
             )}\n`
-          : provider.toLowerCase() === "gemini"
+          : provider.toLowerCase() === "azure"
             ? `You can create a ${chalk.bold(
-                `${provider.toUpperCase()}_API_KEY`,
-              )} ` + `in the ${chalk.bold(`Google AI Studio`)}.\n`
-            : `You can create a ${chalk.bold(
-                `${provider.toUpperCase()}_API_KEY`,
-              )} ` + `in the ${chalk.bold(`${provider}`)} dashboard.\n`
+                `${provider.toUpperCase()}_OPENAI_API_KEY`,
+              )} ` +
+              `in Azure AI Foundry portal at ${chalk.bold(chalk.underline("https://ai.azure.com"))}.\n`
+            : provider.toLowerCase() === "gemini"
+              ? `You can create a ${chalk.bold(
+                  `${provider.toUpperCase()}_API_KEY`,
+                )} ` + `in the ${chalk.bold(`Google AI Studio`)}.\n`
+              : `You can create a ${chalk.bold(
+                  `${provider.toUpperCase()}_API_KEY`,
+                )} ` + `in the ${chalk.bold(`${provider}`)} dashboard.\n`
       }`,
   );
   process.exit(1);

codex-cli/src/utils/agent/agent-loop.ts

@@ -800,7 +800,8 @@ export class AgentLoop {
 
             const responseCall =
               !this.config.provider ||
-              this.config.provider?.toLowerCase() === "openai"
+              this.config.provider?.toLowerCase() === "openai" ||
+              this.config.provider?.toLowerCase() === "azure"
                 ? (params: ResponseCreateParams) =>
                     this.oai.responses.create(params)
                 : (params: ResponseCreateParams) =>
@@ -1188,7 +1189,8 @@ export class AgentLoop {
 
               const responseCall =
                 !this.config.provider ||
-                this.config.provider?.toLowerCase() === "openai"
+                this.config.provider?.toLowerCase() === "openai" ||
+                this.config.provider?.toLowerCase() === "azure"
                   ? (params: ResponseCreateParams) =>
                       this.oai.responses.create(params)
                   : (params: ResponseCreateParams) =>

codex-cli/src/utils/config.ts

@@ -69,7 +69,7 @@ export const OPENAI_BASE_URL = process.env["OPENAI_BASE_URL"] || "";
 export let OPENAI_API_KEY = process.env["OPENAI_API_KEY"] || "";
 
 export const AZURE_OPENAI_API_VERSION =
-  process.env["AZURE_OPENAI_API_VERSION"] || "2025-03-01-preview";
+  process.env["AZURE_OPENAI_API_VERSION"] || "2025-04-01-preview";
 
 export const DEFAULT_REASONING_EFFORT = "high";
 export const OPENAI_ORGANIZATION = process.env["OPENAI_ORGANIZATION"] || "";

codex-cli/src/utils/get-api-key.tsx

@@ -382,6 +382,8 @@ async function handleCallback(
 
   const exchanged = (await exchangeRes.json()) as {
     access_token: string;
+    // NOTE(mbolin): I did not see the "key" property set in practice. Note
+    // this property is not read by the code.
     key: string;
   };
 

codex-cli/tests/agent-azure-responses-endpoint.test.ts

@@ -0,0 +1,107 @@
+/**
+ * tests/agent-azure-responses-endpoint.test.ts
+ *
+ * Verifies that AgentLoop calls the `/responses` endpoint when provider is set to Azure.
+ */
+
+import { describe, it, expect, vi, beforeEach } from "vitest";
+
+// Fake stream that yields a completed response event
+class FakeStream {
+  async *[Symbol.asyncIterator]() {
+    yield {
+      type: "response.completed",
+      response: { id: "azure_resp", status: "completed", output: [] },
+    } as any;
+  }
+}
+
+let lastCreateParams: any = null;
+
+vi.mock("openai", () => {
+  class FakeDefaultClient {
+    public responses = {
+      create: async (params: any) => {
+        lastCreateParams = params;
+        return new FakeStream();
+      },
+    };
+  }
+  class FakeAzureClient {
+    public responses = {
+      create: async (params: any) => {
+        lastCreateParams = params;
+        return new FakeStream();
+      },
+    };
+  }
+  class APIConnectionTimeoutError extends Error {}
+  return {
+    __esModule: true,
+    default: FakeDefaultClient,
+    AzureOpenAI: FakeAzureClient,
+    APIConnectionTimeoutError,
+  };
+});
+
+// Stub approvals to bypass command approval logic
+vi.mock("../src/approvals.js", () => ({
+  __esModule: true,
+  alwaysApprovedCommands: new Set<string>(),
+  canAutoApprove: () => ({ type: "auto-approve", runInSandbox: false }),
+  isSafeCommand: () => null,
+}));
+
+// Stub format-command to avoid formatting side effects
+vi.mock("../src/format-command.js", () => ({
+  __esModule: true,
+  formatCommandForDisplay: (cmd: Array<string>) => cmd.join(" "),
+}));
+
+// Stub internal logging to keep output clean
+vi.mock("../src/utils/agent/log.js", () => ({
+  __esModule: true,
+  log: () => {},
+  isLoggingEnabled: () => false,
+}));
+
+import { AgentLoop } from "../src/utils/agent/agent-loop.js";
+
+describe("AgentLoop Azure provider responses endpoint", () => {
+  beforeEach(() => {
+    lastCreateParams = null;
+  });
+
+  it("calls the /responses endpoint when provider is azure", async () => {
+    const cfg: any = {
+      model: "test-model",
+      provider: "azure",
+      instructions: "",
+      disableResponseStorage: false,
+      notify: false,
+    };
+    const loop = new AgentLoop({
+      additionalWritableRoots: [],
+      model: cfg.model,
+      config: cfg,
+      instructions: cfg.instructions,
+      approvalPolicy: { mode: "suggest" } as any,
+      onItem: () => {},
+      onLoading: () => {},
+      getCommandConfirmation: async () => ({ review: "yes" }) as any,
+      onLastResponseId: () => {},
+    });
+
+    await loop.run([
+      {
+        type: "message",
+        role: "user",
+        content: [{ type: "input_text", text: "hello" }],
+      },
+    ]);
+
+    expect(lastCreateParams).not.toBeNull();
+    expect(lastCreateParams.model).toBe(cfg.model);
+    expect(Array.isArray(lastCreateParams.input)).toBe(true);
+  });
+});

codex-cli/tests/approvals.test.ts

@@ -44,6 +44,14 @@ describe("canAutoApprove()", () => {
       group: "Navigating",
       runInSandbox: false,
     });
+
+    // Ripgrep safe invocation.
+    expect(check(["rg", "TODO"])).toEqual({
+      type: "auto-approve",
+      reason: "Ripgrep search",
+      group: "Searching",
+      runInSandbox: false,
+    });
   });
 
   test("simple safe commands within a `bash -lc` call", () => {
@@ -67,6 +75,24 @@ describe("canAutoApprove()", () => {
     });
   });
 
+  test("ripgrep unsafe flags", () => {
+    // Flags that do not take arguments
+    expect(check(["rg", "--search-zip", "TODO"])).toEqual({ type: "ask-user" });
+    expect(check(["rg", "-z", "TODO"])).toEqual({ type: "ask-user" });
+
+    // Flags that take arguments (provided separately)
+    expect(check(["rg", "--pre", "cat", "TODO"])).toEqual({ type: "ask-user" });
+    expect(check(["rg", "--hostname-bin", "hostname", "TODO"])).toEqual({
+      type: "ask-user",
+    });
+
+    // Flags that take arguments in = form
+    expect(check(["rg", "--pre=cat", "TODO"])).toEqual({ type: "ask-user" });
+    expect(check(["rg", "--hostname-bin=hostname", "TODO"])).toEqual({
+      type: "ask-user",
+    });
+  });
+
   test("bash -lc commands with unsafe redirects", () => {
     expect(check(["bash", "-lc", "echo hello > file.txt"])).toEqual({
       type: "ask-user",

codex-rs/.gitignore

@@ -1 +1,7 @@
 /target/
+
+# Recommended value of CARGO_TARGET_DIR when using Docker as explained in .devcontainer/README.md.
+/target-amd64/
+
+# Value of CARGO_TARGET_DIR when using .devcontainer/devcontainer.json.
+/target-arm64/

codex-rs/Cargo.toml

@@ -1,19 +1,22 @@
 [workspace]
-resolver = "2"
 members = [
     "ansi-escape",
     "apply-patch",
+    "arg0",
     "cli",
     "common",
     "core",
     "exec",
     "execpolicy",
+    "file-search",
     "linux-sandbox",
+    "login",
     "mcp-client",
     "mcp-server",
     "mcp-types",
     "tui",
 ]
+resolver = "2"
 
 [workspace.package]
 version = "0.0.0"
@@ -35,3 +38,10 @@ lto = "fat"
 # Because we bundle some of these executables with the TypeScript CLI, we
 # remove everything to make the binary as small as possible.
 strip = "symbols"
+
+# See https://github.com/openai/codex/issues/1411 for details.
+codegen-units = 1
+
+[patch.crates-io]
+# ratatui = { path = "../../ratatui" }
+ratatui = { git = "https://github.com/nornagon/ratatui", branch = "nornagon-v0.29.0-patch" }

codex-rs/README.md

@@ -1,16 +1,90 @@
-# codex-rs
+# Codex CLI (Rust Implementation)
 
-April 24, 2025
+We provide Codex CLI as a standalone, native executable to ensure a zero-dependency install.
 
-Today, Codex CLI is written in TypeScript and requires Node.js 22+ to run it. For a number of users, this runtime requirement inhibits adoption: they would be better served by a standalone executable. As maintainers, we want Codex to run efficiently in a wide range of environments with minimal overhead. We also want to take advantage of operating system-specific APIs to provide better sandboxing, where possible.
+## Installing Codex
 
-To that end, we are moving forward with a Rust implementation of Codex CLI contained in this folder, which has the following benefits:
+Today, the easiest way to install Codex is via `npm`, though we plan to publish Codex to other package managers soon.
 
-- The CLI compiles to small, standalone, platform-specific binaries.
-- Can make direct, native calls to [seccomp](https://man7.org/linux/man-pages/man2/seccomp.2.html) and [landlock](https://man7.org/linux/man-pages/man7/landlock.7.html) in order to support sandboxing on Linux.
-- No runtime garbage collection, resulting in lower memory consumption and better, more predictable performance.
+```shell
+npm i -g @openai/codex@native
+codex
+```
 
-Currently, the Rust implementation is materially behind the TypeScript implementation in functionality, so continue to use the TypeScript implementation for the time being. We will publish native executables via GitHub Releases as soon as we feel the Rust version is usable.
+You can also download a platform-specific release directly from our [GitHub Releases](https://github.com/openai/codex/releases).
+
+## What's new in the Rust CLI
+
+While we are [working to close the gap between the TypeScript and Rust implementations of Codex CLI](https://github.com/openai/codex/issues/1262), note that the Rust CLI has a number of features that the TypeScript CLI does not!
+
+### Config
+
+Codex supports a rich set of configuration options. Note that the Rust CLI uses `config.toml` instead of `config.json`. See [`config.md`](./config.md) for details.
+
+### Model Context Protocol Support
+
+Codex CLI functions as an MCP client that can connect to MCP servers on startup. See the [`mcp_servers`](./config.md#mcp_servers) section in the configuration documentation for details.
+
+It is still experimental, but you can also launch Codex as an MCP _server_ by running `codex mcp`. Use the [`@modelcontextprotocol/inspector`](https://github.com/modelcontextprotocol/inspector) to try it out:
+
+```shell
+npx @modelcontextprotocol/inspector codex mcp
+```
+
+### Notifications
+
+You can enable notifications by configuring a script that is run whenever the agent finishes a turn. The [notify documentation](./config.md#notify) includes a detailed example that explains how to get desktop notifications via [terminal-notifier](https://github.com/julienXX/terminal-notifier) on macOS.
+
+### `codex exec` to run Codex programmatially/non-interactively
+
+To run Codex non-interactively, run `codex exec PROMPT` (you can also pass the prompt via `stdin`) and Codex will work on your task until it decides that it is done and exits. Output is printed to the terminal directly. You can set the `RUST_LOG` environment variable to see more about what's going on.
+
+### Use `@` for file search
+
+Typing `@` triggers a fuzzy-filename search over the workspace root. Use up/down to select among the results and Tab or Enter to replace the `@` with the selected path. You can use Esc to cancel the search.
+
+### `--cd`/`-C` flag
+
+Sometimes it is not convenient to `cd` to the directory you want Codex to use as the "working root" before running Codex. Fortunately, `codex` supports a `--cd` option so you can specify whatever folder you want. You can confirm that Codex is honoring `--cd` by double-checking the **workdir** it reports in the TUI at the start of a new session.
+
+### Shell completions
+
+Generate shell completion scripts via:
+
+```shell
+codex completion bash
+codex completion zsh
+codex completion fish
+```
+
+### Experimenting with the Codex Sandbox
+
+To test to see what happens when a command is run under the sandbox provided by Codex, we provide the following subcommands in Codex CLI:
+
+```
+# macOS
+codex debug seatbelt [--full-auto] [COMMAND]...
+
+# Linux
+codex debug landlock [--full-auto] [COMMAND]...
+```
+
+### Selecting a sandbox policy via `--sandbox`
+
+The Rust CLI exposes a dedicated `--sandbox` (`-s`) flag that lets you pick the sandbox policy **without** having to reach for the generic `-c/--config` option:
+
+```shell
+# Run Codex with the default, read-only sandbox
+codex --sandbox read-only
+
+# Allow the agent to write within the current workspace while still blocking network access
+codex --sandbox workspace-write
+
+# Danger! Disable sandboxing entirely (only do this if you are already running in a container or other isolated env)
+codex --sandbox danger-full-access
+```
+
+The same setting can be persisted in `~/.codex/config.toml` via the top-level `sandbox_mode = "MODE"` key, e.g. `sandbox_mode = "workspace-write"`.
 
 ## Code Organization
 
@@ -20,373 +94,3 @@ This folder is the root of a Cargo workspace. It contains quite a bit of experim
 - [`exec/`](./exec) "headless" CLI for use in automation.
 - [`tui/`](./tui) CLI that launches a fullscreen TUI built with [Ratatui](https://ratatui.rs/).
 - [`cli/`](./cli) CLI multitool that provides the aforementioned CLIs via subcommands.
-
-## Config
-
-The CLI can be configured via a file named `config.toml`. By default, configuration is read from `~/.codex/config.toml`, though the `CODEX_HOME` environment variable can be used to specify a directory other than `~/.codex`.
-
-The `config.toml` file supports the following options:
-
-### model
-
-The model that Codex should use.
-
-```toml
-model = "o3"  # overrides the default of "o4-mini"
-```
-
-### model_provider
-
-Codex comes bundled with a number of "model providers" predefined. This config value is a string that indicates which provider to use. You can also define your own providers via `model_providers`.
-
-For example, if you are running ollama with Mistral locally, then you would need to add the following to your config:
-
-```toml
-model = "mistral"
-model_provider = "ollama"
-```
-
-because the following definition for `ollama` is included in Codex:
-
-```toml
-[model_providers.ollama]
-name = "Ollama"
-base_url = "http://localhost:11434/v1"
-wire_api = "chat"
-```
-
-This option defaults to `"openai"` and the corresponding provider is defined as follows:
-
-```toml
-[model_providers.openai]
-name = "OpenAI"
-base_url = "https://api.openai.com/v1"
-env_key = "OPENAI_API_KEY"
-wire_api = "responses"
-```
-
-### model_providers
-
-This option lets you override and amend the default set of model providers bundled with Codex. This value is a map where the key is the value to use with `model_provider` to select the correspodning provider.
-
-For example, if you wanted to add a provider that uses the OpenAI 4o model via the chat completions API, then you
-
-```toml
-# Recall that in TOML, root keys must be listed before tables.
-model = "gpt-4o"
-model_provider = "openai-chat-completions"
-
-[model_providers.openai-chat-completions]
-# Name of the provider that will be displayed in the Codex UI.
-name = "OpenAI using Chat Completions"
-# The path `/chat/completions` will be amended to this URL to make the POST
-# request for the chat completions.
-base_url = "https://api.openai.com/v1"
-# If `env_key` is set, identifies an environment variable that must be set when
-# using Codex with this provider. The value of the environment variable must be
-# non-empty and will be used in the `Bearer TOKEN` HTTP header for the POST request.
-env_key = "OPENAI_API_KEY"
-# valid values for wire_api are "chat" and "responses".
-wire_api = "chat"
-```
-
-### approval_policy
-
-Determines when the user should be prompted to approve whether Codex can execute a command:
-
-```toml
-# This is analogous to --suggest in the TypeScript Codex CLI
-approval_policy = "unless-allow-listed"
-```
-
-```toml
-# If the command fails when run in the sandbox, Codex asks for permission to
-# retry the command outside the sandbox.
-approval_policy = "on-failure"
-```
-
-```toml
-# User is never prompted: if the command fails, Codex will automatically try
-# something out. Note the `exec` subcommand always uses this mode.
-approval_policy = "never"
-```
-
-### profiles
-
-A _profile_ is a collection of configuration values that can be set together. Multiple profiles can be defined in `config.toml` and you can specify the one you
-want to use at runtime via the `--profile` flag.
-
-Here is an example of a `config.toml` that defines multiple profiles:
-
-```toml
-model = "o3"
-approval_policy = "unless-allow-listed"
-sandbox_permissions = ["disk-full-read-access"]
-disable_response_storage = false
-
-# Setting `profile` is equivalent to specifying `--profile o3` on the command
-# line, though the `--profile` flag can still be used to override this value.
-profile = "o3"
-
-[model_providers.openai-chat-completions]
-name = "OpenAI using Chat Completions"
-base_url = "https://api.openai.com/v1"
-env_key = "OPENAI_API_KEY"
-wire_api = "chat"
-
-[profiles.o3]
-model = "o3"
-model_provider = "openai"
-approval_policy = "never"
-
-[profiles.gpt3]
-model = "gpt-3.5-turbo"
-model_provider = "openai-chat-completions"
-
-[profiles.zdr]
-model = "o3"
-model_provider = "openai"
-approval_policy = "on-failure"
-disable_response_storage = true
-```
-
-Users can specify config values at multiple levels. Order of precedence is as follows:
-
-1. custom command-line argument, e.g., `--model o3`
-2. as part of a profile, where the `--profile` is specified via a CLI (or in the config file itself)
-3. as an entry in `config.toml`, e.g., `model = "o3"`
-4. the default value that comes with Codex CLI (i.e., Codex CLI defaults to `o4-mini`)
-
-### sandbox_permissions
-
-List of permissions to grant to the sandbox that Codex uses to execute untrusted commands:
-
-```toml
-# This is comparable to --full-auto in the TypeScript Codex CLI, though
-# specifying `disk-write-platform-global-temp-folder` adds /tmp as a writable
-# folder in addition to $TMPDIR.
-sandbox_permissions = [
-    "disk-full-read-access",
-    "disk-write-platform-user-temp-folder",
-    "disk-write-platform-global-temp-folder",
-    "disk-write-cwd",
-]
-```
-
-To add additional writable folders, use `disk-write-folder`, which takes a parameter (this can be specified multiple times):
-
-```toml
-sandbox_permissions = [
-    # ...
-    "disk-write-folder=/Users/mbolin/.pyenv/shims",
-]
-```
-
-### mcp_servers
-
-Defines the list of MCP servers that Codex can consult for tool use. Currently, only servers that are launched by executing a program that communicate over stdio are supported. For servers that use the SSE transport, consider an adapter like [mcp-proxy](https://github.com/sparfenyuk/mcp-proxy).
-
-**Note:** Codex may cache the list of tools and resources from an MCP server so that Codex can include this information in context at startup without spawning all the servers. This is designed to save resources by loading MCP servers lazily.
-
-This config option is comparable to how Claude and Cursor define `mcpServers` in their respective JSON config files, though because Codex uses TOML for its config language, the format is slightly different. For example, the following config in JSON:
-
-```json
-{
-  "mcpServers": {
-    "server-name": {
-      "command": "npx",
-      "args": ["-y", "mcp-server"],
-      "env": {
-        "API_KEY": "value"
-      }
-    }
-  }
-}
-```
-
-Should be represented as follows in `~/.codex/config.toml`:
-
-```toml
-# IMPORTANT: the top-level key is `mcp_servers` rather than `mcpServers`.
-[mcp_servers.server-name]
-command = "npx"
-args = ["-y", "mcp-server"]
-env = { "API_KEY" = "value" }
-```
-
-### disable_response_storage
-
-Currently, customers whose accounts are set to use Zero Data Retention (ZDR) must set `disable_response_storage` to `true` so that Codex uses an alternative to the Responses API that works with ZDR:
-
-```toml
-disable_response_storage = true
-```
-
-### shell_environment_policy
-
-Codex spawns subprocesses (e.g. when executing a `local_shell` tool-call suggested by the assistant). By default it passes **only a minimal core subset** of your environment to those subprocesses to avoid leaking credentials. You can tune this behavior via the **`shell_environment_policy`** block in
-`config.toml`:
-
-```toml
-[shell_environment_policy]
-# inherit can be "core" (default), "all", or "none"
-inherit = "core"
-# set to true to *skip* the filter for `"*KEY*"` and `"*TOKEN*"`
-ignore_default_excludes = false
-# exclude patterns (case-insensitive globs)
-exclude = ["AWS_*", "AZURE_*"]
-# force-set / override values
-set = { CI = "1" }
-# if provided, *only* vars matching these patterns are kept
-include_only = ["PATH", "HOME"]
-```
-
-| Field                     | Type                       | Default | Description                                                                                                                                     |
-| ------------------------- | -------------------------- | ------- | ----------------------------------------------------------------------------------------------------------------------------------------------- |
-| `inherit`                 | string                     | `core`  | Starting template for the environment:<br>`core` (`HOME`, `PATH`, `USER`, …), `all` (clone full parent env), or `none` (start empty).           |
-| `ignore_default_excludes` | boolean                    | `false` | When `false`, Codex removes any var whose **name** contains `KEY`, `SECRET`, or `TOKEN` (case-insensitive) before other rules run.              |
-| `exclude`                 | array&lt;string&gt;        | `[]`    | Case-insensitive glob patterns to drop after the default filter.<br>Examples: `"AWS_*"`, `"AZURE_*"`.                                           |
-| `set`                     | table&lt;string,string&gt; | `{}`    | Explicit key/value overrides or additions – always win over inherited values.                                                                   |
-| `include_only`            | array&lt;string&gt;        | `[]`    | If non-empty, a whitelist of patterns; only variables that match _one_ pattern survive the final step. (Generally used with `inherit = "all"`.) |
-
-The patterns are **glob style**, not full regular expressions: `*` matches any
-number of characters, `?` matches exactly one, and character classes like
-`[A-Z]`/`[^0-9]` are supported. Matching is always **case-insensitive**. This
-syntax is documented in code as `EnvironmentVariablePattern` (see
-`core/src/config_types.rs`).
-
-If you just need a clean slate with a few custom entries you can write:
-
-```toml
-[shell_environment_policy]
-inherit = "none"
-set = { PATH = "/usr/bin", MY_FLAG = "1" }
-```
-
-Currently, `CODEX_SANDBOX_NETWORK_DISABLED=1` is also added to the environment, assuming network is disabled. This is not configurable.
-
-### notify
-
-Specify a program that will be executed to get notified about events generated by Codex. Note that the program will receive the notification argument as a string of JSON, e.g.:
-
-```json
-{
-  "type": "agent-turn-complete",
-  "turn-id": "12345",
-  "input-messages": ["Rename `foo` to `bar` and update the callsites."],
-  "last-assistant-message": "Rename complete and verified `cargo build` succeeds."
-}
-```
-
-The `"type"` property will always be set. Currently, `"agent-turn-complete"` is the only notification type that is supported.
-
-As an example, here is a Python script that parses the JSON and decides whether to show a desktop push notification using [terminal-notifier](https://github.com/julienXX/terminal-notifier) on macOS:
-
-```python
-#!/usr/bin/env python3
-
-import json
-import subprocess
-import sys
-
-
-def main() -> int:
-    if len(sys.argv) != 2:
-        print("Usage: notify.py <NOTIFICATION_JSON>")
-        return 1
-
-    try:
-        notification = json.loads(sys.argv[1])
-    except json.JSONDecodeError:
-        return 1
-
-    match notification_type := notification.get("type"):
-        case "agent-turn-complete":
-            assistant_message = notification.get("last-assistant-message")
-            if assistant_message:
-                title = f"Codex: {assistant_message}"
-            else:
-                title = "Codex: Turn Complete!"
-            input_messages = notification.get("input_messages", [])
-            message = " ".join(input_messages)
-            title += message
-        case _:
-            print(f"not sending a push notification for: {notification_type}")
-            return 0
-
-    subprocess.check_output(
-        [
-            "terminal-notifier",
-            "-title",
-            title,
-            "-message",
-            message,
-            "-group",
-            "codex",
-            "-ignoreDnD",
-            "-activate",
-            "com.googlecode.iterm2",
-        ]
-    )
-
-    return 0
-
-
-if __name__ == "__main__":
-    sys.exit(main())
-```
-
-To have Codex use this script for notifications, you would configure it via `notify` in `~/.codex/config.toml` using the appropriate path to `notify.py` on your computer:
-
-```toml
-notify = ["python3", "/Users/mbolin/.codex/notify.py"]
-```
-
-### history
-
-By default, Codex CLI records messages sent to the model in `$CODEX_HOME/history.jsonl`. Note that on UNIX, the file permissions are set to `o600`, so it should only be readable and writable by the owner.
-
-To disable this behavior, configure `[history]` as follows:
-
-```toml
-[history]
-persistence = "none"  # "save-all" is the default value
-```
-
-### file_opener
-
-Identifies the editor/URI scheme to use for hyperlinking citations in model output. If set, citations to files in the model output will be hyperlinked using the specified URI scheme so they can be ctrl/cmd-clicked from the terminal to open them.
-
-For example, if the model output includes a reference such as `【F:/home/user/project/main.py†L42-L50】`, then this would be rewritten to link to the URI `vscode://file/home/user/project/main.py:42`.
-
-Note this is **not** a general editor setting (like `$EDITOR`), as it only accepts a fixed set of values:
-
-- `"vscode"` (default)
-- `"vscode-insiders"`
-- `"windsurf"`
-- `"cursor"`
-- `"none"` to explicitly disable this feature
-
-Currently, `"vscode"` is the default, though Codex does not verify VS Code is installed. As such, `file_opener` may default to `"none"` or something else in the future.
-
-### project_doc_max_bytes
-
-Maximum number of bytes to read from an `AGENTS.md` file to include in the instructions sent with the first turn of a session. Defaults to 32 KiB.
-
-### tui
-
-Options that are specific to the TUI.
-
-```toml
-[tui]
-# This will make it so that Codex does not try to process mouse events, which
-# means your Terminal's native drag-to-text to text selection and copy/paste
-# should work. The tradeoff is that Codex will not receive any mouse events, so
-# it will not be possible to use the mouse to scroll conversation history.
-#
-# Note that most terminals support holding down a modifier key when using the
-# mouse to support text selection. For example, even if Codex mouse capture is
-# enabled (i.e., this is set to `false`), you can still hold down alt while
-# dragging the mouse to select text.
-disable_mouse_capture = true  # defaults to `false`
-```

codex-rs/ansi-escape/Cargo.toml

@@ -1,7 +1,7 @@
 [package]
+edition = "2024"
 name = "codex-ansi-escape"
 version = { workspace = true }
-edition = "2024"
 
 [lib]
 name = "codex_ansi_escape"
@@ -10,7 +10,7 @@ path = "src/lib.rs"
 [dependencies]
 ansi-to-tui = "7.0.0"
 ratatui = { version = "0.29.0", features = [
-    "unstable-widget-ref",
     "unstable-rendered-line-info",
+    "unstable-widget-ref",
 ] }
 tracing = { version = "0.1.41", features = ["log"] }

codex-rs/apply-patch/Cargo.toml

@@ -1,7 +1,7 @@
 [package]
+edition = "2024"
 name = "codex-apply-patch"
 version = { workspace = true }
-edition = "2024"
 
 [lib]
 name = "codex_apply_patch"
@@ -12,12 +12,10 @@ workspace = true
 
 [dependencies]
 anyhow = "1"
-regex = "1.11.1"
-serde_json = "1.0.110"
 similar = "2.7.0"
 thiserror = "2.0.12"
-tree-sitter = "0.25.3"
-tree-sitter-bash = "0.23.3"
+tree-sitter = "0.25.8"
+tree-sitter-bash = "0.25.0"
 
 [dev-dependencies]
 pretty_assertions = "1.4.1"

codex-rs/apply-patch/apply_patch_tool_instructions.md

@@ -0,0 +1,40 @@
+To edit files, ALWAYS use the `shell` tool with `apply_patch` CLI.  `apply_patch` effectively allows you to execute a diff/patch against a file, but the format of the diff specification is unique to this task, so pay careful attention to these instructions. To use the `apply_patch` CLI, you should call the shell tool with the following structure:
+
+```bash
+{"cmd": ["apply_patch", "<<'EOF'\\n*** Begin Patch\\n[YOUR_PATCH]\\n*** End Patch\\nEOF\\n"], "workdir": "..."}
+```
+
+Where [YOUR_PATCH] is the actual content of your patch, specified in the following V4A diff format.
+
+*** [ACTION] File: [path/to/file] -> ACTION can be one of Add, Update, or Delete.
+For each snippet of code that needs to be changed, repeat the following:
+[context_before] -> See below for further instructions on context.
+- [old_code] -> Precede the old code with a minus sign.
++ [new_code] -> Precede the new, replacement code with a plus sign.
+[context_after] -> See below for further instructions on context.
+
+For instructions on [context_before] and [context_after]:
+- By default, show 3 lines of code immediately above and 3 lines immediately below each change. If a change is within 3 lines of a previous change, do NOT duplicate the first change’s [context_after] lines in the second change’s [context_before] lines.
+- If 3 lines of context is insufficient to uniquely identify the snippet of code within the file, use the @@ operator to indicate the class or function to which the snippet belongs. For instance, we might have:
+@@ class BaseClass
+[3 lines of pre-context]
+- [old_code]
++ [new_code]
+[3 lines of post-context]
+
+- If a code block is repeated so many times in a class or function such that even a single `@@` statement and 3 lines of context cannot uniquely identify the snippet of code, you can use multiple `@@` statements to jump to the right context. For instance:
+
+@@ class BaseClass
+@@ 	def method():
+[3 lines of pre-context]
+- [old_code]
++ [new_code]
+[3 lines of post-context]
+
+Note, then, that we do not use line numbers in this diff format, as the context is enough to uniquely identify code. An example of a message that you might pass as "input" to this function, in order to apply a patch, is shown below.
+
+```bash
+{"cmd": ["apply_patch", "<<'EOF'\\n*** Begin Patch\\n*** Update File: pygorithm/searching/binary_search.py\\n@@ class BaseClass\\n@@     def search():\\n-        pass\\n+        raise NotImplementedError()\\n@@ class Subclass\\n@@     def search():\\n-        pass\\n+        raise NotImplementedError()\\n*** End Patch\\nEOF\\n"], "workdir": "..."}
+```
+
+File references can only be relative, NEVER ABSOLUTE. After the apply_patch command is run, it will always say "Done!", regardless of whether the patch was successfully applied or not. However, you can determine if there are issue and errors by looking at any warnings or logging lines printed BEFORE the "Done!" is output.

codex-rs/apply-patch/src/lib.rs

@@ -19,6 +19,9 @@ use tree_sitter::LanguageError;
 use tree_sitter::Parser;
 use tree_sitter_bash::LANGUAGE as BASH;
 
+/// Detailed instructions for gpt-4.1 on how to use the `apply_patch` tool.
+pub const APPLY_PATCH_TOOL_INSTRUCTIONS: &str = include_str!("../apply_patch_tool_instructions.md");
+
 #[derive(Debug, Error, PartialEq)]
 pub enum ApplyPatchError {
     #[error(transparent)]
@@ -55,16 +58,24 @@ impl PartialEq for IoError {
 
 #[derive(Debug, PartialEq)]
 pub enum MaybeApplyPatch {
-    Body(Vec<Hunk>),
+    Body(ApplyPatchArgs),
     ShellParseError(ExtractHeredocError),
     PatchParseError(ParseError),
     NotApplyPatch,
 }
 
+/// Both the raw PATCH argument to `apply_patch` as well as the PATCH argument
+/// parsed into hunks.
+#[derive(Debug, PartialEq)]
+pub struct ApplyPatchArgs {
+    pub patch: String,
+    pub hunks: Vec<Hunk>,
+}
+
 pub fn maybe_parse_apply_patch(argv: &[String]) -> MaybeApplyPatch {
     match argv {
         [cmd, body] if cmd == "apply_patch" => match parse_patch(body) {
-            Ok(hunks) => MaybeApplyPatch::Body(hunks),
+            Ok(source) => MaybeApplyPatch::Body(source),
             Err(e) => MaybeApplyPatch::PatchParseError(e),
         },
         [bash, flag, script]
@@ -74,7 +85,7 @@ pub fn maybe_parse_apply_patch(argv: &[String]) -> MaybeApplyPatch {
         {
             match extract_heredoc_body_from_apply_patch_command(script) {
                 Ok(body) => match parse_patch(&body) {
-                    Ok(hunks) => MaybeApplyPatch::Body(hunks),
+                    Ok(source) => MaybeApplyPatch::Body(source),
                     Err(e) => MaybeApplyPatch::PatchParseError(e),
                 },
                 Err(e) => MaybeApplyPatch::ShellParseError(e),
@@ -113,11 +124,19 @@ pub enum MaybeApplyPatchVerified {
     NotApplyPatch,
 }
 
-#[derive(Debug, PartialEq)]
 /// ApplyPatchAction is the result of parsing an `apply_patch` command. By
 /// construction, all paths should be absolute paths.
+#[derive(Debug, PartialEq)]
 pub struct ApplyPatchAction {
     changes: HashMap<PathBuf, ApplyPatchFileChange>,
+
+    /// The raw patch argument that can be used with `apply_patch` as an exec
+    /// call. i.e., if the original arg was parsed in "lenient" mode with a
+    /// heredoc, this should be the value without the heredoc wrapper.
+    pub patch: String,
+
+    /// The working directory that was used to resolve relative paths in the patch.
+    pub cwd: PathBuf,
 }
 
 impl ApplyPatchAction {
@@ -137,8 +156,28 @@ impl ApplyPatchAction {
             panic!("path must be absolute");
         }
 
+        #[allow(clippy::expect_used)]
+        let filename = path
+            .file_name()
+            .expect("path should not be empty")
+            .to_string_lossy();
+        let patch = format!(
+            r#"*** Begin Patch
+*** Update File: {filename}
+@@
++ {content}
+*** End Patch"#,
+        );
         let changes = HashMap::from([(path.to_path_buf(), ApplyPatchFileChange::Add { content })]);
-        Self { changes }
+        #[allow(clippy::expect_used)]
+        Self {
+            changes,
+            cwd: path
+                .parent()
+                .expect("path should have parent")
+                .to_path_buf(),
+            patch,
+        }
     }
 }
 
@@ -146,7 +185,7 @@ impl ApplyPatchAction {
 /// patch.
 pub fn maybe_parse_apply_patch_verified(argv: &[String], cwd: &Path) -> MaybeApplyPatchVerified {
     match maybe_parse_apply_patch(argv) {
-        MaybeApplyPatch::Body(hunks) => {
+        MaybeApplyPatch::Body(ApplyPatchArgs { patch, hunks }) => {
             let mut changes = HashMap::new();
             for hunk in hunks {
                 let path = hunk.resolve_path(cwd);
@@ -180,7 +219,11 @@ pub fn maybe_parse_apply_patch_verified(argv: &[String], cwd: &Path) -> MaybeApp
                     }
                 }
             }
-            MaybeApplyPatchVerified::Body(ApplyPatchAction { changes })
+            MaybeApplyPatchVerified::Body(ApplyPatchAction {
+                changes,
+                patch,
+                cwd: cwd.to_path_buf(),
+            })
         }
         MaybeApplyPatch::ShellParseError(e) => MaybeApplyPatchVerified::ShellParseError(e),
         MaybeApplyPatch::PatchParseError(e) => MaybeApplyPatchVerified::CorrectnessError(e.into()),
@@ -261,7 +304,7 @@ pub fn apply_patch(
     stderr: &mut impl std::io::Write,
 ) -> Result<(), ApplyPatchError> {
     let hunks = match parse_patch(patch) {
-        Ok(hunks) => hunks,
+        Ok(source) => source.hunks,
         Err(e) => {
             match &e {
                 InvalidPatchError(message) => {
@@ -630,7 +673,7 @@ mod tests {
 
     /// Helper to construct a patch with the given body.
     fn wrap_patch(body: &str) -> String {
-        format!("*** Begin Patch\n{}\n*** End Patch", body)
+        format!("*** Begin Patch\n{body}\n*** End Patch")
     }
 
     fn strs_to_strings(strs: &[&str]) -> Vec<String> {
@@ -649,7 +692,7 @@ mod tests {
         ]);
 
         match maybe_parse_apply_patch(&args) {
-            MaybeApplyPatch::Body(hunks) => {
+            MaybeApplyPatch::Body(ApplyPatchArgs { hunks, patch: _ }) => {
                 assert_eq!(
                     hunks,
                     vec![Hunk::AddFile {
@@ -658,7 +701,7 @@ mod tests {
                     }]
                 );
             }
-            result => panic!("expected MaybeApplyPatch::Body got {:?}", result),
+            result => panic!("expected MaybeApplyPatch::Body got {result:?}"),
         }
     }
 
@@ -676,7 +719,7 @@ PATCH"#,
         ]);
 
         match maybe_parse_apply_patch(&args) {
-            MaybeApplyPatch::Body(hunks) => {
+            MaybeApplyPatch::Body(ApplyPatchArgs { hunks, patch: _ }) => {
                 assert_eq!(
                     hunks,
                     vec![Hunk::AddFile {
@@ -685,7 +728,7 @@ PATCH"#,
                     }]
                 );
             }
-            result => panic!("expected MaybeApplyPatch::Body got {:?}", result),
+            result => panic!("expected MaybeApplyPatch::Body got {result:?}"),
         }
     }
 
@@ -951,7 +994,7 @@ PATCH"#,
         ));
         let patch = parse_patch(&patch).unwrap();
 
-        let update_file_chunks = match patch.as_slice() {
+        let update_file_chunks = match patch.hunks.as_slice() {
             [Hunk::UpdateFile { chunks, .. }] => chunks,
             _ => panic!("Expected a single UpdateFile hunk"),
         };
@@ -989,7 +1032,7 @@ PATCH"#,
         ));
 
         let patch = parse_patch(&patch).unwrap();
-        let chunks = match patch.as_slice() {
+        let chunks = match patch.hunks.as_slice() {
             [Hunk::UpdateFile { chunks, .. }] => chunks,
             _ => panic!("Expected a single UpdateFile hunk"),
         };
@@ -1026,7 +1069,7 @@ PATCH"#,
         ));
 
         let patch = parse_patch(&patch).unwrap();
-        let chunks = match patch.as_slice() {
+        let chunks = match patch.hunks.as_slice() {
             [Hunk::UpdateFile { chunks, .. }] => chunks,
             _ => panic!("Expected a single UpdateFile hunk"),
         };
@@ -1061,7 +1104,7 @@ PATCH"#,
         ));
 
         let patch = parse_patch(&patch).unwrap();
-        let chunks = match patch.as_slice() {
+        let chunks = match patch.hunks.as_slice() {
             [Hunk::UpdateFile { chunks, .. }] => chunks,
             _ => panic!("Expected a single UpdateFile hunk"),
         };
@@ -1107,7 +1150,7 @@ PATCH"#,
 
         // Extract chunks then build the unified diff.
         let parsed = parse_patch(&patch).unwrap();
-        let chunks = match parsed.as_slice() {
+        let chunks = match parsed.hunks.as_slice() {
             [Hunk::UpdateFile { chunks, .. }] => chunks,
             _ => panic!("Expected a single UpdateFile hunk"),
         };
@@ -1190,6 +1233,8 @@ g
                         new_content: "updated session directory content\n".to_string(),
                     },
                 )]),
+                patch: argv[1].clone(),
+                cwd: session_dir.path().to_path_buf(),
             })
         );
     }

codex-rs/apply-patch/src/parser.rs

@@ -22,6 +22,7 @@
 //!
 //! The parser below is a little more lenient than the explicit spec and allows for
 //! leading/trailing whitespace around patch markers.
+use crate::ApplyPatchArgs;
 use std::path::Path;
 use std::path::PathBuf;
 
@@ -37,7 +38,15 @@ const EOF_MARKER: &str = "*** End of File";
 const CHANGE_CONTEXT_MARKER: &str = "@@ ";
 const EMPTY_CHANGE_CONTEXT_MARKER: &str = "@@";
 
-#[derive(Debug, PartialEq, Error)]
+/// Currently, the only OpenAI model that knowingly requires lenient parsing is
+/// gpt-4.1. While we could try to require everyone to pass in a strictness
+/// param when invoking apply_patch, it is a pain to thread it through all of
+/// the call sites, so we resign ourselves allowing lenient parsing for all
+/// models. See [`ParseMode::Lenient`] for details on the exceptions we make for
+/// gpt-4.1.
+const PARSE_IN_STRICT_MODE: bool = false;
+
+#[derive(Debug, PartialEq, Error, Clone)]
 pub enum ParseError {
     #[error("invalid patch: {0}")]
     InvalidPatchError(String),
@@ -46,7 +55,7 @@ pub enum ParseError {
 }
 use ParseError::*;
 
-#[derive(Debug, PartialEq)]
+#[derive(Debug, PartialEq, Clone)]
 #[allow(clippy::enum_variant_names)]
 pub enum Hunk {
     AddFile {
@@ -78,7 +87,7 @@ impl Hunk {
 
 use Hunk::*;
 
-#[derive(Debug, PartialEq)]
+#[derive(Debug, PartialEq, Clone)]
 pub struct UpdateFileChunk {
     /// A single line of context used to narrow down the position of the chunk
     /// (this is usually a class, method, or function definition.)
@@ -94,20 +103,69 @@ pub struct UpdateFileChunk {
     pub is_end_of_file: bool,
 }
 
-pub fn parse_patch(patch: &str) -> Result<Vec<Hunk>, ParseError> {
+pub fn parse_patch(patch: &str) -> Result<ApplyPatchArgs, ParseError> {
+    let mode = if PARSE_IN_STRICT_MODE {
+        ParseMode::Strict
+    } else {
+        ParseMode::Lenient
+    };
+    parse_patch_text(patch, mode)
+}
+
+enum ParseMode {
+    /// Parse the patch text argument as is.
+    Strict,
+
+    /// GPT-4.1 is known to formulate the `command` array for the `local_shell`
+    /// tool call for `apply_patch` call using something like the following:
+    ///
+    /// ```json
+    /// [
+    ///   "apply_patch",
+    ///   "<<'EOF'\n*** Begin Patch\n*** Update File: README.md\n@@...\n*** End Patch\nEOF\n",
+    /// ]
+    /// ```
+    ///
+    /// This is a problem because `local_shell` is a bit of a misnomer: the
+    /// `command` is not invoked by passing the arguments to a shell like Bash,
+    /// but are invoked using something akin to `execvpe(3)`.
+    ///
+    /// This is significant in this case because where a shell would interpret
+    /// `<<'EOF'...` as a heredoc and pass the contents via stdin (which is
+    /// fine, as `apply_patch` is specified to read from stdin if no argument is
+    /// passed), `execvpe(3)` interprets the heredoc as a literal string. To get
+    /// the `local_shell` tool to run a command the way shell would, the
+    /// `command` array must be something like:
+    ///
+    /// ```json
+    /// [
+    ///   "bash",
+    ///   "-lc",
+    ///   "apply_patch <<'EOF'\n*** Begin Patch\n*** Update File: README.md\n@@...\n*** End Patch\nEOF\n",
+    /// ]
+    /// ```
+    ///
+    /// In lenient mode, we check if the argument to `apply_patch` starts with
+    /// `<<'EOF'` and ends with `EOF\n`. If so, we strip off these markers,
+    /// trim() the result, and treat what is left as the patch text.
+    Lenient,
+}
+
+fn parse_patch_text(patch: &str, mode: ParseMode) -> Result<ApplyPatchArgs, ParseError> {
     let lines: Vec<&str> = patch.trim().lines().collect();
-    if lines.is_empty() || lines[0] != BEGIN_PATCH_MARKER {
-        return Err(InvalidPatchError(String::from(
-            "The first line of the patch must be '*** Begin Patch'",
-        )));
-    }
-    let last_line_index = lines.len() - 1;
-    if lines[last_line_index] != END_PATCH_MARKER {
-        return Err(InvalidPatchError(String::from(
-            "The last line of the patch must be '*** End Patch'",
-        )));
-    }
+    let lines: &[&str] = match check_patch_boundaries_strict(&lines) {
+        Ok(()) => &lines,
+        Err(e) => match mode {
+            ParseMode::Strict => {
+                return Err(e);
+            }
+            ParseMode::Lenient => check_patch_boundaries_lenient(&lines, e)?,
+        },
+    };
+
     let mut hunks: Vec<Hunk> = Vec::new();
+    // The above checks ensure that lines.len() >= 2.
+    let last_line_index = lines.len().saturating_sub(1);
     let mut remaining_lines = &lines[1..last_line_index];
     let mut line_number = 2;
     while !remaining_lines.is_empty() {
@@ -116,7 +174,66 @@ pub fn parse_patch(patch: &str) -> Result<Vec<Hunk>, ParseError> {
         line_number += hunk_lines;
         remaining_lines = &remaining_lines[hunk_lines..]
     }
-    Ok(hunks)
+    let patch = lines.join("\n");
+    Ok(ApplyPatchArgs { hunks, patch })
+}
+
+/// Checks the start and end lines of the patch text for `apply_patch`,
+/// returning an error if they do not match the expected markers.
+fn check_patch_boundaries_strict(lines: &[&str]) -> Result<(), ParseError> {
+    let (first_line, last_line) = match lines {
+        [] => (None, None),
+        [first] => (Some(first), Some(first)),
+        [first, .., last] => (Some(first), Some(last)),
+    };
+    check_start_and_end_lines_strict(first_line, last_line)
+}
+
+/// If we are in lenient mode, we check if the first line starts with `<<EOF`
+/// (possibly quoted) and the last line ends with `EOF`. There must be at least
+/// 4 lines total because the heredoc markers take up 2 lines and the patch text
+/// must have at least 2 lines.
+///
+/// If successful, returns the lines of the patch text that contain the patch
+/// contents, excluding the heredoc markers.
+fn check_patch_boundaries_lenient<'a>(
+    original_lines: &'a [&'a str],
+    original_parse_error: ParseError,
+) -> Result<&'a [&'a str], ParseError> {
+    match original_lines {
+        [first, .., last] => {
+            if (first == &"<<EOF" || first == &"<<'EOF'" || first == &"<<\"EOF\"")
+                && last.ends_with("EOF")
+                && original_lines.len() >= 4
+            {
+                let inner_lines = &original_lines[1..original_lines.len() - 1];
+                match check_patch_boundaries_strict(inner_lines) {
+                    Ok(()) => Ok(inner_lines),
+                    Err(e) => Err(e),
+                }
+            } else {
+                Err(original_parse_error)
+            }
+        }
+        _ => Err(original_parse_error),
+    }
+}
+
+fn check_start_and_end_lines_strict(
+    first_line: Option<&&str>,
+    last_line: Option<&&str>,
+) -> Result<(), ParseError> {
+    match (first_line, last_line) {
+        (Some(&first), Some(&last)) if first == BEGIN_PATCH_MARKER && last == END_PATCH_MARKER => {
+            Ok(())
+        }
+        (Some(&first), _) if first != BEGIN_PATCH_MARKER => Err(InvalidPatchError(String::from(
+            "The first line of the patch must be '*** Begin Patch'",
+        ))),
+        _ => Err(InvalidPatchError(String::from(
+            "The last line of the patch must be '*** End Patch'",
+        ))),
+    }
 }
 
 /// Attempts to parse a single hunk from the start of lines.
@@ -310,24 +427,26 @@ fn parse_update_file_chunk(
 }
 
 #[test]
+#[allow(clippy::unwrap_used)]
 fn test_parse_patch() {
     assert_eq!(
-        parse_patch("bad"),
+        parse_patch_text("bad", ParseMode::Strict),
         Err(InvalidPatchError(
             "The first line of the patch must be '*** Begin Patch'".to_string()
         ))
     );
     assert_eq!(
-        parse_patch("*** Begin Patch\nbad"),
+        parse_patch_text("*** Begin Patch\nbad", ParseMode::Strict),
         Err(InvalidPatchError(
             "The last line of the patch must be '*** End Patch'".to_string()
         ))
     );
     assert_eq!(
-        parse_patch(
+        parse_patch_text(
             "*** Begin Patch\n\
              *** Update File: test.py\n\
-             *** End Patch"
+             *** End Patch",
+            ParseMode::Strict
         ),
         Err(InvalidHunkError {
             message: "Update file hunk for path 'test.py' is empty".to_string(),
@@ -335,14 +454,17 @@ fn test_parse_patch() {
         })
     );
     assert_eq!(
-        parse_patch(
+        parse_patch_text(
             "*** Begin Patch\n\
-             *** End Patch"
-        ),
-        Ok(Vec::new())
+             *** End Patch",
+            ParseMode::Strict
+        )
+        .unwrap()
+        .hunks,
+        Vec::new()
     );
     assert_eq!(
-        parse_patch(
+        parse_patch_text(
             "*** Begin Patch\n\
              *** Add File: path/add.py\n\
              +abc\n\
@@ -353,9 +475,12 @@ fn test_parse_patch() {
              @@ def f():\n\
              -    pass\n\
              +    return 123\n\
-             *** End Patch"
-        ),
-        Ok(vec![
+             *** End Patch",
+            ParseMode::Strict
+        )
+        .unwrap()
+        .hunks,
+        vec![
             AddFile {
                 path: PathBuf::from("path/add.py"),
                 contents: "abc\ndef\n".to_string()
@@ -373,20 +498,23 @@ fn test_parse_patch() {
                     is_end_of_file: false
                 }]
             }
-        ])
+        ]
     );
     // Update hunk followed by another hunk (Add File).
     assert_eq!(
-        parse_patch(
+        parse_patch_text(
             "*** Begin Patch\n\
              *** Update File: file.py\n\
              @@\n\
              +line\n\
              *** Add File: other.py\n\
              +content\n\
-             *** End Patch"
-        ),
-        Ok(vec![
+             *** End Patch",
+            ParseMode::Strict
+        )
+        .unwrap()
+        .hunks,
+        vec![
             UpdateFile {
                 path: PathBuf::from("file.py"),
                 move_path: None,
@@ -401,20 +529,23 @@ fn test_parse_patch() {
                 path: PathBuf::from("other.py"),
                 contents: "content\n".to_string()
             }
-        ])
+        ]
     );
 
     // Update hunk without an explicit @@ header for the first chunk should parse.
     // Use a raw string to preserve the leading space diff marker on the context line.
     assert_eq!(
-        parse_patch(
+        parse_patch_text(
             r#"*** Begin Patch
 *** Update File: file2.py
  import foo
 +bar
 *** End Patch"#,
-        ),
-        Ok(vec![UpdateFile {
+            ParseMode::Strict
+        )
+        .unwrap()
+        .hunks,
+        vec![UpdateFile {
             path: PathBuf::from("file2.py"),
             move_path: None,
             chunks: vec![UpdateFileChunk {
@@ -423,7 +554,90 @@ fn test_parse_patch() {
                 new_lines: vec!["import foo".to_string(), "bar".to_string()],
                 is_end_of_file: false,
             }],
-        }])
+        }]
+    );
+}
+
+#[test]
+fn test_parse_patch_lenient() {
+    let patch_text = r#"*** Begin Patch
+*** Update File: file2.py
+ import foo
++bar
+*** End Patch"#;
+    let expected_patch = vec![UpdateFile {
+        path: PathBuf::from("file2.py"),
+        move_path: None,
+        chunks: vec![UpdateFileChunk {
+            change_context: None,
+            old_lines: vec!["import foo".to_string()],
+            new_lines: vec!["import foo".to_string(), "bar".to_string()],
+            is_end_of_file: false,
+        }],
+    }];
+    let expected_error =
+        InvalidPatchError("The first line of the patch must be '*** Begin Patch'".to_string());
+
+    let patch_text_in_heredoc = format!("<<EOF\n{patch_text}\nEOF\n");
+    assert_eq!(
+        parse_patch_text(&patch_text_in_heredoc, ParseMode::Strict),
+        Err(expected_error.clone())
+    );
+    assert_eq!(
+        parse_patch_text(&patch_text_in_heredoc, ParseMode::Lenient),
+        Ok(ApplyPatchArgs {
+            hunks: expected_patch.clone(),
+            patch: patch_text.to_string()
+        })
+    );
+
+    let patch_text_in_single_quoted_heredoc = format!("<<'EOF'\n{patch_text}\nEOF\n");
+    assert_eq!(
+        parse_patch_text(&patch_text_in_single_quoted_heredoc, ParseMode::Strict),
+        Err(expected_error.clone())
+    );
+    assert_eq!(
+        parse_patch_text(&patch_text_in_single_quoted_heredoc, ParseMode::Lenient),
+        Ok(ApplyPatchArgs {
+            hunks: expected_patch.clone(),
+            patch: patch_text.to_string()
+        })
+    );
+
+    let patch_text_in_double_quoted_heredoc = format!("<<\"EOF\"\n{patch_text}\nEOF\n");
+    assert_eq!(
+        parse_patch_text(&patch_text_in_double_quoted_heredoc, ParseMode::Strict),
+        Err(expected_error.clone())
+    );
+    assert_eq!(
+        parse_patch_text(&patch_text_in_double_quoted_heredoc, ParseMode::Lenient),
+        Ok(ApplyPatchArgs {
+            hunks: expected_patch.clone(),
+            patch: patch_text.to_string()
+        })
+    );
+
+    let patch_text_in_mismatched_quotes_heredoc = format!("<<\"EOF'\n{patch_text}\nEOF\n");
+    assert_eq!(
+        parse_patch_text(&patch_text_in_mismatched_quotes_heredoc, ParseMode::Strict),
+        Err(expected_error.clone())
+    );
+    assert_eq!(
+        parse_patch_text(&patch_text_in_mismatched_quotes_heredoc, ParseMode::Lenient),
+        Err(expected_error.clone())
+    );
+
+    let patch_text_with_missing_closing_heredoc =
+        "<<EOF\n*** Begin Patch\n*** Update File: file2.py\nEOF\n".to_string();
+    assert_eq!(
+        parse_patch_text(&patch_text_with_missing_closing_heredoc, ParseMode::Strict),
+        Err(expected_error.clone())
+    );
+    assert_eq!(
+        parse_patch_text(&patch_text_with_missing_closing_heredoc, ParseMode::Lenient),
+        Err(InvalidPatchError(
+            "The last line of the patch must be '*** End Patch'".to_string()
+        ))
     );
 }
 

codex-rs/arg0/Cargo.toml

@@ -0,0 +1,19 @@
+[package]
+edition = "2024"
+name = "codex-arg0"
+version = { workspace = true }
+
+[lib]
+name = "codex_arg0"
+path = "src/lib.rs"
+
+[lints]
+workspace = true
+
+[dependencies]
+anyhow = "1"
+codex-apply-patch = { path = "../apply-patch" }
+codex-core = { path = "../core" }
+codex-linux-sandbox = { path = "../linux-sandbox" }
+dotenvy = "0.15.7"
+tokio = { version = "1", features = ["rt-multi-thread"] }

codex-rs/arg0/src/lib.rs

@@ -0,0 +1,91 @@
+use std::future::Future;
+use std::path::Path;
+use std::path::PathBuf;
+
+use codex_core::CODEX_APPLY_PATCH_ARG1;
+
+/// While we want to deploy the Codex CLI as a single executable for simplicity,
+/// we also want to expose some of its functionality as distinct CLIs, so we use
+/// the "arg0 trick" to determine which CLI to dispatch. This effectively allows
+/// us to simulate deploying multiple executables as a single binary on Mac and
+/// Linux (but not Windows).
+///
+/// When the current executable is invoked through the hard-link or alias named
+/// `codex-linux-sandbox` we *directly* execute
+/// [`codex_linux_sandbox::run_main`] (which never returns). Otherwise we:
+///
+/// 1.  Use [`dotenvy::from_path`] and [`dotenvy::dotenv`] to modify the
+///     environment before creating any threads.
+/// 2.  Construct a Tokio multi-thread runtime.
+/// 3.  Derive the path to the current executable (so children can re-invoke the
+///     sandbox) when running on Linux.
+/// 4.  Execute the provided async `main_fn` inside that runtime, forwarding any
+///     error. Note that `main_fn` receives `codex_linux_sandbox_exe:
+///     Option<PathBuf>`, as an argument, which is generally needed as part of
+///     constructing [`codex_core::config::Config`].
+///
+/// This function should be used to wrap any `main()` function in binary crates
+/// in this workspace that depends on these helper CLIs.
+pub fn arg0_dispatch_or_else<F, Fut>(main_fn: F) -> anyhow::Result<()>
+where
+    F: FnOnce(Option<PathBuf>) -> Fut,
+    Fut: Future<Output = anyhow::Result<()>>,
+{
+    // Determine if we were invoked via the special alias.
+    let mut args = std::env::args_os();
+    let argv0 = args.next().unwrap_or_default();
+    let exe_name = Path::new(&argv0)
+        .file_name()
+        .and_then(|s| s.to_str())
+        .unwrap_or("");
+
+    if exe_name == "codex-linux-sandbox" {
+        // Safety: [`run_main`] never returns.
+        codex_linux_sandbox::run_main();
+    }
+
+    let argv1 = args.next().unwrap_or_default();
+    if argv1 == CODEX_APPLY_PATCH_ARG1 {
+        let patch_arg = args.next().and_then(|s| s.to_str().map(|s| s.to_owned()));
+        let exit_code = match patch_arg {
+            Some(patch_arg) => {
+                let mut stdout = std::io::stdout();
+                let mut stderr = std::io::stderr();
+                match codex_apply_patch::apply_patch(&patch_arg, &mut stdout, &mut stderr) {
+                    Ok(()) => 0,
+                    Err(_) => 1,
+                }
+            }
+            None => {
+                eprintln!("Error: {CODEX_APPLY_PATCH_ARG1} requires a UTF-8 PATCH argument.");
+                1
+            }
+        };
+        std::process::exit(exit_code);
+    }
+
+    // This modifies the environment, which is not thread-safe, so do this
+    // before creating any threads/the Tokio runtime.
+    load_dotenv();
+
+    // Regular invocation – create a Tokio runtime and execute the provided
+    // async entry-point.
+    let runtime = tokio::runtime::Runtime::new()?;
+    runtime.block_on(async move {
+        let codex_linux_sandbox_exe: Option<PathBuf> = if cfg!(target_os = "linux") {
+            std::env::current_exe().ok()
+        } else {
+            None
+        };
+
+        main_fn(codex_linux_sandbox_exe).await
+    })
+}
+
+/// Load env vars from ~/.codex/.env and `$(pwd)/.env`.
+fn load_dotenv() {
+    if let Ok(codex_home) = codex_core::config::find_codex_home() {
+        dotenvy::from_path(codex_home.join(".env")).ok();
+    }
+    dotenvy::dotenv().ok();
+}

codex-rs/chatgpt/Cargo.toml

@@ -0,0 +1,21 @@
+[package]
+edition = "2024"
+name = "codex-chatgpt"
+version = { workspace = true }
+
+[lints]
+workspace = true
+
+[dependencies]
+anyhow = "1"
+clap = { version = "4", features = ["derive"] }
+codex-common = { path = "../common", features = ["cli"] }
+codex-core = { path = "../core" }
+codex-login = { path = "../login" }
+reqwest = { version = "0.12", features = ["json", "stream"] }
+serde = { version = "1", features = ["derive"] }
+serde_json = "1"
+tokio = { version = "1", features = ["full"] }
+
+[dev-dependencies]
+tempfile = "3"

codex-rs/chatgpt/README.md

@@ -0,0 +1,5 @@
+# ChatGPT
+
+This crate pertains to first party ChatGPT APIs and products such as Codex agent.
+
+This crate should be primarily built and maintained by OpenAI employees. Please reach out to a maintainer before making an external contribution.

codex-rs/chatgpt/src/apply_command.rs

@@ -0,0 +1,101 @@
+use std::path::PathBuf;
+
+use clap::Parser;
+use codex_common::CliConfigOverrides;
+use codex_core::config::Config;
+use codex_core::config::ConfigOverrides;
+
+use crate::chatgpt_token::init_chatgpt_token_from_auth;
+use crate::get_task::GetTaskResponse;
+use crate::get_task::OutputItem;
+use crate::get_task::PrOutputItem;
+use crate::get_task::get_task;
+
+/// Applies the latest diff from a Codex agent task.
+#[derive(Debug, Parser)]
+pub struct ApplyCommand {
+    pub task_id: String,
+
+    #[clap(flatten)]
+    pub config_overrides: CliConfigOverrides,
+}
+pub async fn run_apply_command(
+    apply_cli: ApplyCommand,
+    cwd: Option<PathBuf>,
+) -> anyhow::Result<()> {
+    let config = Config::load_with_cli_overrides(
+        apply_cli
+            .config_overrides
+            .parse_overrides()
+            .map_err(anyhow::Error::msg)?,
+        ConfigOverrides::default(),
+    )?;
+
+    init_chatgpt_token_from_auth(&config.codex_home).await?;
+
+    let task_response = get_task(&config, apply_cli.task_id).await?;
+    apply_diff_from_task(task_response, cwd).await
+}
+
+pub async fn apply_diff_from_task(
+    task_response: GetTaskResponse,
+    cwd: Option<PathBuf>,
+) -> anyhow::Result<()> {
+    let diff_turn = match task_response.current_diff_task_turn {
+        Some(turn) => turn,
+        None => anyhow::bail!("No diff turn found"),
+    };
+    let output_diff = diff_turn.output_items.iter().find_map(|item| match item {
+        OutputItem::Pr(PrOutputItem { output_diff }) => Some(output_diff),
+        _ => None,
+    });
+    match output_diff {
+        Some(output_diff) => apply_diff(&output_diff.diff, cwd).await,
+        None => anyhow::bail!("No PR output item found"),
+    }
+}
+
+async fn apply_diff(diff: &str, cwd: Option<PathBuf>) -> anyhow::Result<()> {
+    let mut cmd = tokio::process::Command::new("git");
+    if let Some(cwd) = cwd {
+        cmd.current_dir(cwd);
+    }
+    let toplevel_output = cmd
+        .args(vec!["rev-parse", "--show-toplevel"])
+        .output()
+        .await?;
+
+    if !toplevel_output.status.success() {
+        anyhow::bail!("apply must be run from a git repository.");
+    }
+
+    let repo_root = String::from_utf8(toplevel_output.stdout)?
+        .trim()
+        .to_string();
+
+    let mut git_apply_cmd = tokio::process::Command::new("git")
+        .args(vec!["apply", "--3way"])
+        .current_dir(&repo_root)
+        .stdin(std::process::Stdio::piped())
+        .stdout(std::process::Stdio::piped())
+        .stderr(std::process::Stdio::piped())
+        .spawn()?;
+
+    if let Some(mut stdin) = git_apply_cmd.stdin.take() {
+        tokio::io::AsyncWriteExt::write_all(&mut stdin, diff.as_bytes()).await?;
+        drop(stdin);
+    }
+
+    let output = git_apply_cmd.wait_with_output().await?;
+
+    if !output.status.success() {
+        anyhow::bail!(
+            "Git apply failed with status {}: {}",
+            output.status,
+            String::from_utf8_lossy(&output.stderr)
+        );
+    }
+
+    println!("Successfully applied diff");
+    Ok(())
+}

codex-rs/chatgpt/src/chatgpt_client.rs

@@ -0,0 +1,49 @@
+use codex_core::config::Config;
+
+use crate::chatgpt_token::get_chatgpt_token_data;
+use crate::chatgpt_token::init_chatgpt_token_from_auth;
+
+use anyhow::Context;
+use serde::de::DeserializeOwned;
+
+/// Make a GET request to the ChatGPT backend API.
+pub(crate) async fn chatgpt_get_request<T: DeserializeOwned>(
+    config: &Config,
+    path: String,
+) -> anyhow::Result<T> {
+    let chatgpt_base_url = &config.chatgpt_base_url;
+    init_chatgpt_token_from_auth(&config.codex_home).await?;
+
+    // Make direct HTTP request to ChatGPT backend API with the token
+    let client = reqwest::Client::new();
+    let url = format!("{chatgpt_base_url}{path}");
+
+    let token =
+        get_chatgpt_token_data().ok_or_else(|| anyhow::anyhow!("ChatGPT token not available"))?;
+
+    let account_id = token.account_id.ok_or_else(|| {
+        anyhow::anyhow!("ChatGPT account ID not available, please re-run `codex login`")
+    });
+
+    let response = client
+        .get(&url)
+        .bearer_auth(&token.access_token)
+        .header("chatgpt-account-id", account_id?)
+        .header("Content-Type", "application/json")
+        .header("User-Agent", "codex-cli")
+        .send()
+        .await
+        .context("Failed to send request")?;
+
+    if response.status().is_success() {
+        let result: T = response
+            .json()
+            .await
+            .context("Failed to parse JSON response")?;
+        Ok(result)
+    } else {
+        let status = response.status();
+        let body = response.text().await.unwrap_or_default();
+        anyhow::bail!("Request failed with status {}: {}", status, body)
+    }
+}

codex-rs/chatgpt/src/chatgpt_token.rs

@@ -0,0 +1,27 @@
+use std::path::Path;
+use std::sync::LazyLock;
+use std::sync::RwLock;
+
+use codex_login::TokenData;
+
+static CHATGPT_TOKEN: LazyLock<RwLock<Option<TokenData>>> = LazyLock::new(|| RwLock::new(None));
+
+pub fn get_chatgpt_token_data() -> Option<TokenData> {
+    CHATGPT_TOKEN.read().ok()?.clone()
+}
+
+pub fn set_chatgpt_token_data(value: TokenData) {
+    if let Ok(mut guard) = CHATGPT_TOKEN.write() {
+        *guard = Some(value);
+    }
+}
+
+/// Initialize the ChatGPT token from auth.json file
+pub async fn init_chatgpt_token_from_auth(codex_home: &Path) -> std::io::Result<()> {
+    let auth = codex_login::load_auth(codex_home, true)?;
+    if let Some(auth) = auth {
+        let token_data = auth.get_token_data().await?;
+        set_chatgpt_token_data(token_data);
+    }
+    Ok(())
+}

codex-rs/chatgpt/src/get_task.rs

@@ -0,0 +1,40 @@
+use codex_core::config::Config;
+use serde::Deserialize;
+
+use crate::chatgpt_client::chatgpt_get_request;
+
+#[derive(Debug, Deserialize)]
+pub struct GetTaskResponse {
+    pub current_diff_task_turn: Option<AssistantTurn>,
+}
+
+// Only relevant fields for our extraction
+#[derive(Debug, Deserialize)]
+pub struct AssistantTurn {
+    pub output_items: Vec<OutputItem>,
+}
+
+#[derive(Debug, Deserialize)]
+#[serde(tag = "type")]
+pub enum OutputItem {
+    #[serde(rename = "pr")]
+    Pr(PrOutputItem),
+
+    #[serde(other)]
+    Other,
+}
+
+#[derive(Debug, Deserialize)]
+pub struct PrOutputItem {
+    pub output_diff: OutputDiff,
+}
+
+#[derive(Debug, Deserialize)]
+pub struct OutputDiff {
+    pub diff: String,
+}
+
+pub(crate) async fn get_task(config: &Config, task_id: String) -> anyhow::Result<GetTaskResponse> {
+    let path = format!("/wham/tasks/{task_id}");
+    chatgpt_get_request(config, path).await
+}

codex-rs/chatgpt/src/lib.rs

@@ -0,0 +1,4 @@
+pub mod apply_command;
+mod chatgpt_client;
+mod chatgpt_token;
+pub mod get_task;

codex-rs/chatgpt/tests/apply_command_e2e.rs

@@ -0,0 +1,190 @@
+#![expect(clippy::expect_used)]
+
+use codex_chatgpt::apply_command::apply_diff_from_task;
+use codex_chatgpt::get_task::GetTaskResponse;
+use std::path::Path;
+use tempfile::TempDir;
+use tokio::process::Command;
+
+/// Creates a temporary git repository with initial commit
+async fn create_temp_git_repo() -> anyhow::Result<TempDir> {
+    let temp_dir = TempDir::new()?;
+    let repo_path = temp_dir.path();
+    let envs = vec![
+        ("GIT_CONFIG_GLOBAL", "/dev/null"),
+        ("GIT_CONFIG_NOSYSTEM", "1"),
+    ];
+
+    let output = Command::new("git")
+        .envs(envs.clone())
+        .args(["init"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    if !output.status.success() {
+        anyhow::bail!(
+            "Failed to initialize git repo: {}",
+            String::from_utf8_lossy(&output.stderr)
+        );
+    }
+
+    Command::new("git")
+        .envs(envs.clone())
+        .args(["config", "user.email", "test@example.com"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    Command::new("git")
+        .envs(envs.clone())
+        .args(["config", "user.name", "Test User"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    std::fs::write(repo_path.join("README.md"), "# Test Repo\n")?;
+
+    Command::new("git")
+        .envs(envs.clone())
+        .args(["add", "README.md"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    let output = Command::new("git")
+        .envs(envs.clone())
+        .args(["commit", "-m", "Initial commit"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    if !output.status.success() {
+        anyhow::bail!(
+            "Failed to create initial commit: {}",
+            String::from_utf8_lossy(&output.stderr)
+        );
+    }
+
+    Ok(temp_dir)
+}
+
+async fn mock_get_task_with_fixture() -> anyhow::Result<GetTaskResponse> {
+    let fixture_path = Path::new(env!("CARGO_MANIFEST_DIR")).join("tests/task_turn_fixture.json");
+    let fixture_content = std::fs::read_to_string(fixture_path)?;
+    let response: GetTaskResponse = serde_json::from_str(&fixture_content)?;
+    Ok(response)
+}
+
+#[tokio::test]
+async fn test_apply_command_creates_fibonacci_file() {
+    let temp_repo = create_temp_git_repo()
+        .await
+        .expect("Failed to create temp git repo");
+    let repo_path = temp_repo.path();
+
+    let task_response = mock_get_task_with_fixture()
+        .await
+        .expect("Failed to load fixture");
+
+    apply_diff_from_task(task_response, Some(repo_path.to_path_buf()))
+        .await
+        .expect("Failed to apply diff from task");
+
+    // Assert that fibonacci.js was created in scripts/ directory
+    let fibonacci_path = repo_path.join("scripts/fibonacci.js");
+    assert!(fibonacci_path.exists(), "fibonacci.js was not created");
+
+    // Verify the file contents match expected
+    let contents = std::fs::read_to_string(&fibonacci_path).expect("Failed to read fibonacci.js");
+    assert!(
+        contents.contains("function fibonacci(n)"),
+        "fibonacci.js doesn't contain expected function"
+    );
+    assert!(
+        contents.contains("#!/usr/bin/env node"),
+        "fibonacci.js doesn't have shebang"
+    );
+    assert!(
+        contents.contains("module.exports = fibonacci;"),
+        "fibonacci.js doesn't export function"
+    );
+
+    // Verify file has correct number of lines (31 as specified in fixture)
+    let line_count = contents.lines().count();
+    assert_eq!(
+        line_count, 31,
+        "fibonacci.js should have 31 lines, got {line_count}",
+    );
+}
+
+#[tokio::test]
+async fn test_apply_command_with_merge_conflicts() {
+    let temp_repo = create_temp_git_repo()
+        .await
+        .expect("Failed to create temp git repo");
+    let repo_path = temp_repo.path();
+
+    // Create conflicting fibonacci.js file first
+    let scripts_dir = repo_path.join("scripts");
+    std::fs::create_dir_all(&scripts_dir).expect("Failed to create scripts directory");
+
+    let conflicting_content = r#"#!/usr/bin/env node
+
+// This is a different fibonacci implementation
+function fib(num) {
+  if (num <= 1) return num;
+  return fib(num - 1) + fib(num - 2);
+}
+
+console.log("Running fibonacci...");
+console.log(fib(10));
+"#;
+
+    let fibonacci_path = scripts_dir.join("fibonacci.js");
+    std::fs::write(&fibonacci_path, conflicting_content).expect("Failed to write conflicting file");
+
+    Command::new("git")
+        .args(["add", "scripts/fibonacci.js"])
+        .current_dir(repo_path)
+        .output()
+        .await
+        .expect("Failed to add fibonacci.js");
+
+    Command::new("git")
+        .args(["commit", "-m", "Add conflicting fibonacci implementation"])
+        .current_dir(repo_path)
+        .output()
+        .await
+        .expect("Failed to commit conflicting file");
+
+    let original_dir = std::env::current_dir().expect("Failed to get current dir");
+    std::env::set_current_dir(repo_path).expect("Failed to change directory");
+    struct DirGuard(std::path::PathBuf);
+    impl Drop for DirGuard {
+        fn drop(&mut self) {
+            let _ = std::env::set_current_dir(&self.0);
+        }
+    }
+    let _guard = DirGuard(original_dir);
+
+    let task_response = mock_get_task_with_fixture()
+        .await
+        .expect("Failed to load fixture");
+
+    let apply_result = apply_diff_from_task(task_response, Some(repo_path.to_path_buf())).await;
+
+    assert!(
+        apply_result.is_err(),
+        "Expected apply to fail due to merge conflicts"
+    );
+
+    let contents = std::fs::read_to_string(&fibonacci_path).expect("Failed to read fibonacci.js");
+
+    assert!(
+        contents.contains("<<<<<<< HEAD")
+            || contents.contains("=======")
+            || contents.contains(">>>>>>> "),
+        "fibonacci.js should contain merge conflict markers, got: {contents}",
+    );
+}

codex-rs/chatgpt/tests/task_turn_fixture.json

@@ -0,0 +1,65 @@
+{
+    "current_diff_task_turn": {
+        "output_items": [
+            {
+                "type": "pr",
+                "pr_title": "Add fibonacci script",
+                "pr_message": "## Summary\n- add a basic Fibonacci script under `scripts/`\n\n## Testing\n- `node scripts/fibonacci.js 10`\n- `npm run lint` *(fails: next not found)*",
+                "output_diff": {
+                    "type": "output_diff",
+                    "repo_id": "/workspace/rddit-vercel",
+                    "base_commit_sha": "1a2e9baf2ce2fdd0c126b47b1bcfd512de2a9f7b",
+                    "diff": "diff --git a/scripts/fibonacci.js b/scripts/fibonacci.js\nnew file mode 100644\nindex 0000000000000000000000000000000000000000..6c9fdfdbf8669b7968936411050525b995d0a9a6\n--- /dev/null\n+++ b/scripts/fibonacci.js\n@@ -0,0 +1,31 @@\n+#!/usr/bin/env node\n+\n+function fibonacci(n) {\n+  if (n < 0) {\n+    throw new Error(\"n must be non-negative\");\n+  }\n+  let a = 0;\n+  let b = 1;\n+  for (let i = 0; i < n; i++) {\n+    const next = a + b;\n+    a = b;\n+    b = next;\n+  }\n+  return a;\n+}\n+\n+function printUsage() {\n+  console.log(\"Usage: node scripts/fibonacci.js <n>\");\n+}\n+\n+if (require.main === module) {\n+  const arg = process.argv[2];\n+  if (arg === undefined || isNaN(Number(arg))) {\n+    printUsage();\n+    process.exit(1);\n+  }\n+  const n = Number(arg);\n+  console.log(fibonacci(n));\n+}\n+\n+module.exports = fibonacci;\n",
+                    "external_storage_diff": {
+                        "file_id": "file_00000000114c61f786900f8c2130ace7",
+                        "ttl": null
+                    },
+                    "files_modified": 1,
+                    "lines_added": 31,
+                    "lines_removed": 0,
+                    "commit_message": "Add fibonacci script"
+                }
+            },
+            {
+                "type": "message",
+                "role": "assistant",
+                "content": [
+                    {
+                        "content_type": "text",
+                        "text": "**Summary**\n\n- Created a command-line Fibonacci script that validates input and prints the result when executed with Node"
+                    },
+                    {
+                        "content_type": "repo_file_citation",
+                        "path": "scripts/fibonacci.js",
+                        "line_range_start": 1,
+                        "line_range_end": 31
+                    },
+                    {
+                        "content_type": "text",
+                        "text": "\n\n**Testing**\n\n- ❌ `npm run lint` (failed to run `next lint`)"
+                    },
+                    {
+                        "content_type": "terminal_chunk_citation",
+                        "terminal_chunk_id": "7dd543",
+                        "line_range_start": 1,
+                        "line_range_end": 5
+                    },
+                    {
+                        "content_type": "text",
+                        "text": "\n- ✅ `node scripts/fibonacci.js 10` produced “55”"
+                    },
+                    {
+                        "content_type": "terminal_chunk_citation",
+                        "terminal_chunk_id": "6ee559",
+                        "line_range_start": 1,
+                        "line_range_end": 3
+                    },
+                    {
+                        "content_type": "text",
+                        "text": "\n\nCodex couldn't run certain commands due to environment limitations. Consider configuring a setup script or internet access in your Codex environment to install dependencies."
+                    }
+                ]
+            }
+        ]
+    }
+}

codex-rs/cli/Cargo.toml

@@ -1,7 +1,7 @@
 [package]
+edition = "2024"
 name = "codex-cli"
 version = { workspace = true }
-edition = "2024"
 
 [[bin]]
 name = "codex"
@@ -17,10 +17,13 @@ workspace = true
 [dependencies]
 anyhow = "1"
 clap = { version = "4", features = ["derive"] }
-codex-core = { path = "../core" }
+clap_complete = "4"
+codex-arg0 = { path = "../arg0" }
+codex-chatgpt = { path = "../chatgpt" }
 codex-common = { path = "../common", features = ["cli"] }
+codex-core = { path = "../core" }
 codex-exec = { path = "../exec" }
-codex-linux-sandbox = { path = "../linux-sandbox" }
+codex-login = { path = "../login" }
 codex-mcp-server = { path = "../mcp-server" }
 codex-tui = { path = "../tui" }
 serde_json = "1"

codex-rs/cli/src/debug_sandbox.rs

@@ -1,14 +1,13 @@
 use std::path::PathBuf;
 
 use codex_common::CliConfigOverrides;
-use codex_common::SandboxPermissionOption;
 use codex_core::config::Config;
 use codex_core::config::ConfigOverrides;
-use codex_core::exec::StdioPolicy;
+use codex_core::config_types::SandboxMode;
 use codex_core::exec::spawn_command_under_linux_sandbox;
-use codex_core::exec::spawn_command_under_seatbelt;
 use codex_core::exec_env::create_env;
-use codex_core::protocol::SandboxPolicy;
+use codex_core::seatbelt::spawn_command_under_seatbelt;
+use codex_core::spawn::StdioPolicy;
 
 use crate::LandlockCommand;
 use crate::SeatbeltCommand;
@@ -20,13 +19,11 @@ pub async fn run_command_under_seatbelt(
 ) -> anyhow::Result<()> {
     let SeatbeltCommand {
         full_auto,
-        sandbox,
         config_overrides,
         command,
     } = command;
     run_command_under_sandbox(
         full_auto,
-        sandbox,
         command,
         config_overrides,
         codex_linux_sandbox_exe,
@@ -41,13 +38,11 @@ pub async fn run_command_under_landlock(
 ) -> anyhow::Result<()> {
     let LandlockCommand {
         full_auto,
-        sandbox,
         config_overrides,
         command,
     } = command;
     run_command_under_sandbox(
         full_auto,
-        sandbox,
         command,
         config_overrides,
         codex_linux_sandbox_exe,
@@ -63,20 +58,19 @@ enum SandboxType {
 
 async fn run_command_under_sandbox(
     full_auto: bool,
-    sandbox: SandboxPermissionOption,
     command: Vec<String>,
     config_overrides: CliConfigOverrides,
     codex_linux_sandbox_exe: Option<PathBuf>,
     sandbox_type: SandboxType,
 ) -> anyhow::Result<()> {
-    let sandbox_policy = create_sandbox_policy(full_auto, sandbox);
+    let sandbox_mode = create_sandbox_mode(full_auto);
     let cwd = std::env::current_dir()?;
     let config = Config::load_with_cli_overrides(
         config_overrides
             .parse_overrides()
             .map_err(anyhow::Error::msg)?,
         ConfigOverrides {
-            sandbox_policy: Some(sandbox_policy),
+            sandbox_mode: Some(sandbox_mode),
             codex_linux_sandbox_exe,
             ..Default::default()
         },
@@ -110,13 +104,10 @@ async fn run_command_under_sandbox(
     handle_exit_status(status);
 }
 
-pub fn create_sandbox_policy(full_auto: bool, sandbox: SandboxPermissionOption) -> SandboxPolicy {
+pub fn create_sandbox_mode(full_auto: bool) -> SandboxMode {
     if full_auto {
-        SandboxPolicy::new_full_auto_policy()
+        SandboxMode::WorkspaceWrite
     } else {
-        match sandbox.permissions.map(Into::into) {
-            Some(sandbox_policy) => sandbox_policy,
-            None => SandboxPolicy::new_read_only_policy(),
-        }
+        SandboxMode::ReadOnly
     }
 }

codex-rs/cli/src/lib.rs

@@ -1,10 +1,10 @@
 pub mod debug_sandbox;
 mod exit_status;
+pub mod login;
 pub mod proto;
 
 use clap::Parser;
 use codex_common::CliConfigOverrides;
-use codex_common::SandboxPermissionOption;
 
 #[derive(Debug, Parser)]
 pub struct SeatbeltCommand {
@@ -12,9 +12,6 @@ pub struct SeatbeltCommand {
     #[arg(long = "full-auto", default_value_t = false)]
     pub full_auto: bool,
 
-    #[clap(flatten)]
-    pub sandbox: SandboxPermissionOption,
-
     #[clap(skip)]
     pub config_overrides: CliConfigOverrides,
 
@@ -29,9 +26,6 @@ pub struct LandlockCommand {
     #[arg(long = "full-auto", default_value_t = false)]
     pub full_auto: bool,
 
-    #[clap(flatten)]
-    pub sandbox: SandboxPermissionOption,
-
     #[clap(skip)]
     pub config_overrides: CliConfigOverrides,
 

codex-rs/cli/src/login.rs

@@ -0,0 +1,126 @@
+use std::env;
+
+use codex_common::CliConfigOverrides;
+use codex_core::config::Config;
+use codex_core::config::ConfigOverrides;
+use codex_login::AuthMode;
+use codex_login::OPENAI_API_KEY_ENV_VAR;
+use codex_login::load_auth;
+use codex_login::login_with_api_key;
+use codex_login::login_with_chatgpt;
+
+pub async fn run_login_with_chatgpt(cli_config_overrides: CliConfigOverrides) -> ! {
+    let config = load_config_or_exit(cli_config_overrides);
+
+    let capture_output = false;
+    match login_with_chatgpt(&config.codex_home, capture_output).await {
+        Ok(_) => {
+            eprintln!("Successfully logged in");
+            std::process::exit(0);
+        }
+        Err(e) => {
+            eprintln!("Error logging in: {e}");
+            std::process::exit(1);
+        }
+    }
+}
+
+pub async fn run_login_with_api_key(
+    cli_config_overrides: CliConfigOverrides,
+    api_key: String,
+) -> ! {
+    let config = load_config_or_exit(cli_config_overrides);
+
+    match login_with_api_key(&config.codex_home, &api_key) {
+        Ok(_) => {
+            eprintln!("Successfully logged in");
+            std::process::exit(0);
+        }
+        Err(e) => {
+            eprintln!("Error logging in: {e}");
+            std::process::exit(1);
+        }
+    }
+}
+
+pub async fn run_login_status(cli_config_overrides: CliConfigOverrides) -> ! {
+    let config = load_config_or_exit(cli_config_overrides);
+
+    match load_auth(&config.codex_home, true) {
+        Ok(Some(auth)) => match auth.mode {
+            AuthMode::ApiKey => {
+                if let Some(api_key) = auth.api_key.as_deref() {
+                    eprintln!("Logged in using an API key - {}", safe_format_key(api_key));
+
+                    if let Ok(env_api_key) = env::var(OPENAI_API_KEY_ENV_VAR) {
+                        if env_api_key == api_key {
+                            eprintln!(
+                                "   API loaded from OPENAI_API_KEY environment variable or .env file"
+                            );
+                        }
+                    }
+                } else {
+                    eprintln!("Logged in using an API key");
+                }
+                std::process::exit(0);
+            }
+            AuthMode::ChatGPT => {
+                eprintln!("Logged in using ChatGPT");
+                std::process::exit(0);
+            }
+        },
+        Ok(None) => {
+            eprintln!("Not logged in");
+            std::process::exit(1);
+        }
+        Err(e) => {
+            eprintln!("Error checking login status: {e}");
+            std::process::exit(1);
+        }
+    }
+}
+
+fn load_config_or_exit(cli_config_overrides: CliConfigOverrides) -> Config {
+    let cli_overrides = match cli_config_overrides.parse_overrides() {
+        Ok(v) => v,
+        Err(e) => {
+            eprintln!("Error parsing -c overrides: {e}");
+            std::process::exit(1);
+        }
+    };
+
+    let config_overrides = ConfigOverrides::default();
+    match Config::load_with_cli_overrides(cli_overrides, config_overrides) {
+        Ok(config) => config,
+        Err(e) => {
+            eprintln!("Error loading configuration: {e}");
+            std::process::exit(1);
+        }
+    }
+}
+
+fn safe_format_key(key: &str) -> String {
+    if key.len() <= 13 {
+        return "***".to_string();
+    }
+    let prefix = &key[..8];
+    let suffix = &key[key.len() - 5..];
+    format!("{prefix}***{suffix}")
+}
+
+#[cfg(test)]
+mod tests {
+    use super::safe_format_key;
+
+    #[test]
+    fn formats_long_key() {
+        let key = "sk-proj-1234567890ABCDE";
+        assert_eq!(safe_format_key(key), "sk-proj-***ABCDE");
+    }
+
+    #[test]
+    fn short_key_returns_stars() {
+        let key = "sk-proj-12345";
+        assert_eq!(safe_format_key(key), "***");
+    }
+}

codex-rs/cli/src/main.rs

@@ -1,6 +1,15 @@
+use clap::CommandFactory;
 use clap::Parser;
+use clap_complete::Shell;
+use clap_complete::generate;
+use codex_arg0::arg0_dispatch_or_else;
+use codex_chatgpt::apply_command::ApplyCommand;
+use codex_chatgpt::apply_command::run_apply_command;
 use codex_cli::LandlockCommand;
 use codex_cli::SeatbeltCommand;
+use codex_cli::login::run_login_status;
+use codex_cli::login::run_login_with_api_key;
+use codex_cli::login::run_login_with_chatgpt;
 use codex_cli::proto;
 use codex_common::CliConfigOverrides;
 use codex_exec::Cli as ExecCli;
@@ -36,6 +45,9 @@ enum Subcommand {
     #[clap(visible_alias = "e")]
     Exec(ExecCli),
 
+    /// Manage login.
+    Login(LoginCommand),
+
     /// Experimental: run Codex as an MCP server.
     Mcp,
 
@@ -43,8 +55,22 @@ enum Subcommand {
     #[clap(visible_alias = "p")]
     Proto(ProtoCli),
 
+    /// Generate shell completion scripts.
+    Completion(CompletionCommand),
+
     /// Internal debugging commands.
     Debug(DebugArgs),
+
+    /// Apply the latest diff produced by Codex agent as a `git apply` to your local working tree.
+    #[clap(visible_alias = "a")]
+    Apply(ApplyCommand),
+}
+
+#[derive(Debug, Parser)]
+struct CompletionCommand {
+    /// Shell to generate completions for
+    #[clap(value_enum, default_value_t = Shell::Bash)]
+    shell: Shell,
 }
 
 #[derive(Debug, Parser)]
@@ -63,10 +89,25 @@ enum DebugCommand {
 }
 
 #[derive(Debug, Parser)]
-struct ReplProto {}
+struct LoginCommand {
+    #[clap(skip)]
+    config_overrides: CliConfigOverrides,
+
+    #[arg(long = "api-key", value_name = "API_KEY")]
+    api_key: Option<String>,
+
+    #[command(subcommand)]
+    action: Option<LoginSubcommand>,
+}
+
+#[derive(Debug, clap::Subcommand)]
+enum LoginSubcommand {
+    /// Show login status.
+    Status,
+}
 
 fn main() -> anyhow::Result<()> {
-    codex_linux_sandbox::run_with_sandbox(|codex_linux_sandbox_exe| async move {
+    arg0_dispatch_or_else(|codex_linux_sandbox_exe| async move {
         cli_main(codex_linux_sandbox_exe).await?;
         Ok(())
     })
@@ -79,7 +120,8 @@ async fn cli_main(codex_linux_sandbox_exe: Option<PathBuf>) -> anyhow::Result<()
         None => {
             let mut tui_cli = cli.interactive;
             prepend_config_flags(&mut tui_cli.config_overrides, cli.config_overrides);
-            codex_tui::run_main(tui_cli, codex_linux_sandbox_exe)?;
+            let usage = codex_tui::run_main(tui_cli, codex_linux_sandbox_exe).await?;
+            println!("{}", codex_core::protocol::FinalOutput::from(usage));
         }
         Some(Subcommand::Exec(mut exec_cli)) => {
             prepend_config_flags(&mut exec_cli.config_overrides, cli.config_overrides);
@@ -88,10 +130,28 @@ async fn cli_main(codex_linux_sandbox_exe: Option<PathBuf>) -> anyhow::Result<()
         Some(Subcommand::Mcp) => {
             codex_mcp_server::run_main(codex_linux_sandbox_exe).await?;
         }
+        Some(Subcommand::Login(mut login_cli)) => {
+            prepend_config_flags(&mut login_cli.config_overrides, cli.config_overrides);
+            match login_cli.action {
+                Some(LoginSubcommand::Status) => {
+                    run_login_status(login_cli.config_overrides).await;
+                }
+                None => {
+                    if let Some(api_key) = login_cli.api_key {
+                        run_login_with_api_key(login_cli.config_overrides, api_key).await;
+                    } else {
+                        run_login_with_chatgpt(login_cli.config_overrides).await;
+                    }
+                }
+            }
+        }
         Some(Subcommand::Proto(mut proto_cli)) => {
             prepend_config_flags(&mut proto_cli.config_overrides, cli.config_overrides);
             proto::run_main(proto_cli).await?;
         }
+        Some(Subcommand::Completion(completion_cli)) => {
+            print_completion(completion_cli);
+        }
         Some(Subcommand::Debug(debug_args)) => match debug_args.cmd {
             DebugCommand::Seatbelt(mut seatbelt_cli) => {
                 prepend_config_flags(&mut seatbelt_cli.config_overrides, cli.config_overrides);
@@ -110,6 +170,10 @@ async fn cli_main(codex_linux_sandbox_exe: Option<PathBuf>) -> anyhow::Result<()
                 .await?;
             }
         },
+        Some(Subcommand::Apply(mut apply_cli)) => {
+            prepend_config_flags(&mut apply_cli.config_overrides, cli.config_overrides);
+            run_apply_command(apply_cli, None).await?;
+        }
     }
 
     Ok(())
@@ -125,3 +189,9 @@ fn prepend_config_flags(
         .raw_overrides
         .splice(0..0, cli_config_overrides.raw_overrides);
 }
+
+fn print_completion(cmd: CompletionCommand) {
+    let mut app = MultitoolCli::command();
+    let name = "codex";
+    generate(cmd.shell, &mut app, name, &mut std::io::stdout());
+}

codex-rs/cli/src/proto.rs

@@ -4,10 +4,12 @@ use std::sync::Arc;
 use clap::Parser;
 use codex_common::CliConfigOverrides;
 use codex_core::Codex;
+use codex_core::CodexSpawnOk;
 use codex_core::config::Config;
 use codex_core::config::ConfigOverrides;
 use codex_core::protocol::Submission;
 use codex_core::util::notify_on_sigint;
+use codex_login::load_auth;
 use tokio::io::AsyncBufReadExt;
 use tokio::io::BufReader;
 use tracing::error;
@@ -34,8 +36,9 @@ pub async fn run_main(opts: ProtoCli) -> anyhow::Result<()> {
         .map_err(anyhow::Error::msg)?;
 
     let config = Config::load_with_cli_overrides(overrides_vec, ConfigOverrides::default())?;
+    let auth = load_auth(&config.codex_home, true)?;
     let ctrl_c = notify_on_sigint();
-    let (codex, _init_id) = Codex::spawn(config, ctrl_c.clone()).await?;
+    let CodexSpawnOk { codex, .. } = Codex::spawn(config, auth, ctrl_c.clone()).await?;
     let codex = Arc::new(codex);
 
     // Task that reads JSON lines from stdin and forwards to Submission Queue

codex-rs/common/Cargo.toml

@@ -1,7 +1,7 @@
 [package]
+edition = "2024"
 name = "codex-common"
 version = { workspace = true }
-edition = "2024"
 
 [lints]
 workspace = true
@@ -9,10 +9,11 @@ workspace = true
 [dependencies]
 clap = { version = "4", features = ["derive", "wrap_help"], optional = true }
 codex-core = { path = "../core" }
-toml = { version = "0.8", optional = true }
 serde = { version = "1", optional = true }
+toml = { version = "0.9", optional = true }
 
 [features]
 # Separate feature so that `clap` is not a mandatory dependency.
-cli = ["clap", "toml", "serde"]
+cli = ["clap", "serde", "toml"]
 elapsed = []
+sandbox_summary = []

codex-rs/common/src/approval_mode_cli_arg.rs

@@ -1,27 +1,23 @@
 //! Standard type to use with the `--approval-mode` CLI option.
 //! Available when the `cli` feature is enabled for the crate.
 
-use clap::ArgAction;
-use clap::Parser;
 use clap::ValueEnum;
 
-use codex_core::config::parse_sandbox_permission_with_base_path;
 use codex_core::protocol::AskForApproval;
-use codex_core::protocol::SandboxPermission;
 
 #[derive(Clone, Copy, Debug, ValueEnum)]
 #[value(rename_all = "kebab-case")]
 pub enum ApprovalModeCliArg {
+    /// Only run "trusted" commands (e.g. ls, cat, sed) without asking for user
+    /// approval. Will escalate to the user if the model proposes a command that
+    /// is not in the "trusted" set.
+    Untrusted,
+
     /// Run all commands without asking for user approval.
     /// Only asks for approval if a command fails to execute, in which case it
     /// will escalate to the user to ask for un-sandboxed execution.
     OnFailure,
 
-    /// Only run "known safe" commands (e.g. ls, cat, sed) without
-    /// asking for user approval. Will escalate to the user if the model
-    /// proposes a command that is not allow-listed.
-    UnlessAllowListed,
-
     /// Never ask for user approval
     /// Execution failures are immediately returned to the model.
     Never,
@@ -30,44 +26,9 @@ pub enum ApprovalModeCliArg {
 impl From<ApprovalModeCliArg> for AskForApproval {
     fn from(value: ApprovalModeCliArg) -> Self {
         match value {
+            ApprovalModeCliArg::Untrusted => AskForApproval::UnlessTrusted,
             ApprovalModeCliArg::OnFailure => AskForApproval::OnFailure,
-            ApprovalModeCliArg::UnlessAllowListed => AskForApproval::UnlessAllowListed,
             ApprovalModeCliArg::Never => AskForApproval::Never,
         }
     }
 }
-
-#[derive(Parser, Debug)]
-pub struct SandboxPermissionOption {
-    /// Specify this flag multiple times to specify the full set of permissions
-    /// to grant to Codex.
-    ///
-    /// ```shell
-    /// codex -s disk-full-read-access \
-    ///       -s disk-write-cwd \
-    ///       -s disk-write-platform-user-temp-folder \
-    ///       -s disk-write-platform-global-temp-folder
-    /// ```
-    ///
-    /// Note disk-write-folder takes a value:
-    ///
-    /// ```shell
-    ///     -s disk-write-folder=$HOME/.pyenv/shims
-    /// ```
-    ///
-    /// These permissions are quite broad and should be used with caution:
-    ///
-    /// ```shell
-    ///     -s disk-full-write-access
-    ///     -s network-full-access
-    /// ```
-    #[arg(long = "sandbox-permission", short = 's', action = ArgAction::Append, value_parser = parse_sandbox_permission)]
-    pub permissions: Option<Vec<SandboxPermission>>,
-}
-
-/// Custom value-parser so we can keep the CLI surface small *and*
-/// still handle the parameterised `disk-write-folder` case.
-fn parse_sandbox_permission(raw: &str) -> std::io::Result<SandboxPermission> {
-    let base_path = std::env::current_dir()?;
-    parse_sandbox_permission_with_base_path(raw, base_path)
-}

codex-rs/common/src/config_override.rs

@@ -23,7 +23,7 @@ pub struct CliConfigOverrides {
     /// parse as JSON, the raw string is used as a literal.
     ///
     /// Examples:
-    ///   - `-c model="o4-mini"`
+    ///   - `-c model="o3"`
     ///   - `-c 'sandbox_permissions=["disk-full-read-access"]'`
     ///   - `-c shell_environment_policy.inherit=all`
     #[arg(
@@ -61,10 +61,14 @@ impl CliConfigOverrides {
 
                 // Attempt to parse as JSON. If that fails, treat it as a raw
                 // string. This allows convenient usage such as
-                // `-c model=o4-mini` without the quotes.
+                // `-c model=o3` without the quotes.
                 let value: Value = match parse_toml_value(value_str) {
                     Ok(v) => v,
-                    Err(_) => Value::String(value_str.to_string()),
+                    Err(_) => {
+                        // Strip leading/trailing quotes if present
+                        let trimmed = value_str.trim().trim_matches(|c| c == '"' || c == '\'');
+                        Value::String(trimmed.to_string())
+                    }
                 };
 
                 Ok((key.to_string(), value))

codex-rs/common/src/elapsed.rs

@@ -20,7 +20,7 @@ pub fn format_duration(duration: Duration) -> String {
 
 fn format_elapsed_millis(millis: i64) -> String {
     if millis < 1000 {
-        format!("{}ms", millis)
+        format!("{millis}ms")
     } else if millis < 60_000 {
         format!("{:.2}s", millis as f64 / 1000.0)
     } else {

codex-rs/common/src/lib.rs

@@ -6,11 +6,20 @@ pub mod elapsed;
 
 #[cfg(feature = "cli")]
 pub use approval_mode_cli_arg::ApprovalModeCliArg;
+
 #[cfg(feature = "cli")]
-pub use approval_mode_cli_arg::SandboxPermissionOption;
+mod sandbox_mode_cli_arg;
+
+#[cfg(feature = "cli")]
+pub use sandbox_mode_cli_arg::SandboxModeCliArg;
 
 #[cfg(any(feature = "cli", test))]
 mod config_override;
 
 #[cfg(feature = "cli")]
 pub use config_override::CliConfigOverrides;
+
+mod sandbox_summary;
+
+#[cfg(feature = "sandbox_summary")]
+pub use sandbox_summary::summarize_sandbox_policy;

codex-rs/common/src/sandbox_mode_cli_arg.rs

@@ -0,0 +1,28 @@
+//! Standard type to use with the `--sandbox` (`-s`) CLI option.
+//!
+//! This mirrors the variants of [`codex_core::protocol::SandboxPolicy`], but
+//! without any of the associated data so it can be expressed as a simple flag
+//! on the command-line. Users that need to tweak the advanced options for
+//! `workspace-write` can continue to do so via `-c` overrides or their
+//! `config.toml`.
+
+use clap::ValueEnum;
+use codex_core::config_types::SandboxMode;
+
+#[derive(Clone, Copy, Debug, ValueEnum)]
+#[value(rename_all = "kebab-case")]
+pub enum SandboxModeCliArg {
+    ReadOnly,
+    WorkspaceWrite,
+    DangerFullAccess,
+}
+
+impl From<SandboxModeCliArg> for SandboxMode {
+    fn from(value: SandboxModeCliArg) -> Self {
+        match value {
+            SandboxModeCliArg::ReadOnly => SandboxMode::ReadOnly,
+            SandboxModeCliArg::WorkspaceWrite => SandboxMode::WorkspaceWrite,
+            SandboxModeCliArg::DangerFullAccess => SandboxMode::DangerFullAccess,
+        }
+    }
+}

codex-rs/common/src/sandbox_summary.rs

@@ -0,0 +1,28 @@
+use codex_core::protocol::SandboxPolicy;
+
+pub fn summarize_sandbox_policy(sandbox_policy: &SandboxPolicy) -> String {
+    match sandbox_policy {
+        SandboxPolicy::DangerFullAccess => "danger-full-access".to_string(),
+        SandboxPolicy::ReadOnly => "read-only".to_string(),
+        SandboxPolicy::WorkspaceWrite {
+            writable_roots,
+            network_access,
+        } => {
+            let mut summary = "workspace-write".to_string();
+            if !writable_roots.is_empty() {
+                summary.push_str(&format!(
+                    " [{}]",
+                    writable_roots
+                        .iter()
+                        .map(|p| p.to_string_lossy())
+                        .collect::<Vec<_>>()
+                        .join(", ")
+                ));
+            }
+            if *network_access {
+                summary.push_str(" (network access enabled)");
+            }
+            summary
+        }
+    }
+}

codex-rs/config.md

@@ -0,0 +1,505 @@
+# Config
+
+Codex supports several mechanisms for setting config values:
+
+- Config-specific command-line flags, such as `--model o3` (highest precedence).
+- A generic `-c`/`--config` flag that takes a `key=value` pair, such as `--config model="o3"`.
+  - The key can contain dots to set a value deeper than the root, e.g. `--config model_providers.openai.wire_api="chat"`.
+  - Values can contain objects, such as `--config shell_environment_policy.include_only=["PATH", "HOME", "USER"]`.
+  - For consistency with `config.toml`, values are in TOML format rather than JSON format, so use `{a = 1, b = 2}` rather than `{"a": 1, "b": 2}`.
+  - If `value` cannot be parsed as a valid TOML value, it is treated as a string value. This means that both `-c model="o3"` and `-c model=o3` are equivalent.
+- The `$CODEX_HOME/config.toml` configuration file where the `CODEX_HOME` environment value defaults to `~/.codex`. (Note `CODEX_HOME` will also be where logs and other Codex-related information are stored.)
+
+Both the `--config` flag and the `config.toml` file support the following options:
+
+## model
+
+The model that Codex should use.
+
+```toml
+model = "o3"  # overrides the default of "codex-mini-latest"
+```
+
+## model_providers
+
+This option lets you override and amend the default set of model providers bundled with Codex. This value is a map where the key is the value to use with `model_provider` to select the corresponding provider.
+
+For example, if you wanted to add a provider that uses the OpenAI 4o model via the chat completions API, then you could add the following configuration:
+
+```toml
+# Recall that in TOML, root keys must be listed before tables.
+model = "gpt-4o"
+model_provider = "openai-chat-completions"
+
+[model_providers.openai-chat-completions]
+# Name of the provider that will be displayed in the Codex UI.
+name = "OpenAI using Chat Completions"
+# The path `/chat/completions` will be amended to this URL to make the POST
+# request for the chat completions.
+base_url = "https://api.openai.com/v1"
+# If `env_key` is set, identifies an environment variable that must be set when
+# using Codex with this provider. The value of the environment variable must be
+# non-empty and will be used in the `Bearer TOKEN` HTTP header for the POST request.
+env_key = "OPENAI_API_KEY"
+# Valid values for wire_api are "chat" and "responses". Defaults to "chat" if omitted.
+wire_api = "chat"
+# If necessary, extra query params that need to be added to the URL.
+# See the Azure example below.
+query_params = {}
+```
+
+Note this makes it possible to use Codex CLI with non-OpenAI models, so long as they use a wire API that is compatible with the OpenAI chat completions API. For example, you could define the following provider to use Codex CLI with Ollama running locally:
+
+```toml
+[model_providers.ollama]
+name = "Ollama"
+base_url = "http://localhost:11434/v1"
+```
+
+Or a third-party provider (using a distinct environment variable for the API key):
+
+```toml
+[model_providers.mistral]
+name = "Mistral"
+base_url = "https://api.mistral.ai/v1"
+env_key = "MISTRAL_API_KEY"
+```
+
+Note that Azure requires `api-version` to be passed as a query parameter, so be sure to specify it as part of `query_params` when defining the Azure provider:
+
+```toml
+[model_providers.azure]
+name = "Azure"
+# Make sure you set the appropriate subdomain for this URL.
+base_url = "https://YOUR_PROJECT_NAME.openai.azure.com/openai"
+env_key = "AZURE_OPENAI_API_KEY"  # Or "OPENAI_API_KEY", whichever you use.
+query_params = { api-version = "2025-04-01-preview" }
+```
+
+It is also possible to configure a provider to include extra HTTP headers with a request. These can be hardcoded values (`http_headers`) or values read from environment variables (`env_http_headers`):
+
+```toml
+[model_providers.example]
+# name, base_url, ...
+
+# This will add the HTTP header `X-Example-Header` with value `example-value`
+# to each request to the model provider.
+http_headers = { "X-Example-Header" = "example-value" }
+
+# This will add the HTTP header `X-Example-Features` with the value of the
+# `EXAMPLE_FEATURES` environment variable to each request to the model provider
+# _if_ the environment variable is set and its value is non-empty.
+env_http_headers = { "X-Example-Features": "EXAMPLE_FEATURES" }
+```
+
+### Per-provider network tuning
+
+The following optional settings control retry behaviour and streaming idle timeouts **per model provider**. They must be specified inside the corresponding `[model_providers.<id>]` block in `config.toml`. (Older releases accepted top‑level keys; those are now ignored.)
+
+Example:
+
+```toml
+[model_providers.openai]
+name = "OpenAI"
+base_url = "https://api.openai.com/v1"
+env_key = "OPENAI_API_KEY"
+# network tuning overrides (all optional; falls back to built‑in defaults)
+request_max_retries = 4            # retry failed HTTP requests
+stream_max_retries = 10            # retry dropped SSE streams
+stream_idle_timeout_ms = 300000    # 5m idle timeout
+```
+
+#### request_max_retries
+
+How many times Codex will retry a failed HTTP request to the model provider. Defaults to `4`.
+
+#### stream_max_retries
+
+Number of times Codex will attempt to reconnect when a streaming response is interrupted. Defaults to `10`.
+
+#### stream_idle_timeout_ms
+
+How long Codex will wait for activity on a streaming response before treating the connection as lost. Defaults to `300_000` (5 minutes).
+
+## model_provider
+
+Identifies which provider to use from the `model_providers` map. Defaults to `"openai"`. You can override the `base_url` for the built-in `openai` provider via the `OPENAI_BASE_URL` environment variable.
+
+Note that if you override `model_provider`, then you likely want to override
+`model`, as well. For example, if you are running ollama with Mistral locally,
+then you would need to add the following to your config in addition to the new entry in the `model_providers` map:
+
+```toml
+model_provider = "ollama"
+model = "mistral"
+```
+
+## approval_policy
+
+Determines when the user should be prompted to approve whether Codex can execute a command:
+
+```toml
+# Codex has hardcoded logic that defines a set of "trusted" commands.
+# Setting the approval_policy to `untrusted` means that Codex will prompt the
+# user before running a command not in the "trusted" set.
+#
+# See https://github.com/openai/codex/issues/1260 for the plan to enable
+# end-users to define their own trusted commands.
+approval_policy = "untrusted"
+```
+
+```toml
+# If the command fails when run in the sandbox, Codex asks for permission to
+# retry the command outside the sandbox.
+approval_policy = "on-failure"
+```
+
+```toml
+# User is never prompted: if the command fails, Codex will automatically try
+# something out. Note the `exec` subcommand always uses this mode.
+approval_policy = "never"
+```
+
+## profiles
+
+A _profile_ is a collection of configuration values that can be set together. Multiple profiles can be defined in `config.toml` and you can specify the one you
+want to use at runtime via the `--profile` flag.
+
+Here is an example of a `config.toml` that defines multiple profiles:
+
+```toml
+model = "o3"
+approval_policy = "unless-allow-listed"
+disable_response_storage = false
+
+# Setting `profile` is equivalent to specifying `--profile o3` on the command
+# line, though the `--profile` flag can still be used to override this value.
+profile = "o3"
+
+[model_providers.openai-chat-completions]
+name = "OpenAI using Chat Completions"
+base_url = "https://api.openai.com/v1"
+env_key = "OPENAI_API_KEY"
+wire_api = "chat"
+
+[profiles.o3]
+model = "o3"
+model_provider = "openai"
+approval_policy = "never"
+model_reasoning_effort = "high"
+model_reasoning_summary = "detailed"
+
+[profiles.gpt3]
+model = "gpt-3.5-turbo"
+model_provider = "openai-chat-completions"
+
+[profiles.zdr]
+model = "o3"
+model_provider = "openai"
+approval_policy = "on-failure"
+disable_response_storage = true
+```
+
+Users can specify config values at multiple levels. Order of precedence is as follows:
+
+1. custom command-line argument, e.g., `--model o3`
+2. as part of a profile, where the `--profile` is specified via a CLI (or in the config file itself)
+3. as an entry in `config.toml`, e.g., `model = "o3"`
+4. the default value that comes with Codex CLI (i.e., Codex CLI defaults to `codex-mini-latest`)
+
+## model_reasoning_effort
+
+If the model name starts with `"o"` (as in `"o3"` or `"o4-mini"`) or `"codex"`, reasoning is enabled by default when using the Responses API. As explained in the [OpenAI Platform documentation](https://platform.openai.com/docs/guides/reasoning?api-mode=responses#get-started-with-reasoning), this can be set to:
+
+- `"low"`
+- `"medium"` (default)
+- `"high"`
+
+To disable reasoning, set `model_reasoning_effort` to `"none"` in your config:
+
+```toml
+model_reasoning_effort = "none"  # disable reasoning
+```
+
+## model_reasoning_summary
+
+If the model name starts with `"o"` (as in `"o3"` or `"o4-mini"`) or `"codex"`, reasoning is enabled by default when using the Responses API. As explained in the [OpenAI Platform documentation](https://platform.openai.com/docs/guides/reasoning?api-mode=responses#reasoning-summaries), this can be set to:
+
+- `"auto"` (default)
+- `"concise"`
+- `"detailed"`
+
+To disable reasoning summaries, set `model_reasoning_summary` to `"none"` in your config:
+
+```toml
+model_reasoning_summary = "none"  # disable reasoning summaries
+```
+
+## model_supports_reasoning_summaries
+
+By default, `reasoning` is only set on requests to OpenAI models that are known to support them. To force `reasoning` to set on requests to the current model, you can force this behavior by setting the following in `config.toml`:
+
+```toml
+model_supports_reasoning_summaries = true
+```
+
+## sandbox_mode
+
+Codex executes model-generated shell commands inside an OS-level sandbox.
+
+In most cases you can pick the desired behaviour with a single option:
+
+```toml
+# same as `--sandbox read-only`
+sandbox_mode = "read-only"
+```
+
+The default policy is `read-only`, which means commands can read any file on
+disk, but attempts to write a file or access the network will be blocked.
+
+A more relaxed policy is `workspace-write`. When specified, the current working directory for the Codex task will be writable (as well as `$TMPDIR` on macOS). Note that the CLI defaults to using the directory where it was spawned as `cwd`, though this can be overridden using `--cwd/-C`.
+
+```toml
+# same as `--sandbox workspace-write`
+sandbox_mode = "workspace-write"
+
+# Extra settings that only apply when `sandbox = "workspace-write"`.
+[sandbox_workspace_write]
+# By default, only the cwd for the Codex session will be writable (and $TMPDIR
+# on macOS), but you can specify additional writable folders in this array.
+writable_roots = ["/tmp"]
+# Allow the command being run inside the sandbox to make outbound network
+# requests. Disabled by default.
+network_access = false
+```
+
+To disable sandboxing altogether, specify `danger-full-access` like so:
+
+```toml
+# same as `--sandbox danger-full-access`
+sandbox_mode = "danger-full-access"
+```
+
+This is reasonable to use if Codex is running in an environment that provides its own sandboxing (such as a Docker container) such that further sandboxing is unnecessary.
+
+Though using this option may also be necessary if you try to use Codex in environments where its native sandboxing mechanisms are unsupported, such as older Linux kernels or on Windows.
+
+## mcp_servers
+
+Defines the list of MCP servers that Codex can consult for tool use. Currently, only servers that are launched by executing a program that communicate over stdio are supported. For servers that use the SSE transport, consider an adapter like [mcp-proxy](https://github.com/sparfenyuk/mcp-proxy).
+
+**Note:** Codex may cache the list of tools and resources from an MCP server so that Codex can include this information in context at startup without spawning all the servers. This is designed to save resources by loading MCP servers lazily.
+
+This config option is comparable to how Claude and Cursor define `mcpServers` in their respective JSON config files, though because Codex uses TOML for its config language, the format is slightly different. For example, the following config in JSON:
+
+```json
+{
+  "mcpServers": {
+    "server-name": {
+      "command": "npx",
+      "args": ["-y", "mcp-server"],
+      "env": {
+        "API_KEY": "value"
+      }
+    }
+  }
+}
+```
+
+Should be represented as follows in `~/.codex/config.toml`:
+
+```toml
+# IMPORTANT: the top-level key is `mcp_servers` rather than `mcpServers`.
+[mcp_servers.server-name]
+command = "npx"
+args = ["-y", "mcp-server"]
+env = { "API_KEY" = "value" }
+```
+
+## disable_response_storage
+
+Currently, customers whose accounts are set to use Zero Data Retention (ZDR) must set `disable_response_storage` to `true` so that Codex uses an alternative to the Responses API that works with ZDR:
+
+```toml
+disable_response_storage = true
+```
+
+## shell_environment_policy
+
+Codex spawns subprocesses (e.g. when executing a `local_shell` tool-call suggested by the assistant). By default it passes **only a minimal core subset** of your environment to those subprocesses to avoid leaking credentials. You can tune this behavior via the **`shell_environment_policy`** block in
+`config.toml`:
+
+```toml
+[shell_environment_policy]
+# inherit can be "core" (default), "all", or "none"
+inherit = "core"
+# set to true to *skip* the filter for `"*KEY*"` and `"*TOKEN*"`
+ignore_default_excludes = false
+# exclude patterns (case-insensitive globs)
+exclude = ["AWS_*", "AZURE_*"]
+# force-set / override values
+set = { CI = "1" }
+# if provided, *only* vars matching these patterns are kept
+include_only = ["PATH", "HOME"]
+```
+
+| Field                     | Type                       | Default | Description                                                                                                                                     |
+| ------------------------- | -------------------------- | ------- | ----------------------------------------------------------------------------------------------------------------------------------------------- |
+| `inherit`                 | string                     | `core`  | Starting template for the environment:<br>`core` (`HOME`, `PATH`, `USER`, …), `all` (clone full parent env), or `none` (start empty).           |
+| `ignore_default_excludes` | boolean                    | `false` | When `false`, Codex removes any var whose **name** contains `KEY`, `SECRET`, or `TOKEN` (case-insensitive) before other rules run.              |
+| `exclude`                 | array&lt;string&gt;        | `[]`    | Case-insensitive glob patterns to drop after the default filter.<br>Examples: `"AWS_*"`, `"AZURE_*"`.                                           |
+| `set`                     | table&lt;string,string&gt; | `{}`    | Explicit key/value overrides or additions – always win over inherited values.                                                                   |
+| `include_only`            | array&lt;string&gt;        | `[]`    | If non-empty, a whitelist of patterns; only variables that match _one_ pattern survive the final step. (Generally used with `inherit = "all"`.) |
+
+The patterns are **glob style**, not full regular expressions: `*` matches any
+number of characters, `?` matches exactly one, and character classes like
+`[A-Z]`/`[^0-9]` are supported. Matching is always **case-insensitive**. This
+syntax is documented in code as `EnvironmentVariablePattern` (see
+`core/src/config_types.rs`).
+
+If you just need a clean slate with a few custom entries you can write:
+
+```toml
+[shell_environment_policy]
+inherit = "none"
+set = { PATH = "/usr/bin", MY_FLAG = "1" }
+```
+
+Currently, `CODEX_SANDBOX_NETWORK_DISABLED=1` is also added to the environment, assuming network is disabled. This is not configurable.
+
+## notify
+
+Specify a program that will be executed to get notified about events generated by Codex. Note that the program will receive the notification argument as a string of JSON, e.g.:
+
+```json
+{
+  "type": "agent-turn-complete",
+  "turn-id": "12345",
+  "input-messages": ["Rename `foo` to `bar` and update the callsites."],
+  "last-assistant-message": "Rename complete and verified `cargo build` succeeds."
+}
+```
+
+The `"type"` property will always be set. Currently, `"agent-turn-complete"` is the only notification type that is supported.
+
+As an example, here is a Python script that parses the JSON and decides whether to show a desktop push notification using [terminal-notifier](https://github.com/julienXX/terminal-notifier) on macOS:
+
+```python
+#!/usr/bin/env python3
+
+import json
+import subprocess
+import sys
+
+
+def main() -> int:
+    if len(sys.argv) != 2:
+        print("Usage: notify.py <NOTIFICATION_JSON>")
+        return 1
+
+    try:
+        notification = json.loads(sys.argv[1])
+    except json.JSONDecodeError:
+        return 1
+
+    match notification_type := notification.get("type"):
+        case "agent-turn-complete":
+            assistant_message = notification.get("last-assistant-message")
+            if assistant_message:
+                title = f"Codex: {assistant_message}"
+            else:
+                title = "Codex: Turn Complete!"
+            input_messages = notification.get("input_messages", [])
+            message = " ".join(input_messages)
+            title += message
+        case _:
+            print(f"not sending a push notification for: {notification_type}")
+            return 0
+
+    subprocess.check_output(
+        [
+            "terminal-notifier",
+            "-title",
+            title,
+            "-message",
+            message,
+            "-group",
+            "codex",
+            "-ignoreDnD",
+            "-activate",
+            "com.googlecode.iterm2",
+        ]
+    )
+
+    return 0
+
+
+if __name__ == "__main__":
+    sys.exit(main())
+```
+
+To have Codex use this script for notifications, you would configure it via `notify` in `~/.codex/config.toml` using the appropriate path to `notify.py` on your computer:
+
+```toml
+notify = ["python3", "/Users/mbolin/.codex/notify.py"]
+```
+
+## history
+
+By default, Codex CLI records messages sent to the model in `$CODEX_HOME/history.jsonl`. Note that on UNIX, the file permissions are set to `o600`, so it should only be readable and writable by the owner.
+
+To disable this behavior, configure `[history]` as follows:
+
+```toml
+[history]
+persistence = "none"  # "save-all" is the default value
+```
+
+## file_opener
+
+Identifies the editor/URI scheme to use for hyperlinking citations in model output. If set, citations to files in the model output will be hyperlinked using the specified URI scheme so they can be ctrl/cmd-clicked from the terminal to open them.
+
+For example, if the model output includes a reference such as `【F:/home/user/project/main.py†L42-L50】`, then this would be rewritten to link to the URI `vscode://file/home/user/project/main.py:42`.
+
+Note this is **not** a general editor setting (like `$EDITOR`), as it only accepts a fixed set of values:
+
+- `"vscode"` (default)
+- `"vscode-insiders"`
+- `"windsurf"`
+- `"cursor"`
+- `"none"` to explicitly disable this feature
+
+Currently, `"vscode"` is the default, though Codex does not verify VS Code is installed. As such, `file_opener` may default to `"none"` or something else in the future.
+
+## hide_agent_reasoning
+
+Codex intermittently emits "reasoning" events that show the model's internal "thinking" before it produces a final answer. Some users may find these events distracting, especially in CI logs or minimal terminal output.
+
+Setting `hide_agent_reasoning` to `true` suppresses these events in **both** the TUI as well as the headless `exec` sub-command:
+
+```toml
+hide_agent_reasoning = true   # defaults to false
+```
+
+## model_context_window
+
+The size of the context window for the model, in tokens.
+
+In general, Codex knows the context window for the most common OpenAI models, but if you are using a new model with an old version of the Codex CLI, then you can use `model_context_window` to tell Codex what value to use to determine how much context is left during a conversation.
+
+## model_max_output_tokens
+
+This is analogous to `model_context_window`, but for the maximum number of output tokens for the model.
+
+## project_doc_max_bytes
+
+Maximum number of bytes to read from an `AGENTS.md` file to include in the instructions sent with the first turn of a session. Defaults to 32 KiB.
+
+## tui
+
+Options that are specific to the TUI.
+
+```toml
+[tui]
+# More to come here
+```

codex-rs/core/Cargo.toml

@@ -1,7 +1,7 @@
 [package]
+edition = "2024"
 name = "codex-core"
 version = { workspace = true }
-edition = "2024"
 
 [lib]
 name = "codex_core"
@@ -13,24 +13,27 @@ workspace = true
 [dependencies]
 anyhow = "1"
 async-channel = "2.3.1"
-base64 = "0.21"
+base64 = "0.22"
 bytes = "1.10.1"
+chrono = { version = "0.4", features = ["serde"] }
 codex-apply-patch = { path = "../apply-patch" }
+codex-login = { path = "../login" }
 codex-mcp-client = { path = "../mcp-client" }
 dirs = "6"
 env-flags = "0.1.1"
 eventsource-stream = "0.2.3"
 fs2 = "0.4.3"
-fs-err = "3.1.0"
 futures = "0.3"
+libc = "0.2.174"
 mcp-types = { path = "../mcp-types" }
 mime_guess = "2.0"
-patch = "0.7"
-path-absolutize = "3.1.1"
 rand = "0.9"
 reqwest = { version = "0.12", features = ["json", "stream"] }
 serde = { version = "1", features = ["derive"] }
 serde_json = "1"
+sha1 = "0.10.6"
+shlex = "1.3.0"
+strum_macros = "0.27.2"
 thiserror = "2.0.12"
 time = { version = "0.3", features = ["formatting", "local-offset", "macros"] }
 tokio = { version = "1", features = [
@@ -41,13 +44,15 @@ tokio = { version = "1", features = [
     "signal",
 ] }
 tokio-util = "0.7.14"
-toml = "0.8.20"
+toml = "0.9.2"
 tracing = { version = "0.1.41", features = ["log"] }
-tree-sitter = "0.25.3"
-tree-sitter-bash = "0.23.3"
+tree-sitter = "0.25.8"
+tree-sitter-bash = "0.25.0"
 uuid = { version = "1", features = ["serde", "v4"] }
+whoami = "1.6.0"
 wildmatch = "2.4.0"
 
+
 [target.'cfg(target_os = "linux")'.dependencies]
 landlock = "0.4.1"
 seccompiler = "0.5.0"
@@ -56,10 +61,17 @@ seccompiler = "0.5.0"
 [target.x86_64-unknown-linux-musl.dependencies]
 openssl-sys = { version = "*", features = ["vendored"] }
 
+# Build OpenSSL from source for musl builds.
+[target.aarch64-unknown-linux-musl.dependencies]
+openssl-sys = { version = "*", features = ["vendored"] }
+
 [dev-dependencies]
 assert_cmd = "2"
+core_test_support = { path = "tests/common" }
 maplit = "1.0.2"
 predicates = "3"
 pretty_assertions = "1.4.1"
 tempfile = "3"
+tokio-test = "0.4"
+walkdir = "2.5.0"
 wiremock = "0.6"

codex-rs/core/README.md

@@ -2,9 +2,18 @@
 
 This crate implements the business logic for Codex. It is designed to be used by the various Codex UIs written in Rust.
 
-Though for non-Rust UIs, we are also working to define a _protocol_ for talking to Codex. See:
+## Dependencies
 
-- [Specification](../docs/protocol_v1.md)
-- [Rust types](./src/protocol.rs)
+Note that `codex-core` makes some assumptions about certain helper utilities being available in the environment. Currently, this
 
-You can use the `proto` subcommand using the executable in the [`cli` crate](../cli) to speak the protocol using newline-delimited-JSON over stdin/stdout.
+### macOS
+
+Expects `/usr/bin/sandbox-exec` to be present.
+
+### Linux
+
+Expects the binary containing `codex-core` to run the equivalent of `codex debug landlock` when `arg0` is `codex-linux-sandbox`. See the `codex-arg0` crate for details.
+
+### All Platforms
+
+Expects the binary containing `codex-core` to simulate the virtual `apply_patch` CLI when `arg1` is `--codex-run-as-apply-patch`. See the `codex-arg0` crate for details.

codex-rs/core/prompt.md

@@ -96,3 +96,12 @@ You can invoke apply_patch like:
 ```
 shell {"command":["apply_patch","*** Begin Patch\n*** Add File: hello.txt\n+Hello, world!\n*** End Patch\n"]}
 ```
+
+Plan updates
+
+A tool named `update_plan` is available. Use it to keep an up‑to‑date, step‑by‑step plan for the task so you can follow your progress. When making your plans, keep in mind that you are a deployed coding agent - `update_plan` calls should not involve doing anything that you aren't capable of doing. For example, `update_plan` calls should NEVER contain tasks to merge your own pull requests. Only stop to ask the user if you genuinely need their feedback on a change.
+
+- At the start of the task, call `update_plan` with an initial plan: a short list of 1‑sentence steps with a `status` for each step (`pending`, `in_progress`, or `completed`). There should always be exactly one `in_progress` step until everything is done.
+- Whenever you finish a step, call `update_plan` again, marking the finished step as `completed` and the next step as `in_progress`.
+- If your plan needs to change, call `update_plan` with the revised steps and include an `explanation` describing the change.
+- When all steps are complete, make a final `update_plan` call with all steps marked `completed`.

codex-rs/core/src/apply_patch.rs

@@ -0,0 +1,157 @@
+use crate::codex::Session;
+use crate::models::FunctionCallOutputPayload;
+use crate::models::ResponseInputItem;
+use crate::protocol::FileChange;
+use crate::protocol::ReviewDecision;
+use crate::safety::SafetyCheck;
+use crate::safety::assess_patch_safety;
+use codex_apply_patch::ApplyPatchAction;
+use codex_apply_patch::ApplyPatchFileChange;
+use std::collections::HashMap;
+use std::path::Path;
+use std::path::PathBuf;
+
+pub const CODEX_APPLY_PATCH_ARG1: &str = "--codex-run-as-apply-patch";
+
+pub(crate) enum InternalApplyPatchInvocation {
+    /// The `apply_patch` call was handled programmatically, without any sort
+    /// of sandbox, because the user explicitly approved it. This is the
+    /// result to use with the `shell` function call that contained `apply_patch`.
+    Output(ResponseInputItem),
+
+    /// The `apply_patch` call was approved, either automatically because it
+    /// appears that it should be allowed based on the user's sandbox policy
+    /// *or* because the user explicitly approved it. In either case, we use
+    /// exec with [`CODEX_APPLY_PATCH_ARG1`] to realize the `apply_patch` call,
+    /// but [`ApplyPatchExec::auto_approved`] is used to determine the sandbox
+    /// used with the `exec()`.
+    DelegateToExec(ApplyPatchExec),
+}
+
+pub(crate) struct ApplyPatchExec {
+    pub(crate) action: ApplyPatchAction,
+    pub(crate) user_explicitly_approved_this_action: bool,
+}
+
+impl From<ResponseInputItem> for InternalApplyPatchInvocation {
+    fn from(item: ResponseInputItem) -> Self {
+        InternalApplyPatchInvocation::Output(item)
+    }
+}
+
+pub(crate) async fn apply_patch(
+    sess: &Session,
+    sub_id: &str,
+    call_id: &str,
+    action: ApplyPatchAction,
+) -> InternalApplyPatchInvocation {
+    let writable_roots_snapshot = {
+        #[allow(clippy::unwrap_used)]
+        let guard = sess.writable_roots.lock().unwrap();
+        guard.clone()
+    };
+
+    match assess_patch_safety(
+        &action,
+        sess.approval_policy,
+        &writable_roots_snapshot,
+        &sess.cwd,
+    ) {
+        SafetyCheck::AutoApprove { .. } => {
+            InternalApplyPatchInvocation::DelegateToExec(ApplyPatchExec {
+                action,
+                user_explicitly_approved_this_action: false,
+            })
+        }
+        SafetyCheck::AskUser => {
+            // Compute a readable summary of path changes to include in the
+            // approval request so the user can make an informed decision.
+            //
+            // Note that it might be worth expanding this approval request to
+            // give the user the option to expand the set of writable roots so
+            // that similar patches can be auto-approved in the future during
+            // this session.
+            let rx_approve = sess
+                .request_patch_approval(sub_id.to_owned(), call_id.to_owned(), &action, None, None)
+                .await;
+            match rx_approve.await.unwrap_or_default() {
+                ReviewDecision::Approved | ReviewDecision::ApprovedForSession => {
+                    InternalApplyPatchInvocation::DelegateToExec(ApplyPatchExec {
+                        action,
+                        user_explicitly_approved_this_action: true,
+                    })
+                }
+                ReviewDecision::Denied | ReviewDecision::Abort => {
+                    ResponseInputItem::FunctionCallOutput {
+                        call_id: call_id.to_owned(),
+                        output: FunctionCallOutputPayload {
+                            content: "patch rejected by user".to_string(),
+                            success: Some(false),
+                        },
+                    }
+                    .into()
+                }
+            }
+        }
+        SafetyCheck::Reject { reason } => ResponseInputItem::FunctionCallOutput {
+            call_id: call_id.to_owned(),
+            output: FunctionCallOutputPayload {
+                content: format!("patch rejected: {reason}"),
+                success: Some(false),
+            },
+        }
+        .into(),
+    }
+}
+
+pub(crate) fn convert_apply_patch_to_protocol(
+    action: &ApplyPatchAction,
+) -> HashMap<PathBuf, FileChange> {
+    let changes = action.changes();
+    let mut result = HashMap::with_capacity(changes.len());
+    for (path, change) in changes {
+        let protocol_change = match change {
+            ApplyPatchFileChange::Add { content } => FileChange::Add {
+                content: content.clone(),
+            },
+            ApplyPatchFileChange::Delete => FileChange::Delete,
+            ApplyPatchFileChange::Update {
+                unified_diff,
+                move_path,
+                new_content: _new_content,
+            } => FileChange::Update {
+                unified_diff: unified_diff.clone(),
+                move_path: move_path.clone(),
+            },
+        };
+        result.insert(path.clone(), protocol_change);
+    }
+    result
+}
+
+pub(crate) fn get_writable_roots(cwd: &Path) -> Vec<PathBuf> {
+    let mut writable_roots = Vec::new();
+    if cfg!(target_os = "macos") {
+        // On macOS, $TMPDIR is private to the user.
+        writable_roots.push(std::env::temp_dir());
+
+        // Allow pyenv to update its shims directory. Without this, any tool
+        // that happens to be managed by `pyenv` will fail with an error like:
+        //
+        //   pyenv: cannot rehash: $HOME/.pyenv/shims isn't writable
+        //
+        // which is emitted every time `pyenv` tries to run `rehash` (for
+        // example, after installing a new Python package that drops an entry
+        // point). Although the sandbox is intentionally read‑only by default,
+        // writing to the user's local `pyenv` directory is safe because it
+        // is already user‑writable and scoped to the current user account.
+        if let Ok(home_dir) = std::env::var("HOME") {
+            let pyenv_dir = PathBuf::from(home_dir).join(".pyenv");
+            writable_roots.push(pyenv_dir);
+        }
+    }
+
+    writable_roots.push(cwd.to_path_buf());
+
+    writable_roots
+}

codex-rs/core/src/bash.rs

@@ -0,0 +1,219 @@
+use tree_sitter::Parser;
+use tree_sitter::Tree;
+use tree_sitter_bash::LANGUAGE as BASH;
+
+/// Parse the provided bash source using tree-sitter-bash, returning a Tree on
+/// success or None if parsing failed.
+pub fn try_parse_bash(bash_lc_arg: &str) -> Option<Tree> {
+    let lang = BASH.into();
+    let mut parser = Parser::new();
+    #[expect(clippy::expect_used)]
+    parser.set_language(&lang).expect("load bash grammar");
+    let old_tree: Option<&Tree> = None;
+    parser.parse(bash_lc_arg, old_tree)
+}
+
+/// Parse a script which may contain multiple simple commands joined only by
+/// the safe logical/pipe/sequencing operators: `&&`, `||`, `;`, `|`.
+///
+/// Returns `Some(Vec<command_words>)` if every command is a plain word‑only
+/// command and the parse tree does not contain disallowed constructs
+/// (parentheses, redirections, substitutions, control flow, etc.). Otherwise
+/// returns `None`.
+pub fn try_parse_word_only_commands_sequence(tree: &Tree, src: &str) -> Option<Vec<Vec<String>>> {
+    if tree.root_node().has_error() {
+        return None;
+    }
+
+    // List of allowed (named) node kinds for a "word only commands sequence".
+    // If we encounter a named node that is not in this list we reject.
+    const ALLOWED_KINDS: &[&str] = &[
+        // top level containers
+        "program",
+        "list",
+        "pipeline",
+        // commands & words
+        "command",
+        "command_name",
+        "word",
+        "string",
+        "string_content",
+        "raw_string",
+        "number",
+    ];
+    // Allow only safe punctuation / operator tokens; anything else causes reject.
+    const ALLOWED_PUNCT_TOKENS: &[&str] = &["&&", "||", ";", "|", "\"", "'"];
+
+    let root = tree.root_node();
+    let mut cursor = root.walk();
+    let mut stack = vec![root];
+    let mut command_nodes = Vec::new();
+    while let Some(node) = stack.pop() {
+        let kind = node.kind();
+        if node.is_named() {
+            if !ALLOWED_KINDS.contains(&kind) {
+                return None;
+            }
+            if kind == "command" {
+                command_nodes.push(node);
+            }
+        } else {
+            // Reject any punctuation / operator tokens that are not explicitly allowed.
+            if kind.chars().any(|c| "&;|".contains(c)) && !ALLOWED_PUNCT_TOKENS.contains(&kind) {
+                return None;
+            }
+            if !(ALLOWED_PUNCT_TOKENS.contains(&kind) || kind.trim().is_empty()) {
+                // If it's a quote token or operator it's allowed above; we also allow whitespace tokens.
+                // Any other punctuation like parentheses, braces, redirects, backticks, etc are rejected.
+                return None;
+            }
+        }
+        for child in node.children(&mut cursor) {
+            stack.push(child);
+        }
+    }
+
+    let mut commands = Vec::new();
+    for node in command_nodes {
+        if let Some(words) = parse_plain_command_from_node(node, src) {
+            commands.push(words);
+        } else {
+            return None;
+        }
+    }
+    Some(commands)
+}
+
+fn parse_plain_command_from_node(cmd: tree_sitter::Node, src: &str) -> Option<Vec<String>> {
+    if cmd.kind() != "command" {
+        return None;
+    }
+    let mut words = Vec::new();
+    let mut cursor = cmd.walk();
+    for child in cmd.named_children(&mut cursor) {
+        match child.kind() {
+            "command_name" => {
+                let word_node = child.named_child(0)?;
+                if word_node.kind() != "word" {
+                    return None;
+                }
+                words.push(word_node.utf8_text(src.as_bytes()).ok()?.to_owned());
+            }
+            "word" | "number" => {
+                words.push(child.utf8_text(src.as_bytes()).ok()?.to_owned());
+            }
+            "string" => {
+                if child.child_count() == 3
+                    && child.child(0)?.kind() == "\""
+                    && child.child(1)?.kind() == "string_content"
+                    && child.child(2)?.kind() == "\""
+                {
+                    words.push(child.child(1)?.utf8_text(src.as_bytes()).ok()?.to_owned());
+                } else {
+                    return None;
+                }
+            }
+            "raw_string" => {
+                let raw_string = child.utf8_text(src.as_bytes()).ok()?;
+                let stripped = raw_string
+                    .strip_prefix('\'')
+                    .and_then(|s| s.strip_suffix('\''));
+                if let Some(s) = stripped {
+                    words.push(s.to_owned());
+                } else {
+                    return None;
+                }
+            }
+            _ => return None,
+        }
+    }
+    Some(words)
+}
+
+#[cfg(test)]
+mod tests {
+    #![allow(clippy::unwrap_used)]
+    use super::*;
+
+    fn parse_seq(src: &str) -> Option<Vec<Vec<String>>> {
+        let tree = try_parse_bash(src)?;
+        try_parse_word_only_commands_sequence(&tree, src)
+    }
+
+    #[test]
+    fn accepts_single_simple_command() {
+        let cmds = parse_seq("ls -1").unwrap();
+        assert_eq!(cmds, vec![vec!["ls".to_string(), "-1".to_string()]]);
+    }
+
+    #[test]
+    fn accepts_multiple_commands_with_allowed_operators() {
+        let src = "ls && pwd; echo 'hi there' | wc -l";
+        let cmds = parse_seq(src).unwrap();
+        let expected: Vec<Vec<String>> = vec![
+            vec!["wc".to_string(), "-l".to_string()],
+            vec!["echo".to_string(), "hi there".to_string()],
+            vec!["pwd".to_string()],
+            vec!["ls".to_string()],
+        ];
+        assert_eq!(cmds, expected);
+    }
+
+    #[test]
+    fn extracts_double_and_single_quoted_strings() {
+        let cmds = parse_seq("echo \"hello world\"").unwrap();
+        assert_eq!(
+            cmds,
+            vec![vec!["echo".to_string(), "hello world".to_string()]]
+        );
+
+        let cmds2 = parse_seq("echo 'hi there'").unwrap();
+        assert_eq!(
+            cmds2,
+            vec![vec!["echo".to_string(), "hi there".to_string()]]
+        );
+    }
+
+    #[test]
+    fn accepts_numbers_as_words() {
+        let cmds = parse_seq("echo 123 456").unwrap();
+        assert_eq!(
+            cmds,
+            vec![vec![
+                "echo".to_string(),
+                "123".to_string(),
+                "456".to_string()
+            ]]
+        );
+    }
+
+    #[test]
+    fn rejects_parentheses_and_subshells() {
+        assert!(parse_seq("(ls)").is_none());
+        assert!(parse_seq("ls || (pwd && echo hi)").is_none());
+    }
+
+    #[test]
+    fn rejects_redirections_and_unsupported_operators() {
+        assert!(parse_seq("ls > out.txt").is_none());
+        assert!(parse_seq("echo hi & echo bye").is_none());
+    }
+
+    #[test]
+    fn rejects_command_and_process_substitutions_and_expansions() {
+        assert!(parse_seq("echo $(pwd)").is_none());
+        assert!(parse_seq("echo `pwd`").is_none());
+        assert!(parse_seq("echo $HOME").is_none());
+        assert!(parse_seq("echo \"hi $USER\"").is_none());
+    }
+
+    #[test]
+    fn rejects_variable_assignment_prefix() {
+        assert!(parse_seq("FOO=bar ls").is_none());
+    }
+
+    #[test]
+    fn rejects_trailing_operator_parse_error() {
+        assert!(parse_seq("ls &&").is_none());
+    }
+}

codex-rs/core/src/chat_completions.rs

@@ -21,62 +21,116 @@ use crate::client_common::ResponseEvent;
 use crate::client_common::ResponseStream;
 use crate::error::CodexErr;
 use crate::error::Result;
-use crate::flags::OPENAI_REQUEST_MAX_RETRIES;
-use crate::flags::OPENAI_STREAM_IDLE_TIMEOUT_MS;
 use crate::models::ContentItem;
 use crate::models::ResponseItem;
+use crate::openai_tools::create_tools_json_for_chat_completions_api;
 use crate::util::backoff;
 
-/// Implementation for the classic Chat Completions API. This is intentionally
-/// minimal: we only stream back plain assistant text.
+/// Implementation for the classic Chat Completions API.
 pub(crate) async fn stream_chat_completions(
     prompt: &Prompt,
     model: &str,
+    include_plan_tool: bool,
     client: &reqwest::Client,
     provider: &ModelProviderInfo,
 ) -> Result<ResponseStream> {
     // Build messages array
     let mut messages = Vec::<serde_json::Value>::new();
 
-    let full_instructions = prompt.get_full_instructions();
+    let full_instructions = prompt.get_full_instructions(model);
     messages.push(json!({"role": "system", "content": full_instructions}));
 
+    if let Some(instr) = &prompt.user_instructions {
+        messages.push(json!({"role": "user", "content": instr}));
+    }
+
     for item in &prompt.input {
-        if let ResponseItem::Message { role, content } = item {
-            let mut text = String::new();
-            for c in content {
-                match c {
-                    ContentItem::InputText { text: t } | ContentItem::OutputText { text: t } => {
-                        text.push_str(t);
+        match item {
+            ResponseItem::Message { role, content, .. } => {
+                let mut text = String::new();
+                for c in content {
+                    match c {
+                        ContentItem::InputText { text: t }
+                        | ContentItem::OutputText { text: t } => {
+                            text.push_str(t);
+                        }
+                        _ => {}
                     }
-                    _ => {}
                 }
+                messages.push(json!({"role": role, "content": text}));
+            }
+            ResponseItem::FunctionCall {
+                name,
+                arguments,
+                call_id,
+                ..
+            } => {
+                messages.push(json!({
+                    "role": "assistant",
+                    "content": null,
+                    "tool_calls": [{
+                        "id": call_id,
+                        "type": "function",
+                        "function": {
+                            "name": name,
+                            "arguments": arguments,
+                        }
+                    }]
+                }));
+            }
+            ResponseItem::LocalShellCall {
+                id,
+                call_id: _,
+                status,
+                action,
+            } => {
+                // Confirm with API team.
+                messages.push(json!({
+                    "role": "assistant",
+                    "content": null,
+                    "tool_calls": [{
+                        "id": id.clone().unwrap_or_else(|| "".to_string()),
+                        "type": "local_shell_call",
+                        "status": status,
+                        "action": action,
+                    }]
+                }));
+            }
+            ResponseItem::FunctionCallOutput { call_id, output } => {
+                messages.push(json!({
+                    "role": "tool",
+                    "tool_call_id": call_id,
+                    "content": output.content,
+                }));
+            }
+            ResponseItem::Reasoning { .. } | ResponseItem::Other => {
+                // Omit these items from the conversation history.
+                continue;
             }
-            messages.push(json!({"role": role, "content": text}));
         }
     }
 
+    let tools_json = create_tools_json_for_chat_completions_api(prompt, model, include_plan_tool)?;
     let payload = json!({
         "model": model,
         "messages": messages,
-        "stream": true
+        "stream": true,
+        "tools": tools_json,
     });
 
-    let base_url = provider.base_url.trim_end_matches('/');
-    let url = format!("{}/chat/completions", base_url);
+    debug!(
+        "POST to {}: {}",
+        provider.get_full_url(),
+        serde_json::to_string_pretty(&payload).unwrap_or_default()
+    );
 
-    debug!(url, "POST (chat)");
-    trace!("request payload: {}", payload);
-
-    let api_key = provider.api_key()?;
     let mut attempt = 0;
+    let max_retries = provider.request_max_retries();
     loop {
         attempt += 1;
 
-        let mut req_builder = client.post(&url);
-        if let Some(api_key) = &api_key {
-            req_builder = req_builder.bearer_auth(api_key.clone());
-        }
+        let req_builder = provider.create_request_builder(client)?;
+
         let res = req_builder
             .header(reqwest::header::ACCEPT, "text/event-stream")
             .json(&payload)
@@ -85,9 +139,13 @@ pub(crate) async fn stream_chat_completions(
 
         match res {
             Ok(resp) if resp.status().is_success() => {
-                let (tx_event, rx_event) = mpsc::channel::<Result<ResponseEvent>>(16);
+                let (tx_event, rx_event) = mpsc::channel::<Result<ResponseEvent>>(1600);
                 let stream = resp.bytes_stream().map_err(CodexErr::Reqwest);
-                tokio::spawn(process_chat_sse(stream, tx_event));
+                tokio::spawn(process_chat_sse(
+                    stream,
+                    tx_event,
+                    provider.stream_idle_timeout(),
+                ));
                 return Ok(ResponseStream { rx_event });
             }
             Ok(res) => {
@@ -97,7 +155,7 @@ pub(crate) async fn stream_chat_completions(
                     return Err(CodexErr::UnexpectedStatus(status, body));
                 }
 
-                if attempt > *OPENAI_REQUEST_MAX_RETRIES {
+                if attempt > max_retries {
                     return Err(CodexErr::RetryLimit(status));
                 }
 
@@ -113,7 +171,7 @@ pub(crate) async fn stream_chat_completions(
                 tokio::time::sleep(delay).await;
             }
             Err(e) => {
-                if attempt > *OPENAI_REQUEST_MAX_RETRIES {
+                if attempt > max_retries {
                     return Err(e.into());
                 }
                 let delay = backoff(attempt);
@@ -126,13 +184,29 @@ pub(crate) async fn stream_chat_completions(
 /// Lightweight SSE processor for the Chat Completions streaming format. The
 /// output is mapped onto Codex's internal [`ResponseEvent`] so that the rest
 /// of the pipeline can stay agnostic of the underlying wire format.
-async fn process_chat_sse<S>(stream: S, tx_event: mpsc::Sender<Result<ResponseEvent>>)
-where
+async fn process_chat_sse<S>(
+    stream: S,
+    tx_event: mpsc::Sender<Result<ResponseEvent>>,
+    idle_timeout: Duration,
+) where
     S: Stream<Item = Result<Bytes>> + Unpin,
 {
     let mut stream = stream.eventsource();
 
-    let idle_timeout = *OPENAI_STREAM_IDLE_TIMEOUT_MS;
+    // State to accumulate a function call across streaming chunks.
+    // OpenAI may split the `arguments` string over multiple `delta` events
+    // until the chunk whose `finish_reason` is `tool_calls` is emitted. We
+    // keep collecting the pieces here and forward a single
+    // `ResponseItem::FunctionCall` once the call is complete.
+    #[derive(Default)]
+    struct FunctionCallState {
+        name: Option<String>,
+        arguments: String,
+        call_id: Option<String>,
+        active: bool,
+    }
+
+    let mut fn_call_state = FunctionCallState::default();
 
     loop {
         let sse = match timeout(idle_timeout, stream.next()).await {
@@ -146,6 +220,7 @@ where
                 let _ = tx_event
                     .send(Ok(ResponseEvent::Completed {
                         response_id: String::new(),
+                        token_usage: None,
                     }))
                     .await;
                 return;
@@ -163,6 +238,7 @@ where
             let _ = tx_event
                 .send(Ok(ResponseEvent::Completed {
                     response_id: String::new(),
+                    token_usage: None,
                 }))
                 .await;
             return;
@@ -173,23 +249,92 @@ where
             Ok(v) => v,
             Err(_) => continue,
         };
+        trace!("chat_completions received SSE chunk: {chunk:?}");
 
-        let content_opt = chunk
-            .get("choices")
-            .and_then(|c| c.get(0))
-            .and_then(|c| c.get("delta"))
-            .and_then(|d| d.get("content"))
-            .and_then(|c| c.as_str());
+        let choice_opt = chunk.get("choices").and_then(|c| c.get(0));
 
-        if let Some(content) = content_opt {
-            let item = ResponseItem::Message {
-                role: "assistant".to_string(),
-                content: vec![ContentItem::OutputText {
-                    text: content.to_string(),
-                }],
-            };
+        if let Some(choice) = choice_opt {
+            // Handle assistant content tokens.
+            if let Some(content) = choice
+                .get("delta")
+                .and_then(|d| d.get("content"))
+                .and_then(|c| c.as_str())
+            {
+                let item = ResponseItem::Message {
+                    role: "assistant".to_string(),
+                    content: vec![ContentItem::OutputText {
+                        text: content.to_string(),
+                    }],
+                    id: None,
+                };
 
-            let _ = tx_event.send(Ok(ResponseEvent::OutputItemDone(item))).await;
+                let _ = tx_event.send(Ok(ResponseEvent::OutputItemDone(item))).await;
+            }
+
+            // Handle streaming function / tool calls.
+            if let Some(tool_calls) = choice
+                .get("delta")
+                .and_then(|d| d.get("tool_calls"))
+                .and_then(|tc| tc.as_array())
+            {
+                if let Some(tool_call) = tool_calls.first() {
+                    // Mark that we have an active function call in progress.
+                    fn_call_state.active = true;
+
+                    // Extract call_id if present.
+                    if let Some(id) = tool_call.get("id").and_then(|v| v.as_str()) {
+                        fn_call_state.call_id.get_or_insert_with(|| id.to_string());
+                    }
+
+                    // Extract function details if present.
+                    if let Some(function) = tool_call.get("function") {
+                        if let Some(name) = function.get("name").and_then(|n| n.as_str()) {
+                            fn_call_state.name.get_or_insert_with(|| name.to_string());
+                        }
+
+                        if let Some(args_fragment) =
+                            function.get("arguments").and_then(|a| a.as_str())
+                        {
+                            fn_call_state.arguments.push_str(args_fragment);
+                        }
+                    }
+                }
+            }
+
+            // Emit end-of-turn when finish_reason signals completion.
+            if let Some(finish_reason) = choice.get("finish_reason").and_then(|v| v.as_str()) {
+                match finish_reason {
+                    "tool_calls" if fn_call_state.active => {
+                        // Build the FunctionCall response item.
+                        let item = ResponseItem::FunctionCall {
+                            id: None,
+                            name: fn_call_state.name.clone().unwrap_or_else(|| "".to_string()),
+                            arguments: fn_call_state.arguments.clone(),
+                            call_id: fn_call_state.call_id.clone().unwrap_or_else(String::new),
+                        };
+
+                        // Emit it downstream.
+                        let _ = tx_event.send(Ok(ResponseEvent::OutputItemDone(item))).await;
+                    }
+                    "stop" => {
+                        // Regular turn without tool-call.
+                    }
+                    _ => {}
+                }
+
+                // Emit Completed regardless of reason so the agent can advance.
+                let _ = tx_event
+                    .send(Ok(ResponseEvent::Completed {
+                        response_id: String::new(),
+                        token_usage: None,
+                    }))
+                    .await;
+
+                // Prepare for potential next turn (should not happen in same stream).
+                // fn_call_state = FunctionCallState::default();
+
+                return; // End processing for this SSE stream.
+            }
         }
     }
 }
@@ -236,9 +381,14 @@ where
                 Poll::Ready(None) => return Poll::Ready(None),
                 Poll::Ready(Some(Err(e))) => return Poll::Ready(Some(Err(e))),
                 Poll::Ready(Some(Ok(ResponseEvent::OutputItemDone(item)))) => {
-                    // Accumulate *assistant* text but do not emit yet.
-                    if let crate::models::ResponseItem::Message { role, content } = &item {
-                        if role == "assistant" {
+                    // If this is an incremental assistant message chunk, accumulate but
+                    // do NOT emit yet. Forward any other item (e.g. FunctionCall) right
+                    // away so downstream consumers see it.
+
+                    let is_assistant_delta = matches!(&item, crate::models::ResponseItem::Message { role, .. } if role == "assistant");
+
+                    if is_assistant_delta {
+                        if let crate::models::ResponseItem::Message { content, .. } = &item {
                             if let Some(text) = content.iter().find_map(|c| match c {
                                 crate::models::ContentItem::OutputText { text } => Some(text),
                                 _ => None,
@@ -246,14 +396,21 @@ where
                                 this.cumulative.push_str(text);
                             }
                         }
+
+                        // Swallow partial assistant chunk; keep polling.
+                        continue;
                     }
 
-                    // Swallow partial event; keep polling.
-                    continue;
+                    // Not an assistant message – forward immediately.
+                    return Poll::Ready(Some(Ok(ResponseEvent::OutputItemDone(item))));
                 }
-                Poll::Ready(Some(Ok(ResponseEvent::Completed { response_id }))) => {
+                Poll::Ready(Some(Ok(ResponseEvent::Completed {
+                    response_id,
+                    token_usage,
+                }))) => {
                     if !this.cumulative.is_empty() {
                         let aggregated_item = crate::models::ResponseItem::Message {
+                            id: None,
                             role: "assistant".to_string(),
                             content: vec![crate::models::ContentItem::OutputText {
                                 text: std::mem::take(&mut this.cumulative),
@@ -261,7 +418,10 @@ where
                         };
 
                         // Buffer Completed so it is returned *after* the aggregated message.
-                        this.pending_completed = Some(ResponseEvent::Completed { response_id });
+                        this.pending_completed = Some(ResponseEvent::Completed {
+                            response_id,
+                            token_usage,
+                        });
 
                         return Poll::Ready(Some(Ok(ResponseEvent::OutputItemDone(
                             aggregated_item,
@@ -269,8 +429,22 @@ where
                     }
 
                     // Nothing aggregated – forward Completed directly.
-                    return Poll::Ready(Some(Ok(ResponseEvent::Completed { response_id })));
-                } // No other `Ok` variants exist at the moment, continue polling.
+                    return Poll::Ready(Some(Ok(ResponseEvent::Completed {
+                        response_id,
+                        token_usage,
+                    })));
+                }
+                Poll::Ready(Some(Ok(ResponseEvent::Created))) => {
+                    // These events are exclusive to the Responses API and
+                    // will never appear in a Chat Completions stream.
+                    continue;
+                }
+                Poll::Ready(Some(Ok(ResponseEvent::OutputTextDelta(_))))
+                | Poll::Ready(Some(Ok(ResponseEvent::ReasoningSummaryDelta(_)))) => {
+                    // Deltas are ignored here since aggregation waits for the
+                    // final OutputItemDone.
+                    continue;
+                }
             }
         }
     }
@@ -284,7 +458,7 @@ pub(crate) trait AggregateStreamExt: Stream<Item = Result<ResponseEvent>> + Size
     ///
     /// ```ignore
     ///     OutputItemDone(<full message>)
-    ///     Completed { .. }
+    ///     Completed
     /// ```
     ///
     /// No other `OutputItemDone` events will be seen by the caller.