Merge branch 'main' into codex/implement-cli-tool-invocation-flow-tests

Added support for streaming in `tui`
Added support for streaming in `exec`


https://github.com/user-attachments/assets/4215892e-d940-452c-a1d0-416ed0cf14eb

.github/actions/codex/action.yml

@@ -20,9 +20,9 @@ inputs:
     description: "Value to use as the CODEX_HOME environment variable when running Codex."
     required: false
   codex_release_tag:
-    description: "The release tag of the Codex model to run."
+    description: "The release tag of the Codex model to run, e.g., 'rust-v0.3.0'. Defaults to the latest release."
     required: false
-    default: "codex-rs-ca8e97fcbcb991e542b8689f2d4eab9d30c399d6-1-rust-v0.0.2505302325"
+    default: ""
 
 runs:
   using: "composite"
@@ -84,7 +84,10 @@ runs:
         # we will need to update this action.yml file to match.
         artifact="codex-exec-${triple}.tar.gz"
 
-        gh release download ${{ inputs.codex_release_tag }} --repo openai/codex \
+        TAG_ARG="${{ inputs.codex_release_tag }}"
+        # The usage is `gh release download [<tag>] [flags]`, so if TAG_ARG
+        # is empty, we do not pass it so we can default to the latest release.
+        gh release download ${TAG_ARG:+$TAG_ARG} --repo openai/codex \
           --pattern "$artifact" --output - \
         | tar xzO > /usr/local/bin/codex-exec
         chmod +x /usr/local/bin/codex-exec

.github/actions/codex/bun.lock

@@ -8,9 +8,9 @@
         "@actions/github": "^6.0.1",
       },
       "devDependencies": {
-        "@types/bun": "^1.2.11",
-        "@types/node": "^22.15.21",
-        "prettier": "^3.5.3",
+        "@types/bun": "^1.2.18",
+        "@types/node": "^24.0.13",
+        "prettier": "^3.6.2",
         "typescript": "^5.8.3",
       },
     },
@@ -48,19 +48,23 @@
 
     "@octokit/types": ["@octokit/types@13.10.0", "", { "dependencies": { "@octokit/openapi-types": "^24.2.0" } }, "sha512-ifLaO34EbbPj0Xgro4G5lP5asESjwHracYJvVaPIyXMuiuXLlhic3S47cBdTb+jfODkTE5YtGCLt3Ay3+J97sA=="],
 
-    "@types/bun": ["@types/bun@1.2.13", "", { "dependencies": { "bun-types": "1.2.13" } }, "sha512-u6vXep/i9VBxoJl3GjZsl/BFIsvML8DfVDO0RYLEwtSZSp981kEO1V5NwRcO1CPJ7AmvpbnDCiMKo3JvbDEjAg=="],
+    "@types/bun": ["@types/bun@1.2.18", "", { "dependencies": { "bun-types": "1.2.18" } }, "sha512-Xf6RaWVheyemaThV0kUfaAUvCNokFr+bH8Jxp+tTZfx7dAPA8z9ePnP9S9+Vspzuxxx9JRAXhnyccRj3GyCMdQ=="],
 
-    "@types/node": ["@types/node@22.15.21", "", { "dependencies": { "undici-types": "~6.21.0" } }, "sha512-EV/37Td6c+MgKAbkcLG6vqZ2zEYHD7bvSrzqqs2RIhbA6w3x+Dqz8MZM3sP6kGTeLrdoOgKZe+Xja7tUB2DNkQ=="],
+    "@types/node": ["@types/node@24.0.13", "", { "dependencies": { "undici-types": "~7.8.0" } }, "sha512-Qm9OYVOFHFYg3wJoTSrz80hoec5Lia/dPp84do3X7dZvLikQvM1YpmvTBEdIr/e+U8HTkFjLHLnl78K/qjf+jQ=="],
+
+    "@types/react": ["@types/react@19.1.8", "", { "dependencies": { "csstype": "^3.0.2" } }, "sha512-AwAfQ2Wa5bCx9WP8nZL2uMZWod7J7/JSplxbTmBQ5ms6QpqNYm672H0Vu9ZVKVngQ+ii4R/byguVEUZQyeg44g=="],
 
     "before-after-hook": ["before-after-hook@2.2.3", "", {}, "sha512-NzUnlZexiaH/46WDhANlyR2bXRopNg4F/zuSA3OpZnllCUgRaOF2znDioDWrmbNVsuZk6l9pMquQB38cfBZwkQ=="],
 
-    "bun-types": ["bun-types@1.2.13", "", { "dependencies": { "@types/node": "*" } }, "sha512-rRjA1T6n7wto4gxhAO/ErZEtOXyEZEmnIHQfl0Dt1QQSB4QV0iP6BZ9/YB5fZaHFQ2dwHFrmPaRQ9GGMX01k9Q=="],
+    "bun-types": ["bun-types@1.2.18", "", { "dependencies": { "@types/node": "*" }, "peerDependencies": { "@types/react": "^19" } }, "sha512-04+Eha5NP7Z0A9YgDAzMk5PHR16ZuLVa83b26kH5+cp1qZW4F6FmAURngE7INf4tKOvCE69vYvDEwoNl1tGiWw=="],
+
+    "csstype": ["csstype@3.1.3", "", {}, "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw=="],
 
     "deprecation": ["deprecation@2.3.1", "", {}, "sha512-xmHIy4F3scKVwMsQ4WnVaS8bHOx0DmVwRywosKhaILI0ywMDWPtBSku2HNxRvF7jtwDRsoEwYQSfbxj8b7RlJQ=="],
 
     "once": ["once@1.4.0", "", { "dependencies": { "wrappy": "1" } }, "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w=="],
 
-    "prettier": ["prettier@3.5.3", "", { "bin": { "prettier": "bin/prettier.cjs" } }, "sha512-QQtaxnoDJeAkDvDKWCLiwIXkTgRhwYDEQCghU9Z6q03iyek/rxRh/2lC3HB7P8sWT2xC/y5JDctPLBIGzHKbhw=="],
+    "prettier": ["prettier@3.6.2", "", { "bin": { "prettier": "bin/prettier.cjs" } }, "sha512-I7AIg5boAr5R0FFtJ6rCfD+LFsWHp81dolrFD8S79U9tb8Az2nGrJncnMSnys+bpQJfRUzqs9hnA81OAA3hCuQ=="],
 
     "tunnel": ["tunnel@0.0.6", "", {}, "sha512-1h/Lnq9yajKY2PEbBadPXj3VxsDDu844OnaAo52UVmIzIvwwtBPIuNvkjuzBlTWpfJyUbG3ez0KSBibQkj4ojg=="],
 
@@ -68,7 +72,7 @@
 
     "undici": ["undici@5.29.0", "", { "dependencies": { "@fastify/busboy": "^2.0.0" } }, "sha512-raqeBD6NQK4SkWhQzeYKd1KmIG6dllBOTt55Rmkt4HtI9mwdWtJljnrXjAFUBLTSN67HWrOIZ3EPF4kjUw80Bg=="],
 
-    "undici-types": ["undici-types@6.21.0", "", {}, "sha512-iwDZqg0QAGrg9Rav5H4n0M64c3mkR59cJ6wQp+7C4nI0gsmExaedaYLNO44eT4AtBBwjbTiGPMlt2Md0T9H9JQ=="],
+    "undici-types": ["undici-types@7.8.0", "", {}, "sha512-9UJ2xGDvQ43tYyVMpuHlsgApydB8ZKfVYTsLDhXkFL/6gfkp+U8xTGdh8pMJv1SpZna0zxG1DwsKZsreLbXBxw=="],
 
     "universal-user-agent": ["universal-user-agent@6.0.1", "", {}, "sha512-yCzhz6FN2wU1NiiQRogkTQszlQSlpWaw8SvVegAc+bDxbzHgh1vX8uIe8OYyMH6DwH+sdTJsgMl36+mSMdRJIQ=="],
 

.github/actions/codex/package.json

@@ -13,9 +13,9 @@
         "@actions/github": "^6.0.1"
     },
     "devDependencies": {
-        "@types/bun": "^1.2.11",
-        "@types/node": "^22.15.21",
-        "prettier": "^3.5.3",
+        "@types/bun": "^1.2.18",
+        "@types/node": "^24.0.13",
+        "prettier": "^3.6.2",
         "typescript": "^5.8.3"
     }
 }

.github/dependabot.yaml

@@ -0,0 +1,26 @@
+# https://docs.github.com/en/code-security/dependabot/working-with-dependabot/dependabot-options-reference#package-ecosystem-
+
+version: 2
+updates:
+  - package-ecosystem: bun
+    directory: .github/actions/codex
+    schedule:
+      interval: weekly
+  - package-ecosystem: cargo
+    directories:
+      - codex-rs
+      - codex-rs/*
+    schedule:
+      interval: weekly
+  - package-ecosystem: devcontainers
+    directory: /
+    schedule:
+      interval: weekly
+  - package-ecosystem: docker
+    directory: codex-cli
+    schedule:
+      interval: weekly
+  - package-ecosystem: github-actions
+    directory: /
+    schedule:
+      interval: weekly

.github/workflows/codex.yml

@@ -70,7 +70,7 @@ jobs:
       - name: Install dependencies
         run: pnpm install
 
-      - uses: dtolnay/rust-toolchain@1.87
+      - uses: dtolnay/rust-toolchain@1.88
         with:
           targets: x86_64-unknown-linux-gnu
           components: clippy

.github/workflows/rust-ci.yml

@@ -26,7 +26,7 @@ jobs:
 
     steps:
       - uses: actions/checkout@v4
-      - uses: dtolnay/rust-toolchain@1.87
+      - uses: dtolnay/rust-toolchain@1.88
         with:
           components: rustfmt
       - name: cargo fmt
@@ -64,7 +64,7 @@ jobs:
 
     steps:
       - uses: actions/checkout@v4
-      - uses: dtolnay/rust-toolchain@1.87
+      - uses: dtolnay/rust-toolchain@1.88
         with:
           targets: ${{ matrix.target }}
           components: clippy

.github/workflows/rust-release.yml

@@ -73,7 +73,7 @@ jobs:
 
     steps:
       - uses: actions/checkout@v4
-      - uses: dtolnay/rust-toolchain@1.87
+      - uses: dtolnay/rust-toolchain@1.88
         with:
           targets: ${{ matrix.target }}
 

codex-cli/.gitignore

@@ -1,3 +1,7 @@
 # Added by ./scripts/install_native_deps.sh
+/bin/codex-aarch64-apple-darwin
+/bin/codex-aarch64-unknown-linux-musl
 /bin/codex-linux-sandbox-arm64
 /bin/codex-linux-sandbox-x64
+/bin/codex-x86_64-apple-darwin
+/bin/codex-x86_64-unknown-linux-musl

codex-cli/Dockerfile

@@ -1,4 +1,4 @@
-FROM node:20-slim
+FROM node:24-slim
 
 ARG TZ
 ENV TZ="$TZ"

codex-cli/bin/codex.js

@@ -15,7 +15,6 @@
  *      current platform / architecture, an error is thrown.
  */
 
-import { spawnSync } from "child_process";
 import fs from "fs";
 import path from "path";
 import { fileURLToPath, pathToFileURL } from "url";
@@ -35,12 +34,13 @@ const wantsNative = fs.existsSync(path.join(__dirname, "use-native")) ||
     : false);
 
 // Try native binary if requested.
-if (wantsNative) {
+if (wantsNative && process.platform !== 'win32') {
   const { platform, arch } = process;
 
   let targetTriple = null;
   switch (platform) {
     case "linux":
+    case "android":
       switch (arch) {
         case "x64":
           targetTriple = "x86_64-unknown-linux-musl";
@@ -73,22 +73,76 @@ if (wantsNative) {
   }
 
   const binaryPath = path.join(__dirname, "..", "bin", `codex-${targetTriple}`);
-  const result = spawnSync(binaryPath, process.argv.slice(2), {
+
+  // Use an asynchronous spawn instead of spawnSync so that Node is able to
+  // respond to signals (e.g. Ctrl-C / SIGINT) while the native binary is
+  // executing. This allows us to forward those signals to the child process
+  // and guarantees that when either the child terminates or the parent
+  // receives a fatal signal, both processes exit in a predictable manner.
+  const { spawn } = await import("child_process");
+
+  const child = spawn(binaryPath, process.argv.slice(2), {
     stdio: "inherit",
   });
 
-  const exitCode = typeof result.status === "number" ? result.status : 1;
-  process.exit(exitCode);
-}
+  child.on("error", (err) => {
+    // Typically triggered when the binary is missing or not executable.
+    // Re-throwing here will terminate the parent with a non-zero exit code
+    // while still printing a helpful stack trace.
+    // eslint-disable-next-line no-console
+    console.error(err);
+    process.exit(1);
+  });
 
-// Fallback: execute the original JavaScript CLI.
+  // Forward common termination signals to the child so that it shuts down
+  // gracefully. In the handler we temporarily disable the default behavior of
+  // exiting immediately; once the child has been signaled we simply wait for
+  // its exit event which will in turn terminate the parent (see below).
+  const forwardSignal = (signal) => {
+    if (child.killed) {
+      return;
+    }
+    try {
+      child.kill(signal);
+    } catch {
+      /* ignore */
+    }
+  };
 
-// Resolve the path to the compiled CLI bundle
-const cliPath = path.resolve(__dirname, "../dist/cli.js");
-const cliUrl = pathToFileURL(cliPath).href;
+  ["SIGINT", "SIGTERM", "SIGHUP"].forEach((sig) => {
+    process.on(sig, () => forwardSignal(sig));
+  });
 
-// Load and execute the CLI
-(async () => {
+  // When the child exits, mirror its termination reason in the parent so that
+  // shell scripts and other tooling observe the correct exit status.
+  // Wrap the lifetime of the child process in a Promise so that we can await
+  // its termination in a structured way. The Promise resolves with an object
+  // describing how the child exited: either via exit code or due to a signal.
+  const childResult = await new Promise((resolve) => {
+    child.on("exit", (code, signal) => {
+      if (signal) {
+        resolve({ type: "signal", signal });
+      } else {
+        resolve({ type: "code", exitCode: code ?? 1 });
+      }
+    });
+  });
+
+  if (childResult.type === "signal") {
+    // Re-emit the same signal so that the parent terminates with the expected
+    // semantics (this also sets the correct exit code of 128 + n).
+    process.kill(process.pid, childResult.signal);
+  } else {
+    process.exit(childResult.exitCode);
+  }
+} else {
+  // Fallback: execute the original JavaScript CLI.
+
+  // Resolve the path to the compiled CLI bundle
+  const cliPath = path.resolve(__dirname, "../dist/cli.js");
+  const cliUrl = pathToFileURL(cliPath).href;
+
+  // Load and execute the CLI
   try {
     await import(cliUrl);
   } catch (err) {
@@ -96,4 +150,4 @@ const cliUrl = pathToFileURL(cliPath).href;
     console.error(err);
     process.exit(1);
   }
-})();
+}

codex-cli/scripts/README.md

@@ -0,0 +1,9 @@
+# npm releases
+
+Run the following:
+
+To build the 0.2.x or later version of the npm module, which runs the Rust version of the CLI, build it as follows:
+
+```bash
+./codex-cli/scripts/stage_rust_release.py --release-version 0.6.0
+```

codex-cli/scripts/install_native_deps.sh

@@ -8,7 +8,7 @@
 # the native implementation when users set CODEX_RUST=1.
 #
 # Usage
-#   install_native_deps.sh [RELEASE_ROOT] [--full-native]
+#   install_native_deps.sh [--full-native] [--workflow-url URL] [CODEX_CLI_ROOT]
 #
 # The optional RELEASE_ROOT is the path that contains package.json.  Omitting
 # it installs the binaries into the repository's own bin/ folder to support
@@ -20,32 +20,43 @@ set -euo pipefail
 # Parse arguments
 # ------------------
 
-DEST_DIR=""
+CODEX_CLI_ROOT=""
 INCLUDE_RUST=0
 
-for arg in "$@"; do
-  case "$arg" in
+# Until we start publishing stable GitHub releases, we have to grab the binaries
+# from the GitHub Action that created them. Update the URL below to point to the
+# appropriate workflow run:
+WORKFLOW_URL="https://github.com/openai/codex/actions/runs/15981617627"
+
+while [[ $# -gt 0 ]]; do
+  case "$1" in
     --full-native)
       INCLUDE_RUST=1
       ;;
+    --workflow-url)
+      shift || { echo "--workflow-url requires an argument"; exit 1; }
+      if [ -n "$1" ]; then
+        WORKFLOW_URL="$1"
+      fi
+      ;;
     *)
-      if [[ -z "$DEST_DIR" ]]; then
-        DEST_DIR="$arg"
+      if [[ -z "$CODEX_CLI_ROOT" ]]; then
+        CODEX_CLI_ROOT="$1"
       else
-        echo "Unexpected argument: $arg" >&2
+        echo "Unexpected argument: $1" >&2
         exit 1
       fi
       ;;
   esac
+  shift
 done
 
 # ----------------------------------------------------------------------------
 # Determine where the binaries should be installed.
 # ----------------------------------------------------------------------------
 
-if [[ $# -gt 0 ]]; then
+if [ -n "$CODEX_CLI_ROOT" ]; then
   # The caller supplied a release root directory.
-  CODEX_CLI_ROOT="$1"
   BIN_DIR="$CODEX_CLI_ROOT/bin"
 else
   # No argument; fall back to the repo’s own bin directory.
@@ -62,10 +73,6 @@ mkdir -p "$BIN_DIR"
 # Download and decompress the artifacts from the GitHub Actions workflow.
 # ----------------------------------------------------------------------------
 
-# Until we start publishing stable GitHub releases, we have to grab the binaries
-# from the GitHub Action that created them. Update the URL below to point to the
-# appropriate workflow run:
-WORKFLOW_URL="https://github.com/openai/codex/actions/runs/15981617627"
 WORKFLOW_ID="${WORKFLOW_URL##*/}"
 
 ARTIFACTS_DIR="$(mktemp -d)"

codex-cli/scripts/stage_release.sh

@@ -4,10 +4,7 @@
 # -----------------------------------------------------------------------------
 # Stages an npm release for @openai/codex.
 #
-# The script used to accept a single optional positional argument that indicated
-# the temporary directory in which to stage the package.  We now support a
-# flag-based interface so that we can extend the command with further options
-# without breaking the call-site contract.
+# Usage:
 #
 #   --tmp <dir>  : Use <dir> instead of a freshly created temp directory.
 #   --native     : Bundle the pre-built Rust CLI binaries for Linux alongside
@@ -48,6 +45,7 @@ TMPDIR=""
 INCLUDE_NATIVE=0
 # Default to a timestamp-based version (keep same scheme as before)
 VERSION="$(printf '0.1.%d' "$(date +%y%m%d%H%M)")"
+WORKFLOW_URL=""
 
 # Manual flag parser - Bash getopts does not handle GNU long options well.
 while [[ $# -gt 0 ]]; do
@@ -66,6 +64,10 @@ while [[ $# -gt 0 ]]; do
       shift || { echo "--version requires an argument"; usage 1; }
       VERSION="$1"
       ;;
+    --workflow-url)
+      shift || { echo "--workflow-url requires an argument"; exit 1; }
+      WORKFLOW_URL="$1"
+      ;;
     -h|--help)
       usage 0
       ;;
@@ -125,7 +127,7 @@ jq --arg version "$VERSION" \
 # 2. Native runtime deps (sandbox plus optional Rust binaries)
 
 if [[ "$INCLUDE_NATIVE" -eq 1 ]]; then
-  ./scripts/install_native_deps.sh "$TMPDIR" --full-native
+  ./scripts/install_native_deps.sh --full-native --workflow-url "$WORKFLOW_URL" "$TMPDIR"
   touch "${TMPDIR}/bin/use-native"
 else
   ./scripts/install_native_deps.sh "$TMPDIR"
@@ -136,7 +138,8 @@ popd >/dev/null
 echo "Staged version $VERSION for release in $TMPDIR"
 
 if [[ "$INCLUDE_NATIVE" -eq 1 ]]; then
-  echo "Test Rust:"
+  echo "Verify the CLI:"
+  echo "    node ${TMPDIR}/bin/codex.js --version"
   echo "    node ${TMPDIR}/bin/codex.js --help"
 else
   echo "Test Node:"

codex-cli/scripts/stage_rust_release.py

@@ -0,0 +1,62 @@
+#!/usr/bin/env python3
+
+import json
+import subprocess
+import sys
+import argparse
+from pathlib import Path
+
+
+def main() -> int:
+    parser = argparse.ArgumentParser(
+        description="""Stage a release for the npm module.
+
+Run this after the GitHub Release has been created and use
+`--release-version` to specify the version to release.
+"""
+    )
+    parser.add_argument(
+        "--release-version", required=True, help="Version to release, e.g., 0.3.0"
+    )
+    args = parser.parse_args()
+    version = args.release_version
+
+    gh_run = subprocess.run(
+        [
+            "gh",
+            "run",
+            "list",
+            "--branch",
+            f"rust-v{version}",
+            "--json",
+            "workflowName,url,headSha",
+            "--jq",
+            'first(.[] | select(.workflowName == "rust-release"))',
+        ],
+        stdout=subprocess.PIPE,
+        check=True,
+    )
+    gh_run.check_returncode()
+    workflow = json.loads(gh_run.stdout)
+    sha = workflow["headSha"]
+
+    print(f"should `git checkout {sha}`")
+
+    current_dir = Path(__file__).parent.resolve()
+    stage_release = subprocess.run(
+        [
+            current_dir / "stage_release.sh",
+            "--version",
+            version,
+            "--workflow-url",
+            workflow["url"],
+            "--native",
+        ]
+    )
+    stage_release.check_returncode()
+
+    return 0
+
+
+if __name__ == "__main__":
+    sys.exit(main())

codex-rs/README.md

@@ -47,6 +47,16 @@ Typing `@` triggers a fuzzy-filename search over the workspace root. Use up/down
 
 Sometimes it is not convenient to `cd` to the directory you want Codex to use as the "working root" before running Codex. Fortunately, `codex` supports a `--cd` option so you can specify whatever folder you want. You can confirm that Codex is honoring `--cd` by double-checking the **workdir** it reports in the TUI at the start of a new session.
 
+### Shell completions
+
+Generate shell completion scripts via:
+
+```shell
+codex completion bash
+codex completion zsh
+codex completion fish
+```
+
 ### Experimenting with the Codex Sandbox
 
 To test to see what happens when a command is run under the sandbox provided by Codex, we provide the following subcommands in Codex CLI:

codex-rs/apply-patch/Cargo.toml

@@ -12,11 +12,10 @@ workspace = true
 
 [dependencies]
 anyhow = "1"
-serde_json = "1.0.110"
 similar = "2.7.0"
 thiserror = "2.0.12"
 tree-sitter = "0.25.3"
-tree-sitter-bash = "0.23.3"
+tree-sitter-bash = "0.25.0"
 
 [dev-dependencies]
 pretty_assertions = "1.4.1"

codex-rs/apply-patch/src/lib.rs

@@ -633,7 +633,7 @@ mod tests {
 
     /// Helper to construct a patch with the given body.
     fn wrap_patch(body: &str) -> String {
-        format!("*** Begin Patch\n{}\n*** End Patch", body)
+        format!("*** Begin Patch\n{body}\n*** End Patch")
     }
 
     fn strs_to_strings(strs: &[&str]) -> Vec<String> {
@@ -661,7 +661,7 @@ mod tests {
                     }]
                 );
             }
-            result => panic!("expected MaybeApplyPatch::Body got {:?}", result),
+            result => panic!("expected MaybeApplyPatch::Body got {result:?}"),
         }
     }
 
@@ -688,7 +688,7 @@ PATCH"#,
                     }]
                 );
             }
-            result => panic!("expected MaybeApplyPatch::Body got {:?}", result),
+            result => panic!("expected MaybeApplyPatch::Body got {result:?}"),
         }
     }
 

codex-rs/chatgpt/Cargo.toml

@@ -0,0 +1,21 @@
+[package]
+name = "codex-chatgpt"
+version = { workspace = true }
+edition = "2024"
+
+[lints]
+workspace = true
+
+[dependencies]
+anyhow = "1"
+clap = { version = "4", features = ["derive"] }
+serde = { version = "1", features = ["derive"] }
+serde_json = "1"
+codex-common = { path = "../common", features = ["cli"] }
+codex-core = { path = "../core" }
+codex-login = { path = "../login" }
+reqwest = { version = "0.12", features = ["json", "stream"] }
+tokio = { version = "1", features = ["full"] }
+
+[dev-dependencies]
+tempfile = "3"

codex-rs/chatgpt/README.md

@@ -0,0 +1,5 @@
+# ChatGPT
+
+This crate pertains to first party ChatGPT APIs and products such as Codex agent.
+
+This crate should be primarily built and maintained by OpenAI employees. Please reach out to a maintainer before making an external contribution.

codex-rs/chatgpt/src/apply_command.rs

@@ -0,0 +1,89 @@
+use clap::Parser;
+use codex_common::CliConfigOverrides;
+use codex_core::config::Config;
+use codex_core::config::ConfigOverrides;
+
+use crate::chatgpt_token::init_chatgpt_token_from_auth;
+use crate::get_task::GetTaskResponse;
+use crate::get_task::OutputItem;
+use crate::get_task::PrOutputItem;
+use crate::get_task::get_task;
+
+/// Applies the latest diff from a Codex agent task.
+#[derive(Debug, Parser)]
+pub struct ApplyCommand {
+    pub task_id: String,
+
+    #[clap(flatten)]
+    pub config_overrides: CliConfigOverrides,
+}
+pub async fn run_apply_command(apply_cli: ApplyCommand) -> anyhow::Result<()> {
+    let config = Config::load_with_cli_overrides(
+        apply_cli
+            .config_overrides
+            .parse_overrides()
+            .map_err(anyhow::Error::msg)?,
+        ConfigOverrides::default(),
+    )?;
+
+    init_chatgpt_token_from_auth(&config.codex_home).await?;
+
+    let task_response = get_task(&config, apply_cli.task_id).await?;
+    apply_diff_from_task(task_response).await
+}
+
+pub async fn apply_diff_from_task(task_response: GetTaskResponse) -> anyhow::Result<()> {
+    let diff_turn = match task_response.current_diff_task_turn {
+        Some(turn) => turn,
+        None => anyhow::bail!("No diff turn found"),
+    };
+    let output_diff = diff_turn.output_items.iter().find_map(|item| match item {
+        OutputItem::Pr(PrOutputItem { output_diff }) => Some(output_diff),
+        _ => None,
+    });
+    match output_diff {
+        Some(output_diff) => apply_diff(&output_diff.diff).await,
+        None => anyhow::bail!("No PR output item found"),
+    }
+}
+
+async fn apply_diff(diff: &str) -> anyhow::Result<()> {
+    let toplevel_output = tokio::process::Command::new("git")
+        .args(vec!["rev-parse", "--show-toplevel"])
+        .output()
+        .await?;
+
+    if !toplevel_output.status.success() {
+        anyhow::bail!("apply must be run from a git repository.");
+    }
+
+    let repo_root = String::from_utf8(toplevel_output.stdout)?
+        .trim()
+        .to_string();
+
+    let mut git_apply_cmd = tokio::process::Command::new("git")
+        .args(vec!["apply", "--3way"])
+        .current_dir(&repo_root)
+        .stdin(std::process::Stdio::piped())
+        .stdout(std::process::Stdio::piped())
+        .stderr(std::process::Stdio::piped())
+        .spawn()?;
+
+    if let Some(mut stdin) = git_apply_cmd.stdin.take() {
+        tokio::io::AsyncWriteExt::write_all(&mut stdin, diff.as_bytes()).await?;
+        drop(stdin);
+    }
+
+    let output = git_apply_cmd.wait_with_output().await?;
+
+    if !output.status.success() {
+        anyhow::bail!(
+            "Git apply failed with status {}: {}",
+            output.status,
+            String::from_utf8_lossy(&output.stderr)
+        );
+    }
+
+    println!("Successfully applied diff");
+    Ok(())
+}

codex-rs/chatgpt/src/chatgpt_client.rs

@@ -0,0 +1,45 @@
+use codex_core::config::Config;
+
+use crate::chatgpt_token::get_chatgpt_token_data;
+use crate::chatgpt_token::init_chatgpt_token_from_auth;
+
+use anyhow::Context;
+use serde::de::DeserializeOwned;
+
+/// Make a GET request to the ChatGPT backend API.
+pub(crate) async fn chatgpt_get_request<T: DeserializeOwned>(
+    config: &Config,
+    path: String,
+) -> anyhow::Result<T> {
+    let chatgpt_base_url = &config.chatgpt_base_url;
+    init_chatgpt_token_from_auth(&config.codex_home).await?;
+
+    // Make direct HTTP request to ChatGPT backend API with the token
+    let client = reqwest::Client::new();
+    let url = format!("{chatgpt_base_url}{path}");
+
+    let token =
+        get_chatgpt_token_data().ok_or_else(|| anyhow::anyhow!("ChatGPT token not available"))?;
+
+    let response = client
+        .get(&url)
+        .bearer_auth(&token.access_token)
+        .header("chatgpt-account-id", &token.account_id)
+        .header("Content-Type", "application/json")
+        .header("User-Agent", "codex-cli")
+        .send()
+        .await
+        .context("Failed to send request")?;
+
+    if response.status().is_success() {
+        let result: T = response
+            .json()
+            .await
+            .context("Failed to parse JSON response")?;
+        Ok(result)
+    } else {
+        let status = response.status();
+        let body = response.text().await.unwrap_or_default();
+        anyhow::bail!("Request failed with status {}: {}", status, body)
+    }
+}

codex-rs/chatgpt/src/chatgpt_token.rs

@@ -0,0 +1,24 @@
+use std::path::Path;
+use std::sync::LazyLock;
+use std::sync::RwLock;
+
+use codex_login::TokenData;
+
+static CHATGPT_TOKEN: LazyLock<RwLock<Option<TokenData>>> = LazyLock::new(|| RwLock::new(None));
+
+pub fn get_chatgpt_token_data() -> Option<TokenData> {
+    CHATGPT_TOKEN.read().ok()?.clone()
+}
+
+pub fn set_chatgpt_token_data(value: TokenData) {
+    if let Ok(mut guard) = CHATGPT_TOKEN.write() {
+        *guard = Some(value);
+    }
+}
+
+/// Initialize the ChatGPT token from auth.json file
+pub async fn init_chatgpt_token_from_auth(codex_home: &Path) -> std::io::Result<()> {
+    let auth_json = codex_login::try_read_auth_json(codex_home).await?;
+    set_chatgpt_token_data(auth_json.tokens.clone());
+    Ok(())
+}

codex-rs/chatgpt/src/get_task.rs

@@ -0,0 +1,40 @@
+use codex_core::config::Config;
+use serde::Deserialize;
+
+use crate::chatgpt_client::chatgpt_get_request;
+
+#[derive(Debug, Deserialize)]
+pub struct GetTaskResponse {
+    pub current_diff_task_turn: Option<AssistantTurn>,
+}
+
+// Only relevant fields for our extraction
+#[derive(Debug, Deserialize)]
+pub struct AssistantTurn {
+    pub output_items: Vec<OutputItem>,
+}
+
+#[derive(Debug, Deserialize)]
+#[serde(tag = "type")]
+pub enum OutputItem {
+    #[serde(rename = "pr")]
+    Pr(PrOutputItem),
+
+    #[serde(other)]
+    Other,
+}
+
+#[derive(Debug, Deserialize)]
+pub struct PrOutputItem {
+    pub output_diff: OutputDiff,
+}
+
+#[derive(Debug, Deserialize)]
+pub struct OutputDiff {
+    pub diff: String,
+}
+
+pub(crate) async fn get_task(config: &Config, task_id: String) -> anyhow::Result<GetTaskResponse> {
+    let path = format!("/wham/tasks/{task_id}");
+    chatgpt_get_request(config, path).await
+}

codex-rs/chatgpt/src/lib.rs

@@ -0,0 +1,4 @@
+pub mod apply_command;
+mod chatgpt_client;
+mod chatgpt_token;
+pub mod get_task;

codex-rs/chatgpt/tests/apply_command_e2e.rs

@@ -0,0 +1,191 @@
+#![expect(clippy::expect_used)]
+
+use codex_chatgpt::apply_command::apply_diff_from_task;
+use codex_chatgpt::get_task::GetTaskResponse;
+use std::path::Path;
+use tempfile::TempDir;
+use tokio::process::Command;
+
+/// Creates a temporary git repository with initial commit
+async fn create_temp_git_repo() -> anyhow::Result<TempDir> {
+    let temp_dir = TempDir::new()?;
+    let repo_path = temp_dir.path();
+
+    let output = Command::new("git")
+        .args(["init"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    if !output.status.success() {
+        anyhow::bail!(
+            "Failed to initialize git repo: {}",
+            String::from_utf8_lossy(&output.stderr)
+        );
+    }
+
+    Command::new("git")
+        .args(["config", "user.email", "test@example.com"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    Command::new("git")
+        .args(["config", "user.name", "Test User"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    std::fs::write(repo_path.join("README.md"), "# Test Repo\n")?;
+
+    Command::new("git")
+        .args(["add", "README.md"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    let output = Command::new("git")
+        .args(["commit", "-m", "Initial commit"])
+        .current_dir(repo_path)
+        .output()
+        .await?;
+
+    if !output.status.success() {
+        anyhow::bail!(
+            "Failed to create initial commit: {}",
+            String::from_utf8_lossy(&output.stderr)
+        );
+    }
+
+    Ok(temp_dir)
+}
+
+async fn mock_get_task_with_fixture() -> anyhow::Result<GetTaskResponse> {
+    let fixture_path = Path::new(env!("CARGO_MANIFEST_DIR")).join("tests/task_turn_fixture.json");
+    let fixture_content = std::fs::read_to_string(fixture_path)?;
+    let response: GetTaskResponse = serde_json::from_str(&fixture_content)?;
+    Ok(response)
+}
+
+#[tokio::test]
+async fn test_apply_command_creates_fibonacci_file() {
+    let temp_repo = create_temp_git_repo()
+        .await
+        .expect("Failed to create temp git repo");
+    let repo_path = temp_repo.path();
+
+    let task_response = mock_get_task_with_fixture()
+        .await
+        .expect("Failed to load fixture");
+
+    let original_dir = std::env::current_dir().expect("Failed to get current dir");
+    std::env::set_current_dir(repo_path).expect("Failed to change directory");
+    struct DirGuard(std::path::PathBuf);
+    impl Drop for DirGuard {
+        fn drop(&mut self) {
+            let _ = std::env::set_current_dir(&self.0);
+        }
+    }
+    let _guard = DirGuard(original_dir);
+
+    apply_diff_from_task(task_response)
+        .await
+        .expect("Failed to apply diff from task");
+
+    // Assert that fibonacci.js was created in scripts/ directory
+    let fibonacci_path = repo_path.join("scripts/fibonacci.js");
+    assert!(fibonacci_path.exists(), "fibonacci.js was not created");
+
+    // Verify the file contents match expected
+    let contents = std::fs::read_to_string(&fibonacci_path).expect("Failed to read fibonacci.js");
+    assert!(
+        contents.contains("function fibonacci(n)"),
+        "fibonacci.js doesn't contain expected function"
+    );
+    assert!(
+        contents.contains("#!/usr/bin/env node"),
+        "fibonacci.js doesn't have shebang"
+    );
+    assert!(
+        contents.contains("module.exports = fibonacci;"),
+        "fibonacci.js doesn't export function"
+    );
+
+    // Verify file has correct number of lines (31 as specified in fixture)
+    let line_count = contents.lines().count();
+    assert_eq!(
+        line_count, 31,
+        "fibonacci.js should have 31 lines, got {line_count}",
+    );
+}
+
+#[tokio::test]
+async fn test_apply_command_with_merge_conflicts() {
+    let temp_repo = create_temp_git_repo()
+        .await
+        .expect("Failed to create temp git repo");
+    let repo_path = temp_repo.path();
+
+    // Create conflicting fibonacci.js file first
+    let scripts_dir = repo_path.join("scripts");
+    std::fs::create_dir_all(&scripts_dir).expect("Failed to create scripts directory");
+
+    let conflicting_content = r#"#!/usr/bin/env node
+
+// This is a different fibonacci implementation
+function fib(num) {
+  if (num <= 1) return num;
+  return fib(num - 1) + fib(num - 2);
+}
+
+console.log("Running fibonacci...");
+console.log(fib(10));
+"#;
+
+    let fibonacci_path = scripts_dir.join("fibonacci.js");
+    std::fs::write(&fibonacci_path, conflicting_content).expect("Failed to write conflicting file");
+
+    Command::new("git")
+        .args(["add", "scripts/fibonacci.js"])
+        .current_dir(repo_path)
+        .output()
+        .await
+        .expect("Failed to add fibonacci.js");
+
+    Command::new("git")
+        .args(["commit", "-m", "Add conflicting fibonacci implementation"])
+        .current_dir(repo_path)
+        .output()
+        .await
+        .expect("Failed to commit conflicting file");
+
+    let original_dir = std::env::current_dir().expect("Failed to get current dir");
+    std::env::set_current_dir(repo_path).expect("Failed to change directory");
+    struct DirGuard(std::path::PathBuf);
+    impl Drop for DirGuard {
+        fn drop(&mut self) {
+            let _ = std::env::set_current_dir(&self.0);
+        }
+    }
+    let _guard = DirGuard(original_dir);
+
+    let task_response = mock_get_task_with_fixture()
+        .await
+        .expect("Failed to load fixture");
+
+    let apply_result = apply_diff_from_task(task_response).await;
+
+    assert!(
+        apply_result.is_err(),
+        "Expected apply to fail due to merge conflicts"
+    );
+
+    let contents = std::fs::read_to_string(&fibonacci_path).expect("Failed to read fibonacci.js");
+
+    assert!(
+        contents.contains("<<<<<<< HEAD")
+            || contents.contains("=======")
+            || contents.contains(">>>>>>> "),
+        "fibonacci.js should contain merge conflict markers, got: {contents}",
+    );
+}

codex-rs/chatgpt/tests/task_turn_fixture.json

@@ -0,0 +1,65 @@
+{
+    "current_diff_task_turn": {
+        "output_items": [
+            {
+                "type": "pr",
+                "pr_title": "Add fibonacci script",
+                "pr_message": "## Summary\n- add a basic Fibonacci script under `scripts/`\n\n## Testing\n- `node scripts/fibonacci.js 10`\n- `npm run lint` *(fails: next not found)*",
+                "output_diff": {
+                    "type": "output_diff",
+                    "repo_id": "/workspace/rddit-vercel",
+                    "base_commit_sha": "1a2e9baf2ce2fdd0c126b47b1bcfd512de2a9f7b",
+                    "diff": "diff --git a/scripts/fibonacci.js b/scripts/fibonacci.js\nnew file mode 100644\nindex 0000000000000000000000000000000000000000..6c9fdfdbf8669b7968936411050525b995d0a9a6\n--- /dev/null\n+++ b/scripts/fibonacci.js\n@@ -0,0 +1,31 @@\n+#!/usr/bin/env node\n+\n+function fibonacci(n) {\n+  if (n < 0) {\n+    throw new Error(\"n must be non-negative\");\n+  }\n+  let a = 0;\n+  let b = 1;\n+  for (let i = 0; i < n; i++) {\n+    const next = a + b;\n+    a = b;\n+    b = next;\n+  }\n+  return a;\n+}\n+\n+function printUsage() {\n+  console.log(\"Usage: node scripts/fibonacci.js <n>\");\n+}\n+\n+if (require.main === module) {\n+  const arg = process.argv[2];\n+  if (arg === undefined || isNaN(Number(arg))) {\n+    printUsage();\n+    process.exit(1);\n+  }\n+  const n = Number(arg);\n+  console.log(fibonacci(n));\n+}\n+\n+module.exports = fibonacci;\n",
+                    "external_storage_diff": {
+                        "file_id": "file_00000000114c61f786900f8c2130ace7",
+                        "ttl": null
+                    },
+                    "files_modified": 1,
+                    "lines_added": 31,
+                    "lines_removed": 0,
+                    "commit_message": "Add fibonacci script"
+                }
+            },
+            {
+                "type": "message",
+                "role": "assistant",
+                "content": [
+                    {
+                        "content_type": "text",
+                        "text": "**Summary**\n\n- Created a command-line Fibonacci script that validates input and prints the result when executed with Node"
+                    },
+                    {
+                        "content_type": "repo_file_citation",
+                        "path": "scripts/fibonacci.js",
+                        "line_range_start": 1,
+                        "line_range_end": 31
+                    },
+                    {
+                        "content_type": "text",
+                        "text": "\n\n**Testing**\n\n- ❌ `npm run lint` (failed to run `next lint`)"
+                    },
+                    {
+                        "content_type": "terminal_chunk_citation",
+                        "terminal_chunk_id": "7dd543",
+                        "line_range_start": 1,
+                        "line_range_end": 5
+                    },
+                    {
+                        "content_type": "text",
+                        "text": "\n- ✅ `node scripts/fibonacci.js 10` produced “55”"
+                    },
+                    {
+                        "content_type": "terminal_chunk_citation",
+                        "terminal_chunk_id": "6ee559",
+                        "line_range_start": 1,
+                        "line_range_end": 3
+                    },
+                    {
+                        "content_type": "text",
+                        "text": "\n\nCodex couldn't run certain commands due to environment limitations. Consider configuring a setup script or internet access in your Codex environment to install dependencies."
+                    }
+                ]
+            }
+        ]
+    }
+}

codex-rs/cli/Cargo.toml

@@ -17,6 +17,8 @@ workspace = true
 [dependencies]
 anyhow = "1"
 clap = { version = "4", features = ["derive"] }
+clap_complete = "4"
+codex-chatgpt = { path = "../chatgpt" }
 codex-core = { path = "../core" }
 codex-common = { path = "../common", features = ["cli"] }
 codex-exec = { path = "../exec" }
@@ -34,3 +36,11 @@ tokio = { version = "1", features = [
 ] }
 tracing = "0.1.41"
 tracing-subscriber = "0.3.19"
+
+[dev-dependencies]
+assert_cmd = "2"
+predicates = "3"
+tempfile = "3"
+wiremock = "0.6"
+tokio = { version = "1", features = ["macros", "rt-multi-thread"] }
+indoc = "2"

codex-rs/cli/src/main.rs

@@ -1,4 +1,9 @@
+use clap::CommandFactory;
 use clap::Parser;
+use clap_complete::Shell;
+use clap_complete::generate;
+use codex_chatgpt::apply_command::ApplyCommand;
+use codex_chatgpt::apply_command::run_apply_command;
 use codex_cli::LandlockCommand;
 use codex_cli::SeatbeltCommand;
 use codex_cli::login::run_login_with_chatgpt;
@@ -47,8 +52,22 @@ enum Subcommand {
     #[clap(visible_alias = "p")]
     Proto(ProtoCli),
 
+    /// Generate shell completion scripts.
+    Completion(CompletionCommand),
+
     /// Internal debugging commands.
     Debug(DebugArgs),
+
+    /// Apply the latest diff produced by Codex agent as a `git apply` to your local working tree.
+    #[clap(visible_alias = "a")]
+    Apply(ApplyCommand),
+}
+
+#[derive(Debug, Parser)]
+struct CompletionCommand {
+    /// Shell to generate completions for
+    #[clap(value_enum, default_value_t = Shell::Bash)]
+    shell: Shell,
 }
 
 #[derive(Debug, Parser)]
@@ -103,6 +122,9 @@ async fn cli_main(codex_linux_sandbox_exe: Option<PathBuf>) -> anyhow::Result<()
             prepend_config_flags(&mut proto_cli.config_overrides, cli.config_overrides);
             proto::run_main(proto_cli).await?;
         }
+        Some(Subcommand::Completion(completion_cli)) => {
+            print_completion(completion_cli);
+        }
         Some(Subcommand::Debug(debug_args)) => match debug_args.cmd {
             DebugCommand::Seatbelt(mut seatbelt_cli) => {
                 prepend_config_flags(&mut seatbelt_cli.config_overrides, cli.config_overrides);
@@ -121,6 +143,10 @@ async fn cli_main(codex_linux_sandbox_exe: Option<PathBuf>) -> anyhow::Result<()
                 .await?;
             }
         },
+        Some(Subcommand::Apply(mut apply_cli)) => {
+            prepend_config_flags(&mut apply_cli.config_overrides, cli.config_overrides);
+            run_apply_command(apply_cli).await?;
+        }
     }
 
     Ok(())
@@ -136,3 +162,9 @@ fn prepend_config_flags(
         .raw_overrides
         .splice(0..0, cli_config_overrides.raw_overrides);
 }
+
+fn print_completion(cmd: CompletionCommand) {
+    let mut app = MultitoolCli::command();
+    let name = "codex";
+    generate(cmd.shell, &mut app, name, &mut std::io::stdout());
+}

codex-rs/cli/tests/integration.rs

@@ -0,0 +1,223 @@
+#![allow(clippy::unwrap_used)]
+
+//! End-to-end integration tests for the `codex` CLI.
+//!
+//! These spin up a local [`wiremock`][] server to stand in for the MCP server
+//! and then run the real compiled `codex` binary against it. The goal is to
+//! verify the high-level request/response flow rather than the details of the
+//! individual async functions.
+//!
+//! [`wiremock`]: https://docs.rs/wiremock
+
+use codex_core::exec::CODEX_SANDBOX_NETWORK_DISABLED_ENV_VAR;
+use predicates::prelude::*;
+use std::fs;
+use std::path::Path;
+use tempfile::TempDir;
+use wiremock::Mock;
+use wiremock::MockServer;
+use wiremock::ResponseTemplate;
+use wiremock::matchers::method;
+use wiremock::matchers::path;
+
+// ----- tests -----
+
+/// Sends a single simple prompt and verifies that the streamed response is
+/// surfaced to the user. This exercises the most common "ask a question, get a
+/// textual answer" flow.
+#[tokio::test(flavor = "multi_thread", worker_threads = 2)]
+async fn full_conversation_turn_integration() {
+    if std::env::var(CODEX_SANDBOX_NETWORK_DISABLED_ENV_VAR).is_ok() {
+        println!("Skipping test because network is disabled");
+        return;
+    }
+
+    let server = MockServer::start().await;
+    Mock::given(method("POST"))
+        .and(path("/v1/responses"))
+        .respond_with(
+            ResponseTemplate::new(200)
+                .insert_header("content-type", "text/event-stream")
+                .set_body_raw(sse_message("Hello, world."), "text/event-stream"),
+        )
+        .expect(1)
+        .mount(&server)
+        .await;
+
+    // Disable retries — the mock server will fail hard if we make an unexpected
+    // request, so retries only slow the test down.
+    unsafe {
+        std::env::set_var("OPENAI_REQUEST_MAX_RETRIES", "0");
+        std::env::set_var("OPENAI_STREAM_MAX_RETRIES", "0");
+    }
+
+    let codex_home = TempDir::new().unwrap();
+    let sandbox = TempDir::new().unwrap();
+    write_config(codex_home.path(), &server);
+
+    // Capture the agent's final message in a file so we can assert on it precisely.
+    let last_message_file = sandbox.path().join("last_message.txt");
+
+    let mut cmd = assert_cmd::Command::cargo_bin("codex").unwrap();
+    cmd.env("CODEX_HOME", codex_home.path())
+        .current_dir(sandbox.path())
+        .arg("exec")
+        .arg("--skip-git-repo-check")
+        .arg("--output-last-message")
+        .arg(&last_message_file)
+        .arg("Hello");
+
+    cmd.assert()
+        .success()
+        .stdout(predicate::str::contains("Hello, world."));
+
+    // Assert on the captured last message file (more robust than stdout formatting).
+    let last = fs::read_to_string(&last_message_file).unwrap();
+    let expected = "Hello, world.";
+    assert_eq!(last.trim(), expected);
+}
+
+/// Simulates a tool invocation (`shell`) followed by a second assistant message
+/// once the tool call completes.
+#[tokio::test(flavor = "multi_thread", worker_threads = 2)]
+async fn tool_invocation_flow() {
+    if std::env::var(CODEX_SANDBOX_NETWORK_DISABLED_ENV_VAR).is_ok() {
+        println!("Skipping test because network is disabled");
+        return;
+    }
+
+    let server = MockServer::start().await;
+
+    // The first request returns a function-call item; the second returns the
+    // final assistant message. Use an atomic counter to serve them in order.
+    struct SeqResponder {
+        count: std::sync::atomic::AtomicUsize,
+    }
+    impl wiremock::Respond for SeqResponder {
+        fn respond(&self, _: &wiremock::Request) -> ResponseTemplate {
+            use std::sync::atomic::Ordering;
+            match self.count.fetch_add(1, Ordering::SeqCst) {
+                0 => ResponseTemplate::new(200)
+                    .insert_header("content-type", "text/event-stream")
+                    .set_body_raw(sse_function_call(), "text/event-stream"),
+                _ => ResponseTemplate::new(200)
+                    .insert_header("content-type", "text/event-stream")
+                    .set_body_raw(sse_final_after_call(), "text/event-stream"),
+            }
+        }
+    }
+
+    Mock::given(method("POST"))
+        .and(path("/v1/responses"))
+        .respond_with(SeqResponder {
+            count: std::sync::atomic::AtomicUsize::new(0),
+        })
+        .expect(2)
+        .mount(&server)
+        .await;
+
+    unsafe {
+        std::env::set_var("OPENAI_REQUEST_MAX_RETRIES", "0");
+        std::env::set_var("OPENAI_STREAM_MAX_RETRIES", "0");
+    }
+
+    let codex_home = TempDir::new().unwrap();
+    let sandbox = TempDir::new().unwrap();
+    write_config(codex_home.path(), &server);
+
+    // Capture final assistant message after tool invocation.
+    let last_message_file = sandbox.path().join("last_message.txt");
+
+    let mut cmd = assert_cmd::Command::cargo_bin("codex").unwrap();
+    cmd.env("CODEX_HOME", codex_home.path())
+        .current_dir(sandbox.path())
+        .arg("exec")
+        .arg("--skip-git-repo-check")
+        .arg("--output-last-message")
+        .arg(&last_message_file)
+        .arg("Run shell");
+
+    cmd.assert()
+        .success()
+        .stdout(predicate::str::contains("exec echo hi"))
+        .stdout(predicate::str::contains("hi"));
+
+    // Assert that the final assistant message (second response) was 'done'.
+    let last = fs::read_to_string(&last_message_file).unwrap();
+    let expected = "done";
+    assert_eq!(last.trim(), expected);
+}
+
+/// Write a minimal `config.toml` pointing the CLI at the mock server.
+fn write_config(codex_home: &Path, server: &MockServer) {
+    fs::write(
+        codex_home.join("config.toml"),
+        format!(
+            r#"
+model_provider = "mock"
+model = "test-model"
+
+[model_providers.mock]
+name = "mock"
+base_url = "{}/v1"
+env_key = "PATH"
+wire_api = "responses"
+"#,
+            server.uri()
+        ),
+    )
+    .unwrap();
+}
+
+/// Small helper to generate an SSE stream with a single assistant message.
+fn sse_message(text: &str) -> String {
+    const TEMPLATE: &str = r#"event: response.output_item.done
+data: {"type":"response.output_item.done","item":{"type":"message","role":"assistant","content":[{"type":"output_text","text":"TEXT_PLACEHOLDER"}]}}
+
+event: response.completed
+data: {"type":"response.completed","response":{"id":"resp1","output":[]}}
+
+
+"#;
+
+    TEMPLATE.replace("TEXT_PLACEHOLDER", text)
+}
+
+/// Helper to craft an SSE stream that returns a `function_call`.
+fn sse_function_call() -> String {
+    let call = serde_json::json!({
+        "type": "response.output_item.done",
+        "item": {
+            "type": "function_call",
+            "name": "shell",
+            "arguments": "{\"command\":[\"echo\",\"hi\"]}",
+            "call_id": "call1"
+        }
+    });
+    let completed = serde_json::json!({
+        "type": "response.completed",
+        "response": {"id": "resp1", "output": []}
+    });
+
+    format!(
+        "event: response.output_item.done\ndata: {call}\n\n\
+event: response.completed\ndata: {completed}\n\n\n"
+    )
+}
+
+/// SSE stream for the assistant's final message after the tool call returns.
+fn sse_final_after_call() -> String {
+    let msg = serde_json::json!({
+        "type": "response.output_item.done",
+        "item": {"type": "message", "role": "assistant", "content": [{"type": "output_text", "text": "done"}]}
+    });
+    let completed = serde_json::json!({
+        "type": "response.completed",
+        "response": {"id": "resp2", "output": []}
+    });
+
+    format!(
+        "event: response.output_item.done\ndata: {msg}\n\n\
+event: response.completed\ndata: {completed}\n\n\n"
+    )
+}

codex-rs/common/Cargo.toml

@@ -9,7 +9,7 @@ workspace = true
 [dependencies]
 clap = { version = "4", features = ["derive", "wrap_help"], optional = true }
 codex-core = { path = "../core" }
-toml = { version = "0.8", optional = true }
+toml = { version = "0.9", optional = true }
 serde = { version = "1", optional = true }
 
 [features]

codex-rs/common/src/elapsed.rs

@@ -20,7 +20,7 @@ pub fn format_duration(duration: Duration) -> String {
 
 fn format_elapsed_millis(millis: i64) -> String {
     if millis < 1000 {
-        format!("{}ms", millis)
+        format!("{millis}ms")
     } else if millis < 60_000 {
         format!("{:.2}s", millis as f64 / 1000.0)
     } else {

codex-rs/config.md

@@ -94,15 +94,15 @@ env_http_headers = { "X-Example-Features": "EXAMPLE_FEATURES" }
 
 ## model_provider
 
-Identifies which provider to use from the `model_providers` map. Defaults to `"openai"`.
+Identifies which provider to use from the `model_providers` map. Defaults to `"openai"`. You can override the `base_url` for the built-in `openai` provider via the `OPENAI_BASE_URL` environment variable.
 
 Note that if you override `model_provider`, then you likely want to override
 `model`, as well. For example, if you are running ollama with Mistral locally,
 then you would need to add the following to your config in addition to the new entry in the `model_providers` map:
 
 ```toml
-model = "mistral"
 model_provider = "ollama"
+model = "mistral"
 ```
 
 ## approval_policy
@@ -157,6 +157,8 @@ wire_api = "chat"
 model = "o3"
 model_provider = "openai"
 approval_policy = "never"
+model_reasoning_effort = "high"
+model_reasoning_summary = "detailed"
 
 [profiles.gpt3]
 model = "gpt-3.5-turbo"
@@ -204,6 +206,14 @@ To disable reasoning summaries, set `model_reasoning_summary` to `"none"` in you
 model_reasoning_summary = "none"  # disable reasoning summaries
 ```
 
+## model_supports_reasoning_summaries
+
+By default, `reasoning` is only set on requests to OpenAI models that are known to support them. To force `reasoning` to set on requests to the current model, you can force this behavior by setting the following in `config.toml`:
+
+```toml
+model_supports_reasoning_summaries = true
+```
+
 ## sandbox_mode
 
 Codex executes model-generated shell commands inside an OS-level sandbox.

codex-rs/core/Cargo.toml

@@ -13,26 +13,21 @@ workspace = true
 [dependencies]
 anyhow = "1"
 async-channel = "2.3.1"
-base64 = "0.21"
+base64 = "0.22"
 bytes = "1.10.1"
 codex-apply-patch = { path = "../apply-patch" }
-codex-login = { path = "../login" }
 codex-mcp-client = { path = "../mcp-client" }
 dirs = "6"
 env-flags = "0.1.1"
 eventsource-stream = "0.2.3"
 fs2 = "0.4.3"
-fs-err = "3.1.0"
 futures = "0.3"
 mcp-types = { path = "../mcp-types" }
 mime_guess = "2.0"
-patch = "0.7"
-path-absolutize = "3.1.1"
 rand = "0.9"
 reqwest = { version = "0.12", features = ["json", "stream"] }
 serde = { version = "1", features = ["derive"] }
 serde_json = "1"
-strum = "0.27.1"
 strum_macros = "0.27.1"
 thiserror = "2.0.12"
 time = { version = "0.3", features = ["formatting", "local-offset", "macros"] }
@@ -44,10 +39,10 @@ tokio = { version = "1", features = [
     "signal",
 ] }
 tokio-util = "0.7.14"
-toml = "0.8.20"
+toml = "0.9.1"
 tracing = { version = "0.1.41", features = ["log"] }
 tree-sitter = "0.25.3"
-tree-sitter-bash = "0.23.3"
+tree-sitter-bash = "0.25.0"
 uuid = { version = "1", features = ["serde", "v4"] }
 wildmatch = "2.4.0"
 
@@ -69,4 +64,5 @@ maplit = "1.0.2"
 predicates = "3"
 pretty_assertions = "1.4.1"
 tempfile = "3"
+tokio-test = "0.4"
 wiremock = "0.6"

codex-rs/core/src/chat_completions.rs

@@ -134,7 +134,7 @@ pub(crate) async fn stream_chat_completions(
 
         match res {
             Ok(resp) if resp.status().is_success() => {
-                let (tx_event, rx_event) = mpsc::channel::<Result<ResponseEvent>>(16);
+                let (tx_event, rx_event) = mpsc::channel::<Result<ResponseEvent>>(1600);
                 let stream = resp.bytes_stream().map_err(CodexErr::Reqwest);
                 tokio::spawn(process_chat_sse(stream, tx_event));
                 return Ok(ResponseStream { rx_event });
@@ -426,6 +426,12 @@ where
                     // will never appear in a Chat Completions stream.
                     continue;
                 }
+                Poll::Ready(Some(Ok(ResponseEvent::OutputTextDelta(_))))
+                | Poll::Ready(Some(Ok(ResponseEvent::ReasoningSummaryDelta(_)))) => {
+                    // Deltas are ignored here since aggregation waits for the
+                    // final OutputItemDone.
+                    continue;
+                }
             }
         }
     }

codex-rs/core/src/client.rs

@@ -23,6 +23,7 @@ use crate::client_common::ResponseEvent;
 use crate::client_common::ResponseStream;
 use crate::client_common::ResponsesApiRequest;
 use crate::client_common::create_reasoning_param_for_request;
+use crate::config::Config;
 use crate::config_types::ReasoningEffort as ReasoningEffortConfig;
 use crate::config_types::ReasoningSummary as ReasoningSummaryConfig;
 use crate::error::CodexErr;
@@ -36,10 +37,11 @@ use crate::models::ResponseItem;
 use crate::openai_tools::create_tools_json_for_responses_api;
 use crate::protocol::TokenUsage;
 use crate::util::backoff;
+use std::sync::Arc;
 
 #[derive(Clone)]
 pub struct ModelClient {
-    model: String,
+    config: Arc<Config>,
     client: reqwest::Client,
     provider: ModelProviderInfo,
     effort: ReasoningEffortConfig,
@@ -48,13 +50,13 @@ pub struct ModelClient {
 
 impl ModelClient {
     pub fn new(
-        model: impl ToString,
+        config: Arc<Config>,
         provider: ModelProviderInfo,
         effort: ReasoningEffortConfig,
         summary: ReasoningSummaryConfig,
     ) -> Self {
         Self {
-            model: model.to_string(),
+            config,
             client: reqwest::Client::new(),
             provider,
             effort,
@@ -70,9 +72,13 @@ impl ModelClient {
             WireApi::Responses => self.stream_responses(prompt).await,
             WireApi::Chat => {
                 // Create the raw streaming connection first.
-                let response_stream =
-                    stream_chat_completions(prompt, &self.model, &self.client, &self.provider)
-                        .await?;
+                let response_stream = stream_chat_completions(
+                    prompt,
+                    &self.config.model,
+                    &self.client,
+                    &self.provider,
+                )
+                .await?;
 
                 // Wrap it with the aggregation adapter so callers see *only*
                 // the final assistant message per turn (matching the
@@ -106,11 +112,11 @@ impl ModelClient {
             return stream_from_fixture(path).await;
         }
 
-        let full_instructions = prompt.get_full_instructions(&self.model);
-        let tools_json = create_tools_json_for_responses_api(prompt, &self.model)?;
-        let reasoning = create_reasoning_param_for_request(&self.model, self.effort, self.summary);
+        let full_instructions = prompt.get_full_instructions(&self.config.model);
+        let tools_json = create_tools_json_for_responses_api(prompt, &self.config.model)?;
+        let reasoning = create_reasoning_param_for_request(&self.config, self.effort, self.summary);
         let payload = ResponsesApiRequest {
-            model: &self.model,
+            model: &self.config.model,
             instructions: &full_instructions,
             input: &prompt.input,
             tools: &tools_json,
@@ -119,6 +125,7 @@ impl ModelClient {
             reasoning,
             previous_response_id: prompt.prev_id.clone(),
             store: prompt.store,
+            // TODO: make this configurable
             stream: true,
         };
 
@@ -142,7 +149,7 @@ impl ModelClient {
             let res = req_builder.send().await;
             match res {
                 Ok(resp) if resp.status().is_success() => {
-                    let (tx_event, rx_event) = mpsc::channel::<Result<ResponseEvent>>(16);
+                    let (tx_event, rx_event) = mpsc::channel::<Result<ResponseEvent>>(1600);
 
                     // spawn task to process SSE
                     let stream = resp.bytes_stream().map_err(CodexErr::Reqwest);
@@ -199,6 +206,7 @@ struct SseEvent {
     kind: String,
     response: Option<Value>,
     item: Option<Value>,
+    delta: Option<String>,
 }
 
 #[derive(Debug, Deserialize)]
@@ -331,6 +339,22 @@ where
                     return;
                 }
             }
+            "response.output_text.delta" => {
+                if let Some(delta) = event.delta {
+                    let event = ResponseEvent::OutputTextDelta(delta);
+                    if tx_event.send(Ok(event)).await.is_err() {
+                        return;
+                    }
+                }
+            }
+            "response.reasoning_summary_text.delta" => {
+                if let Some(delta) = event.delta {
+                    let event = ResponseEvent::ReasoningSummaryDelta(delta);
+                    if tx_event.send(Ok(event)).await.is_err() {
+                        return;
+                    }
+                }
+            }
             "response.created" => {
                 if event.response.is_some() {
                     let _ = tx_event.send(Ok(ResponseEvent::Created {})).await;
@@ -354,10 +378,8 @@ where
             | "response.function_call_arguments.delta"
             | "response.in_progress"
             | "response.output_item.added"
-            | "response.output_text.delta"
             | "response.output_text.done"
             | "response.reasoning_summary_part.added"
-            | "response.reasoning_summary_text.delta"
             | "response.reasoning_summary_text.done" => {
                 // Currently, we ignore these events, but we handle them
                 // separately to skip the logging message in the `other` case.
@@ -369,7 +391,7 @@ where
 
 /// used in tests to stream from a text SSE file
 async fn stream_from_fixture(path: impl AsRef<Path>) -> Result<ResponseStream> {
-    let (tx_event, rx_event) = mpsc::channel::<Result<ResponseEvent>>(16);
+    let (tx_event, rx_event) = mpsc::channel::<Result<ResponseEvent>>(1600);
     let f = std::fs::File::open(path.as_ref())?;
     let lines = std::io::BufReader::new(f).lines();
 
@@ -385,3 +407,241 @@ async fn stream_from_fixture(path: impl AsRef<Path>) -> Result<ResponseStream> {
     tokio::spawn(process_sse(stream, tx_event));
     Ok(ResponseStream { rx_event })
 }
+
+#[cfg(test)]
+mod tests {
+    #![allow(clippy::expect_used, clippy::unwrap_used)]
+
+    use super::*;
+    use serde_json::json;
+    use tokio::sync::mpsc;
+    use tokio_test::io::Builder as IoBuilder;
+    use tokio_util::io::ReaderStream;
+
+    // ────────────────────────────
+    // Helpers
+    // ────────────────────────────
+
+    /// Runs the SSE parser on pre-chunked byte slices and returns every event
+    /// (including any final `Err` from a stream-closure check).
+    async fn collect_events(chunks: &[&[u8]]) -> Vec<Result<ResponseEvent>> {
+        let mut builder = IoBuilder::new();
+        for chunk in chunks {
+            builder.read(chunk);
+        }
+
+        let reader = builder.build();
+        let stream = ReaderStream::new(reader).map_err(CodexErr::Io);
+        let (tx, mut rx) = mpsc::channel::<Result<ResponseEvent>>(16);
+        tokio::spawn(process_sse(stream, tx));
+
+        let mut events = Vec::new();
+        while let Some(ev) = rx.recv().await {
+            events.push(ev);
+        }
+        events
+    }
+
+    /// Builds an in-memory SSE stream from JSON fixtures and returns only the
+    /// successfully parsed events (panics on internal channel errors).
+    async fn run_sse(events: Vec<serde_json::Value>) -> Vec<ResponseEvent> {
+        let mut body = String::new();
+        for e in events {
+            let kind = e
+                .get("type")
+                .and_then(|v| v.as_str())
+                .expect("fixture event missing type");
+            if e.as_object().map(|o| o.len() == 1).unwrap_or(false) {
+                body.push_str(&format!("event: {kind}\n\n"));
+            } else {
+                body.push_str(&format!("event: {kind}\ndata: {e}\n\n"));
+            }
+        }
+
+        let (tx, mut rx) = mpsc::channel::<Result<ResponseEvent>>(8);
+        let stream = ReaderStream::new(std::io::Cursor::new(body)).map_err(CodexErr::Io);
+        tokio::spawn(process_sse(stream, tx));
+
+        let mut out = Vec::new();
+        while let Some(ev) = rx.recv().await {
+            out.push(ev.expect("channel closed"));
+        }
+        out
+    }
+
+    // ────────────────────────────
+    // Tests from `implement-test-for-responses-api-sse-parser`
+    // ────────────────────────────
+
+    #[tokio::test]
+    async fn parses_items_and_completed() {
+        let item1 = json!({
+            "type": "response.output_item.done",
+            "item": {
+                "type": "message",
+                "role": "assistant",
+                "content": [{"type": "output_text", "text": "Hello"}]
+            }
+        })
+        .to_string();
+
+        let item2 = json!({
+            "type": "response.output_item.done",
+            "item": {
+                "type": "message",
+                "role": "assistant",
+                "content": [{"type": "output_text", "text": "World"}]
+            }
+        })
+        .to_string();
+
+        let completed = json!({
+            "type": "response.completed",
+            "response": { "id": "resp1" }
+        })
+        .to_string();
+
+        let sse1 = format!("event: response.output_item.done\ndata: {item1}\n\n");
+        let sse2 = format!("event: response.output_item.done\ndata: {item2}\n\n");
+        let sse3 = format!("event: response.completed\ndata: {completed}\n\n");
+
+        let events = collect_events(&[sse1.as_bytes(), sse2.as_bytes(), sse3.as_bytes()]).await;
+
+        assert_eq!(events.len(), 3);
+
+        matches!(
+            &events[0],
+            Ok(ResponseEvent::OutputItemDone(ResponseItem::Message { role, .. }))
+                if role == "assistant"
+        );
+
+        matches!(
+            &events[1],
+            Ok(ResponseEvent::OutputItemDone(ResponseItem::Message { role, .. }))
+                if role == "assistant"
+        );
+
+        match &events[2] {
+            Ok(ResponseEvent::Completed {
+                response_id,
+                token_usage,
+            }) => {
+                assert_eq!(response_id, "resp1");
+                assert!(token_usage.is_none());
+            }
+            other => panic!("unexpected third event: {other:?}"),
+        }
+    }
+
+    #[tokio::test]
+    async fn error_when_missing_completed() {
+        let item1 = json!({
+            "type": "response.output_item.done",
+            "item": {
+                "type": "message",
+                "role": "assistant",
+                "content": [{"type": "output_text", "text": "Hello"}]
+            }
+        })
+        .to_string();
+
+        let sse1 = format!("event: response.output_item.done\ndata: {item1}\n\n");
+
+        let events = collect_events(&[sse1.as_bytes()]).await;
+
+        assert_eq!(events.len(), 2);
+
+        matches!(events[0], Ok(ResponseEvent::OutputItemDone(_)));
+
+        match &events[1] {
+            Err(CodexErr::Stream(msg)) => {
+                assert_eq!(msg, "stream closed before response.completed")
+            }
+            other => panic!("unexpected second event: {other:?}"),
+        }
+    }
+
+    // ────────────────────────────
+    // Table-driven test from `main`
+    // ────────────────────────────
+
+    /// Verifies that the adapter produces the right `ResponseEvent` for a
+    /// variety of incoming `type` values.
+    #[tokio::test]
+    async fn table_driven_event_kinds() {
+        struct TestCase {
+            name: &'static str,
+            event: serde_json::Value,
+            expect_first: fn(&ResponseEvent) -> bool,
+            expected_len: usize,
+        }
+
+        fn is_created(ev: &ResponseEvent) -> bool {
+            matches!(ev, ResponseEvent::Created)
+        }
+        fn is_output(ev: &ResponseEvent) -> bool {
+            matches!(ev, ResponseEvent::OutputItemDone(_))
+        }
+        fn is_completed(ev: &ResponseEvent) -> bool {
+            matches!(ev, ResponseEvent::Completed { .. })
+        }
+
+        let completed = json!({
+            "type": "response.completed",
+            "response": {
+                "id": "c",
+                "usage": {
+                    "input_tokens": 0,
+                    "input_tokens_details": null,
+                    "output_tokens": 0,
+                    "output_tokens_details": null,
+                    "total_tokens": 0
+                },
+                "output": []
+            }
+        });
+
+        let cases = vec![
+            TestCase {
+                name: "created",
+                event: json!({"type": "response.created", "response": {}}),
+                expect_first: is_created,
+                expected_len: 2,
+            },
+            TestCase {
+                name: "output_item.done",
+                event: json!({
+                    "type": "response.output_item.done",
+                    "item": {
+                        "type": "message",
+                        "role": "assistant",
+                        "content": [
+                            {"type": "output_text", "text": "hi"}
+                        ]
+                    }
+                }),
+                expect_first: is_output,
+                expected_len: 2,
+            },
+            TestCase {
+                name: "unknown",
+                event: json!({"type": "response.new_tool_event"}),
+                expect_first: is_completed,
+                expected_len: 1,
+            },
+        ];
+
+        for case in cases {
+            let mut evs = vec![case.event];
+            evs.push(completed.clone());
+
+            let out = run_sse(evs).await;
+            assert_eq!(out.len(), case.expected_len, "case {}", case.name);
+            assert!(
+                (case.expect_first)(&out[0]),
+                "first event mismatch in case {}",
+                case.name
+            );
+        }
+    }
+}

codex-rs/core/src/client_common.rs

@@ -37,7 +37,7 @@ pub struct Prompt {
 }
 
 impl Prompt {
-    pub(crate) fn get_full_instructions(&self, model: &str) -> Cow<str> {
+    pub(crate) fn get_full_instructions(&self, model: &str) -> Cow<'_, str> {
         let mut sections: Vec<&str> = vec![BASE_INSTRUCTIONS];
         if let Some(ref user) = self.user_instructions {
             sections.push(user);
@@ -57,6 +57,8 @@ pub enum ResponseEvent {
         response_id: String,
         token_usage: Option<TokenUsage>,
     },
+    OutputTextDelta(String),
+    ReasoningSummaryDelta(String),
 }
 
 #[derive(Debug, Serialize)]
@@ -131,15 +133,16 @@ pub(crate) struct ResponsesApiRequest<'a> {
     pub(crate) stream: bool,
 }
 
+use crate::config::Config;
+
 pub(crate) fn create_reasoning_param_for_request(
-    model: &str,
+    config: &Config,
     effort: ReasoningEffortConfig,
     summary: ReasoningSummaryConfig,
 ) -> Option<Reasoning> {
-    let effort: Option<OpenAiReasoningEffort> = effort.into();
-    let effort = effort?;
-
-    if model_supports_reasoning_summaries(model) {
+    if model_supports_reasoning_summaries(config) {
+        let effort: Option<OpenAiReasoningEffort> = effort.into();
+        let effort = effort?;
         Some(Reasoning {
             effort,
             summary: summary.into(),
@@ -149,19 +152,24 @@ pub(crate) fn create_reasoning_param_for_request(
     }
 }
 
-pub fn model_supports_reasoning_summaries(model: &str) -> bool {
-    // Currently, we hardcode this rule to decide whether enable reasoning.
+pub fn model_supports_reasoning_summaries(config: &Config) -> bool {
+    // Currently, we hardcode this rule to decide whether to enable reasoning.
     // We expect reasoning to apply only to OpenAI models, but we do not want
     // users to have to mess with their config to disable reasoning for models
     // that do not support it, such as `gpt-4.1`.
     //
     // Though if a user is using Codex with non-OpenAI models that, say, happen
-    // to start with "o", then they can set `model_reasoning_effort = "none` in
+    // to start with "o", then they can set `model_reasoning_effort = "none"` in
     // config.toml to disable reasoning.
     //
-    // Ultimately, this should also be configurable in config.toml, but we
-    // need to have defaults that "just work." Perhaps we could have a
-    // "reasoning models pattern" as part of ModelProviderInfo?
+    // Converseley, if a user has a non-OpenAI provider that supports reasoning,
+    // they can set the top-level `model_supports_reasoning_summaries = true`
+    // config option to enable reasoning.
+    if config.model_supports_reasoning_summaries {
+        return true;
+    }
+
+    let model = &config.model;
     model.starts_with("o") || model.starts_with("codex")
 }
 

codex-rs/core/src/codex.rs

@@ -61,7 +61,9 @@ use crate::models::ResponseInputItem;
 use crate::models::ResponseItem;
 use crate::models::ShellToolCallParams;
 use crate::project_doc::get_user_instructions;
+use crate::protocol::AgentMessageDeltaEvent;
 use crate::protocol::AgentMessageEvent;
+use crate::protocol::AgentReasoningDeltaEvent;
 use crate::protocol::AgentReasoningEvent;
 use crate::protocol::ApplyPatchApprovalRequestEvent;
 use crate::protocol::AskForApproval;
@@ -103,7 +105,7 @@ impl Codex {
     /// submitted to start the session.
     pub async fn spawn(config: Config, ctrl_c: Arc<Notify>) -> CodexResult<(Codex, String)> {
         let (tx_sub, rx_sub) = async_channel::bounded(64);
-        let (tx_event, rx_event) = async_channel::bounded(64);
+        let (tx_event, rx_event) = async_channel::bounded(1600);
 
         let instructions = get_user_instructions(&config).await;
         let configure_session = Op::ConfigureSession {
@@ -586,7 +588,7 @@ async fn submission_loop(
                 }
 
                 let client = ModelClient::new(
-                    model.clone(),
+                    config.clone(),
                     provider.clone(),
                     model_reasoning_effort,
                     model_reasoning_summary,
@@ -1121,15 +1123,8 @@ async fn try_run_turn(
 
     let mut stream = sess.client.clone().stream(&prompt).await?;
 
-    // Buffer all the incoming messages from the stream first, then execute them.
-    // If we execute a function call in the middle of handling the stream, it can time out.
-    let mut input = Vec::new();
-    while let Some(event) = stream.next().await {
-        input.push(event?);
-    }
-
     let mut output = Vec::new();
-    for event in input {
+    while let Some(Ok(event)) = stream.next().await {
         match event {
             ResponseEvent::Created => {
                 let mut state = sess.state.lock().unwrap();
@@ -1172,6 +1167,20 @@ async fn try_run_turn(
                 state.previous_response_id = Some(response_id);
                 break;
             }
+            ResponseEvent::OutputTextDelta(delta) => {
+                let event = Event {
+                    id: sub_id.to_string(),
+                    msg: EventMsg::AgentMessageDelta(AgentMessageDeltaEvent { delta }),
+                };
+                sess.tx_event.send(event).await.ok();
+            }
+            ResponseEvent::ReasoningSummaryDelta(delta) => {
+                let event = Event {
+                    id: sub_id.to_string(),
+                    msg: EventMsg::AgentReasoningDelta(AgentReasoningDeltaEvent { delta }),
+                };
+                sess.tx_event.send(event).await.ok();
+            }
         }
     }
     Ok(output)
@@ -1297,7 +1306,7 @@ async fn handle_function_call(
                     ResponseInputItem::FunctionCallOutput {
                         call_id,
                         output: FunctionCallOutputPayload {
-                            content: format!("unsupported call: {}", name),
+                            content: format!("unsupported call: {name}"),
                             success: None,
                         },
                     }
@@ -1489,8 +1498,7 @@ async fn handle_sandbox_error(
             call_id,
             output: FunctionCallOutputPayload {
                 content: format!(
-                    "failed in sandbox {:?} with execution error: {error}",
-                    sandbox_type
+                    "failed in sandbox {sandbox_type:?} with execution error: {error}"
                 ),
                 success: Some(false),
             },

codex-rs/core/src/config.rs

@@ -130,6 +130,13 @@ pub struct Config {
     /// If not "none", the value to use for `reasoning.summary` when making a
     /// request using the Responses API.
     pub model_reasoning_summary: ReasoningSummary,
+
+    /// When set to `true`, overrides the default heuristic and forces
+    /// `model_supports_reasoning_summaries()` to return `true`.
+    pub model_supports_reasoning_summaries: bool,
+
+    /// Base URL for requests to ChatGPT (as opposed to the OpenAI API).
+    pub chatgpt_base_url: String,
 }
 
 impl Config {
@@ -308,6 +315,12 @@ pub struct ConfigToml {
 
     pub model_reasoning_effort: Option<ReasoningEffort>,
     pub model_reasoning_summary: Option<ReasoningSummary>,
+
+    /// Override to force-enable reasoning summaries for the configured model.
+    pub model_supports_reasoning_summaries: Option<bool>,
+
+    /// Base URL for requests to ChatGPT (as opposed to the OpenAI API).
+    pub chatgpt_base_url: Option<String>,
 }
 
 impl ConfigToml {
@@ -464,8 +477,23 @@ impl Config {
             codex_linux_sandbox_exe,
 
             hide_agent_reasoning: cfg.hide_agent_reasoning.unwrap_or(false),
-            model_reasoning_effort: cfg.model_reasoning_effort.unwrap_or_default(),
-            model_reasoning_summary: cfg.model_reasoning_summary.unwrap_or_default(),
+            model_reasoning_effort: config_profile
+                .model_reasoning_effort
+                .or(cfg.model_reasoning_effort)
+                .unwrap_or_default(),
+            model_reasoning_summary: config_profile
+                .model_reasoning_summary
+                .or(cfg.model_reasoning_summary)
+                .unwrap_or_default(),
+
+            model_supports_reasoning_summaries: cfg
+                .model_supports_reasoning_summaries
+                .unwrap_or(false),
+
+            chatgpt_base_url: config_profile
+                .chatgpt_base_url
+                .or(cfg.chatgpt_base_url)
+                .unwrap_or("https://chatgpt.com/backend-api/".to_string()),
         };
         Ok(config)
     }
@@ -659,6 +687,8 @@ wire_api = "chat"
 model = "o3"
 model_provider = "openai"
 approval_policy = "never"
+model_reasoning_effort = "high"
+model_reasoning_summary = "detailed"
 
 [profiles.gpt3]
 model = "gpt-3.5-turbo"
@@ -766,8 +796,10 @@ disable_response_storage = true
                 tui: Tui::default(),
                 codex_linux_sandbox_exe: None,
                 hide_agent_reasoning: false,
-                model_reasoning_effort: ReasoningEffort::default(),
-                model_reasoning_summary: ReasoningSummary::default(),
+                model_reasoning_effort: ReasoningEffort::High,
+                model_reasoning_summary: ReasoningSummary::Detailed,
+                model_supports_reasoning_summaries: false,
+                chatgpt_base_url: "https://chatgpt.com/backend-api/".to_string(),
             },
             o3_profile_config
         );
@@ -812,6 +844,8 @@ disable_response_storage = true
             hide_agent_reasoning: false,
             model_reasoning_effort: ReasoningEffort::default(),
             model_reasoning_summary: ReasoningSummary::default(),
+            model_supports_reasoning_summaries: false,
+            chatgpt_base_url: "https://chatgpt.com/backend-api/".to_string(),
         };
 
         assert_eq!(expected_gpt3_profile_config, gpt3_profile_config);
@@ -871,6 +905,8 @@ disable_response_storage = true
             hide_agent_reasoning: false,
             model_reasoning_effort: ReasoningEffort::default(),
             model_reasoning_summary: ReasoningSummary::default(),
+            model_supports_reasoning_summaries: false,
+            chatgpt_base_url: "https://chatgpt.com/backend-api/".to_string(),
         };
 
         assert_eq!(expected_zdr_profile_config, zdr_profile_config);

codex-rs/core/src/config_profile.rs

@@ -1,5 +1,7 @@
 use serde::Deserialize;
 
+use crate::config_types::ReasoningEffort;
+use crate::config_types::ReasoningSummary;
 use crate::protocol::AskForApproval;
 
 /// Collection of common configuration options that a user can define as a unit
@@ -12,4 +14,7 @@ pub struct ConfigProfile {
     pub model_provider: Option<String>,
     pub approval_policy: Option<AskForApproval>,
     pub disable_response_storage: Option<bool>,
+    pub model_reasoning_effort: Option<ReasoningEffort>,
+    pub model_reasoning_summary: Option<ReasoningSummary>,
+    pub chatgpt_base_url: Option<String>,
 }

codex-rs/core/src/is_safe_command.rs

@@ -240,8 +240,7 @@ mod tests {
         ] {
             assert!(
                 !is_safe_to_call_with_exec(&args),
-                "expected {:?} to be unsafe",
-                args
+                "expected {args:?} to be unsafe"
             );
         }
     }

codex-rs/core/src/mcp_connection_manager.rs

@@ -79,9 +79,19 @@ impl McpConnectionManager {
 
         // Launch all configured servers concurrently.
         let mut join_set = JoinSet::new();
+        let mut errors = ClientStartErrors::new();
 
         for (server_name, cfg) in mcp_servers {
-            // TODO: Verify server name: require `^[a-zA-Z0-9_-]+$`?
+            // Validate server name before spawning
+            if !is_valid_mcp_server_name(&server_name) {
+                let error = anyhow::anyhow!(
+                    "invalid server name '{}': must match pattern ^[a-zA-Z0-9_-]+$",
+                    server_name
+                );
+                errors.insert(server_name, error);
+                continue;
+            }
+
             join_set.spawn(async move {
                 let McpServerConfig { command, args, env } = cfg;
                 let client_res = McpClient::new_stdio_client(command, args, env).await;
@@ -117,7 +127,6 @@ impl McpConnectionManager {
 
         let mut clients: HashMap<String, std::sync::Arc<McpClient>> =
             HashMap::with_capacity(join_set.len());
-        let mut errors = ClientStartErrors::new();
 
         while let Some(res) = join_set.join_next().await {
             let (server_name, client_res) = res?; // JoinError propagation
@@ -208,3 +217,10 @@ pub async fn list_all_tools(
 
     Ok(aggregated)
 }
+
+fn is_valid_mcp_server_name(server_name: &str) -> bool {
+    !server_name.is_empty()
+        && server_name
+            .chars()
+            .all(|c| c.is_ascii_alphanumeric() || c == '_' || c == '-')
+}

codex-rs/core/src/model_provider_info.rs

@@ -176,7 +176,15 @@ pub fn built_in_model_providers() -> HashMap<String, ModelProviderInfo> {
             "openai",
             P {
                 name: "OpenAI".into(),
-                base_url: "https://api.openai.com/v1".into(),
+                // Allow users to override the default OpenAI endpoint by
+                // exporting `OPENAI_BASE_URL`. This is useful when pointing
+                // Codex at a proxy, mock server, or Azure-style deployment
+                // without requiring a full TOML override for the built-in
+                // OpenAI provider.
+                base_url: std::env::var("OPENAI_BASE_URL")
+                    .ok()
+                    .filter(|v| !v.trim().is_empty())
+                    .unwrap_or_else(|| "https://api.openai.com/v1".to_string()),
                 env_key: Some("OPENAI_API_KEY".into()),
                 env_key_instructions: Some("Create an API key (https://platform.openai.com) and export it as an environment variable.".into()),
                 wire_api: WireApi::Responses,

codex-rs/core/src/models.rs

@@ -145,7 +145,7 @@ impl From<Vec<InputItem>> for ResponseInputItem {
                                 .unwrap_or_else(|| "application/octet-stream".to_string());
                             let encoded = base64::engine::general_purpose::STANDARD.encode(bytes);
                             Some(ContentItem::InputImage {
-                                image_url: format!("data:{};base64,{}", mime, encoded),
+                                image_url: format!("data:{mime};base64,{encoded}"),
                             })
                         }
                         Err(err) => {

codex-rs/core/src/protocol.rs

@@ -282,9 +282,15 @@ pub enum EventMsg {
     /// Agent text output message
     AgentMessage(AgentMessageEvent),
 
+    /// Agent text output delta message
+    AgentMessageDelta(AgentMessageDeltaEvent),
+
     /// Reasoning event from agent.
     AgentReasoning(AgentReasoningEvent),
 
+    /// Agent reasoning delta event from agent.
+    AgentReasoningDelta(AgentReasoningDeltaEvent),
+
     /// Ack the client's configure message.
     SessionConfigured(SessionConfiguredEvent),
 
@@ -340,11 +346,21 @@ pub struct AgentMessageEvent {
     pub message: String,
 }
 
+#[derive(Debug, Clone, Deserialize, Serialize)]
+pub struct AgentMessageDeltaEvent {
+    pub delta: String,
+}
+
 #[derive(Debug, Clone, Deserialize, Serialize)]
 pub struct AgentReasoningEvent {
     pub text: String,
 }
 
+#[derive(Debug, Clone, Deserialize, Serialize)]
+pub struct AgentReasoningDeltaEvent {
+    pub delta: String,
+}
+
 #[derive(Debug, Clone, Deserialize, Serialize)]
 pub struct McpToolCallBeginEvent {
     /// Identifier so this can be paired with the McpToolCallEnd event.

codex-rs/core/tests/cli_responses_fixture.sse

@@ -0,0 +1,8 @@
+event: response.created
+data: {"type":"response.created","response":{"id":"resp1"}}
+
+event: response.output_item.done
+data: {"type":"response.output_item.done","item":{"type":"message","role":"assistant","content":[{"type":"output_text","text":"fixture hello"}]}}
+
+event: response.completed
+data: {"type":"response.completed","response":{"id":"resp1","output":[]}}

codex-rs/core/tests/cli_stream.rs

@@ -0,0 +1,119 @@
+#![expect(clippy::unwrap_used)]
+
+use assert_cmd::Command as AssertCommand;
+use codex_core::exec::CODEX_SANDBOX_NETWORK_DISABLED_ENV_VAR;
+use tempfile::TempDir;
+use wiremock::Mock;
+use wiremock::MockServer;
+use wiremock::ResponseTemplate;
+use wiremock::matchers::method;
+use wiremock::matchers::path;
+
+/// Tests streaming chat completions through the CLI using a mock server.
+/// This test:
+/// 1. Sets up a mock server that simulates OpenAI's chat completions API
+/// 2. Configures codex to use this mock server via a custom provider
+/// 3. Sends a simple "hello?" prompt and verifies the streamed response
+/// 4. Ensures the response is received exactly once and contains "hi"
+#[tokio::test(flavor = "multi_thread", worker_threads = 2)]
+async fn chat_mode_stream_cli() {
+    if std::env::var(CODEX_SANDBOX_NETWORK_DISABLED_ENV_VAR).is_ok() {
+        println!(
+            "Skipping test because it cannot execute when network is disabled in a Codex sandbox."
+        );
+        return;
+    }
+
+    let server = MockServer::start().await;
+    let sse = concat!(
+        "data: {\"choices\":[{\"delta\":{\"content\":\"hi\"}}]}\n\n",
+        "data: {\"choices\":[{\"delta\":{}}]}\n\n",
+        "data: [DONE]\n\n"
+    );
+    Mock::given(method("POST"))
+        .and(path("/v1/chat/completions"))
+        .respond_with(
+            ResponseTemplate::new(200)
+                .insert_header("content-type", "text/event-stream")
+                .set_body_raw(sse, "text/event-stream"),
+        )
+        .expect(1)
+        .mount(&server)
+        .await;
+
+    let home = TempDir::new().unwrap();
+    let provider_override = format!(
+        "model_providers.mock={{ name = \"mock\", base_url = \"{}/v1\", env_key = \"PATH\", wire_api = \"chat\" }}",
+        server.uri()
+    );
+    let mut cmd = AssertCommand::new("cargo");
+    cmd.arg("run")
+        .arg("-p")
+        .arg("codex-cli")
+        .arg("--quiet")
+        .arg("--")
+        .arg("exec")
+        .arg("--skip-git-repo-check")
+        .arg("-c")
+        .arg(&provider_override)
+        .arg("-c")
+        .arg("model_provider=\"mock\"")
+        .arg("-C")
+        .arg(env!("CARGO_MANIFEST_DIR"))
+        .arg("hello?");
+    cmd.env("CODEX_HOME", home.path())
+        .env("OPENAI_API_KEY", "dummy")
+        .env("OPENAI_BASE_URL", format!("{}/v1", server.uri()));
+
+    let output = cmd.output().unwrap();
+    println!("Status: {}", output.status);
+    println!("Stdout:\n{}", String::from_utf8_lossy(&output.stdout));
+    println!("Stderr:\n{}", String::from_utf8_lossy(&output.stderr));
+    assert!(output.status.success());
+    let stdout = String::from_utf8_lossy(&output.stdout);
+    let hi_lines = stdout.lines().filter(|line| line.trim() == "hi").count();
+    assert_eq!(hi_lines, 1, "Expected exactly one line with 'hi'");
+
+    server.verify().await;
+}
+
+/// Tests streaming responses through the CLI using a local SSE fixture file.
+/// This test:
+/// 1. Uses a pre-recorded SSE response fixture instead of a live server
+/// 2. Configures codex to read from this fixture via CODEX_RS_SSE_FIXTURE env var
+/// 3. Sends a "hello?" prompt and verifies the response
+/// 4. Ensures the fixture content is correctly streamed through the CLI
+#[tokio::test(flavor = "multi_thread", worker_threads = 2)]
+async fn responses_api_stream_cli() {
+    if std::env::var(CODEX_SANDBOX_NETWORK_DISABLED_ENV_VAR).is_ok() {
+        println!(
+            "Skipping test because it cannot execute when network is disabled in a Codex sandbox."
+        );
+        return;
+    }
+
+    let fixture =
+        std::path::Path::new(env!("CARGO_MANIFEST_DIR")).join("tests/cli_responses_fixture.sse");
+
+    let home = TempDir::new().unwrap();
+    let mut cmd = AssertCommand::new("cargo");
+    cmd.arg("run")
+        .arg("-p")
+        .arg("codex-cli")
+        .arg("--quiet")
+        .arg("--")
+        .arg("exec")
+        .arg("--skip-git-repo-check")
+        .arg("-C")
+        .arg(env!("CARGO_MANIFEST_DIR"))
+        .arg("hello?");
+    cmd.env("CODEX_HOME", home.path())
+        .env("OPENAI_API_KEY", "dummy")
+        .env("CODEX_RS_SSE_FIXTURE", fixture)
+        .env("OPENAI_BASE_URL", "http://unused.local");
+
+    let output = cmd.output().unwrap();
+    assert!(output.status.success());
+    let stdout = String::from_utf8_lossy(&output.stdout);
+    assert!(stdout.contains("fixture hello"));
+}

codex-rs/core/tests/fixtures/completed_template.json

@@ -0,0 +1,16 @@
+[
+  {
+    "type": "response.completed",
+    "response": {
+      "id": "__ID__",
+      "usage": {
+        "input_tokens": 0,
+        "input_tokens_details": null,
+        "output_tokens": 0,
+        "output_tokens_details": null,
+        "total_tokens": 0
+      },
+      "output": []
+    }
+  }
+]

codex-rs/core/tests/fixtures/incomplete_sse.json

@@ -0,0 +1,3 @@
+[
+  {"type": "response.output_item.done"}
+]

codex-rs/core/tests/previous_response_id.rs

@@ -11,6 +11,7 @@ mod test_support;
 use serde_json::Value;
 use tempfile::TempDir;
 use test_support::load_default_config_for_test;
+use test_support::load_sse_fixture_with_id;
 use tokio::time::timeout;
 use wiremock::Match;
 use wiremock::Mock;
@@ -42,13 +43,9 @@ impl Match for HasPrevId {
     }
 }
 
-/// Build minimal SSE stream with completed marker.
+/// Build minimal SSE stream with completed marker using the JSON fixture.
 fn sse_completed(id: &str) -> String {
-    format!(
-        "event: response.completed\n\
-data: {{\"type\":\"response.completed\",\"response\":{{\"id\":\"{}\",\"output\":[]}}}}\n\n\n",
-        id
-    )
+    load_sse_fixture_with_id("tests/fixtures/completed_template.json", id)
 }
 
 #[tokio::test(flavor = "multi_thread", worker_threads = 2)]

codex-rs/core/tests/stream_no_completed.rs

@@ -12,6 +12,8 @@ use codex_core::protocol::Op;
 mod test_support;
 use tempfile::TempDir;
 use test_support::load_default_config_for_test;
+use test_support::load_sse_fixture;
+use test_support::load_sse_fixture_with_id;
 use tokio::time::timeout;
 use wiremock::Mock;
 use wiremock::MockServer;
@@ -22,19 +24,16 @@ use wiremock::matchers::method;
 use wiremock::matchers::path;
 
 fn sse_incomplete() -> String {
-    // Only a single line; missing the completed event.
-    "event: response.output_item.done\n\n".to_string()
+    load_sse_fixture("tests/fixtures/incomplete_sse.json")
 }
 
 fn sse_completed(id: &str) -> String {
-    format!(
-        "event: response.completed\n\
-data: {{\"type\":\"response.completed\",\"response\":{{\"id\":\"{}\",\"output\":[]}}}}\n\n\n",
-        id
-    )
+    load_sse_fixture_with_id("tests/fixtures/completed_template.json", id)
 }
 
 #[tokio::test(flavor = "multi_thread", worker_threads = 2)]
+// this test is flaky (has race conditions), so we ignore it for now
+#[ignore]
 async fn retries_on_early_close() {
     #![allow(clippy::unwrap_used)]
 

codex-rs/core/tests/test_support.rs

@@ -21,3 +21,58 @@ pub fn load_default_config_for_test(codex_home: &TempDir) -> Config {
     )
     .expect("defaults for test should always succeed")
 }
+
+/// Builds an SSE stream body from a JSON fixture.
+///
+/// The fixture must contain an array of objects where each object represents a
+/// single SSE event with at least a `type` field matching the `event:` value.
+/// Additional fields become the JSON payload for the `data:` line. An object
+/// with only a `type` field results in an event with no `data:` section. This
+/// makes it trivial to extend the fixtures as OpenAI adds new event kinds or
+/// fields.
+#[allow(dead_code)]
+pub fn load_sse_fixture(path: impl AsRef<std::path::Path>) -> String {
+    let events: Vec<serde_json::Value> =
+        serde_json::from_reader(std::fs::File::open(path).expect("read fixture"))
+            .expect("parse JSON fixture");
+    events
+        .into_iter()
+        .map(|e| {
+            let kind = e
+                .get("type")
+                .and_then(|v| v.as_str())
+                .expect("fixture event missing type");
+            if e.as_object().map(|o| o.len() == 1).unwrap_or(false) {
+                format!("event: {kind}\n\n")
+            } else {
+                format!("event: {kind}\ndata: {e}\n\n")
+            }
+        })
+        .collect()
+}
+
+/// Same as [`load_sse_fixture`], but replaces the placeholder `__ID__` in the
+/// fixture template with the supplied identifier before parsing. This lets a
+/// single JSON template be reused by multiple tests that each need a unique
+/// `response_id`.
+#[allow(dead_code)]
+pub fn load_sse_fixture_with_id(path: impl AsRef<std::path::Path>, id: &str) -> String {
+    let raw = std::fs::read_to_string(path).expect("read fixture template");
+    let replaced = raw.replace("__ID__", id);
+    let events: Vec<serde_json::Value> =
+        serde_json::from_str(&replaced).expect("parse JSON fixture");
+    events
+        .into_iter()
+        .map(|e| {
+            let kind = e
+                .get("type")
+                .and_then(|v| v.as_str())
+                .expect("fixture event missing type");
+            if e.as_object().map(|o| o.len() == 1).unwrap_or(false) {
+                format!("event: {kind}\n\n")
+            } else {
+                format!("event: {kind}\ndata: {e}\n\n")
+            }
+        })
+        .collect()
+}

codex-rs/exec/Cargo.toml

@@ -25,7 +25,6 @@ codex-common = { path = "../common", features = [
     "sandbox_summary",
 ] }
 codex-linux-sandbox = { path = "../linux-sandbox" }
-mcp-types = { path = "../mcp-types" }
 owo-colors = "4.2.0"
 serde_json = "1"
 shlex = "1.3.0"

codex-rs/exec/src/event_processor.rs

@@ -3,7 +3,9 @@ use codex_common::summarize_sandbox_policy;
 use codex_core::WireApi;
 use codex_core::config::Config;
 use codex_core::model_supports_reasoning_summaries;
+use codex_core::protocol::AgentMessageDeltaEvent;
 use codex_core::protocol::AgentMessageEvent;
+use codex_core::protocol::AgentReasoningDeltaEvent;
 use codex_core::protocol::BackgroundEventEvent;
 use codex_core::protocol::ErrorEvent;
 use codex_core::protocol::Event;
@@ -21,6 +23,7 @@ use owo_colors::OwoColorize;
 use owo_colors::Style;
 use shlex::try_join;
 use std::collections::HashMap;
+use std::io::Write;
 use std::time::Instant;
 
 /// This should be configurable. When used in CI, users may not want to impose
@@ -50,10 +53,12 @@ pub(crate) struct EventProcessor {
 
     /// Whether to include `AgentReasoning` events in the output.
     show_agent_reasoning: bool,
+    answer_started: bool,
+    reasoning_started: bool,
 }
 
 impl EventProcessor {
-    pub(crate) fn create_with_ansi(with_ansi: bool, show_agent_reasoning: bool) -> Self {
+    pub(crate) fn create_with_ansi(with_ansi: bool, config: &Config) -> Self {
         let call_id_to_command = HashMap::new();
         let call_id_to_patch = HashMap::new();
         let call_id_to_tool_call = HashMap::new();
@@ -70,7 +75,9 @@ impl EventProcessor {
                 green: Style::new().green(),
                 cyan: Style::new().cyan(),
                 call_id_to_tool_call,
-                show_agent_reasoning,
+                show_agent_reasoning: !config.hide_agent_reasoning,
+                answer_started: false,
+                reasoning_started: false,
             }
         } else {
             Self {
@@ -84,7 +91,9 @@ impl EventProcessor {
                 green: Style::new(),
                 cyan: Style::new(),
                 call_id_to_tool_call,
-                show_agent_reasoning,
+                show_agent_reasoning: !config.hide_agent_reasoning,
+                answer_started: false,
+                reasoning_started: false,
             }
         }
     }
@@ -139,7 +148,7 @@ impl EventProcessor {
             ("sandbox", summarize_sandbox_policy(&config.sandbox_policy)),
         ];
         if config.model_provider.wire_api == WireApi::Responses
-            && model_supports_reasoning_summaries(&config.model)
+            && model_supports_reasoning_summaries(config)
         {
             entries.push((
                 "reasoning effort",
@@ -184,12 +193,45 @@ impl EventProcessor {
             EventMsg::TokenCount(TokenUsage { total_tokens, .. }) => {
                 ts_println!(self, "tokens used: {total_tokens}");
             }
+            EventMsg::AgentMessageDelta(AgentMessageDeltaEvent { delta }) => {
+                if !self.answer_started {
+                    ts_println!(self, "{}\n", "codex".style(self.italic).style(self.magenta));
+                    self.answer_started = true;
+                }
+                print!("{delta}");
+                #[allow(clippy::expect_used)]
+                std::io::stdout().flush().expect("could not flush stdout");
+            }
+            EventMsg::AgentReasoningDelta(AgentReasoningDeltaEvent { delta }) => {
+                if !self.show_agent_reasoning {
+                    return;
+                }
+                if !self.reasoning_started {
+                    ts_println!(
+                        self,
+                        "{}\n",
+                        "thinking".style(self.italic).style(self.magenta),
+                    );
+                    self.reasoning_started = true;
+                }
+                print!("{delta}");
+                #[allow(clippy::expect_used)]
+                std::io::stdout().flush().expect("could not flush stdout");
+            }
             EventMsg::AgentMessage(AgentMessageEvent { message }) => {
-                ts_println!(
-                    self,
-                    "{}\n{message}",
-                    "codex".style(self.bold).style(self.magenta)
-                );
+                // if answer_started is false, this means we haven't received any
+                // delta. Thus, we need to print the message as a new answer.
+                if !self.answer_started {
+                    ts_println!(
+                        self,
+                        "{}\n{}",
+                        "codex".style(self.italic).style(self.magenta),
+                        message,
+                    );
+                } else {
+                    println!();
+                    self.answer_started = false;
+                }
             }
             EventMsg::ExecCommandBegin(ExecCommandBeginEvent {
                 call_id,
@@ -343,7 +385,7 @@ impl EventProcessor {
                 );
 
                 // Pretty-print the patch summary with colored diff markers so
-                // it’s easy to scan in the terminal output.
+                // it's easy to scan in the terminal output.
                 for (path, change) in changes.iter() {
                     match change {
                         FileChange::Add { content } => {
@@ -415,7 +457,7 @@ impl EventProcessor {
                 {
                     (
                         format!(" in {}", format_elapsed(start_time)),
-                        format!("apply_patch(auto_approved={})", auto_approved),
+                        format!("apply_patch(auto_approved={auto_approved})"),
                     )
                 } else {
                     (String::new(), format!("apply_patch('{call_id}')"))
@@ -441,12 +483,17 @@ impl EventProcessor {
             }
             EventMsg::AgentReasoning(agent_reasoning_event) => {
                 if self.show_agent_reasoning {
-                    ts_println!(
-                        self,
-                        "{}\n{}",
-                        "thinking".style(self.italic).style(self.magenta),
-                        agent_reasoning_event.text
-                    );
+                    if !self.reasoning_started {
+                        ts_println!(
+                            self,
+                            "{}\n{}",
+                            "codex".style(self.italic).style(self.magenta),
+                            agent_reasoning_event.text,
+                        );
+                    } else {
+                        println!();
+                        self.reasoning_started = false;
+                    }
                 }
             }
             EventMsg::SessionConfigured(session_configured_event) => {

codex-rs/exec/src/lib.rs

@@ -115,8 +115,7 @@ pub async fn run_main(cli: Cli, codex_linux_sandbox_exe: Option<PathBuf>) -> any
     };
 
     let config = Config::load_with_cli_overrides(cli_kv_overrides, overrides)?;
-    let mut event_processor =
-        EventProcessor::create_with_ansi(stdout_with_ansi, !config.hide_agent_reasoning);
+    let mut event_processor = EventProcessor::create_with_ansi(stdout_with_ansi, &config);
     // Print the effective configuration and prompt so users can see what Codex
     // is using.
     event_processor.print_config_summary(&config, &prompt);

codex-rs/execpolicy/Cargo.toml

@@ -19,7 +19,7 @@ anyhow = "1"
 starlark = "0.13.0"
 allocative = "0.3.3"
 clap = { version = "4", features = ["derive"] }
-derive_more = { version = "1", features = ["display"] }
+derive_more = { version = "2", features = ["display"] }
 env_logger = "0.11.5"
 log = "0.4"
 multimap = "0.10.0"
@@ -28,4 +28,6 @@ regex-lite = "0.1"
 serde = { version = "1.0.194", features = ["derive"] }
 serde_json = "1.0.110"
 serde_with = { version = "3", features = ["macros"] }
+
+[dev-dependencies]
 tempfile = "3.13.0"

codex-rs/execpolicy/src/exec_call.rs

@@ -21,7 +21,7 @@ impl Display for ExecCall {
     fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
         write!(f, "{}", self.program)?;
         for arg in &self.args {
-            write!(f, " {}", arg)?;
+            write!(f, " {arg}")?;
         }
         Ok(())
     }

codex-rs/execpolicy/src/main.rs

@@ -89,7 +89,7 @@ fn main() -> Result<()> {
 
     let (output, exit_code) = check_command(&policy, exec, args.require_safe);
     let json = serde_json::to_string(&output)?;
-    println!("{}", json);
+    println!("{json}");
     std::process::exit(exit_code);
 }
 

codex-rs/execpolicy/src/policy.rs

@@ -63,7 +63,7 @@ impl Policy {
                             arg: arg.clone(),
                             exec_call: exec_call.clone(),
                         },
-                        reason: format!("arg `{}` contains forbidden substring", arg),
+                        reason: format!("arg `{arg}` contains forbidden substring"),
                     });
                 }
             }

codex-rs/execpolicy/src/policy_parser.rs

@@ -101,7 +101,7 @@ impl PolicyBuilder {
     }
 
     fn add_program_spec(&self, program_spec: ProgramSpec) {
-        info!("adding program spec: {:?}", program_spec);
+        info!("adding program spec: {program_spec:?}");
         let name = program_spec.program.clone();
         let mut programs = self.programs.borrow_mut();
         programs.insert(name.clone(), program_spec);

codex-rs/file-search/src/lib.rs

@@ -156,7 +156,7 @@ pub fn run(
         let mut override_builder = OverrideBuilder::new(search_directory);
         for exclude in exclude {
             // The `!` prefix is used to indicate an exclude pattern.
-            let exclude_pattern = format!("!{}", exclude);
+            let exclude_pattern = format!("!{exclude}");
             override_builder.add(&exclude_pattern)?;
         }
         let override_matcher = override_builder.build()?;

codex-rs/file-search/src/main.rs

@@ -43,12 +43,12 @@ impl Reporter for StdioReporter {
                 match indices_iter.peek() {
                     Some(next) if **next == i as u32 => {
                         // ANSI escape code for bold: \x1b[1m ... \x1b[0m
-                        print!("\x1b[1m{}\x1b[0m", c);
+                        print!("\x1b[1m{c}\x1b[0m");
                         // advance the iterator since we've consumed this index
                         indices_iter.next();
                     }
                     _ => {
-                        print!("{}", c);
+                        print!("{c}");
                     }
                 }
             }

codex-rs/linux-sandbox/tests/landlock.rs

@@ -81,7 +81,7 @@ async fn test_root_write() {
     let tmpfile = NamedTempFile::new().unwrap();
     let tmpfile_path = tmpfile.path().to_string_lossy();
     run_cmd(
-        &["bash", "-lc", &format!("echo blah > {}", tmpfile_path)],
+        &["bash", "-lc", &format!("echo blah > {tmpfile_path}")],
         &[],
         SHORT_TIMEOUT_MS,
     )
@@ -158,7 +158,7 @@ async fn assert_network_blocked(cmd: &[&str]) {
             (exit_code, stdout, stderr)
         }
         _ => {
-            panic!("expected sandbox denied error, got: {:?}", result);
+            panic!("expected sandbox denied error, got: {result:?}");
         }
     };
 
@@ -171,10 +171,7 @@ async fn assert_network_blocked(cmd: &[&str]) {
     // If—*and only if*—the command exits 0 we consider the sandbox breached.
 
     if exit_code == 0 {
-        panic!(
-            "Network sandbox FAILED - {:?} exited 0\nstdout:\n{}\nstderr:\n{}",
-            cmd, stdout, stderr
-        );
+        panic!("Network sandbox FAILED - {cmd:?} exited 0\nstdout:\n{stdout}\nstderr:\n{stderr}",);
     }
 }
 

codex-rs/login/src/lib.rs

@@ -59,6 +59,13 @@ pub async fn login_with_chatgpt(
 /// Attempt to read the `OPENAI_API_KEY` from the `auth.json` file in the given
 /// `CODEX_HOME` directory, refreshing it, if necessary.
 pub async fn try_read_openai_api_key(codex_home: &Path) -> std::io::Result<String> {
+    let auth_dot_json = try_read_auth_json(codex_home).await?;
+    Ok(auth_dot_json.openai_api_key)
+}
+
+/// Attempt to read and refresh the `auth.json` file in the given `CODEX_HOME` directory.
+/// Returns the full AuthDotJson structure after refreshing if necessary.
+pub async fn try_read_auth_json(codex_home: &Path) -> std::io::Result<AuthDotJson> {
     let auth_path = codex_home.join("auth.json");
     let mut file = std::fs::File::open(&auth_path)?;
     let mut contents = String::new();
@@ -88,9 +95,9 @@ pub async fn try_read_openai_api_key(codex_home: &Path) -> std::io::Result<Strin
             file.flush()?;
         }
 
-        Ok(auth_dot_json.openai_api_key)
+        Ok(auth_dot_json)
     } else {
-        Ok(auth_dot_json.openai_api_key)
+        Ok(auth_dot_json)
     }
 }
 
@@ -146,23 +153,24 @@ struct RefreshResponse {
 
 /// Expected structure for $CODEX_HOME/auth.json.
 #[derive(Deserialize, Serialize)]
-struct AuthDotJson {
+pub struct AuthDotJson {
     #[serde(rename = "OPENAI_API_KEY")]
-    openai_api_key: String,
+    pub openai_api_key: String,
 
-    tokens: TokenData,
+    pub tokens: TokenData,
 
-    last_refresh: DateTime<Utc>,
+    pub last_refresh: DateTime<Utc>,
 }
 
-#[derive(Deserialize, Serialize)]
-struct TokenData {
+#[derive(Deserialize, Serialize, Clone)]
+pub struct TokenData {
     /// This is a JWT.
-    id_token: String,
+    pub id_token: String,
 
     /// This is a JWT.
-    #[allow(dead_code)]
-    access_token: String,
+    pub access_token: String,
 
-    refresh_token: String,
+    pub refresh_token: String,
+
+    pub account_id: String,
 }

codex-rs/login/src/login_with_chatgpt.py

@@ -51,6 +51,7 @@ class TokenData:
     id_token: str
     access_token: str
     refresh_token: str
+    account_id: str
 
 
 @dataclass
@@ -240,20 +241,26 @@ class _ApiKeyHTTPHandler(http.server.BaseHTTPRequestHandler):
             )
         ) as resp:
             payload = json.loads(resp.read().decode())
+            
+            # Extract chatgpt_account_id from id_token
+            id_token_parts = payload["id_token"].split(".")
+            if len(id_token_parts) != 3:
+                raise ValueError("Invalid ID token")
+            id_token_claims = _decode_jwt_segment(id_token_parts[1])
+            auth_claims = id_token_claims.get("https://api.openai.com/auth", {})
+            chatgpt_account_id = auth_claims.get("chatgpt_account_id", "")
+            
             token_data = TokenData(
                 id_token=payload["id_token"],
                 access_token=payload["access_token"],
                 refresh_token=payload["refresh_token"],
+                account_id=chatgpt_account_id,
             )
 
-        id_token_parts = token_data.id_token.split(".")
-        if len(id_token_parts) != 3:
-            raise ValueError("Invalid ID token")
         access_token_parts = token_data.access_token.split(".")
         if len(access_token_parts) != 3:
             raise ValueError("Invalid access token")
 
-        id_token_claims = _decode_jwt_segment(id_token_parts[1])
         access_token_claims = _decode_jwt_segment(access_token_parts[1])
 
         token_claims = id_token_claims.get("https://api.openai.com/auth", {})
@@ -375,6 +382,7 @@ def _write_auth_file(*, auth: AuthBundle, codex_home: str) -> bool:
             "id_token": auth.token_data.id_token,
             "access_token": auth.token_data.access_token,
             "refresh_token": auth.token_data.refresh_token,
+            "account_id": auth.token_data.account_id,
         },
         "last_refresh": auth.last_refresh,
     }

codex-rs/mcp-client/Cargo.toml

@@ -21,6 +21,3 @@ tokio = { version = "1", features = [
     "sync",
     "time",
 ] }
-
-[dev-dependencies]
-pretty_assertions = "1.4.1"

codex-rs/mcp-server/Cargo.toml

@@ -22,7 +22,7 @@ mcp-types = { path = "../mcp-types" }
 schemars = "0.8.22"
 serde = { version = "1", features = ["derive"] }
 serde_json = "1"
-toml = "0.8"
+toml = "0.9"
 tracing = { version = "0.1.41", features = ["log"] }
 tracing-subscriber = { version = "0.3", features = ["fmt", "env-filter"] }
 tokio = { version = "1", features = [

codex-rs/mcp-server/src/codex_tool_runner.rs

@@ -9,6 +9,7 @@ use codex_core::protocol::Event;
 use codex_core::protocol::EventMsg;
 use codex_core::protocol::InputItem;
 use codex_core::protocol::Op;
+use codex_core::protocol::Submission;
 use codex_core::protocol::TaskCompleteEvent;
 use mcp_types::CallToolResult;
 use mcp_types::CallToolResultContent;
@@ -66,14 +67,24 @@ pub async fn run_codex_tool_session(
         .send(codex_event_to_notification(&first_event))
         .await;
 
-    if let Err(e) = codex
-        .submit(Op::UserInput {
+    // Use the original MCP request ID as the `sub_id` for the Codex submission so that
+    // any events emitted for this tool-call can be correlated with the
+    // originating `tools/call` request.
+    let sub_id = match &id {
+        RequestId::String(s) => s.clone(),
+        RequestId::Integer(n) => n.to_string(),
+    };
+
+    let submission = Submission {
+        id: sub_id,
+        op: Op::UserInput {
             items: vec![InputItem::Text {
                 text: initial_prompt.clone(),
             }],
-        })
-        .await
-    {
+        },
+    };
+
+    if let Err(e) = codex.submit_with_id(submission).await {
         tracing::error!("Failed to submit initial prompt: {e}");
     }
 
@@ -160,6 +171,12 @@ pub async fn run_codex_tool_session(
                     EventMsg::SessionConfigured(_) => {
                         tracing::error!("unexpected SessionConfigured event");
                     }
+                    EventMsg::AgentMessageDelta(_) => {
+                        // TODO: think how we want to support this in the MCP
+                    }
+                    EventMsg::AgentReasoningDelta(_) => {
+                        // TODO: think how we want to support this in the MCP
+                    }
                     EventMsg::Error(_)
                     | EventMsg::TaskStarted
                     | EventMsg::TokenCount(_)

codex-rs/tui/Cargo.toml

@@ -54,11 +54,12 @@ tokio = { version = "1", features = [
 tracing = { version = "0.1.41", features = ["log"] }
 tracing-appender = "0.2.3"
 tracing-subscriber = { version = "0.3.19", features = ["env-filter"] }
-tui-input = "0.11.1"
+tui-input = "0.14.0"
 tui-markdown = "0.3.3"
 tui-textarea = "0.7.0"
 unicode-segmentation = "1.12.0"
 uuid = "1"
 
 [dev-dependencies]
+insta = "1.43.1"
 pretty_assertions = "1"

codex-rs/tui/src/app.rs

@@ -98,21 +98,7 @@ impl<'a> App<'a> {
                             scroll_event_helper.scroll_down();
                         }
                         crossterm::event::Event::Paste(pasted) => {
-                            use crossterm::event::KeyModifiers;
-
-                            for ch in pasted.chars() {
-                                let key_event = match ch {
-                                    '\n' | '\r' => {
-                                        // Represent newline as <Shift+Enter> so that the bottom
-                                        // pane treats it as a literal newline instead of a submit
-                                        // action (submission is only triggered on Enter *without*
-                                        // any modifiers).
-                                        KeyEvent::new(KeyCode::Enter, KeyModifiers::SHIFT)
-                                    }
-                                    _ => KeyEvent::new(KeyCode::Char(ch), KeyModifiers::empty()),
-                                };
-                                app_event_tx.send(AppEvent::KeyEvent(key_event));
-                            }
+                            app_event_tx.send(AppEvent::Paste(pasted));
                         }
                         _ => {
                             // Ignore any other events.
@@ -213,7 +199,21 @@ impl<'a> App<'a> {
                             modifiers: crossterm::event::KeyModifiers::CONTROL,
                             ..
                         } => {
-                            self.app_event_tx.send(AppEvent::ExitRequest);
+                            match &mut self.app_state {
+                                AppState::Chat { widget } => {
+                                    if widget.composer_is_empty() {
+                                        self.app_event_tx.send(AppEvent::ExitRequest);
+                                    } else {
+                                        // Treat Ctrl+D as a normal key event when the composer
+                                        // is not empty so that it doesn't quit the application
+                                        // prematurely.
+                                        self.dispatch_key_event(key_event);
+                                    }
+                                }
+                                AppState::Login { .. } | AppState::GitWarning { .. } => {
+                                    self.app_event_tx.send(AppEvent::ExitRequest);
+                                }
+                            }
                         }
                         _ => {
                             self.dispatch_key_event(key_event);
@@ -223,6 +223,9 @@ impl<'a> App<'a> {
                 AppEvent::Scroll(scroll_delta) => {
                     self.dispatch_scroll_event(scroll_delta);
                 }
+                AppEvent::Paste(text) => {
+                    self.dispatch_paste_event(text);
+                }
                 AppEvent::CodexEvent(event) => {
                     self.dispatch_codex_event(event);
                 }
@@ -294,6 +297,8 @@ impl<'a> App<'a> {
     }
 
     fn draw_next_frame(&mut self, terminal: &mut tui::Tui) -> Result<()> {
+        // TODO: add a throttle to avoid redrawing too often
+
         match &mut self.app_state {
             AppState::Chat { widget } => {
                 terminal.draw(|frame| frame.render_widget_ref(&**widget, frame.area()))?;
@@ -343,6 +348,13 @@ impl<'a> App<'a> {
         }
     }
 
+    fn dispatch_paste_event(&mut self, pasted: String) {
+        match &mut self.app_state {
+            AppState::Chat { widget } => widget.handle_paste(pasted),
+            AppState::Login { .. } | AppState::GitWarning { .. } => {}
+        }
+    }
+
     fn dispatch_scroll_event(&mut self, scroll_delta: i32) {
         match &mut self.app_state {
             AppState::Chat { widget } => widget.handle_scroll_delta(scroll_delta),

codex-rs/tui/src/app_event.rs

@@ -12,6 +12,9 @@ pub(crate) enum AppEvent {
 
     KeyEvent(KeyEvent),
 
+    /// Text pasted from the terminal clipboard.
+    Paste(String),
+
     /// Scroll event with a value representing the "scroll delta" as the net
     /// scroll up/down events within a short time window.
     Scroll(i32),

codex-rs/tui/src/bottom_pane/chat_composer.rs

@@ -28,6 +28,9 @@ const MIN_TEXTAREA_ROWS: usize = 1;
 const BORDER_LINES: u16 = 2;
 
 const BASE_PLACEHOLDER_TEXT: &str = "send a message";
+/// If the pasted content exceeds this number of characters, replace it with a
+/// placeholder in the UI.
+const LARGE_PASTE_CHAR_THRESHOLD: usize = 1000;
 
 /// Result returned when the user interacts with the text area.
 pub enum InputResult {
@@ -43,6 +46,7 @@ pub(crate) struct ChatComposer<'a> {
     ctrl_c_quit_hint: bool,
     dismissed_file_popup_token: Option<String>,
     current_file_query: Option<String>,
+    pending_pastes: Vec<(String, String)>,
 }
 
 /// Popup state – at most one can be visible at any time.
@@ -66,11 +70,17 @@ impl ChatComposer<'_> {
             ctrl_c_quit_hint: false,
             dismissed_file_popup_token: None,
             current_file_query: None,
+            pending_pastes: Vec::new(),
         };
         this.update_border(has_input_focus);
         this
     }
 
+    /// Returns true if the composer currently contains no user input.
+    pub(crate) fn is_empty(&self) -> bool {
+        self.textarea.is_empty()
+    }
+
     /// Update the cached *context-left* percentage and refresh the placeholder
     /// text. The UI relies on the placeholder to convey the remaining
     /// context when the composer is empty.
@@ -90,13 +100,10 @@ impl ChatComposer<'_> {
                     // percentage.
                     100
                 };
-                if percent_remaining > 25 {
-                    format!("{BASE_PLACEHOLDER_TEXT} — {percent_remaining}% context left")
-                } else {
-                    format!(
-                        "{BASE_PLACEHOLDER_TEXT} — {percent_remaining}% context left (consider /compact)"
-                    )
-                }
+                // When https://github.com/openai/codex/issues/1257 is resolved,
+                // check if `percent_remaining < 25`, and if so, recommend
+                // /compact.
+                format!("{BASE_PLACEHOLDER_TEXT} — {percent_remaining}% context left")
             }
             (total_tokens, None) => {
                 format!("{BASE_PLACEHOLDER_TEXT} — {total_tokens} tokens used")
@@ -129,6 +136,20 @@ impl ChatComposer<'_> {
         self.update_border(has_focus);
     }
 
+    pub fn handle_paste(&mut self, pasted: String) -> bool {
+        let char_count = pasted.chars().count();
+        if char_count > LARGE_PASTE_CHAR_THRESHOLD {
+            let placeholder = format!("[Pasted Content {char_count} chars]");
+            self.textarea.insert_str(&placeholder);
+            self.pending_pastes.push((placeholder, pasted));
+        } else {
+            self.textarea.insert_str(&pasted);
+        }
+        self.sync_command_popup();
+        self.sync_file_search_popup();
+        true
+    }
+
     /// Integrate results from an asynchronous file search.
     pub(crate) fn on_file_search_result(&mut self, query: String, matches: Vec<FileMatch>) {
         // Only apply if user is still editing a token starting with `query`.
@@ -417,10 +438,18 @@ impl ChatComposer<'_> {
                 alt: false,
                 ctrl: false,
             } => {
-                let text = self.textarea.lines().join("\n");
+                let mut text = self.textarea.lines().join("\n");
                 self.textarea.select_all();
                 self.textarea.cut();
 
+                // Replace all pending pastes in the text
+                for (placeholder, actual) in &self.pending_pastes {
+                    if text.contains(placeholder) {
+                        text = text.replace(placeholder, actual);
+                    }
+                }
+                self.pending_pastes.clear();
+
                 if text.is_empty() {
                     (InputResult::None, true)
                 } else {
@@ -446,10 +475,71 @@ impl ChatComposer<'_> {
 
     /// Handle generic Input events that modify the textarea content.
     fn handle_input_basic(&mut self, input: Input) -> (InputResult, bool) {
+        // Special handling for backspace on placeholders
+        if let Input {
+            key: Key::Backspace,
+            ..
+        } = input
+        {
+            if self.try_remove_placeholder_at_cursor() {
+                return (InputResult::None, true);
+            }
+        }
+
+        // Normal input handling
         self.textarea.input(input);
+        let text_after = self.textarea.lines().join("\n");
+
+        // Check if any placeholders were removed and remove their corresponding pending pastes
+        self.pending_pastes
+            .retain(|(placeholder, _)| text_after.contains(placeholder));
+
         (InputResult::None, true)
     }
 
+    /// Attempts to remove a placeholder if the cursor is at the end of one.
+    /// Returns true if a placeholder was removed.
+    fn try_remove_placeholder_at_cursor(&mut self) -> bool {
+        let (row, col) = self.textarea.cursor();
+        let line = self
+            .textarea
+            .lines()
+            .get(row)
+            .map(|s| s.as_str())
+            .unwrap_or("");
+
+        // Find any placeholder that ends at the cursor position
+        let placeholder_to_remove = self.pending_pastes.iter().find_map(|(ph, _)| {
+            if col < ph.len() {
+                return None;
+            }
+            let potential_ph_start = col - ph.len();
+            if line[potential_ph_start..col] == *ph {
+                Some(ph.clone())
+            } else {
+                None
+            }
+        });
+
+        if let Some(placeholder) = placeholder_to_remove {
+            // Remove the entire placeholder from the text
+            let placeholder_len = placeholder.len();
+            for _ in 0..placeholder_len {
+                self.textarea.input(Input {
+                    key: Key::Backspace,
+                    ctrl: false,
+                    alt: false,
+                    shift: false,
+                });
+            }
+            // Remove from pending pastes
+            self.pending_pastes.retain(|(ph, _)| ph != &placeholder);
+            true
+        } else {
+            false
+        }
+    }
+
     /// Synchronize `self.command_popup` with the current text in the
     /// textarea. This must be called after every modification that can change
     /// the text so the popup is shown/updated/hidden as appropriate.
@@ -627,7 +717,10 @@ impl WidgetRef for &ChatComposer<'_> {
 
 #[cfg(test)]
 mod tests {
+    use crate::bottom_pane::AppEventSender;
     use crate::bottom_pane::ChatComposer;
+    use crate::bottom_pane::InputResult;
+    use crate::bottom_pane::chat_composer::LARGE_PASTE_CHAR_THRESHOLD;
     use tui_textarea::TextArea;
 
     #[test]
@@ -678,8 +771,7 @@ mod tests {
             let result = ChatComposer::current_at_token(&textarea);
             assert_eq!(
                 result, expected,
-                "Failed for case: {} - input: '{}', cursor: {}",
-                description, input, cursor_pos
+                "Failed for case: {description} - input: '{input}', cursor: {cursor_pos}"
             );
         }
     }
@@ -774,4 +866,324 @@ mod tests {
             );
         }
     }
+
+    #[test]
+    fn handle_paste_small_inserts_text() {
+        use crossterm::event::KeyCode;
+        use crossterm::event::KeyEvent;
+        use crossterm::event::KeyModifiers;
+
+        let (tx, _rx) = std::sync::mpsc::channel();
+        let sender = AppEventSender::new(tx);
+        let mut composer = ChatComposer::new(true, sender);
+
+        let needs_redraw = composer.handle_paste("hello".to_string());
+        assert!(needs_redraw);
+        assert_eq!(composer.textarea.lines(), ["hello"]);
+        assert!(composer.pending_pastes.is_empty());
+
+        let (result, _) =
+            composer.handle_key_event(KeyEvent::new(KeyCode::Enter, KeyModifiers::NONE));
+        match result {
+            InputResult::Submitted(text) => assert_eq!(text, "hello"),
+            _ => panic!("expected Submitted"),
+        }
+    }
+
+    #[test]
+    fn handle_paste_large_uses_placeholder_and_replaces_on_submit() {
+        use crossterm::event::KeyCode;
+        use crossterm::event::KeyEvent;
+        use crossterm::event::KeyModifiers;
+
+        let (tx, _rx) = std::sync::mpsc::channel();
+        let sender = AppEventSender::new(tx);
+        let mut composer = ChatComposer::new(true, sender);
+
+        let large = "x".repeat(LARGE_PASTE_CHAR_THRESHOLD + 10);
+        let needs_redraw = composer.handle_paste(large.clone());
+        assert!(needs_redraw);
+        let placeholder = format!("[Pasted Content {} chars]", large.chars().count());
+        assert_eq!(composer.textarea.lines(), [placeholder.as_str()]);
+        assert_eq!(composer.pending_pastes.len(), 1);
+        assert_eq!(composer.pending_pastes[0].0, placeholder);
+        assert_eq!(composer.pending_pastes[0].1, large);
+
+        let (result, _) =
+            composer.handle_key_event(KeyEvent::new(KeyCode::Enter, KeyModifiers::NONE));
+        match result {
+            InputResult::Submitted(text) => assert_eq!(text, large),
+            _ => panic!("expected Submitted"),
+        }
+        assert!(composer.pending_pastes.is_empty());
+    }
+
+    #[test]
+    fn edit_clears_pending_paste() {
+        use crossterm::event::KeyCode;
+        use crossterm::event::KeyEvent;
+        use crossterm::event::KeyModifiers;
+
+        let large = "y".repeat(LARGE_PASTE_CHAR_THRESHOLD + 1);
+        let (tx, _rx) = std::sync::mpsc::channel();
+        let sender = AppEventSender::new(tx);
+        let mut composer = ChatComposer::new(true, sender);
+
+        composer.handle_paste(large);
+        assert_eq!(composer.pending_pastes.len(), 1);
+
+        // Any edit that removes the placeholder should clear pending_paste
+        composer.handle_key_event(KeyEvent::new(KeyCode::Backspace, KeyModifiers::NONE));
+        assert!(composer.pending_pastes.is_empty());
+    }
+
+    #[test]
+    fn ui_snapshots() {
+        use crossterm::event::KeyCode;
+        use crossterm::event::KeyEvent;
+        use crossterm::event::KeyModifiers;
+        use insta::assert_snapshot;
+        use ratatui::Terminal;
+        use ratatui::backend::TestBackend;
+
+        let (tx, _rx) = std::sync::mpsc::channel();
+        let sender = AppEventSender::new(tx);
+        let mut terminal = match Terminal::new(TestBackend::new(100, 10)) {
+            Ok(t) => t,
+            Err(e) => panic!("Failed to create terminal: {e}"),
+        };
+
+        let test_cases = vec![
+            ("empty", None),
+            ("small", Some("short".to_string())),
+            ("large", Some("z".repeat(LARGE_PASTE_CHAR_THRESHOLD + 5))),
+            ("multiple_pastes", None),
+            ("backspace_after_pastes", None),
+        ];
+
+        for (name, input) in test_cases {
+            // Create a fresh composer for each test case
+            let mut composer = ChatComposer::new(true, sender.clone());
+
+            if let Some(text) = input {
+                composer.handle_paste(text);
+            } else if name == "multiple_pastes" {
+                // First large paste
+                composer.handle_paste("x".repeat(LARGE_PASTE_CHAR_THRESHOLD + 3));
+                // Second large paste
+                composer.handle_paste("y".repeat(LARGE_PASTE_CHAR_THRESHOLD + 7));
+                // Small paste
+                composer.handle_paste(" another short paste".to_string());
+            } else if name == "backspace_after_pastes" {
+                // Three large pastes
+                composer.handle_paste("a".repeat(LARGE_PASTE_CHAR_THRESHOLD + 2));
+                composer.handle_paste("b".repeat(LARGE_PASTE_CHAR_THRESHOLD + 4));
+                composer.handle_paste("c".repeat(LARGE_PASTE_CHAR_THRESHOLD + 6));
+                // Move cursor to end and press backspace
+                composer.textarea.move_cursor(tui_textarea::CursorMove::End);
+                composer.handle_key_event(KeyEvent::new(KeyCode::Backspace, KeyModifiers::NONE));
+            }
+
+            terminal
+                .draw(|f| f.render_widget_ref(&composer, f.area()))
+                .unwrap_or_else(|e| panic!("Failed to draw {name} composer: {e}"));
+
+            assert_snapshot!(name, terminal.backend());
+        }
+    }
+
+    #[test]
+    fn test_multiple_pastes_submission() {
+        use crossterm::event::KeyCode;
+        use crossterm::event::KeyEvent;
+        use crossterm::event::KeyModifiers;
+
+        let (tx, _rx) = std::sync::mpsc::channel();
+        let sender = AppEventSender::new(tx);
+        let mut composer = ChatComposer::new(true, sender);
+
+        // Define test cases: (paste content, is_large)
+        let test_cases = [
+            ("x".repeat(LARGE_PASTE_CHAR_THRESHOLD + 3), true),
+            (" and ".to_string(), false),
+            ("y".repeat(LARGE_PASTE_CHAR_THRESHOLD + 7), true),
+        ];
+
+        // Expected states after each paste
+        let mut expected_text = String::new();
+        let mut expected_pending_count = 0;
+
+        // Apply all pastes and build expected state
+        let states: Vec<_> = test_cases
+            .iter()
+            .map(|(content, is_large)| {
+                composer.handle_paste(content.clone());
+                if *is_large {
+                    let placeholder = format!("[Pasted Content {} chars]", content.chars().count());
+                    expected_text.push_str(&placeholder);
+                    expected_pending_count += 1;
+                } else {
+                    expected_text.push_str(content);
+                }
+                (expected_text.clone(), expected_pending_count)
+            })
+            .collect();
+
+        // Verify all intermediate states were correct
+        assert_eq!(
+            states,
+            vec![
+                (
+                    format!("[Pasted Content {} chars]", test_cases[0].0.chars().count()),
+                    1
+                ),
+                (
+                    format!(
+                        "[Pasted Content {} chars] and ",
+                        test_cases[0].0.chars().count()
+                    ),
+                    1
+                ),
+                (
+                    format!(
+                        "[Pasted Content {} chars] and [Pasted Content {} chars]",
+                        test_cases[0].0.chars().count(),
+                        test_cases[2].0.chars().count()
+                    ),
+                    2
+                ),
+            ]
+        );
+
+        // Submit and verify final expansion
+        let (result, _) =
+            composer.handle_key_event(KeyEvent::new(KeyCode::Enter, KeyModifiers::NONE));
+        if let InputResult::Submitted(text) = result {
+            assert_eq!(text, format!("{} and {}", test_cases[0].0, test_cases[2].0));
+        } else {
+            panic!("expected Submitted");
+        }
+    }
+
+    #[test]
+    fn test_placeholder_deletion() {
+        use crossterm::event::KeyCode;
+        use crossterm::event::KeyEvent;
+        use crossterm::event::KeyModifiers;
+
+        let (tx, _rx) = std::sync::mpsc::channel();
+        let sender = AppEventSender::new(tx);
+        let mut composer = ChatComposer::new(true, sender);
+
+        // Define test cases: (content, is_large)
+        let test_cases = [
+            ("a".repeat(LARGE_PASTE_CHAR_THRESHOLD + 5), true),
+            (" and ".to_string(), false),
+            ("b".repeat(LARGE_PASTE_CHAR_THRESHOLD + 6), true),
+        ];
+
+        // Apply all pastes
+        let mut current_pos = 0;
+        let states: Vec<_> = test_cases
+            .iter()
+            .map(|(content, is_large)| {
+                composer.handle_paste(content.clone());
+                if *is_large {
+                    let placeholder = format!("[Pasted Content {} chars]", content.chars().count());
+                    current_pos += placeholder.len();
+                } else {
+                    current_pos += content.len();
+                }
+                (
+                    composer.textarea.lines().join("\n"),
+                    composer.pending_pastes.len(),
+                    current_pos,
+                )
+            })
+            .collect();
+
+        // Delete placeholders one by one and collect states
+        let mut deletion_states = vec![];
+
+        // First deletion
+        composer
+            .textarea
+            .move_cursor(tui_textarea::CursorMove::Jump(0, states[0].2 as u16));
+        composer.handle_key_event(KeyEvent::new(KeyCode::Backspace, KeyModifiers::NONE));
+        deletion_states.push((
+            composer.textarea.lines().join("\n"),
+            composer.pending_pastes.len(),
+        ));
+
+        // Second deletion
+        composer
+            .textarea
+            .move_cursor(tui_textarea::CursorMove::Jump(
+                0,
+                composer.textarea.lines().join("\n").len() as u16,
+            ));
+        composer.handle_key_event(KeyEvent::new(KeyCode::Backspace, KeyModifiers::NONE));
+        deletion_states.push((
+            composer.textarea.lines().join("\n"),
+            composer.pending_pastes.len(),
+        ));
+
+        // Verify all states
+        assert_eq!(
+            deletion_states,
+            vec![
+                (" and [Pasted Content 1006 chars]".to_string(), 1),
+                (" and ".to_string(), 0),
+            ]
+        );
+    }
+
+    #[test]
+    fn test_partial_placeholder_deletion() {
+        use crossterm::event::KeyCode;
+        use crossterm::event::KeyEvent;
+        use crossterm::event::KeyModifiers;
+
+        let (tx, _rx) = std::sync::mpsc::channel();
+        let sender = AppEventSender::new(tx);
+        let mut composer = ChatComposer::new(true, sender);
+
+        // Define test cases: (cursor_position_from_end, expected_pending_count)
+        let test_cases = [
+            5, // Delete from middle - should clear tracking
+            0, // Delete from end - should clear tracking
+        ];
+
+        let paste = "x".repeat(LARGE_PASTE_CHAR_THRESHOLD + 4);
+        let placeholder = format!("[Pasted Content {} chars]", paste.chars().count());
+
+        let states: Vec<_> = test_cases
+            .into_iter()
+            .map(|pos_from_end| {
+                composer.handle_paste(paste.clone());
+                composer
+                    .textarea
+                    .move_cursor(tui_textarea::CursorMove::Jump(
+                        0,
+                        (placeholder.len() - pos_from_end) as u16,
+                    ));
+                composer.handle_key_event(KeyEvent::new(KeyCode::Backspace, KeyModifiers::NONE));
+                let result = (
+                    composer.textarea.lines().join("\n").contains(&placeholder),
+                    composer.pending_pastes.len(),
+                );
+                composer.textarea.select_all();
+                composer.textarea.cut();
+                result
+            })
+            .collect();
+
+        assert_eq!(
+            states,
+            vec![
+                (false, 0), // After deleting from middle
+                (false, 0), // After deleting from end
+            ]
+        );
+    }
 }

codex-rs/tui/src/bottom_pane/chat_composer_history.rs

@@ -72,8 +72,7 @@ impl ChatComposerHistory {
             return false;
         }
 
-        let lines = textarea.lines();
-        if lines.len() == 1 && lines[0].is_empty() {
+        if textarea.is_empty() {
             return true;
         }
 
@@ -85,6 +84,7 @@ impl ChatComposerHistory {
             return false;
         }
 
+        let lines = textarea.lines();
         matches!(&self.last_history_text, Some(prev) if prev == &lines.join("\n"))
     }
 

codex-rs/tui/src/bottom_pane/mod.rs

@@ -82,6 +82,15 @@ impl BottomPane<'_> {
         }
     }
 
+    pub fn handle_paste(&mut self, pasted: String) {
+        if self.active_view.is_none() {
+            let needs_redraw = self.composer.handle_paste(pasted);
+            if needs_redraw {
+                self.request_redraw();
+            }
+        }
+    }
+
     /// Update the status indicator text (only when the `StatusIndicatorView` is
     /// active).
     pub(crate) fn update_status_text(&mut self, text: String) {
@@ -153,6 +162,10 @@ impl BottomPane<'_> {
         }
     }
 
+    pub(crate) fn composer_is_empty(&self) -> bool {
+        self.composer.is_empty()
+    }
+
     pub(crate) fn is_task_running(&self) -> bool {
         self.is_task_running
     }

codex-rs/tui/src/bottom_pane/snapshots/codex_tui__bottom_pane__chat_composer__tests__backspace_after_pastes.snap

@@ -0,0 +1,14 @@
+---
+source: tui/src/bottom_pane/chat_composer.rs
+expression: terminal.backend()
+---
+"╭──────────────────────────────────────────────────────────────────────────────────────────────────╮"
+"│[Pasted Content 1002 chars][Pasted Content 1004 chars]                                            │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"╰───────────────────────────────────────────────Enter to send | Ctrl+D to quit | Ctrl+J for newline╯"

codex-rs/tui/src/bottom_pane/snapshots/codex_tui__bottom_pane__chat_composer__tests__empty.snap

@@ -0,0 +1,14 @@
+---
+source: tui/src/bottom_pane/chat_composer.rs
+expression: terminal.backend()
+---
+"╭──────────────────────────────────────────────────────────────────────────────────────────────────╮"
+"│ send a message                                                                                   │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"╰───────────────────────────────────────────────Enter to send | Ctrl+D to quit | Ctrl+J for newline╯"

codex-rs/tui/src/bottom_pane/snapshots/codex_tui__bottom_pane__chat_composer__tests__large.snap

@@ -0,0 +1,14 @@
+---
+source: tui/src/bottom_pane/chat_composer.rs
+expression: terminal.backend()
+---
+"╭──────────────────────────────────────────────────────────────────────────────────────────────────╮"
+"│[Pasted Content 1005 chars]                                                                       │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"╰───────────────────────────────────────────────Enter to send | Ctrl+D to quit | Ctrl+J for newline╯"

codex-rs/tui/src/bottom_pane/snapshots/codex_tui__bottom_pane__chat_composer__tests__multiple_pastes.snap

@@ -0,0 +1,14 @@
+---
+source: tui/src/bottom_pane/chat_composer.rs
+expression: terminal.backend()
+---
+"╭──────────────────────────────────────────────────────────────────────────────────────────────────╮"
+"│[Pasted Content 1003 chars][Pasted Content 1007 chars] another short paste                        │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"╰───────────────────────────────────────────────Enter to send | Ctrl+D to quit | Ctrl+J for newline╯"

codex-rs/tui/src/bottom_pane/snapshots/codex_tui__bottom_pane__chat_composer__tests__small.snap

@@ -0,0 +1,14 @@
+---
+source: tui/src/bottom_pane/chat_composer.rs
+expression: terminal.backend()
+---
+"╭──────────────────────────────────────────────────────────────────────────────────────────────────╮"
+"│short                                                                                             │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"│                                                                                                  │"
+"╰───────────────────────────────────────────────Enter to send | Ctrl+D to quit | Ctrl+J for newline╯"

codex-rs/tui/src/chatwidget.rs

@@ -3,7 +3,9 @@ use std::sync::Arc;
 
 use codex_core::codex_wrapper::init_codex;
 use codex_core::config::Config;
+use codex_core::protocol::AgentMessageDeltaEvent;
 use codex_core::protocol::AgentMessageEvent;
+use codex_core::protocol::AgentReasoningDeltaEvent;
 use codex_core::protocol::AgentReasoningEvent;
 use codex_core::protocol::ApplyPatchApprovalRequestEvent;
 use codex_core::protocol::ErrorEvent;
@@ -49,6 +51,8 @@ pub(crate) struct ChatWidget<'a> {
     config: Config,
     initial_user_message: Option<UserMessage>,
     token_usage: TokenUsage,
+    reasoning_buffer: String,
+    answer_buffer: String,
 }
 
 #[derive(Clone, Copy, Eq, PartialEq)]
@@ -135,6 +139,8 @@ impl ChatWidget<'_> {
                 initial_images,
             ),
             token_usage: TokenUsage::default(),
+            reasoning_buffer: String::new(),
+            answer_buffer: String::new(),
         }
     }
 
@@ -174,6 +180,12 @@ impl ChatWidget<'_> {
         }
     }
 
+    pub(crate) fn handle_paste(&mut self, text: String) {
+        if matches!(self.input_focus, InputFocus::BottomPane) {
+            self.bottom_pane.handle_paste(text);
+        }
+    }
+
     fn submit_user_message(&mut self, user_message: UserMessage) {
         let UserMessage { text, image_paths } = user_message;
         let mut items: Vec<InputItem> = Vec::new();
@@ -234,16 +246,51 @@ impl ChatWidget<'_> {
                 self.request_redraw();
             }
             EventMsg::AgentMessage(AgentMessageEvent { message }) => {
+                // if the answer buffer is empty, this means we haven't received any
+                // delta. Thus, we need to print the message as a new answer.
+                if self.answer_buffer.is_empty() {
+                    self.conversation_history
+                        .add_agent_message(&self.config, message);
+                } else {
+                    self.conversation_history
+                        .replace_prev_agent_message(&self.config, message);
+                }
+                self.answer_buffer.clear();
+                self.request_redraw();
+            }
+            EventMsg::AgentMessageDelta(AgentMessageDeltaEvent { delta }) => {
+                if self.answer_buffer.is_empty() {
+                    self.conversation_history
+                        .add_agent_message(&self.config, "".to_string());
+                }
+                self.answer_buffer.push_str(&delta.clone());
                 self.conversation_history
-                    .add_agent_message(&self.config, message);
+                    .replace_prev_agent_message(&self.config, self.answer_buffer.clone());
+                self.request_redraw();
+            }
+            EventMsg::AgentReasoningDelta(AgentReasoningDeltaEvent { delta }) => {
+                if self.reasoning_buffer.is_empty() {
+                    self.conversation_history
+                        .add_agent_reasoning(&self.config, "".to_string());
+                }
+                self.reasoning_buffer.push_str(&delta.clone());
+                self.conversation_history
+                    .replace_prev_agent_reasoning(&self.config, self.reasoning_buffer.clone());
                 self.request_redraw();
             }
             EventMsg::AgentReasoning(AgentReasoningEvent { text }) => {
-                if !self.config.hide_agent_reasoning {
+                // if the reasoning buffer is empty, this means we haven't received any
+                // delta. Thus, we need to print the message as a new reasoning.
+                if self.reasoning_buffer.is_empty() {
                     self.conversation_history
-                        .add_agent_reasoning(&self.config, text);
-                    self.request_redraw();
+                        .add_agent_reasoning(&self.config, "".to_string());
+                } else {
+                    // else, we rerender one last time.
+                    self.conversation_history
+                        .replace_prev_agent_reasoning(&self.config, text);
                 }
+                self.reasoning_buffer.clear();
+                self.request_redraw();
             }
             EventMsg::TaskStarted => {
                 self.bottom_pane.clear_ctrl_c_quit_hint();
@@ -426,6 +473,10 @@ impl ChatWidget<'_> {
         }
     }
 
+    pub(crate) fn composer_is_empty(&self) -> bool {
+        self.bottom_pane.composer_is_empty()
+    }
+
     /// Forward an `Op` directly to codex.
     pub(crate) fn submit_op(&self, op: Op) {
         if let Err(e) = self.codex_op_tx.send(op) {

codex-rs/tui/src/conversation_history_widget.rs

@@ -202,6 +202,14 @@ impl ConversationHistoryWidget {
         self.add_to_history(HistoryCell::new_agent_reasoning(config, text));
     }
 
+    pub fn replace_prev_agent_reasoning(&mut self, config: &Config, text: String) {
+        self.replace_last_agent_reasoning(config, text);
+    }
+
+    pub fn replace_prev_agent_message(&mut self, config: &Config, text: String) {
+        self.replace_last_agent_message(config, text);
+    }
+
     pub fn add_background_event(&mut self, message: String) {
         self.add_to_history(HistoryCell::new_background_event(message));
     }
@@ -249,6 +257,42 @@ impl ConversationHistoryWidget {
         });
     }
 
+    pub fn replace_last_agent_reasoning(&mut self, config: &Config, text: String) {
+        if let Some(idx) = self
+            .entries
+            .iter()
+            .rposition(|entry| matches!(entry.cell, HistoryCell::AgentReasoning { .. }))
+        {
+            let width = self.cached_width.get();
+            let entry = &mut self.entries[idx];
+            entry.cell = HistoryCell::new_agent_reasoning(config, text);
+            let height = if width > 0 {
+                entry.cell.height(width)
+            } else {
+                0
+            };
+            entry.line_count.set(height);
+        }
+    }
+
+    pub fn replace_last_agent_message(&mut self, config: &Config, text: String) {
+        if let Some(idx) = self
+            .entries
+            .iter()
+            .rposition(|entry| matches!(entry.cell, HistoryCell::AgentMessage { .. }))
+        {
+            let width = self.cached_width.get();
+            let entry = &mut self.entries[idx];
+            entry.cell = HistoryCell::new_agent_message(config, text);
+            let height = if width > 0 {
+                entry.cell.height(width)
+            } else {
+                0
+            };
+            entry.line_count.set(height);
+        }
+    }
+
     pub fn record_completed_exec_command(
         &mut self,
         call_id: String,
@@ -454,7 +498,7 @@ impl WidgetRef for ConversationHistoryWidget {
 
         {
             // Choose a thumb color that stands out only when this pane has focus so that the
-            // user’s attention is naturally drawn to the active viewport. When unfocused we show
+            // user's attention is naturally drawn to the active viewport. When unfocused we show
             // a low-contrast thumb so the scrollbar fades into the background without becoming
             // invisible.
             let thumb_style = if self.has_input_focus {

codex-rs/tui/src/get_git_diff.rs

@@ -56,7 +56,7 @@ pub(crate) fn get_git_diff() -> io::Result<(bool, String)> {
         }
     }
 
-    Ok((true, format!("{}{}", tracked_diff, untracked_diff)))
+    Ok((true, format!("{tracked_diff}{untracked_diff}")))
 }
 
 /// Helper that executes `git` with the given `args` and returns `stdout` as a

codex-rs/tui/src/history_cell.rs

@@ -140,7 +140,7 @@ impl HistoryCell {
                 Line::from(vec![
                     "OpenAI ".into(),
                     "Codex".bold(),
-                    format!(" v{}", VERSION).into(),
+                    format!(" v{VERSION}").into(),
                     " (research preview)".dim(),
                 ]),
                 Line::from(""),
@@ -159,7 +159,7 @@ impl HistoryCell {
                 ("sandbox", summarize_sandbox_policy(&config.sandbox_policy)),
             ];
             if config.model_provider.wire_api == WireApi::Responses
-                && model_supports_reasoning_summaries(&config.model)
+                && model_supports_reasoning_summaries(config)
             {
                 entries.push((
                     "reasoning effort",
@@ -185,7 +185,7 @@ impl HistoryCell {
             let lines = vec![
                 Line::from("model changed:".magenta().bold()),
                 Line::from(format!("requested: {}", config.model)),
-                Line::from(format!("used: {}", model)),
+                Line::from(format!("used: {model}")),
                 Line::from(""),
             ];
             HistoryCell::SessionInfo {
@@ -276,7 +276,7 @@ impl HistoryCell {
         }
         let remaining = lines_iter.count();
         if remaining > 0 {
-            lines.push(Line::from(format!("... {} additional lines", remaining)).dim());
+            lines.push(Line::from(format!("... {remaining} additional lines")).dim());
         }
         lines.push(Line::from(""));
 

codex-rs/tui/src/lib.rs

@@ -216,8 +216,7 @@ fn run_ratatui_app(
 fn restore() {
     if let Err(err) = tui::restore() {
         eprintln!(
-            "failed to restore terminal. Run `reset` or restart your terminal to recover: {}",
-            err
+            "failed to restore terminal. Run `reset` or restart your terminal to recover: {err}"
         );
     }
 }

codex-rs/tui/src/log_layer.rs

@@ -53,7 +53,7 @@ where
 
         impl Visit for Visitor<'_> {
             fn record_debug(&mut self, _field: &Field, value: &dyn std::fmt::Debug) {
-                let _ = write!(self.buf, " {:?}", value);
+                let _ = write!(self.buf, " {value:?}");
             }
         }
 

codex-rs/tui/src/text_formatting.rs

@@ -85,7 +85,7 @@ pub(crate) fn truncate_text(text: &str, max_graphemes: usize) -> String {
             let mut truncate_graphemes = text.grapheme_indices(true);
             if let Some((truncate_byte_index, _)) = truncate_graphemes.nth(max_graphemes - 3) {
                 let truncated = &text[..truncate_byte_index];
-                format!("{}...", truncated)
+                format!("{truncated}...")
             } else {
                 text.to_string()
             }