mirror of
https://github.com/anomalyco/opencode.git
synced 2026-02-21 08:14:31 +00:00
Compare commits
10 Commits
add-api-sh
...
config-spl
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
678b665a58 | ||
|
|
be7c7ae30a | ||
|
|
7787f82565 | ||
|
|
37c7aa8bce | ||
|
|
f96868e444 | ||
|
|
171bde2cad | ||
|
|
b536e00af3 | ||
|
|
da32a4c0a9 | ||
|
|
af95c1eed0 | ||
|
|
47ccd1d344 |
35
.github/workflows/publish.yml
vendored
35
.github/workflows/publish.yml
vendored
@@ -41,13 +41,6 @@ jobs:
|
||||
|
||||
- uses: ./.github/actions/setup-bun
|
||||
|
||||
- name: Setup git committer
|
||||
id: committer
|
||||
uses: ./.github/actions/setup-git-committer
|
||||
with:
|
||||
opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
|
||||
opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
|
||||
|
||||
- name: Install OpenCode
|
||||
if: inputs.bump || inputs.version
|
||||
run: bun i -g opencode-ai
|
||||
@@ -56,16 +49,14 @@ jobs:
|
||||
run: |
|
||||
./script/version.ts
|
||||
env:
|
||||
GH_TOKEN: ${{ steps.committer.outputs.token }}
|
||||
GH_TOKEN: ${{ github.token }}
|
||||
OPENCODE_BUMP: ${{ inputs.bump }}
|
||||
OPENCODE_VERSION: ${{ inputs.version }}
|
||||
OPENCODE_API_KEY: ${{ secrets.OPENCODE_API_KEY }}
|
||||
GH_REPO: ${{ (github.ref_name == 'beta' && 'anomalyco/opencode-beta') || github.repository }}
|
||||
outputs:
|
||||
version: ${{ steps.version.outputs.version }}
|
||||
release: ${{ steps.version.outputs.release }}
|
||||
tag: ${{ steps.version.outputs.tag }}
|
||||
repo: ${{ steps.version.outputs.repo }}
|
||||
|
||||
build-cli:
|
||||
needs: version
|
||||
@@ -78,13 +69,6 @@ jobs:
|
||||
|
||||
- uses: ./.github/actions/setup-bun
|
||||
|
||||
- name: Setup git committer
|
||||
id: committer
|
||||
uses: ./.github/actions/setup-git-committer
|
||||
with:
|
||||
opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
|
||||
opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
|
||||
|
||||
- name: Build
|
||||
id: build
|
||||
run: |
|
||||
@@ -92,8 +76,7 @@ jobs:
|
||||
env:
|
||||
OPENCODE_VERSION: ${{ needs.version.outputs.version }}
|
||||
OPENCODE_RELEASE: ${{ needs.version.outputs.release }}
|
||||
GH_REPO: ${{ needs.version.outputs.repo }}
|
||||
GH_TOKEN: ${{ steps.committer.outputs.token }}
|
||||
GH_TOKEN: ${{ github.token }}
|
||||
|
||||
- uses: actions/upload-artifact@v4
|
||||
with:
|
||||
@@ -206,13 +189,6 @@ jobs:
|
||||
if: contains(matrix.settings.host, 'ubuntu')
|
||||
run: cargo tauri --version
|
||||
|
||||
- name: Setup git committer
|
||||
id: committer
|
||||
uses: ./.github/actions/setup-git-committer
|
||||
with:
|
||||
opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
|
||||
opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
|
||||
|
||||
- name: Build and upload artifacts
|
||||
uses: tauri-apps/tauri-action@390cbe447412ced1303d35abe75287949e43437a
|
||||
timeout-minutes: 60
|
||||
@@ -220,16 +196,14 @@ jobs:
|
||||
projectPath: packages/desktop
|
||||
uploadWorkflowArtifacts: true
|
||||
tauriScript: ${{ (contains(matrix.settings.host, 'ubuntu') && 'cargo tauri') || '' }}
|
||||
args: --target ${{ matrix.settings.target }} --config ${{ (github.ref_name == 'beta' && './src-tauri/tauri.beta.conf.json') || './src-tauri/tauri.prod.conf.json' }} --verbose
|
||||
args: --target ${{ matrix.settings.target }} --config ./src-tauri/tauri.prod.conf.json --verbose
|
||||
updaterJsonPreferNsis: true
|
||||
releaseId: ${{ needs.version.outputs.release }}
|
||||
tagName: ${{ needs.version.outputs.tag }}
|
||||
releaseDraft: true
|
||||
releaseAssetNamePattern: opencode-desktop-[platform]-[arch][ext]
|
||||
repo: ${{ (github.ref_name == 'beta' && 'opencode-beta') || '' }}
|
||||
releaseCommitish: ${{ github.sha }}
|
||||
env:
|
||||
GITHUB_TOKEN: ${{ steps.committer.outputs.token }}
|
||||
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||
TAURI_BUNDLER_NEW_APPIMAGE_FORMAT: true
|
||||
TAURI_SIGNING_PRIVATE_KEY: ${{ secrets.TAURI_SIGNING_PRIVATE_KEY }}
|
||||
TAURI_SIGNING_PRIVATE_KEY_PASSWORD: ${{ secrets.TAURI_SIGNING_PRIVATE_KEY_PASSWORD }}
|
||||
@@ -306,5 +280,4 @@ jobs:
|
||||
OPENCODE_RELEASE: ${{ needs.version.outputs.release }}
|
||||
AUR_KEY: ${{ secrets.AUR_KEY }}
|
||||
GITHUB_TOKEN: ${{ steps.committer.outputs.token }}
|
||||
GH_REPO: ${{ needs.version.outputs.repo }}
|
||||
NPM_CONFIG_PROVENANCE: false
|
||||
|
||||
1
.gitignore
vendored
1
.gitignore
vendored
@@ -27,4 +27,3 @@ target
|
||||
opencode-dev
|
||||
logs/
|
||||
*.bun-build
|
||||
tsconfig.tsbuildinfo
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
---
|
||||
description: Translate content for a specified locale while preserving technical terms
|
||||
mode: subagent
|
||||
model: opencode/gemini-3.1-pro
|
||||
model: opencode/gemini-3-pro
|
||||
---
|
||||
|
||||
You are a professional translator and localization specialist.
|
||||
|
||||
@@ -5,16 +5,8 @@ import DESCRIPTION from "./github-triage.txt"
|
||||
const TEAM = {
|
||||
desktop: ["adamdotdevin", "iamdavidhill", "Brendonovich", "nexxeln"],
|
||||
zen: ["fwang", "MrMushrooooom"],
|
||||
tui: [
|
||||
"thdxr",
|
||||
"kommander",
|
||||
// "rekram1-node" (on vacation)
|
||||
],
|
||||
core: [
|
||||
"thdxr",
|
||||
// "rekram1-node", (on vacation)
|
||||
"jlongster",
|
||||
],
|
||||
tui: ["thdxr", "kommander", "rekram1-node"],
|
||||
core: ["thdxr", "rekram1-node", "jlongster"],
|
||||
docs: ["R44VC0RP"],
|
||||
windows: ["Hona"],
|
||||
} as const
|
||||
@@ -50,7 +42,10 @@ async function githubFetch(endpoint: string, options: RequestInit = {}) {
|
||||
export default tool({
|
||||
description: DESCRIPTION,
|
||||
args: {
|
||||
assignee: tool.schema.enum(ASSIGNEES as [string, ...string[]]).describe("The username of the assignee"),
|
||||
assignee: tool.schema
|
||||
.enum(ASSIGNEES as [string, ...string[]])
|
||||
.describe("The username of the assignee")
|
||||
.default("rekram1-node"),
|
||||
labels: tool.schema
|
||||
.array(tool.schema.enum(["nix", "opentui", "perf", "web", "desktop", "zen", "docs", "windows", "core"]))
|
||||
.describe("The labels(s) to add to the issue")
|
||||
@@ -73,8 +68,7 @@ export default tool({
|
||||
results.push("Dropped label: nix (issue does not mention nix)")
|
||||
}
|
||||
|
||||
// const assignee = nix ? "rekram1-node" : web ? pick(TEAM.desktop) : args.assignee
|
||||
const assignee = web ? pick(TEAM.desktop) : args.assignee
|
||||
const assignee = nix ? "rekram1-node" : web ? pick(TEAM.desktop) : args.assignee
|
||||
|
||||
if (labels.includes("zen") && !zen) {
|
||||
throw new Error("Only add the zen label when issue title/body contains 'zen'")
|
||||
|
||||
@@ -4,5 +4,3 @@ Choose labels and assignee using the current triage policy and ownership rules.
|
||||
Pick the most fitting labels for the issue and assign one owner.
|
||||
|
||||
If unsure, choose the team/section with the most overlap with the issue and assign a member from that team at random.
|
||||
|
||||
(Note: rekram1-node is on vacation, do not assign issues to him.)
|
||||
|
||||
112
bun.lock
112
bun.lock
@@ -15,7 +15,6 @@
|
||||
"@actions/artifact": "5.0.1",
|
||||
"@tsconfig/bun": "catalog:",
|
||||
"@types/mime-types": "3.0.1",
|
||||
"glob": "13.0.5",
|
||||
"husky": "9.1.7",
|
||||
"prettier": "3.6.2",
|
||||
"semver": "^7.6.0",
|
||||
@@ -25,7 +24,7 @@
|
||||
},
|
||||
"packages/app": {
|
||||
"name": "@opencode-ai/app",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@kobalte/core": "catalog:",
|
||||
"@opencode-ai/sdk": "workspace:*",
|
||||
@@ -75,7 +74,7 @@
|
||||
},
|
||||
"packages/console/app": {
|
||||
"name": "@opencode-ai/console-app",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@cloudflare/vite-plugin": "1.15.2",
|
||||
"@ibm/plex": "6.4.1",
|
||||
@@ -109,7 +108,7 @@
|
||||
},
|
||||
"packages/console/core": {
|
||||
"name": "@opencode-ai/console-core",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@aws-sdk/client-sts": "3.782.0",
|
||||
"@jsx-email/render": "1.1.1",
|
||||
@@ -136,7 +135,7 @@
|
||||
},
|
||||
"packages/console/function": {
|
||||
"name": "@opencode-ai/console-function",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@ai-sdk/anthropic": "2.0.0",
|
||||
"@ai-sdk/openai": "2.0.2",
|
||||
@@ -160,7 +159,7 @@
|
||||
},
|
||||
"packages/console/mail": {
|
||||
"name": "@opencode-ai/console-mail",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@jsx-email/all": "2.2.3",
|
||||
"@jsx-email/cli": "1.4.3",
|
||||
@@ -184,7 +183,7 @@
|
||||
},
|
||||
"packages/desktop": {
|
||||
"name": "@opencode-ai/desktop",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@opencode-ai/app": "workspace:*",
|
||||
"@opencode-ai/ui": "workspace:*",
|
||||
@@ -217,7 +216,7 @@
|
||||
},
|
||||
"packages/enterprise": {
|
||||
"name": "@opencode-ai/enterprise",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@opencode-ai/ui": "workspace:*",
|
||||
"@opencode-ai/util": "workspace:*",
|
||||
@@ -246,7 +245,7 @@
|
||||
},
|
||||
"packages/function": {
|
||||
"name": "@opencode-ai/function",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@octokit/auth-app": "8.0.1",
|
||||
"@octokit/rest": "catalog:",
|
||||
@@ -262,7 +261,7 @@
|
||||
},
|
||||
"packages/opencode": {
|
||||
"name": "opencode",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"bin": {
|
||||
"opencode": "./bin/opencode",
|
||||
},
|
||||
@@ -270,22 +269,22 @@
|
||||
"@actions/core": "1.11.1",
|
||||
"@actions/github": "6.0.1",
|
||||
"@agentclientprotocol/sdk": "0.14.1",
|
||||
"@ai-sdk/amazon-bedrock": "3.0.82",
|
||||
"@ai-sdk/anthropic": "2.0.65",
|
||||
"@ai-sdk/amazon-bedrock": "3.0.79",
|
||||
"@ai-sdk/anthropic": "2.0.62",
|
||||
"@ai-sdk/azure": "2.0.91",
|
||||
"@ai-sdk/cerebras": "1.0.36",
|
||||
"@ai-sdk/cohere": "2.0.22",
|
||||
"@ai-sdk/deepinfra": "1.0.36",
|
||||
"@ai-sdk/gateway": "2.0.30",
|
||||
"@ai-sdk/google": "2.0.54",
|
||||
"@ai-sdk/google-vertex": "3.0.106",
|
||||
"@ai-sdk/google": "2.0.52",
|
||||
"@ai-sdk/google-vertex": "3.0.103",
|
||||
"@ai-sdk/groq": "2.0.34",
|
||||
"@ai-sdk/mistral": "2.0.27",
|
||||
"@ai-sdk/openai": "2.0.89",
|
||||
"@ai-sdk/openai-compatible": "1.0.32",
|
||||
"@ai-sdk/perplexity": "2.0.23",
|
||||
"@ai-sdk/provider": "2.0.1",
|
||||
"@ai-sdk/provider-utils": "3.0.21",
|
||||
"@ai-sdk/provider-utils": "3.0.20",
|
||||
"@ai-sdk/togetherai": "1.0.34",
|
||||
"@ai-sdk/vercel": "1.0.33",
|
||||
"@ai-sdk/xai": "2.0.51",
|
||||
@@ -322,7 +321,6 @@
|
||||
"diff": "catalog:",
|
||||
"drizzle-orm": "1.0.0-beta.12-a5629fb",
|
||||
"fuzzysort": "3.1.0",
|
||||
"glob": "13.0.5",
|
||||
"google-auth-library": "10.5.0",
|
||||
"gray-matter": "4.0.3",
|
||||
"hono": "catalog:",
|
||||
@@ -376,7 +374,7 @@
|
||||
},
|
||||
"packages/plugin": {
|
||||
"name": "@opencode-ai/plugin",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@opencode-ai/sdk": "workspace:*",
|
||||
"zod": "catalog:",
|
||||
@@ -396,7 +394,7 @@
|
||||
},
|
||||
"packages/sdk/js": {
|
||||
"name": "@opencode-ai/sdk",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"devDependencies": {
|
||||
"@hey-api/openapi-ts": "0.90.10",
|
||||
"@tsconfig/node22": "catalog:",
|
||||
@@ -407,7 +405,7 @@
|
||||
},
|
||||
"packages/slack": {
|
||||
"name": "@opencode-ai/slack",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@opencode-ai/sdk": "workspace:*",
|
||||
"@slack/bolt": "^3.17.1",
|
||||
@@ -420,7 +418,7 @@
|
||||
},
|
||||
"packages/ui": {
|
||||
"name": "@opencode-ai/ui",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@kobalte/core": "catalog:",
|
||||
"@opencode-ai/sdk": "workspace:*",
|
||||
@@ -462,7 +460,7 @@
|
||||
},
|
||||
"packages/util": {
|
||||
"name": "@opencode-ai/util",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"zod": "catalog:",
|
||||
},
|
||||
@@ -473,7 +471,7 @@
|
||||
},
|
||||
"packages/web": {
|
||||
"name": "@opencode-ai/web",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@astrojs/cloudflare": "12.6.3",
|
||||
"@astrojs/markdown-remark": "6.3.1",
|
||||
@@ -578,7 +576,7 @@
|
||||
|
||||
"@agentclientprotocol/sdk": ["@agentclientprotocol/sdk@0.14.1", "", { "peerDependencies": { "zod": "^3.25.0 || ^4.0.0" } }, "sha512-b6r3PS3Nly+Wyw9U+0nOr47bV8tfS476EgyEMhoKvJCZLbgqoDFN7DJwkxL88RR0aiOqOYV1ZnESHqb+RmdH8w=="],
|
||||
|
||||
"@ai-sdk/amazon-bedrock": ["@ai-sdk/amazon-bedrock@3.0.82", "", { "dependencies": { "@ai-sdk/anthropic": "2.0.65", "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21", "@smithy/eventstream-codec": "^4.0.1", "@smithy/util-utf8": "^4.0.0", "aws4fetch": "^1.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-yb1EkRCMWex0tnpHPLGQxoJEiJvMGOizuxzlXFOpuGFiYgE679NsWE/F8pHwtoAWsqLlylgGAJvJDIJ8us8LEw=="],
|
||||
"@ai-sdk/amazon-bedrock": ["@ai-sdk/amazon-bedrock@3.0.79", "", { "dependencies": { "@ai-sdk/anthropic": "2.0.62", "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21", "@smithy/eventstream-codec": "^4.0.1", "@smithy/util-utf8": "^4.0.0", "aws4fetch": "^1.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-GfAQUb1GEmdTjLu5Ud1d5sieNHDpwoQdb4S14KmJlA5RsGREUZ1tfSKngFaiClxFtL0xPSZjePhTMV6Z65A7/g=="],
|
||||
|
||||
"@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.0", "", { "dependencies": { "@ai-sdk/provider": "2.0.0", "@ai-sdk/provider-utils": "3.0.0" }, "peerDependencies": { "zod": "^3.25.76 || ^4" } }, "sha512-uyyaO4KhxoIKZztREqLPh+6/K3ZJx/rp72JKoUEL9/kC+vfQTThUfPnY/bUryUpcnawx8IY/tSoYNOi/8PCv7w=="],
|
||||
|
||||
@@ -600,9 +598,9 @@
|
||||
|
||||
"@ai-sdk/gateway": ["@ai-sdk/gateway@2.0.30", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20", "@vercel/oidc": "3.1.0" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-5Nrkj8B4MzkkOfjjA+Cs5pamkbkK4lI11bx80QV7TFcen/hWA8wEC+UVzwuM5H2zpekoNMjvl6GonHnR62XIZw=="],
|
||||
|
||||
"@ai-sdk/google": ["@ai-sdk/google@2.0.54", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-VKguP0x/PUYpdQyuA/uy5pDGJy6reL0X/yDKxHfL207aCUXpFIBmyMhVs4US39dkEVhtmIFSwXauY0Pt170JRw=="],
|
||||
"@ai-sdk/google": ["@ai-sdk/google@2.0.52", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-2XUnGi3f7TV4ujoAhA+Fg3idUoG/+Y2xjCRg70a1/m0DH1KSQqYaCboJ1C19y6ZHGdf5KNT20eJdswP6TvrY2g=="],
|
||||
|
||||
"@ai-sdk/google-vertex": ["@ai-sdk/google-vertex@3.0.106", "", { "dependencies": { "@ai-sdk/anthropic": "2.0.65", "@ai-sdk/google": "2.0.54", "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21", "google-auth-library": "^10.5.0" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-f9sA66bmhgJoTwa+pHWFSdYxPa0lgdQ/MgYNxZptzVyGptoziTf1a9EIXEL3jiCD0qIBAg+IhDAaYalbvZaDqQ=="],
|
||||
"@ai-sdk/google-vertex": ["@ai-sdk/google-vertex@3.0.103", "", { "dependencies": { "@ai-sdk/anthropic": "2.0.63", "@ai-sdk/google": "2.0.53", "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21", "google-auth-library": "^10.5.0" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-MPZRSVOJFxYGHE4s6XjSWaiUPru7u2i/LUUA1Ih2nzNYZaei8c46Z56imOCD/KQjQX3afRA2iZh6P5McsmwhqA=="],
|
||||
|
||||
"@ai-sdk/groq": ["@ai-sdk/groq@2.0.34", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-wfCYkVgmVjxNA32T57KbLabVnv9aFUflJ4urJ7eWgTwbnmGQHElCTu+rJ3ydxkXSqxOkXPwMOttDm7XNrvPjmg=="],
|
||||
|
||||
@@ -616,7 +614,7 @@
|
||||
|
||||
"@ai-sdk/provider": ["@ai-sdk/provider@2.0.1", "", { "dependencies": { "json-schema": "^0.4.0" } }, "sha512-KCUwswvsC5VsW2PWFqF8eJgSCu5Ysj7m1TxiHTVA6g7k360bk0RNQENT8KTMAYEs+8fWPD3Uu4dEmzGHc+jGng=="],
|
||||
|
||||
"@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
"@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"@ai-sdk/togetherai": ["@ai-sdk/togetherai@1.0.34", "", { "dependencies": { "@ai-sdk/openai-compatible": "1.0.32", "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-jjJmJms6kdEc4nC3MDGFJfhV8F1ifY4nolV2dbnT7BM4ab+Wkskc0GwCsJ7G7WdRMk7xDbFh4he3DPL8KJ/cyA=="],
|
||||
|
||||
@@ -2696,7 +2694,7 @@
|
||||
|
||||
"github-slugger": ["github-slugger@2.0.0", "", {}, "sha512-IaOQ9puYtjrkq7Y0Ygl9KDZnrf/aiUJYUpVf89y8kyaxbRG7Y1SrX/jaumrv81vc61+kiMempujsM3Yw7w5qcw=="],
|
||||
|
||||
"glob": ["glob@13.0.5", "", { "dependencies": { "minimatch": "^10.2.1", "minipass": "^7.1.2", "path-scurry": "^2.0.0" } }, "sha512-BzXxZg24Ibra1pbQ/zE7Kys4Ua1ks7Bn6pKLkVPZ9FZe4JQS6/Q7ef3LG1H+k7lUf5l4T3PLSyYyYJVYUvfgTw=="],
|
||||
"glob": ["glob@11.1.0", "", { "dependencies": { "foreground-child": "^3.3.1", "jackspeak": "^4.1.1", "minimatch": "^10.1.1", "minipass": "^7.1.2", "package-json-from-dist": "^1.0.0", "path-scurry": "^2.0.0" }, "bin": { "glob": "dist/esm/bin.mjs" } }, "sha512-vuNwKSaKiqm7g0THUBu2x7ckSs3XJLXE+2ssL7/MfTGPLLcrJQ/4Uq1CjPTtO5cCIiRxqvN6Twy1qOwhL0Xjcw=="],
|
||||
|
||||
"glob-parent": ["glob-parent@5.1.2", "", { "dependencies": { "is-glob": "^4.0.1" } }, "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow=="],
|
||||
|
||||
@@ -3076,7 +3074,7 @@
|
||||
|
||||
"lower-case": ["lower-case@2.0.2", "", { "dependencies": { "tslib": "^2.0.3" } }, "sha512-7fm3l3NAF9WfN6W3JOmf5drwpVqX78JtoGJ3A6W0a6ZnldM41w2fV5D490psKFTpMds8TJse/eHLFFsNHHjHgg=="],
|
||||
|
||||
"lru-cache": ["lru-cache@11.2.6", "", {}, "sha512-ESL2CrkS/2wTPfuend7Zhkzo2u0daGJ/A2VucJOgQ/C48S/zB8MMeMHSGKYpXhIjbPxfuezITkaBH1wqv00DDQ=="],
|
||||
"lru-cache": ["lru-cache@6.0.0", "", { "dependencies": { "yallist": "^4.0.0" } }, "sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA=="],
|
||||
|
||||
"lru.min": ["lru.min@1.1.4", "", {}, "sha512-DqC6n3QQ77zdFpCMASA1a3Jlb64Hv2N2DciFGkO/4L9+q/IpIAuRlKOvCXabtRW6cQf8usbmM6BE/TOPysCdIA=="],
|
||||
|
||||
@@ -4200,9 +4198,9 @@
|
||||
|
||||
"@actions/http-client/undici": ["undici@6.23.0", "", {}, "sha512-VfQPToRA5FZs/qJxLIinmU59u0r7LXqoJkCzinq3ckNJp3vKEh7jTWN589YQ5+aoAC/TGRLyJLCPKcLQbM8r9g=="],
|
||||
|
||||
"@ai-sdk/amazon-bedrock/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.65", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-HqTPP59mLQ9U6jXQcx6EORkdc5FyZu34Sitkg6jNpyMYcRjStvfx4+NWq/qaR+OTwBFcccv8hvVii0CYkH2Lag=="],
|
||||
"@ai-sdk/amazon-bedrock/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.62", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-I3RhaOEMnWlWnrvjNBOYvUb19Dwf2nw01IruZrVJRDi688886e11wnd5DxrBZLd2V29Gizo3vpOPnnExsA+wTA=="],
|
||||
|
||||
"@ai-sdk/amazon-bedrock/@smithy/eventstream-codec": ["@smithy/eventstream-codec@4.2.8", "", { "dependencies": { "@aws-crypto/crc32": "5.2.0", "@smithy/types": "^4.12.0", "@smithy/util-hex-encoding": "^4.2.0", "tslib": "^2.6.2" } }, "sha512-jS/O5Q14UsufqoGhov7dHLOPCzkYJl9QDzusI2Psh4wyYx/izhzvX9P4D69aTxcdfVhEPhjK+wYyn/PzLjKbbw=="],
|
||||
"@ai-sdk/amazon-bedrock/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"@ai-sdk/anthropic/@ai-sdk/provider": ["@ai-sdk/provider@2.0.0", "", { "dependencies": { "json-schema": "^0.4.0" } }, "sha512-6o7Y2SeO9vFKB8lArHXehNuusnpddKPk7xqL7T2/b+OvXMRIXUO1rR4wcv1hAFUAT9avGZshty3Wlua/XA7TvA=="],
|
||||
|
||||
@@ -4210,25 +4208,27 @@
|
||||
|
||||
"@ai-sdk/azure/@ai-sdk/openai": ["@ai-sdk/openai@2.0.89", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-4+qWkBCbL9HPKbgrUO/F2uXZ8GqrYxHa8SWEYIzxEJ9zvWw3ISr3t1/27O1i8MGSym+PzEyHBT48EV4LAwWaEw=="],
|
||||
|
||||
"@ai-sdk/azure/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"@ai-sdk/cerebras/@ai-sdk/openai-compatible": ["@ai-sdk/openai-compatible@1.0.32", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-YspqqyJPzHjqWrjt4y/Wgc2aJgCcQj5uIJgZpq2Ar/lH30cEVhgE+keePDbjKpetD9UwNggCj7u6kO3unS23OQ=="],
|
||||
|
||||
"@ai-sdk/cerebras/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"@ai-sdk/cohere/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
"@ai-sdk/deepgram/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"@ai-sdk/deepinfra/@ai-sdk/openai-compatible": ["@ai-sdk/openai-compatible@1.0.33", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-2KMcR2xAul3u5dGZD7gONgbIki3Hg7Ey+sFu7gsiJ4U2iRU0GDV3ccNq79dTuAEXPDFcOWCUpW8A8jXc0kxJxQ=="],
|
||||
|
||||
"@ai-sdk/deepinfra/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"@ai-sdk/deepseek/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"@ai-sdk/elevenlabs/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"@ai-sdk/fireworks/@ai-sdk/openai-compatible": ["@ai-sdk/openai-compatible@1.0.33", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-2KMcR2xAul3u5dGZD7gONgbIki3Hg7Ey+sFu7gsiJ4U2iRU0GDV3ccNq79dTuAEXPDFcOWCUpW8A8jXc0kxJxQ=="],
|
||||
|
||||
"@ai-sdk/gateway/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
"@ai-sdk/fireworks/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"@ai-sdk/google-vertex/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.65", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-HqTPP59mLQ9U6jXQcx6EORkdc5FyZu34Sitkg6jNpyMYcRjStvfx4+NWq/qaR+OTwBFcccv8hvVii0CYkH2Lag=="],
|
||||
"@ai-sdk/google-vertex/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.63", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-zXlUPCkumnvp8lWS9VFcen/MLF6CL/t1zAKDhpobYj9y/nmylQrKtRvn3RwH871Wd3dF3KYEUXd6M2c6dfCKOA=="],
|
||||
|
||||
"@ai-sdk/groq/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
"@ai-sdk/google-vertex/@ai-sdk/google": ["@ai-sdk/google@2.0.53", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-ccCxr5mrd3AC2CjLq4e1ST7+UiN5T2Pdmgi0XdWM3QohmNBwUQ/RBG7BvL+cB/ex/j6y64tkMmpYz9zBw/SEFQ=="],
|
||||
|
||||
"@ai-sdk/mistral/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
"@ai-sdk/google-vertex/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"@ai-sdk/openai/@ai-sdk/provider": ["@ai-sdk/provider@2.0.0", "", { "dependencies": { "json-schema": "^0.4.0" } }, "sha512-6o7Y2SeO9vFKB8lArHXehNuusnpddKPk7xqL7T2/b+OvXMRIXUO1rR4wcv1hAFUAT9avGZshty3Wlua/XA7TvA=="],
|
||||
|
||||
@@ -4238,20 +4238,12 @@
|
||||
|
||||
"@ai-sdk/openai-compatible/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.0", "", { "dependencies": { "@ai-sdk/provider": "2.0.0", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.3", "zod-to-json-schema": "^3.24.1" }, "peerDependencies": { "zod": "^3.25.76 || ^4" } }, "sha512-BoQZtGcBxkeSH1zK+SRYNDtJPIPpacTeiMZqnG4Rv6xXjEwM0FH4MGs9c+PlhyEWmQCzjRM2HAotEydFhD4dYw=="],
|
||||
|
||||
"@ai-sdk/perplexity/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"@ai-sdk/togetherai/@ai-sdk/openai-compatible": ["@ai-sdk/openai-compatible@1.0.32", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-YspqqyJPzHjqWrjt4y/Wgc2aJgCcQj5uIJgZpq2Ar/lH30cEVhgE+keePDbjKpetD9UwNggCj7u6kO3unS23OQ=="],
|
||||
|
||||
"@ai-sdk/togetherai/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"@ai-sdk/vercel/@ai-sdk/openai-compatible": ["@ai-sdk/openai-compatible@1.0.32", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-YspqqyJPzHjqWrjt4y/Wgc2aJgCcQj5uIJgZpq2Ar/lH30cEVhgE+keePDbjKpetD9UwNggCj7u6kO3unS23OQ=="],
|
||||
|
||||
"@ai-sdk/vercel/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"@ai-sdk/xai/@ai-sdk/openai-compatible": ["@ai-sdk/openai-compatible@1.0.30", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-thubwhRtv9uicAxSWwNpinM7hiL/0CkhL/ymPaHuKvI494J7HIzn8KQZQ2ymRz284WTIZnI7VMyyejxW4RMM6w=="],
|
||||
|
||||
"@ai-sdk/xai/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"@astrojs/check/yargs": ["yargs@17.7.2", "", { "dependencies": { "cliui": "^8.0.1", "escalade": "^3.1.1", "get-caller-file": "^2.0.5", "require-directory": "^2.1.1", "string-width": "^4.2.3", "y18n": "^5.0.5", "yargs-parser": "^21.1.1" } }, "sha512-7dSzzRQ++CKnNI/krKnYRV7JKKPUXMEh61soaHKg9mrWEhzFWhFnxPxGl+69cD1Ou63C13NUPCnmIcrvqCuM6w=="],
|
||||
|
||||
"@astrojs/cloudflare/vite": ["vite@6.4.1", "", { "dependencies": { "esbuild": "^0.25.0", "fdir": "^6.4.4", "picomatch": "^4.0.2", "postcss": "^8.5.3", "rollup": "^4.34.9", "tinyglobby": "^0.2.13" }, "optionalDependencies": { "fsevents": "~2.3.3" }, "peerDependencies": { "@types/node": "^18.0.0 || ^20.0.0 || >=22.0.0", "jiti": ">=1.21.0", "less": "*", "lightningcss": "^1.21.0", "sass": "*", "sass-embedded": "*", "stylus": "*", "sugarss": "*", "terser": "^5.16.0", "tsx": "^4.8.1", "yaml": "^2.4.2" }, "optionalPeers": ["@types/node", "jiti", "less", "lightningcss", "sass", "sass-embedded", "stylus", "sugarss", "terser", "tsx", "yaml"], "bin": { "vite": "bin/vite.js" } }, "sha512-+Oxm7q9hDoLMyJOYfUYBuHQo+dkAloi33apOPP56pzj+vsdJDzr+j1NISE5pyaAuKL4A3UD34qd0lx5+kfKp2g=="],
|
||||
@@ -4638,10 +4630,6 @@
|
||||
|
||||
"accepts/mime-types": ["mime-types@2.1.35", "", { "dependencies": { "mime-db": "1.52.0" } }, "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw=="],
|
||||
|
||||
"ai/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"ai-gateway-provider/@ai-sdk/amazon-bedrock": ["@ai-sdk/amazon-bedrock@3.0.79", "", { "dependencies": { "@ai-sdk/anthropic": "2.0.62", "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21", "@smithy/eventstream-codec": "^4.0.1", "@smithy/util-utf8": "^4.0.0", "aws4fetch": "^1.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-GfAQUb1GEmdTjLu5Ud1d5sieNHDpwoQdb4S14KmJlA5RsGREUZ1tfSKngFaiClxFtL0xPSZjePhTMV6Z65A7/g=="],
|
||||
|
||||
"ai-gateway-provider/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.63", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-zXlUPCkumnvp8lWS9VFcen/MLF6CL/t1zAKDhpobYj9y/nmylQrKtRvn3RwH871Wd3dF3KYEUXd6M2c6dfCKOA=="],
|
||||
|
||||
"ai-gateway-provider/@ai-sdk/google": ["@ai-sdk/google@2.0.53", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-ccCxr5mrd3AC2CjLq4e1ST7+UiN5T2Pdmgi0XdWM3QohmNBwUQ/RBG7BvL+cB/ex/j6y64tkMmpYz9zBw/SEFQ=="],
|
||||
@@ -4652,6 +4640,8 @@
|
||||
|
||||
"ai-gateway-provider/@ai-sdk/openai-compatible": ["@ai-sdk/openai-compatible@1.0.33", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-2KMcR2xAul3u5dGZD7gONgbIki3Hg7Ey+sFu7gsiJ4U2iRU0GDV3ccNq79dTuAEXPDFcOWCUpW8A8jXc0kxJxQ=="],
|
||||
|
||||
"ai-gateway-provider/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"ansi-align/string-width": ["string-width@4.2.3", "", { "dependencies": { "emoji-regex": "^8.0.0", "is-fullwidth-code-point": "^3.0.0", "strip-ansi": "^6.0.1" } }, "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g=="],
|
||||
|
||||
"anymatch/picomatch": ["picomatch@2.3.1", "", {}, "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA=="],
|
||||
@@ -4778,7 +4768,7 @@
|
||||
|
||||
"nypm/tinyexec": ["tinyexec@1.0.2", "", {}, "sha512-W/KYk+NFhkmsYpuHq5JykngiOCnxeVL8v8dFnqxSD8qEEdRfXk1SDM6JzNqcERbcGYj9tMrDQBYV9cjgnunFIg=="],
|
||||
|
||||
"opencode/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.65", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-HqTPP59mLQ9U6jXQcx6EORkdc5FyZu34Sitkg6jNpyMYcRjStvfx4+NWq/qaR+OTwBFcccv8hvVii0CYkH2Lag=="],
|
||||
"opencode/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.62", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-I3RhaOEMnWlWnrvjNBOYvUb19Dwf2nw01IruZrVJRDi688886e11wnd5DxrBZLd2V29Gizo3vpOPnnExsA+wTA=="],
|
||||
|
||||
"opencode/@ai-sdk/openai": ["@ai-sdk/openai@2.0.89", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.20" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-4+qWkBCbL9HPKbgrUO/F2uXZ8GqrYxHa8SWEYIzxEJ9zvWw3ISr3t1/27O1i8MGSym+PzEyHBT48EV4LAwWaEw=="],
|
||||
|
||||
@@ -4796,14 +4786,14 @@
|
||||
|
||||
"openid-client/jose": ["jose@4.15.9", "", {}, "sha512-1vUQX+IdDMVPj4k8kOxgUqlcK518yluMuGZwqlr44FS1ppZB/5GWh4rZG89erpOBOJjU/OBsnCVFfapsRz6nEA=="],
|
||||
|
||||
"openid-client/lru-cache": ["lru-cache@6.0.0", "", { "dependencies": { "yallist": "^4.0.0" } }, "sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA=="],
|
||||
|
||||
"p-locate/p-limit": ["p-limit@2.3.0", "", { "dependencies": { "p-try": "^2.0.0" } }, "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w=="],
|
||||
|
||||
"parse-entities/@types/unist": ["@types/unist@2.0.11", "", {}, "sha512-CmBKiL6NNo/OqgmMn95Fk9Whlp2mtvIv+KNpQKN2F4SjvrEesubTRWGYSg+BnWZOnlCaSTU1sMpsBOzgbYhnsA=="],
|
||||
|
||||
"parse5/entities": ["entities@6.0.1", "", {}, "sha512-aN97NXWF6AWBTahfVOIrB/NShkzi5H7F9r1s9mD3cDj4Ko5f2qhhVoYMibXF7GlLveb/D2ioWay8lxI97Ven3g=="],
|
||||
|
||||
"path-scurry/lru-cache": ["lru-cache@11.2.6", "", {}, "sha512-ESL2CrkS/2wTPfuend7Zhkzo2u0daGJ/A2VucJOgQ/C48S/zB8MMeMHSGKYpXhIjbPxfuezITkaBH1wqv00DDQ=="],
|
||||
|
||||
"pixelmatch/pngjs": ["pngjs@6.0.0", "", {}, "sha512-TRzzuFRRmEoSW/p1KVAmiOgPco2Irlah+bGFCeNfJXxxYGwSw7YwAOAcd7X28K/m5bjBWKsC29KyoMfHbypayg=="],
|
||||
|
||||
"pkg-up/find-up": ["find-up@3.0.0", "", { "dependencies": { "locate-path": "^3.0.0" } }, "sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg=="],
|
||||
@@ -4876,9 +4866,9 @@
|
||||
|
||||
"unifont/ofetch": ["ofetch@1.5.1", "", { "dependencies": { "destr": "^2.0.5", "node-fetch-native": "^1.6.7", "ufo": "^1.6.1" } }, "sha512-2W4oUZlVaqAPAil6FUg/difl6YhqhUR7x2eZY4bQCko22UXg3hptq9KLQdqFClV+Wu85UX7hNtdGTngi/1BxcA=="],
|
||||
|
||||
"utif2/pako": ["pako@1.0.11", "", {}, "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw=="],
|
||||
"unstorage/lru-cache": ["lru-cache@11.2.6", "", {}, "sha512-ESL2CrkS/2wTPfuend7Zhkzo2u0daGJ/A2VucJOgQ/C48S/zB8MMeMHSGKYpXhIjbPxfuezITkaBH1wqv00DDQ=="],
|
||||
|
||||
"vite-plugin-icons-spritesheet/glob": ["glob@11.1.0", "", { "dependencies": { "foreground-child": "^3.3.1", "jackspeak": "^4.1.1", "minimatch": "^10.1.1", "minipass": "^7.1.2", "package-json-from-dist": "^1.0.0", "path-scurry": "^2.0.0" }, "bin": { "glob": "dist/esm/bin.mjs" } }, "sha512-vuNwKSaKiqm7g0THUBu2x7ckSs3XJLXE+2ssL7/MfTGPLLcrJQ/4Uq1CjPTtO5cCIiRxqvN6Twy1qOwhL0Xjcw=="],
|
||||
"utif2/pako": ["pako@1.0.11", "", {}, "sha512-4hLB8Py4zZce5s4yd9XzopqwVv/yGNhV1Bl8NTmCq1763HeK2+EwVTv+leGeL13Dnh2wfbqowVPXCIO0z4taYw=="],
|
||||
|
||||
"vitest/tinyexec": ["tinyexec@1.0.2", "", {}, "sha512-W/KYk+NFhkmsYpuHq5JykngiOCnxeVL8v8dFnqxSD8qEEdRfXk1SDM6JzNqcERbcGYj9tMrDQBYV9cjgnunFIg=="],
|
||||
|
||||
@@ -5212,8 +5202,6 @@
|
||||
|
||||
"accepts/mime-types/mime-db": ["mime-db@1.52.0", "", {}, "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg=="],
|
||||
|
||||
"ai-gateway-provider/@ai-sdk/amazon-bedrock/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.62", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@ai-sdk/provider-utils": "3.0.21" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-I3RhaOEMnWlWnrvjNBOYvUb19Dwf2nw01IruZrVJRDi688886e11wnd5DxrBZLd2V29Gizo3vpOPnnExsA+wTA=="],
|
||||
|
||||
"ai-gateway-provider/@ai-sdk/google-vertex/@ai-sdk/anthropic": ["@ai-sdk/anthropic@2.0.56", "", { "dependencies": { "@ai-sdk/provider": "2.0.0", "@ai-sdk/provider-utils": "3.0.19" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-XHJKu0Yvfu9SPzRfsAFESa+9T7f2YJY6TxykKMfRsAwpeWAiX/Gbx5J5uM15AzYC3Rw8tVP3oH+j7jEivENirQ=="],
|
||||
|
||||
"ai-gateway-provider/@ai-sdk/google-vertex/@ai-sdk/google": ["@ai-sdk/google@2.0.46", "", { "dependencies": { "@ai-sdk/provider": "2.0.0", "@ai-sdk/provider-utils": "3.0.19" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-8PK6u4sGE/kXebd7ZkTp+0aya4kNqzoqpS5m7cHY2NfTK6fhPc6GNvE+MZIZIoHQTp5ed86wGBdeBPpFaaUtyg=="],
|
||||
@@ -5238,6 +5226,8 @@
|
||||
|
||||
"astro/unstorage/h3": ["h3@1.15.5", "", { "dependencies": { "cookie-es": "^1.2.2", "crossws": "^0.3.5", "defu": "^6.1.4", "destr": "^2.0.5", "iron-webcrypto": "^1.2.1", "node-mock-http": "^1.0.4", "radix3": "^1.1.2", "ufo": "^1.6.3", "uncrypto": "^0.1.3" } }, "sha512-xEyq3rSl+dhGX2Lm0+eFQIAzlDN6Fs0EcC4f7BNUmzaRX/PTzeuM+Tr2lHB8FoXggsQIeXLj8EDVgs5ywxyxmg=="],
|
||||
|
||||
"astro/unstorage/lru-cache": ["lru-cache@11.2.6", "", {}, "sha512-ESL2CrkS/2wTPfuend7Zhkzo2u0daGJ/A2VucJOgQ/C48S/zB8MMeMHSGKYpXhIjbPxfuezITkaBH1wqv00DDQ=="],
|
||||
|
||||
"astro/unstorage/ofetch": ["ofetch@1.5.1", "", { "dependencies": { "destr": "^2.0.5", "node-fetch-native": "^1.6.7", "ufo": "^1.6.1" } }, "sha512-2W4oUZlVaqAPAil6FUg/difl6YhqhUR7x2eZY4bQCko22UXg3hptq9KLQdqFClV+Wu85UX7hNtdGTngi/1BxcA=="],
|
||||
|
||||
"aws-sdk/xml2js/sax": ["sax@1.4.4", "", {}, "sha512-1n3r/tGXO6b6VXMdFT54SHzT9ytu9yr7TaELowdYpMqY/Ao7EnlQGmAQ1+RatX7Tkkdm6hONI2owqNx2aZj5Sw=="],
|
||||
@@ -5276,9 +5266,7 @@
|
||||
|
||||
"lazystream/readable-stream/string_decoder": ["string_decoder@1.1.1", "", { "dependencies": { "safe-buffer": "~5.1.0" } }, "sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg=="],
|
||||
|
||||
"opencode/@ai-sdk/openai/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
|
||||
"opencode/@ai-sdk/openai-compatible/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.20", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-iXHVe0apM2zUEzauqJwqmpC37A5rihrStAih5Ks+JE32iTe4LZ58y17UGBjpQQTCRw9YxMeo2UFLxLpBluyvLQ=="],
|
||||
"opencode/@ai-sdk/anthropic/@ai-sdk/provider-utils": ["@ai-sdk/provider-utils@3.0.21", "", { "dependencies": { "@ai-sdk/provider": "2.0.1", "@standard-schema/spec": "^1.0.0", "eventsource-parser": "^3.0.6" }, "peerDependencies": { "zod": "^3.25.76 || ^4.1.8" } }, "sha512-veuMwTLxsgh31Jjn0SnBABnM1f7ebHhRWcV2ZuY3hP3iJDCZ8VXBaYqcHXoOQDqUXTCas08sKQcHyWK+zl882Q=="],
|
||||
|
||||
"opencontrol/@modelcontextprotocol/sdk/express": ["express@5.2.1", "", { "dependencies": { "accepts": "^2.0.0", "body-parser": "^2.2.1", "content-disposition": "^1.0.0", "content-type": "^1.0.5", "cookie": "^0.7.1", "cookie-signature": "^1.2.1", "debug": "^4.4.0", "depd": "^2.0.0", "encodeurl": "^2.0.0", "escape-html": "^1.0.3", "etag": "^1.8.1", "finalhandler": "^2.1.0", "fresh": "^2.0.0", "http-errors": "^2.0.0", "merge-descriptors": "^2.0.0", "mime-types": "^3.0.0", "on-finished": "^2.4.1", "once": "^1.4.0", "parseurl": "^1.3.3", "proxy-addr": "^2.0.7", "qs": "^6.14.0", "range-parser": "^1.2.1", "router": "^2.2.0", "send": "^1.1.0", "serve-static": "^2.2.0", "statuses": "^2.0.1", "type-is": "^2.0.1", "vary": "^1.1.2" } }, "sha512-hIS4idWWai69NezIdRt2xFVofaF4j+6INOpJlVOLDO8zXGpUVEVzIYk12UUi2JzjEzWL3IOAxcTubgz9Po0yXw=="],
|
||||
|
||||
@@ -5370,8 +5358,6 @@
|
||||
|
||||
"type-is/mime-types/mime-db": ["mime-db@1.52.0", "", {}, "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg=="],
|
||||
|
||||
"vite-plugin-icons-spritesheet/glob/minimatch": ["minimatch@10.2.1", "", { "dependencies": { "brace-expansion": "^5.0.2" } }, "sha512-MClCe8IL5nRRmawL6ib/eT4oLyeKMGCghibcDWK+J0hh0Q8kqSdia6BvbRMVk6mPa6WqUa5uR2oxt6C5jd533A=="],
|
||||
|
||||
"wrangler/esbuild/@esbuild/aix-ppc64": ["@esbuild/aix-ppc64@0.25.4", "", { "os": "aix", "cpu": "ppc64" }, "sha512-1VCICWypeQKhVbE9oW/sJaAmjLxhVqacdkvPLEjwlttjfwENRSClS8EjBz0KzRyFSCPDIkuXW34Je/vk7zdB7Q=="],
|
||||
|
||||
"wrangler/esbuild/@esbuild/android-arm": ["@esbuild/android-arm@0.25.4", "", { "os": "android", "cpu": "arm" }, "sha512-QNdQEps7DfFwE3hXiU4BZeOV68HHzYwGd0Nthhd3uCkkEKK7/R6MTgM0P7H7FAs5pU/DIWsviMmEGxEoxIZ+ZQ=="],
|
||||
|
||||
@@ -30,10 +30,6 @@ inputs:
|
||||
description: "Comma-separated list of trigger phrases (case-insensitive). Defaults to '/opencode,/oc'"
|
||||
required: false
|
||||
|
||||
variant:
|
||||
description: "Model variant for provider-specific reasoning effort (e.g., high, max, minimal)"
|
||||
required: false
|
||||
|
||||
oidc_base_url:
|
||||
description: "Base URL for OIDC token exchange API. Only required when running a custom GitHub App install. Defaults to https://api.opencode.ai"
|
||||
required: false
|
||||
@@ -75,5 +71,4 @@ runs:
|
||||
PROMPT: ${{ inputs.prompt }}
|
||||
USE_GITHUB_TOKEN: ${{ inputs.use_github_token }}
|
||||
MENTIONS: ${{ inputs.mentions }}
|
||||
VARIANT: ${{ inputs.variant }}
|
||||
OIDC_BASE_URL: ${{ inputs.oidc_base_url }}
|
||||
|
||||
@@ -1,8 +1,8 @@
|
||||
{
|
||||
"nodeModules": {
|
||||
"x86_64-linux": "sha256-fjrvCgQ2PHYxzw8NsiEHOcor46qN95/cfilFHFqCp/k=",
|
||||
"aarch64-linux": "sha256-xWp4LLJrbrCPFL1F6SSbProq/t/az4CqhTcymPvjOBQ=",
|
||||
"aarch64-darwin": "sha256-Wbfyy/bruFHKUWsyJ2aiPXAzLkk5MNBfN6QdGPQwZS0=",
|
||||
"x86_64-darwin": "sha256-wDnMbiaBCRj5STkaLoVCZTdXVde+/YKfwWzwJZ1AJXQ="
|
||||
"x86_64-linux": "sha256-zs3o4OrLGqECnOxzbawP1UC+a7U3pZKr9QE+36qW+iA=",
|
||||
"aarch64-linux": "sha256-bg0xtNJBbaZpDleCw+S6aay9Ntcil/h4HW7a1jGfc8Q=",
|
||||
"aarch64-darwin": "sha256-alEZaFnNgd/7evGv+HLUieeRr8+YVN/FxhH2sNQBMcQ=",
|
||||
"x86_64-darwin": "sha256-NMBZX6Y7JCUqK6ntCoaf7/a6tFArzDSV/TnBCTtwGMw="
|
||||
}
|
||||
}
|
||||
|
||||
@@ -70,7 +70,6 @@
|
||||
"@actions/artifact": "5.0.1",
|
||||
"@tsconfig/bun": "catalog:",
|
||||
"@types/mime-types": "3.0.1",
|
||||
"glob": "13.0.5",
|
||||
"husky": "9.1.7",
|
||||
"prettier": "3.6.2",
|
||||
"semver": "^7.6.0",
|
||||
|
||||
@@ -225,7 +225,7 @@ export async function hoverSessionItem(page: Page, sessionID: string) {
|
||||
export async function openSessionMoreMenu(page: Page, sessionID: string) {
|
||||
await expect(page).toHaveURL(new RegExp(`/session/${sessionID}(?:[/?#]|$)`))
|
||||
|
||||
const scroller = page.locator(".scroll-view__viewport").first()
|
||||
const scroller = page.locator(".session-scroller").first()
|
||||
await expect(scroller).toBeVisible()
|
||||
await expect(scroller.getByRole("heading", { level: 1 }).first()).toBeVisible({ timeout: 30_000 })
|
||||
|
||||
@@ -332,163 +332,6 @@ export async function withSession<T>(
|
||||
}
|
||||
}
|
||||
|
||||
const seedSystem = [
|
||||
"You are seeding deterministic e2e UI state.",
|
||||
"Follow the user's instruction exactly.",
|
||||
"When asked to call a tool, call exactly that tool exactly once with the exact JSON input.",
|
||||
"Do not call any extra tools.",
|
||||
].join(" ")
|
||||
|
||||
const wait = async <T>(input: { probe: () => Promise<T | undefined>; timeout?: number }) => {
|
||||
const timeout = input.timeout ?? 30_000
|
||||
const end = Date.now() + timeout
|
||||
while (Date.now() < end) {
|
||||
const value = await input.probe()
|
||||
if (value !== undefined) return value
|
||||
await new Promise((resolve) => setTimeout(resolve, 250))
|
||||
}
|
||||
}
|
||||
|
||||
const seed = async <T>(input: {
|
||||
sessionID: string
|
||||
prompt: string
|
||||
sdk: ReturnType<typeof createSdk>
|
||||
probe: () => Promise<T | undefined>
|
||||
timeout?: number
|
||||
attempts?: number
|
||||
}) => {
|
||||
for (let i = 0; i < (input.attempts ?? 2); i++) {
|
||||
await input.sdk.session.promptAsync({
|
||||
sessionID: input.sessionID,
|
||||
agent: "build",
|
||||
system: seedSystem,
|
||||
parts: [{ type: "text", text: input.prompt }],
|
||||
})
|
||||
const value = await wait({ probe: input.probe, timeout: input.timeout })
|
||||
if (value !== undefined) return value
|
||||
}
|
||||
}
|
||||
|
||||
export async function seedSessionQuestion(
|
||||
sdk: ReturnType<typeof createSdk>,
|
||||
input: {
|
||||
sessionID: string
|
||||
questions: Array<{
|
||||
header: string
|
||||
question: string
|
||||
options: Array<{ label: string; description: string }>
|
||||
multiple?: boolean
|
||||
custom?: boolean
|
||||
}>
|
||||
},
|
||||
) {
|
||||
const first = input.questions[0]
|
||||
if (!first) throw new Error("Question seed requires at least one question")
|
||||
|
||||
const text = [
|
||||
"Your only valid response is one question tool call.",
|
||||
`Use this JSON input: ${JSON.stringify({ questions: input.questions })}`,
|
||||
"Do not output plain text.",
|
||||
"After calling the tool, wait for the user response.",
|
||||
].join("\n")
|
||||
|
||||
const result = await seed({
|
||||
sdk,
|
||||
sessionID: input.sessionID,
|
||||
prompt: text,
|
||||
timeout: 30_000,
|
||||
probe: async () => {
|
||||
const list = await sdk.question.list().then((x) => x.data ?? [])
|
||||
return list.find((item) => item.sessionID === input.sessionID && item.questions[0]?.header === first.header)
|
||||
},
|
||||
})
|
||||
|
||||
if (!result) throw new Error("Timed out seeding question request")
|
||||
return { id: result.id }
|
||||
}
|
||||
|
||||
export async function seedSessionPermission(
|
||||
sdk: ReturnType<typeof createSdk>,
|
||||
input: {
|
||||
sessionID: string
|
||||
permission: string
|
||||
patterns: string[]
|
||||
description?: string
|
||||
},
|
||||
) {
|
||||
const text = [
|
||||
"Your only valid response is one bash tool call.",
|
||||
`Use this JSON input: ${JSON.stringify({
|
||||
command: input.patterns[0] ? `ls ${JSON.stringify(input.patterns[0])}` : "pwd",
|
||||
workdir: "/",
|
||||
description: input.description ?? `seed ${input.permission} permission request`,
|
||||
})}`,
|
||||
"Do not output plain text.",
|
||||
].join("\n")
|
||||
|
||||
const result = await seed({
|
||||
sdk,
|
||||
sessionID: input.sessionID,
|
||||
prompt: text,
|
||||
timeout: 30_000,
|
||||
probe: async () => {
|
||||
const list = await sdk.permission.list().then((x) => x.data ?? [])
|
||||
return list.find((item) => item.sessionID === input.sessionID)
|
||||
},
|
||||
})
|
||||
|
||||
if (!result) throw new Error("Timed out seeding permission request")
|
||||
return { id: result.id }
|
||||
}
|
||||
|
||||
export async function seedSessionTodos(
|
||||
sdk: ReturnType<typeof createSdk>,
|
||||
input: {
|
||||
sessionID: string
|
||||
todos: Array<{ content: string; status: string; priority: string }>
|
||||
},
|
||||
) {
|
||||
const text = [
|
||||
"Your only valid response is one todowrite tool call.",
|
||||
`Use this JSON input: ${JSON.stringify({ todos: input.todos })}`,
|
||||
"Do not output plain text.",
|
||||
].join("\n")
|
||||
const target = JSON.stringify(input.todos)
|
||||
|
||||
const result = await seed({
|
||||
sdk,
|
||||
sessionID: input.sessionID,
|
||||
prompt: text,
|
||||
timeout: 30_000,
|
||||
probe: async () => {
|
||||
const todos = await sdk.session.todo({ sessionID: input.sessionID }).then((x) => x.data ?? [])
|
||||
if (JSON.stringify(todos) !== target) return
|
||||
return true
|
||||
},
|
||||
})
|
||||
|
||||
if (!result) throw new Error("Timed out seeding todos")
|
||||
return true
|
||||
}
|
||||
|
||||
export async function clearSessionDockSeed(sdk: ReturnType<typeof createSdk>, sessionID: string) {
|
||||
const [questions, permissions] = await Promise.all([
|
||||
sdk.question.list().then((x) => x.data ?? []),
|
||||
sdk.permission.list().then((x) => x.data ?? []),
|
||||
])
|
||||
|
||||
await Promise.all([
|
||||
...questions
|
||||
.filter((item) => item.sessionID === sessionID)
|
||||
.map((item) => sdk.question.reject({ requestID: item.id }).catch(() => undefined)),
|
||||
...permissions
|
||||
.filter((item) => item.sessionID === sessionID)
|
||||
.map((item) => sdk.permission.reply({ requestID: item.id, reply: "reject" }).catch(() => undefined)),
|
||||
])
|
||||
|
||||
return true
|
||||
}
|
||||
|
||||
export async function openStatusPopover(page: Page) {
|
||||
await defocus(page)
|
||||
|
||||
|
||||
@@ -1,19 +1,7 @@
|
||||
import { base64Decode } from "@opencode-ai/util/encode"
|
||||
import { test, expect } from "../fixtures"
|
||||
import {
|
||||
defocus,
|
||||
createTestProject,
|
||||
cleanupTestProject,
|
||||
openSidebar,
|
||||
setWorkspacesEnabled,
|
||||
sessionIDFromUrl,
|
||||
} from "../actions"
|
||||
import { projectSwitchSelector, promptSelector, workspaceItemSelector, workspaceNewSessionSelector } from "../selectors"
|
||||
import { createSdk, dirSlug } from "../utils"
|
||||
|
||||
function slugFromUrl(url: string) {
|
||||
return /\/([^/]+)\/session(?:\/|$)/.exec(url)?.[1] ?? ""
|
||||
}
|
||||
import { defocus, createTestProject, cleanupTestProject } from "../actions"
|
||||
import { projectSwitchSelector } from "../selectors"
|
||||
import { dirSlug } from "../utils"
|
||||
|
||||
test("can switch between projects from sidebar", async ({ page, withProject }) => {
|
||||
await page.setViewportSize({ width: 1400, height: 800 })
|
||||
@@ -45,94 +33,3 @@ test("can switch between projects from sidebar", async ({ page, withProject }) =
|
||||
await cleanupTestProject(other)
|
||||
}
|
||||
})
|
||||
|
||||
test("switching back to a project opens the latest workspace session", async ({ page, withProject }) => {
|
||||
await page.setViewportSize({ width: 1400, height: 800 })
|
||||
|
||||
const other = await createTestProject()
|
||||
const otherSlug = dirSlug(other)
|
||||
const stamp = Date.now()
|
||||
let rootDir: string | undefined
|
||||
let workspaceDir: string | undefined
|
||||
let sessionID: string | undefined
|
||||
|
||||
try {
|
||||
await withProject(
|
||||
async ({ directory, slug }) => {
|
||||
rootDir = directory
|
||||
await defocus(page)
|
||||
await openSidebar(page)
|
||||
await setWorkspacesEnabled(page, slug, true)
|
||||
|
||||
await page.getByRole("button", { name: "New workspace" }).first().click()
|
||||
|
||||
await expect
|
||||
.poll(
|
||||
() => {
|
||||
const next = slugFromUrl(page.url())
|
||||
if (!next) return ""
|
||||
if (next === slug) return ""
|
||||
return next
|
||||
},
|
||||
{ timeout: 45_000 },
|
||||
)
|
||||
.not.toBe("")
|
||||
|
||||
const workspaceSlug = slugFromUrl(page.url())
|
||||
workspaceDir = base64Decode(workspaceSlug)
|
||||
await openSidebar(page)
|
||||
|
||||
const workspace = page.locator(workspaceItemSelector(workspaceSlug)).first()
|
||||
await expect(workspace).toBeVisible()
|
||||
await workspace.hover()
|
||||
|
||||
const newSession = page.locator(workspaceNewSessionSelector(workspaceSlug)).first()
|
||||
await expect(newSession).toBeVisible()
|
||||
await newSession.click({ force: true })
|
||||
|
||||
await expect(page).toHaveURL(new RegExp(`/${workspaceSlug}/session(?:[/?#]|$)`))
|
||||
|
||||
const prompt = page.locator(promptSelector)
|
||||
await expect(prompt).toBeVisible()
|
||||
await prompt.fill(`project switch remembers workspace ${stamp}`)
|
||||
await prompt.press("Enter")
|
||||
|
||||
await expect.poll(() => sessionIDFromUrl(page.url()) ?? "", { timeout: 30_000 }).not.toBe("")
|
||||
const created = sessionIDFromUrl(page.url())
|
||||
if (!created) throw new Error(`Failed to parse session id from URL: ${page.url()}`)
|
||||
sessionID = created
|
||||
await expect(page).toHaveURL(new RegExp(`/${workspaceSlug}/session/${created}(?:[/?#]|$)`))
|
||||
|
||||
await openSidebar(page)
|
||||
|
||||
const otherButton = page.locator(projectSwitchSelector(otherSlug)).first()
|
||||
await expect(otherButton).toBeVisible()
|
||||
await otherButton.click()
|
||||
await expect(page).toHaveURL(new RegExp(`/${otherSlug}/session`))
|
||||
|
||||
const rootButton = page.locator(projectSwitchSelector(slug)).first()
|
||||
await expect(rootButton).toBeVisible()
|
||||
await rootButton.click()
|
||||
|
||||
await expect(page).toHaveURL(new RegExp(`/${workspaceSlug}/session/${created}(?:[/?#]|$)`))
|
||||
},
|
||||
{ extra: [other] },
|
||||
)
|
||||
} finally {
|
||||
if (sessionID) {
|
||||
const id = sessionID
|
||||
const dirs = [rootDir, workspaceDir].filter((x): x is string => !!x)
|
||||
await Promise.all(
|
||||
dirs.map((directory) =>
|
||||
createSdk(directory)
|
||||
.session.delete({ sessionID: id })
|
||||
.catch(() => undefined),
|
||||
),
|
||||
)
|
||||
}
|
||||
if (workspaceDir) {
|
||||
await cleanupTestProject(workspaceDir)
|
||||
}
|
||||
await cleanupTestProject(other)
|
||||
}
|
||||
})
|
||||
|
||||
@@ -1,15 +1,5 @@
|
||||
export const promptSelector = '[data-component="prompt-input"]'
|
||||
export const terminalSelector = '[data-component="terminal"]'
|
||||
export const sessionComposerDockSelector = '[data-component="session-prompt-dock"]'
|
||||
export const questionDockSelector = '[data-component="dock-prompt"][data-kind="question"]'
|
||||
export const permissionDockSelector = '[data-component="dock-prompt"][data-kind="permission"]'
|
||||
export const permissionRejectSelector = `${permissionDockSelector} [data-slot="permission-footer-actions"] [data-component="button"]:nth-child(1)`
|
||||
export const permissionAllowAlwaysSelector = `${permissionDockSelector} [data-slot="permission-footer-actions"] [data-component="button"]:nth-child(2)`
|
||||
export const permissionAllowOnceSelector = `${permissionDockSelector} [data-slot="permission-footer-actions"] [data-component="button"]:nth-child(3)`
|
||||
export const sessionTodoDockSelector = '[data-component="session-todo-dock"]'
|
||||
export const sessionTodoToggleSelector = '[data-action="session-todo-toggle"]'
|
||||
export const sessionTodoToggleButtonSelector = '[data-action="session-todo-toggle-button"]'
|
||||
export const sessionTodoListSelector = '[data-slot="session-todo-list"]'
|
||||
|
||||
export const modelVariantCycleSelector = '[data-action="model-variant-cycle"]'
|
||||
export const settingsLanguageSelectSelector = '[data-action="settings-language"]'
|
||||
|
||||
@@ -1,207 +0,0 @@
|
||||
import { test, expect } from "../fixtures"
|
||||
import { clearSessionDockSeed, seedSessionPermission, seedSessionQuestion, seedSessionTodos } from "../actions"
|
||||
import {
|
||||
permissionDockSelector,
|
||||
promptSelector,
|
||||
questionDockSelector,
|
||||
sessionComposerDockSelector,
|
||||
sessionTodoDockSelector,
|
||||
sessionTodoListSelector,
|
||||
sessionTodoToggleButtonSelector,
|
||||
} from "../selectors"
|
||||
|
||||
type Sdk = Parameters<typeof clearSessionDockSeed>[0]
|
||||
|
||||
async function withDockSession<T>(sdk: Sdk, title: string, fn: (session: { id: string; title: string }) => Promise<T>) {
|
||||
const session = await sdk.session.create({ title }).then((r) => r.data)
|
||||
if (!session?.id) throw new Error("Session create did not return an id")
|
||||
return fn(session)
|
||||
}
|
||||
|
||||
test.setTimeout(120_000)
|
||||
|
||||
async function withDockSeed<T>(sdk: Sdk, sessionID: string, fn: () => Promise<T>) {
|
||||
try {
|
||||
return await fn()
|
||||
} finally {
|
||||
await clearSessionDockSeed(sdk, sessionID).catch(() => undefined)
|
||||
}
|
||||
}
|
||||
|
||||
test("default dock shows prompt input", async ({ page, sdk, gotoSession }) => {
|
||||
await withDockSession(sdk, "e2e composer dock default", async (session) => {
|
||||
await gotoSession(session.id)
|
||||
|
||||
await expect(page.locator(sessionComposerDockSelector)).toBeVisible()
|
||||
await expect(page.locator(promptSelector)).toBeVisible()
|
||||
await expect(page.locator(questionDockSelector)).toHaveCount(0)
|
||||
await expect(page.locator(permissionDockSelector)).toHaveCount(0)
|
||||
|
||||
await page.locator(promptSelector).click()
|
||||
await expect(page.locator(promptSelector)).toBeFocused()
|
||||
})
|
||||
})
|
||||
|
||||
test("blocked question flow unblocks after submit", async ({ page, sdk, gotoSession }) => {
|
||||
await withDockSession(sdk, "e2e composer dock question", async (session) => {
|
||||
await withDockSeed(sdk, session.id, async () => {
|
||||
await gotoSession(session.id)
|
||||
|
||||
await seedSessionQuestion(sdk, {
|
||||
sessionID: session.id,
|
||||
questions: [
|
||||
{
|
||||
header: "Need input",
|
||||
question: "Pick one option",
|
||||
options: [
|
||||
{ label: "Continue", description: "Continue now" },
|
||||
{ label: "Stop", description: "Stop here" },
|
||||
],
|
||||
},
|
||||
],
|
||||
})
|
||||
|
||||
const dock = page.locator(questionDockSelector)
|
||||
await expect.poll(() => dock.count(), { timeout: 10_000 }).toBe(1)
|
||||
await expect(page.locator(promptSelector)).toHaveCount(0)
|
||||
|
||||
await dock.locator('[data-slot="question-option"]').first().click()
|
||||
await dock.getByRole("button", { name: /submit/i }).click()
|
||||
|
||||
await expect.poll(() => page.locator(questionDockSelector).count(), { timeout: 10_000 }).toBe(0)
|
||||
await expect(page.locator(promptSelector)).toBeVisible()
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
test("blocked permission flow supports allow once", async ({ page, sdk, gotoSession }) => {
|
||||
await withDockSession(sdk, "e2e composer dock permission once", async (session) => {
|
||||
await withDockSeed(sdk, session.id, async () => {
|
||||
await gotoSession(session.id)
|
||||
|
||||
await seedSessionPermission(sdk, {
|
||||
sessionID: session.id,
|
||||
permission: "bash",
|
||||
patterns: ["README.md"],
|
||||
description: "Need permission for command",
|
||||
})
|
||||
|
||||
await expect.poll(() => page.locator(permissionDockSelector).count(), { timeout: 10_000 }).toBe(1)
|
||||
await expect(page.locator(promptSelector)).toHaveCount(0)
|
||||
|
||||
await page
|
||||
.locator(permissionDockSelector)
|
||||
.getByRole("button", { name: /allow once/i })
|
||||
.click()
|
||||
await expect.poll(() => page.locator(permissionDockSelector).count(), { timeout: 10_000 }).toBe(0)
|
||||
await expect(page.locator(promptSelector)).toBeVisible()
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
test("blocked permission flow supports reject", async ({ page, sdk, gotoSession }) => {
|
||||
await withDockSession(sdk, "e2e composer dock permission reject", async (session) => {
|
||||
await withDockSeed(sdk, session.id, async () => {
|
||||
await gotoSession(session.id)
|
||||
|
||||
await seedSessionPermission(sdk, {
|
||||
sessionID: session.id,
|
||||
permission: "bash",
|
||||
patterns: ["REJECT.md"],
|
||||
})
|
||||
|
||||
await expect.poll(() => page.locator(permissionDockSelector).count(), { timeout: 10_000 }).toBe(1)
|
||||
await expect(page.locator(promptSelector)).toHaveCount(0)
|
||||
|
||||
await page.locator(permissionDockSelector).getByRole("button", { name: /deny/i }).click()
|
||||
await expect.poll(() => page.locator(permissionDockSelector).count(), { timeout: 10_000 }).toBe(0)
|
||||
await expect(page.locator(promptSelector)).toBeVisible()
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
test("blocked permission flow supports allow always", async ({ page, sdk, gotoSession }) => {
|
||||
await withDockSession(sdk, "e2e composer dock permission always", async (session) => {
|
||||
await withDockSeed(sdk, session.id, async () => {
|
||||
await gotoSession(session.id)
|
||||
|
||||
await seedSessionPermission(sdk, {
|
||||
sessionID: session.id,
|
||||
permission: "bash",
|
||||
patterns: ["README.md"],
|
||||
description: "Need permission for command",
|
||||
})
|
||||
|
||||
await expect.poll(() => page.locator(permissionDockSelector).count(), { timeout: 10_000 }).toBe(1)
|
||||
await expect(page.locator(promptSelector)).toHaveCount(0)
|
||||
|
||||
await page
|
||||
.locator(permissionDockSelector)
|
||||
.getByRole("button", { name: /allow always/i })
|
||||
.click()
|
||||
await expect.poll(() => page.locator(permissionDockSelector).count(), { timeout: 10_000 }).toBe(0)
|
||||
await expect(page.locator(promptSelector)).toBeVisible()
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
test("todo dock transitions and collapse behavior", async ({ page, sdk, gotoSession }) => {
|
||||
await withDockSession(sdk, "e2e composer dock todo", async (session) => {
|
||||
await withDockSeed(sdk, session.id, async () => {
|
||||
await gotoSession(session.id)
|
||||
|
||||
await seedSessionTodos(sdk, {
|
||||
sessionID: session.id,
|
||||
todos: [
|
||||
{ content: "first task", status: "pending", priority: "high" },
|
||||
{ content: "second task", status: "in_progress", priority: "medium" },
|
||||
],
|
||||
})
|
||||
|
||||
await expect.poll(() => page.locator(sessionTodoDockSelector).count(), { timeout: 10_000 }).toBe(1)
|
||||
await expect(page.locator(sessionTodoListSelector)).toBeVisible()
|
||||
|
||||
await page.locator(sessionTodoToggleButtonSelector).click()
|
||||
await expect(page.locator(sessionTodoListSelector)).toBeHidden()
|
||||
|
||||
await page.locator(sessionTodoToggleButtonSelector).click()
|
||||
await expect(page.locator(sessionTodoListSelector)).toBeVisible()
|
||||
|
||||
await seedSessionTodos(sdk, {
|
||||
sessionID: session.id,
|
||||
todos: [
|
||||
{ content: "first task", status: "completed", priority: "high" },
|
||||
{ content: "second task", status: "cancelled", priority: "medium" },
|
||||
],
|
||||
})
|
||||
|
||||
await expect.poll(() => page.locator(sessionTodoDockSelector).count(), { timeout: 10_000 }).toBe(0)
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
test("keyboard focus stays off prompt while blocked", async ({ page, sdk, gotoSession }) => {
|
||||
await withDockSession(sdk, "e2e composer dock keyboard", async (session) => {
|
||||
await withDockSeed(sdk, session.id, async () => {
|
||||
await gotoSession(session.id)
|
||||
|
||||
await seedSessionQuestion(sdk, {
|
||||
sessionID: session.id,
|
||||
questions: [
|
||||
{
|
||||
header: "Need input",
|
||||
question: "Pick one option",
|
||||
options: [{ label: "Continue", description: "Continue now" }],
|
||||
},
|
||||
],
|
||||
})
|
||||
|
||||
await expect.poll(() => page.locator(questionDockSelector).count(), { timeout: 10_000 }).toBe(1)
|
||||
await expect(page.locator(promptSelector)).toHaveCount(0)
|
||||
|
||||
await page.locator("main").click({ position: { x: 5, y: 5 } })
|
||||
await page.keyboard.type("abc")
|
||||
await expect(page.locator(promptSelector)).toHaveCount(0)
|
||||
})
|
||||
})
|
||||
})
|
||||
@@ -44,7 +44,7 @@ test("session can be renamed via header menu", async ({ page, sdk, gotoSession }
|
||||
const menu = await openSessionMoreMenu(page, session.id)
|
||||
await clickMenuItem(menu, /rename/i)
|
||||
|
||||
const input = page.locator(".scroll-view__viewport").locator(inlineInputSelector).first()
|
||||
const input = page.locator(".session-scroller").locator(inlineInputSelector).first()
|
||||
await expect(input).toBeVisible()
|
||||
await expect(input).toBeFocused()
|
||||
await input.fill(renamedTitle)
|
||||
|
||||
@@ -6,7 +6,6 @@ test("smoke terminal mounts and can create a second tab", async ({ page, gotoSes
|
||||
await gotoSession()
|
||||
|
||||
const terminals = page.locator(terminalSelector)
|
||||
const tabs = page.locator('#terminal-panel [data-slot="tabs-trigger"]')
|
||||
const opened = await terminals.first().isVisible()
|
||||
|
||||
if (!opened) {
|
||||
@@ -22,7 +21,6 @@ test("smoke terminal mounts and can create a second tab", async ({ page, gotoSes
|
||||
await page.locator(promptSelector).click()
|
||||
await page.keyboard.press("Control+Alt+T")
|
||||
|
||||
await expect(tabs).toHaveCount(2)
|
||||
await expect(terminals).toHaveCount(1)
|
||||
await expect(terminals.first().locator("textarea")).toHaveCount(1)
|
||||
await expect(terminals).toHaveCount(2)
|
||||
await expect(terminals.nth(1).locator("textarea")).toHaveCount(1)
|
||||
})
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/app",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"description": "",
|
||||
"type": "module",
|
||||
"exports": {
|
||||
|
||||
@@ -20,7 +20,6 @@ import { useParams } from "@solidjs/router"
|
||||
import { useSync } from "@/context/sync"
|
||||
import { useComments } from "@/context/comments"
|
||||
import { Button } from "@opencode-ai/ui/button"
|
||||
import { DockShellForm, DockTray } from "@opencode-ai/ui/dock-surface"
|
||||
import { Icon } from "@opencode-ai/ui/icon"
|
||||
import { ProviderIcon } from "@opencode-ai/ui/provider-icon"
|
||||
import type { IconName } from "@opencode-ai/ui/icons/provider"
|
||||
@@ -89,8 +88,6 @@ const EXAMPLES = [
|
||||
"prompt.example.25",
|
||||
] as const
|
||||
|
||||
const NON_EMPTY_TEXT = /[^\s\u200B]/
|
||||
|
||||
export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
const sdk = useSDK()
|
||||
const sync = useSync()
|
||||
@@ -638,9 +635,7 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
let buffer = ""
|
||||
|
||||
const flushText = () => {
|
||||
let content = buffer
|
||||
if (content.includes("\r")) content = content.replace(/\r\n?/g, "\n")
|
||||
if (content.includes("\u200B")) content = content.replace(/\u200B/g, "")
|
||||
const content = buffer.replace(/\r\n?/g, "\n").replace(/\u200B/g, "")
|
||||
buffer = ""
|
||||
if (!content) return
|
||||
parts.push({ type: "text", content, start: position, end: position + content.length })
|
||||
@@ -718,12 +713,10 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
const rawParts = parseFromDOM()
|
||||
const images = imageAttachments()
|
||||
const cursorPosition = getCursorPosition(editorRef)
|
||||
const rawText =
|
||||
rawParts.length === 1 && rawParts[0]?.type === "text"
|
||||
? rawParts[0].content
|
||||
: rawParts.map((p) => ("content" in p ? p.content : "")).join("")
|
||||
const rawText = rawParts.map((p) => ("content" in p ? p.content : "")).join("")
|
||||
const trimmed = rawText.replace(/\u200B/g, "").trim()
|
||||
const hasNonText = rawParts.some((part) => part.type !== "text")
|
||||
const shouldReset = !NON_EMPTY_TEXT.test(rawText) && !hasNonText && images.length === 0
|
||||
const shouldReset = trimmed.length === 0 && !hasNonText && images.length === 0
|
||||
|
||||
if (shouldReset) {
|
||||
closePopover()
|
||||
@@ -763,31 +756,19 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
}
|
||||
|
||||
const addPart = (part: ContentPart) => {
|
||||
if (part.type === "image") return false
|
||||
|
||||
const selection = window.getSelection()
|
||||
if (!selection) return false
|
||||
if (!selection || selection.rangeCount === 0) return
|
||||
|
||||
if (selection.rangeCount === 0 || !editorRef.contains(selection.anchorNode)) {
|
||||
editorRef.focus()
|
||||
const cursor = prompt.cursor() ?? promptLength(prompt.current())
|
||||
setCursorPosition(editorRef, cursor)
|
||||
}
|
||||
|
||||
if (selection.rangeCount === 0) return false
|
||||
const range = selection.getRangeAt(0)
|
||||
if (!editorRef.contains(range.startContainer)) return false
|
||||
const cursorPosition = getCursorPosition(editorRef)
|
||||
const currentPrompt = prompt.current()
|
||||
const rawText = currentPrompt.map((p) => ("content" in p ? p.content : "")).join("")
|
||||
const textBeforeCursor = rawText.substring(0, cursorPosition)
|
||||
const atMatch = textBeforeCursor.match(/@(\S*)$/)
|
||||
|
||||
if (part.type === "file" || part.type === "agent") {
|
||||
const cursorPosition = getCursorPosition(editorRef)
|
||||
const rawText = prompt
|
||||
.current()
|
||||
.map((p) => ("content" in p ? p.content : ""))
|
||||
.join("")
|
||||
const textBeforeCursor = rawText.substring(0, cursorPosition)
|
||||
const atMatch = textBeforeCursor.match(/@(\S*)$/)
|
||||
const pill = createPill(part)
|
||||
const gap = document.createTextNode(" ")
|
||||
const range = selection.getRangeAt(0)
|
||||
|
||||
if (atMatch) {
|
||||
const start = atMatch.index ?? cursorPosition - atMatch[0].length
|
||||
@@ -802,9 +783,8 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
range.collapse(true)
|
||||
selection.removeAllRanges()
|
||||
selection.addRange(range)
|
||||
}
|
||||
|
||||
if (part.type === "text") {
|
||||
} else if (part.type === "text") {
|
||||
const range = selection.getRangeAt(0)
|
||||
const fragment = createTextFragment(part.content)
|
||||
const last = fragment.lastChild
|
||||
range.deleteContents()
|
||||
@@ -840,7 +820,6 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
|
||||
handleInput()
|
||||
closePopover()
|
||||
return true
|
||||
}
|
||||
|
||||
const addToHistory = (prompt: Prompt, mode: "normal" | "shell") => {
|
||||
@@ -1066,11 +1045,12 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
commandKeybind={command.keybind}
|
||||
t={(key) => language.t(key as Parameters<typeof language.t>[0])}
|
||||
/>
|
||||
<DockShellForm
|
||||
<form
|
||||
onSubmit={handleSubmit}
|
||||
classList={{
|
||||
"group/prompt-input": true,
|
||||
"focus-within:shadow-xs-border": true,
|
||||
"bg-surface-raised-stronger-non-alpha shadow-xs-border relative z-10": true,
|
||||
"rounded-[12px] overflow-clip focus-within:shadow-xs-border": true,
|
||||
"border-icon-info-active border-dashed": store.draggingType !== null,
|
||||
[props.class ?? ""]: !!props.class,
|
||||
}}
|
||||
@@ -1263,10 +1243,10 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
</div>
|
||||
</Show>
|
||||
</div>
|
||||
</DockShellForm>
|
||||
</form>
|
||||
<Show when={store.mode === "normal" || store.mode === "shell"}>
|
||||
<DockTray attach="top">
|
||||
<div class="px-1.75 pt-5.5 pb-2 flex items-center gap-2 min-w-0">
|
||||
<div class="-mt-3.5 bg-background-base border border-border-weak-base relative z-0 rounded-[12px] rounded-tl-0 rounded-tr-0 overflow-clip">
|
||||
<div class="px-2 pt-5.5 pb-2 flex items-center gap-2 min-w-0">
|
||||
<div class="flex items-center gap-1.5 min-w-0 flex-1">
|
||||
<Show when={store.mode === "shell"}>
|
||||
<div class="h-7 flex items-center gap-1.5 max-w-[160px] min-w-0" style={{ padding: "0 4px 0 8px" }}>
|
||||
@@ -1274,6 +1254,7 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
<div class="size-4 shrink-0" />
|
||||
</div>
|
||||
</Show>
|
||||
|
||||
<Show when={store.mode === "normal"}>
|
||||
<TooltipKeybind
|
||||
placement="top"
|
||||
@@ -1373,7 +1354,7 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
</TooltipKeybind>
|
||||
</Show>
|
||||
</div>
|
||||
<div class="shrink-0">
|
||||
<div class="shrink-0" data-component="prompt-mode-toggle">
|
||||
<RadioGroup
|
||||
options={["shell", "normal"] as const}
|
||||
current={store.mode}
|
||||
@@ -1404,7 +1385,7 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
/>
|
||||
</div>
|
||||
</div>
|
||||
</DockTray>
|
||||
</div>
|
||||
</Show>
|
||||
</div>
|
||||
)
|
||||
|
||||
@@ -7,19 +7,6 @@ import { getCursorPosition } from "./editor-dom"
|
||||
|
||||
export const ACCEPTED_IMAGE_TYPES = ["image/png", "image/jpeg", "image/gif", "image/webp"]
|
||||
export const ACCEPTED_FILE_TYPES = [...ACCEPTED_IMAGE_TYPES, "application/pdf"]
|
||||
const LARGE_PASTE_CHARS = 8000
|
||||
const LARGE_PASTE_BREAKS = 120
|
||||
|
||||
function largePaste(text: string) {
|
||||
if (text.length >= LARGE_PASTE_CHARS) return true
|
||||
let breaks = 0
|
||||
for (const char of text) {
|
||||
if (char !== "\n") continue
|
||||
breaks += 1
|
||||
if (breaks >= LARGE_PASTE_BREAKS) return true
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type PromptAttachmentsInput = {
|
||||
editor: () => HTMLDivElement | undefined
|
||||
@@ -27,7 +14,7 @@ type PromptAttachmentsInput = {
|
||||
isDialogActive: () => boolean
|
||||
setDraggingType: (type: "image" | "@mention" | null) => void
|
||||
focusEditor: () => void
|
||||
addPart: (part: ContentPart) => boolean
|
||||
addPart: (part: ContentPart) => void
|
||||
readClipboardImage?: () => Promise<File | null>
|
||||
}
|
||||
|
||||
@@ -102,13 +89,6 @@ export function createPromptAttachments(input: PromptAttachmentsInput) {
|
||||
}
|
||||
|
||||
if (!plainText) return
|
||||
|
||||
if (largePaste(plainText)) {
|
||||
if (input.addPart({ type: "text", content: plainText, start: 0, end: 0 })) return
|
||||
input.focusEditor()
|
||||
if (input.addPart({ type: "text", content: plainText, start: 0, end: 0 })) return
|
||||
}
|
||||
|
||||
const inserted = typeof document.execCommand === "function" && document.execCommand("insertText", false, plainText)
|
||||
if (inserted) return
|
||||
|
||||
|
||||
@@ -24,28 +24,6 @@ describe("prompt-input editor dom", () => {
|
||||
expect((container.childNodes[1] as HTMLElement).tagName).toBe("BR")
|
||||
})
|
||||
|
||||
test("createTextFragment avoids break-node explosion for large multiline content", () => {
|
||||
const content = Array.from({ length: 220 }, () => "line").join("\n")
|
||||
const fragment = createTextFragment(content)
|
||||
const container = document.createElement("div")
|
||||
container.appendChild(fragment)
|
||||
|
||||
expect(container.childNodes.length).toBe(1)
|
||||
expect(container.childNodes[0]?.nodeType).toBe(Node.TEXT_NODE)
|
||||
expect(container.textContent).toBe(content)
|
||||
})
|
||||
|
||||
test("createTextFragment keeps terminal break in large multiline fallback", () => {
|
||||
const content = `${Array.from({ length: 220 }, () => "line").join("\n")}\n`
|
||||
const fragment = createTextFragment(content)
|
||||
const container = document.createElement("div")
|
||||
container.appendChild(fragment)
|
||||
|
||||
expect(container.childNodes.length).toBe(2)
|
||||
expect(container.childNodes[0]?.textContent).toBe(content.slice(0, -1))
|
||||
expect((container.childNodes[1] as HTMLElement).tagName).toBe("BR")
|
||||
})
|
||||
|
||||
test("length helpers treat breaks as one char and ignore zero-width chars", () => {
|
||||
const container = document.createElement("div")
|
||||
container.appendChild(document.createTextNode("ab\u200B"))
|
||||
|
||||
@@ -1,20 +1,5 @@
|
||||
const MAX_BREAKS = 200
|
||||
|
||||
export function createTextFragment(content: string): DocumentFragment {
|
||||
const fragment = document.createDocumentFragment()
|
||||
let breaks = 0
|
||||
for (const char of content) {
|
||||
if (char !== "\n") continue
|
||||
breaks += 1
|
||||
if (breaks > MAX_BREAKS) {
|
||||
const tail = content.endsWith("\n")
|
||||
const text = tail ? content.slice(0, -1) : content
|
||||
if (text) fragment.appendChild(document.createTextNode(text))
|
||||
if (tail) fragment.appendChild(document.createElement("br"))
|
||||
return fragment
|
||||
}
|
||||
}
|
||||
|
||||
const segments = content.split("\n")
|
||||
segments.forEach((segment, index) => {
|
||||
if (segment) {
|
||||
|
||||
@@ -73,16 +73,12 @@ export function createPromptSubmit(input: PromptSubmitInput) {
|
||||
const abort = async () => {
|
||||
const sessionID = params.id
|
||||
if (!sessionID) return Promise.resolve()
|
||||
|
||||
globalSync.todo.set(sessionID, [])
|
||||
const [, setStore] = globalSync.child(sdk.directory)
|
||||
setStore("todo", sessionID, [])
|
||||
|
||||
const queued = pending.get(sessionID)
|
||||
if (queued) {
|
||||
queued.abort.abort()
|
||||
queued.cleanup()
|
||||
pending.delete(sessionID)
|
||||
globalSync.todo.set(sessionID, undefined)
|
||||
return Promise.resolve()
|
||||
}
|
||||
return sdk.client.session
|
||||
@@ -90,6 +86,9 @@ export function createPromptSubmit(input: PromptSubmitInput) {
|
||||
sessionID,
|
||||
})
|
||||
.catch(() => {})
|
||||
.finally(() => {
|
||||
globalSync.todo.set(sessionID, undefined)
|
||||
})
|
||||
}
|
||||
|
||||
const restoreCommentItems = (items: CommentItem[]) => {
|
||||
|
||||
@@ -8,7 +8,7 @@ import type { QuestionAnswer, QuestionRequest } from "@opencode-ai/sdk/v2"
|
||||
import { useLanguage } from "@/context/language"
|
||||
import { useSDK } from "@/context/sdk"
|
||||
|
||||
export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit: () => void }> = (props) => {
|
||||
export const QuestionDock: Component<{ request: QuestionRequest }> = (props) => {
|
||||
const sdk = useSDK()
|
||||
const language = useLanguage()
|
||||
|
||||
@@ -62,7 +62,7 @@ export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit
|
||||
const measure = () => {
|
||||
if (!root) return
|
||||
|
||||
const scroller = document.querySelector(".scroll-view__viewport")
|
||||
const scroller = document.querySelector(".session-scroller")
|
||||
const head = scroller instanceof HTMLElement ? scroller.firstElementChild : undefined
|
||||
const top =
|
||||
head instanceof HTMLElement && head.classList.contains("sticky") ? head.getBoundingClientRect().bottom : 0
|
||||
@@ -95,7 +95,7 @@ export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit
|
||||
window.addEventListener("resize", update)
|
||||
|
||||
const dock = root?.closest('[data-component="session-prompt-dock"]')
|
||||
const scroller = document.querySelector(".scroll-view__viewport")
|
||||
const scroller = document.querySelector(".session-scroller")
|
||||
const observer = new ResizeObserver(update)
|
||||
if (dock instanceof HTMLElement) observer.observe(dock)
|
||||
if (scroller instanceof HTMLElement) observer.observe(scroller)
|
||||
@@ -115,7 +115,6 @@ export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit
|
||||
const reply = async (answers: QuestionAnswer[]) => {
|
||||
if (store.sending) return
|
||||
|
||||
props.onSubmit()
|
||||
setStore("sending", true)
|
||||
try {
|
||||
await sdk.client.question.reply({ requestID: props.request.id, answers })
|
||||
@@ -129,7 +128,6 @@ export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit
|
||||
const reject = async () => {
|
||||
if (store.sending) return
|
||||
|
||||
props.onSubmit()
|
||||
setStore("sending", true)
|
||||
try {
|
||||
await sdk.client.question.reject({ requestID: props.request.id })
|
||||
@@ -1,6 +1,5 @@
|
||||
import type { Todo } from "@opencode-ai/sdk/v2"
|
||||
import { Checkbox } from "@opencode-ai/ui/checkbox"
|
||||
import { DockTray } from "@opencode-ai/ui/dock-surface"
|
||||
import { IconButton } from "@opencode-ai/ui/icon-button"
|
||||
import { For, Show, createEffect, createMemo, createSignal, on, onCleanup } from "solid-js"
|
||||
import { createStore } from "solid-js/store"
|
||||
@@ -55,14 +54,13 @@ export function SessionTodoDock(props: { todos: Todo[]; title: string; collapseL
|
||||
const preview = createMemo(() => active()?.content ?? "")
|
||||
|
||||
return (
|
||||
<DockTray
|
||||
data-component="session-todo-dock"
|
||||
<div
|
||||
classList={{
|
||||
"bg-background-base border border-border-weak-base relative z-0 rounded-[12px] overflow-clip": true,
|
||||
"h-[78px]": store.collapsed,
|
||||
}}
|
||||
>
|
||||
<div
|
||||
data-action="session-todo-toggle"
|
||||
class="pl-3 pr-2 py-2 flex items-center gap-2"
|
||||
role="button"
|
||||
tabIndex={0}
|
||||
@@ -83,7 +81,6 @@ export function SessionTodoDock(props: { todos: Todo[]; title: string; collapseL
|
||||
</Show>
|
||||
<div classList={{ "ml-auto": !store.collapsed, "ml-1": store.collapsed }}>
|
||||
<IconButton
|
||||
data-action="session-todo-toggle-button"
|
||||
icon="chevron-down"
|
||||
size="normal"
|
||||
variant="ghost"
|
||||
@@ -101,10 +98,10 @@ export function SessionTodoDock(props: { todos: Todo[]; title: string; collapseL
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div data-slot="session-todo-list" hidden={store.collapsed}>
|
||||
<div hidden={store.collapsed}>
|
||||
<TodoList todos={props.todos} open={!store.collapsed} />
|
||||
</div>
|
||||
</DockTray>
|
||||
</div>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -11,7 +11,6 @@ import { Accordion } from "@opencode-ai/ui/accordion"
|
||||
import { StickyAccordionHeader } from "@opencode-ai/ui/sticky-accordion-header"
|
||||
import { Code } from "@opencode-ai/ui/code"
|
||||
import { Markdown } from "@opencode-ai/ui/markdown"
|
||||
import { ScrollView } from "@opencode-ai/ui/scroll-view"
|
||||
import type { Message, Part, UserMessage } from "@opencode-ai/sdk/v2/client"
|
||||
import { useLanguage } from "@/context/language"
|
||||
import { getSessionContextMetrics } from "./session-context-metrics"
|
||||
@@ -269,9 +268,9 @@ export function SessionContextTab() {
|
||||
})
|
||||
|
||||
return (
|
||||
<ScrollView
|
||||
class="@container h-full pb-10"
|
||||
viewportRef={(el) => {
|
||||
<div
|
||||
class="@container h-full overflow-y-auto no-scrollbar pb-10"
|
||||
ref={(el) => {
|
||||
scroll = el
|
||||
restoreScroll()
|
||||
}}
|
||||
@@ -337,6 +336,6 @@ export function SessionContextTab() {
|
||||
</Accordion>
|
||||
</div>
|
||||
</div>
|
||||
</ScrollView>
|
||||
</div>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -250,18 +250,6 @@ export const SettingsGeneral: Component = () => {
|
||||
)}
|
||||
</Select>
|
||||
</SettingsRow>
|
||||
|
||||
<SettingsRow
|
||||
title={language.t("settings.general.row.reasoningSummaries.title")}
|
||||
description={language.t("settings.general.row.reasoningSummaries.description")}
|
||||
>
|
||||
<div data-action="settings-reasoning-summaries">
|
||||
<Switch
|
||||
checked={settings.general.showReasoningSummaries()}
|
||||
onChange={(checked) => settings.general.setShowReasoningSummaries(checked)}
|
||||
/>
|
||||
</div>
|
||||
</SettingsRow>
|
||||
</div>
|
||||
</div>
|
||||
)
|
||||
@@ -430,7 +418,7 @@ export const SettingsGeneral: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-1 pt-6 pb-8">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.tab.general")}</h2>
|
||||
</div>
|
||||
|
||||
@@ -370,7 +370,7 @@ export const SettingsKeybinds: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-4 pt-6 pb-6 max-w-[720px]">
|
||||
<div class="flex items-center justify-between gap-4">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.shortcuts.title")}</h2>
|
||||
|
||||
@@ -59,7 +59,7 @@ export const SettingsModels: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-4 pt-6 pb-6 max-w-[720px]">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.models.title")}</h2>
|
||||
<div class="flex items-center gap-2 px-3 h-9 rounded-lg bg-surface-base">
|
||||
|
||||
@@ -177,7 +177,7 @@ export const SettingsPermissions: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-1 px-4 py-8 sm:p-8 max-w-[720px]">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.permissions.title")}</h2>
|
||||
<p class="text-14-regular text-text-weak">{language.t("settings.permissions.description")}</p>
|
||||
|
||||
@@ -132,7 +132,7 @@ export const SettingsProviders: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-1 pt-6 pb-8 max-w-[720px]">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.providers.title")}</h2>
|
||||
</div>
|
||||
|
||||
@@ -540,7 +540,7 @@ export const Terminal = (props: TerminalProps) => {
|
||||
disposed = true
|
||||
if (fitFrame !== undefined) cancelAnimationFrame(fitFrame)
|
||||
if (sizeTimer !== undefined) clearTimeout(sizeTimer)
|
||||
if (ws && ws.readyState !== WebSocket.CLOSED && ws.readyState !== WebSocket.CLOSING) ws.close(1000)
|
||||
if (ws && ws.readyState !== WebSocket.CLOSED && ws.readyState !== WebSocket.CLOSING) ws.close()
|
||||
|
||||
const finalize = () => {
|
||||
persistTerminal({ term, addon: serializeAddon, cursor, pty: local.pty, onCleanup: props.onCleanup })
|
||||
|
||||
@@ -24,13 +24,9 @@ export function serverDisplayName(conn?: ServerConnection.Any) {
|
||||
function projectsKey(key: ServerConnection.Key) {
|
||||
if (!key) return ""
|
||||
if (key === "sidecar") return "local"
|
||||
if (isLocalHost(key)) return "local"
|
||||
return key
|
||||
}
|
||||
|
||||
function isLocalHost(url: string) {
|
||||
const host = url.replace(/^https?:\/\//, "").split(":")[0]
|
||||
const host = key.replace(/^https?:\/\//, "").split(":")[0]
|
||||
if (host === "localhost" || host === "127.0.0.1") return "local"
|
||||
return key
|
||||
}
|
||||
|
||||
export namespace ServerConnection {
|
||||
@@ -201,7 +197,7 @@ export const { use: useServer, provider: ServerProvider } = createSimpleContext(
|
||||
)
|
||||
const isLocal = createMemo(() => {
|
||||
const c = current()
|
||||
return (c?.type === "sidecar" && c.variant === "base") || (c?.type === "http" && isLocalHost(c.http.url))
|
||||
return c?.type === "sidecar" && c.variant === "base"
|
||||
})
|
||||
|
||||
return {
|
||||
|
||||
@@ -22,7 +22,6 @@ export interface Settings {
|
||||
general: {
|
||||
autoSave: boolean
|
||||
releaseNotes: boolean
|
||||
showReasoningSummaries: boolean
|
||||
}
|
||||
updates: {
|
||||
startup: boolean
|
||||
@@ -43,7 +42,6 @@ const defaultSettings: Settings = {
|
||||
general: {
|
||||
autoSave: true,
|
||||
releaseNotes: true,
|
||||
showReasoningSummaries: false,
|
||||
},
|
||||
updates: {
|
||||
startup: true,
|
||||
@@ -122,13 +120,6 @@ export const { use: useSettings, provider: SettingsProvider } = createSimpleCont
|
||||
setReleaseNotes(value: boolean) {
|
||||
setStore("general", "releaseNotes", value)
|
||||
},
|
||||
showReasoningSummaries: withFallback(
|
||||
() => store.general?.showReasoningSummaries,
|
||||
defaultSettings.general.showReasoningSummaries,
|
||||
),
|
||||
setShowReasoningSummaries(value: boolean) {
|
||||
setStore("general", "showReasoningSummaries", value)
|
||||
},
|
||||
},
|
||||
updates: {
|
||||
startup: withFallback(() => store.updates?.startup, defaultSettings.updates.startup),
|
||||
|
||||
@@ -610,8 +610,6 @@ export const dict = {
|
||||
"settings.general.row.theme.description": "Customise how OpenCode is themed.",
|
||||
"settings.general.row.font.title": "Font",
|
||||
"settings.general.row.font.description": "Customise the mono font used in code blocks",
|
||||
"settings.general.row.reasoningSummaries.title": "Show reasoning summaries",
|
||||
"settings.general.row.reasoningSummaries.description": "Display model reasoning summaries in the timeline",
|
||||
|
||||
"settings.general.row.wayland.title": "Use native Wayland",
|
||||
"settings.general.row.wayland.description": "Disable X11 fallback on Wayland. Requires restart.",
|
||||
|
||||
@@ -527,8 +527,8 @@ export const dict = {
|
||||
"settings.tab.general": "一般",
|
||||
"settings.tab.shortcuts": "ショートカット",
|
||||
"settings.desktop.section.wsl": "WSL",
|
||||
"settings.desktop.wsl.title": "WSL連携",
|
||||
"settings.desktop.wsl.description": "WindowsのWSL環境でOpenCodeサーバーを実行します。",
|
||||
"settings.desktop.wsl.title": "WSL統合",
|
||||
"settings.desktop.wsl.description": "Windows上のWSL内でOpenCodeサーバーを実行します。",
|
||||
"settings.general.section.appearance": "外観",
|
||||
"settings.general.section.notifications": "システム通知",
|
||||
"settings.general.section.updates": "アップデート",
|
||||
|
||||
@@ -81,7 +81,7 @@ export default function Layout(props: ParentProps) {
|
||||
const [store, setStore, , ready] = persisted(
|
||||
Persist.global("layout.page", ["layout.page.v1"]),
|
||||
createStore({
|
||||
lastProjectSession: {} as { [directory: string]: { directory: string; id: string; at: number } },
|
||||
lastSession: {} as { [directory: string]: string },
|
||||
activeProject: undefined as string | undefined,
|
||||
activeWorkspace: undefined as string | undefined,
|
||||
workspaceOrder: {} as Record<string, string[]>,
|
||||
@@ -1074,37 +1074,11 @@ export default function Layout(props: ParentProps) {
|
||||
dialog.show(() => <DialogSettings />)
|
||||
}
|
||||
|
||||
function projectRoot(directory: string) {
|
||||
const project = layout.projects
|
||||
.list()
|
||||
.find((item) => item.worktree === directory || item.sandboxes?.includes(directory))
|
||||
if (project) return project.worktree
|
||||
|
||||
const known = Object.entries(store.workspaceOrder).find(
|
||||
([root, dirs]) => root === directory || dirs.includes(directory),
|
||||
)
|
||||
if (known) return known[0]
|
||||
|
||||
const [child] = globalSync.child(directory, { bootstrap: false })
|
||||
const id = child.project
|
||||
if (!id) return directory
|
||||
|
||||
const meta = globalSync.data.project.find((item) => item.id === id)
|
||||
return meta?.worktree ?? directory
|
||||
}
|
||||
|
||||
function navigateToProject(directory: string | undefined) {
|
||||
if (!directory) return
|
||||
const root = projectRoot(directory)
|
||||
server.projects.touch(root)
|
||||
|
||||
const projectSession = store.lastProjectSession[root]
|
||||
if (projectSession?.id) {
|
||||
navigateWithSidebarReset(`/${base64Encode(projectSession.directory)}/session/${projectSession.id}`)
|
||||
return
|
||||
}
|
||||
|
||||
navigateWithSidebarReset(`/${base64Encode(root)}/session`)
|
||||
server.projects.touch(directory)
|
||||
const lastSession = store.lastSession[directory]
|
||||
navigateWithSidebarReset(`/${base64Encode(directory)}${lastSession ? `/session/${lastSession}` : ""}`)
|
||||
}
|
||||
|
||||
function navigateToSession(session: Session | undefined) {
|
||||
@@ -1458,8 +1432,7 @@ export default function Layout(props: ParentProps) {
|
||||
if (!dir || !id) return
|
||||
const directory = decode64(dir)
|
||||
if (!directory) return
|
||||
const at = Date.now()
|
||||
setStore("lastProjectSession", projectRoot(directory), { directory, id, at })
|
||||
setStore("lastSession", directory, id)
|
||||
notification.session.markViewed(id)
|
||||
const expanded = untrack(() => store.workspaceExpanded[directory])
|
||||
if (expanded === false) {
|
||||
|
||||
@@ -166,7 +166,7 @@ const SessionHoverPreview = (props: {
|
||||
when={props.hoverReady()}
|
||||
fallback={<div class="text-12-regular text-text-weak">{props.language.t("session.messages.loading")}</div>}
|
||||
>
|
||||
<div class="overflow-y-auto overflow-x-hidden max-h-72 h-full">
|
||||
<div class="overflow-y-auto max-h-72 h-full">
|
||||
<MessageNav
|
||||
messages={props.hoverMessages() ?? []}
|
||||
current={undefined}
|
||||
|
||||
@@ -27,7 +27,7 @@ import { SessionReviewTab, type DiffStyle, type SessionReviewTabProps } from "@/
|
||||
import { TerminalPanel } from "@/pages/session/terminal-panel"
|
||||
import { MessageTimeline } from "@/pages/session/message-timeline"
|
||||
import { useSessionCommands } from "@/pages/session/use-session-commands"
|
||||
import { SessionComposerRegion, createSessionComposerState } from "@/pages/session/composer"
|
||||
import { SessionPromptDock } from "@/pages/session/session-prompt-dock"
|
||||
import { SessionMobileTabs } from "@/pages/session/session-mobile-tabs"
|
||||
import { SessionSidePanel } from "@/pages/session/session-side-panel"
|
||||
import { useSessionHashScroll } from "@/pages/session/use-session-hash-scroll"
|
||||
@@ -54,7 +54,11 @@ export default function Page() {
|
||||
},
|
||||
})
|
||||
|
||||
const composer = createSessionComposerState()
|
||||
const blocked = createMemo(() => {
|
||||
const sessionID = params.id
|
||||
if (!sessionID) return false
|
||||
return !!sync.data.permission[sessionID]?.[0] || !!sync.data.question[sessionID]?.[0]
|
||||
})
|
||||
|
||||
const sessionKey = createMemo(() => `${params.dir}${params.id ? "/" + params.id : ""}`)
|
||||
const workspaceKey = createMemo(() => params.dir ?? "")
|
||||
@@ -397,7 +401,7 @@ export default function Page() {
|
||||
}
|
||||
|
||||
if (event.key.length === 1 && event.key !== "Unidentified" && !(event.ctrlKey || event.metaKey)) {
|
||||
if (composer.blocked()) return
|
||||
if (blocked()) return
|
||||
inputRef?.focus()
|
||||
}
|
||||
}
|
||||
@@ -943,12 +947,15 @@ export default function Page() {
|
||||
if (next === dockHeight) return
|
||||
|
||||
const el = scroller
|
||||
const delta = next - dockHeight
|
||||
const stick = el ? el.scrollHeight - el.clientHeight - el.scrollTop < 10 + Math.max(0, delta) : false
|
||||
const stick = el ? el.scrollHeight - el.clientHeight - el.scrollTop < 10 : false
|
||||
|
||||
dockHeight = next
|
||||
|
||||
if (stick) autoScroll.forceScrollToBottom()
|
||||
if (stick && el) {
|
||||
requestAnimationFrame(() => {
|
||||
el.scrollTo({ top: el.scrollHeight, behavior: "auto" })
|
||||
})
|
||||
}
|
||||
|
||||
if (el) scheduleScrollState(el)
|
||||
scrollSpy.markDirty()
|
||||
@@ -1083,8 +1090,7 @@ export default function Page() {
|
||||
</Switch>
|
||||
</div>
|
||||
|
||||
<SessionComposerRegion
|
||||
state={composer}
|
||||
<SessionPromptDock
|
||||
centered={centered()}
|
||||
inputRef={(el) => {
|
||||
inputRef = el
|
||||
@@ -1095,7 +1101,6 @@ export default function Page() {
|
||||
comments.clear()
|
||||
resumeScroll()
|
||||
}}
|
||||
onResponseSubmit={resumeScroll}
|
||||
setPromptDockRef={(el) => {
|
||||
promptDock = el
|
||||
}}
|
||||
|
||||
@@ -1,3 +0,0 @@
|
||||
export { SessionComposerRegion } from "./session-composer-region"
|
||||
export { createSessionComposerBlocked, createSessionComposerState } from "./session-composer-state"
|
||||
export type { SessionComposerState } from "./session-composer-state"
|
||||
@@ -1,128 +0,0 @@
|
||||
import { Show, createEffect, createMemo } from "solid-js"
|
||||
import { useParams } from "@solidjs/router"
|
||||
import { PromptInput } from "@/components/prompt-input"
|
||||
import { useLanguage } from "@/context/language"
|
||||
import { usePrompt } from "@/context/prompt"
|
||||
import { getSessionHandoff, setSessionHandoff } from "@/pages/session/handoff"
|
||||
import { SessionPermissionDock } from "@/pages/session/composer/session-permission-dock"
|
||||
import { SessionQuestionDock } from "@/pages/session/composer/session-question-dock"
|
||||
import type { SessionComposerState } from "@/pages/session/composer/session-composer-state"
|
||||
import { SessionTodoDock } from "@/pages/session/composer/session-todo-dock"
|
||||
|
||||
export function SessionComposerRegion(props: {
|
||||
state: SessionComposerState
|
||||
centered: boolean
|
||||
inputRef: (el: HTMLDivElement) => void
|
||||
newSessionWorktree: string
|
||||
onNewSessionWorktreeReset: () => void
|
||||
onSubmit: () => void
|
||||
onResponseSubmit: () => void
|
||||
setPromptDockRef: (el: HTMLDivElement) => void
|
||||
}) {
|
||||
const params = useParams()
|
||||
const prompt = usePrompt()
|
||||
const language = useLanguage()
|
||||
|
||||
const sessionKey = createMemo(() => `${params.dir}${params.id ? "/" + params.id : ""}`)
|
||||
const handoffPrompt = createMemo(() => getSessionHandoff(sessionKey())?.prompt)
|
||||
|
||||
const previewPrompt = () =>
|
||||
prompt
|
||||
.current()
|
||||
.map((part) => {
|
||||
if (part.type === "file") return `[file:${part.path}]`
|
||||
if (part.type === "agent") return `@${part.name}`
|
||||
if (part.type === "image") return `[image:${part.filename}]`
|
||||
return part.content
|
||||
})
|
||||
.join("")
|
||||
.trim()
|
||||
|
||||
createEffect(() => {
|
||||
if (!prompt.ready()) return
|
||||
setSessionHandoff(sessionKey(), { prompt: previewPrompt() })
|
||||
})
|
||||
|
||||
return (
|
||||
<div
|
||||
ref={props.setPromptDockRef}
|
||||
data-component="session-prompt-dock"
|
||||
class="shrink-0 w-full pb-3 flex flex-col justify-center items-center bg-background-stronger pointer-events-none"
|
||||
>
|
||||
<div
|
||||
classList={{
|
||||
"w-full px-3 pointer-events-auto": true,
|
||||
"md:max-w-200 md:mx-auto 2xl:max-w-[1000px]": props.centered,
|
||||
}}
|
||||
>
|
||||
<Show when={props.state.questionRequest()} keyed>
|
||||
{(request) => (
|
||||
<div>
|
||||
<SessionQuestionDock request={request} onSubmit={props.onResponseSubmit} />
|
||||
</div>
|
||||
)}
|
||||
</Show>
|
||||
|
||||
<Show when={props.state.permissionRequest()} keyed>
|
||||
{(request) => (
|
||||
<div>
|
||||
<SessionPermissionDock
|
||||
request={request}
|
||||
responding={props.state.permissionResponding()}
|
||||
onDecide={(response) => {
|
||||
props.onResponseSubmit()
|
||||
props.state.decide(response)
|
||||
}}
|
||||
/>
|
||||
</div>
|
||||
)}
|
||||
</Show>
|
||||
|
||||
<Show when={!props.state.blocked()}>
|
||||
<Show
|
||||
when={prompt.ready()}
|
||||
fallback={
|
||||
<div class="w-full min-h-32 md:min-h-40 rounded-md border border-border-weak-base bg-background-base/50 px-4 py-3 text-text-weak whitespace-pre-wrap pointer-events-none">
|
||||
{handoffPrompt() || language.t("prompt.loading")}
|
||||
</div>
|
||||
}
|
||||
>
|
||||
<Show when={props.state.dock()}>
|
||||
<div
|
||||
classList={{
|
||||
"transition-[max-height,opacity,transform] duration-[400ms] ease-out overflow-hidden": true,
|
||||
"max-h-[320px]": !props.state.closing(),
|
||||
"max-h-0 pointer-events-none": props.state.closing(),
|
||||
"opacity-0 translate-y-9": props.state.closing() || props.state.opening(),
|
||||
"opacity-100 translate-y-0": !props.state.closing() && !props.state.opening(),
|
||||
}}
|
||||
>
|
||||
<SessionTodoDock
|
||||
todos={props.state.todos()}
|
||||
title={language.t("session.todo.title")}
|
||||
collapseLabel={language.t("session.todo.collapse")}
|
||||
expandLabel={language.t("session.todo.expand")}
|
||||
/>
|
||||
</div>
|
||||
</Show>
|
||||
<div
|
||||
classList={{
|
||||
"relative z-10": true,
|
||||
"transition-[margin] duration-[400ms] ease-out": true,
|
||||
"-mt-9": props.state.dock() && !props.state.closing(),
|
||||
"mt-0": !props.state.dock() || props.state.closing(),
|
||||
}}
|
||||
>
|
||||
<PromptInput
|
||||
ref={props.inputRef}
|
||||
newSessionWorktree={props.newSessionWorktree}
|
||||
onNewSessionWorktreeReset={props.onNewSessionWorktreeReset}
|
||||
onSubmit={props.onSubmit}
|
||||
/>
|
||||
</div>
|
||||
</Show>
|
||||
</Show>
|
||||
</div>
|
||||
</div>
|
||||
)
|
||||
}
|
||||
@@ -1,158 +0,0 @@
|
||||
import { createEffect, createMemo, on, onCleanup } from "solid-js"
|
||||
import { createStore } from "solid-js/store"
|
||||
import type { PermissionRequest, QuestionRequest, Todo } from "@opencode-ai/sdk/v2"
|
||||
import { useParams } from "@solidjs/router"
|
||||
import { showToast } from "@opencode-ai/ui/toast"
|
||||
import { useGlobalSync } from "@/context/global-sync"
|
||||
import { useLanguage } from "@/context/language"
|
||||
import { useSDK } from "@/context/sdk"
|
||||
import { useSync } from "@/context/sync"
|
||||
|
||||
export function createSessionComposerBlocked() {
|
||||
const params = useParams()
|
||||
const sync = useSync()
|
||||
return createMemo(() => {
|
||||
const id = params.id
|
||||
if (!id) return false
|
||||
return !!sync.data.permission[id]?.[0] || !!sync.data.question[id]?.[0]
|
||||
})
|
||||
}
|
||||
|
||||
export function createSessionComposerState() {
|
||||
const params = useParams()
|
||||
const sdk = useSDK()
|
||||
const sync = useSync()
|
||||
const globalSync = useGlobalSync()
|
||||
const language = useLanguage()
|
||||
|
||||
const questionRequest = createMemo((): QuestionRequest | undefined => {
|
||||
const id = params.id
|
||||
if (!id) return
|
||||
return sync.data.question[id]?.[0]
|
||||
})
|
||||
|
||||
const permissionRequest = createMemo((): PermissionRequest | undefined => {
|
||||
const id = params.id
|
||||
if (!id) return
|
||||
return sync.data.permission[id]?.[0]
|
||||
})
|
||||
|
||||
const blocked = createSessionComposerBlocked()
|
||||
|
||||
const todos = createMemo((): Todo[] => {
|
||||
const id = params.id
|
||||
if (!id) return []
|
||||
return globalSync.data.session_todo[id] ?? []
|
||||
})
|
||||
|
||||
const [store, setStore] = createStore({
|
||||
responding: undefined as string | undefined,
|
||||
dock: todos().length > 0,
|
||||
closing: false,
|
||||
opening: false,
|
||||
})
|
||||
|
||||
const permissionResponding = createMemo(() => {
|
||||
const perm = permissionRequest()
|
||||
if (!perm) return false
|
||||
return store.responding === perm.id
|
||||
})
|
||||
|
||||
const decide = (response: "once" | "always" | "reject") => {
|
||||
const perm = permissionRequest()
|
||||
if (!perm) return
|
||||
if (store.responding === perm.id) return
|
||||
|
||||
setStore("responding", perm.id)
|
||||
sdk.client.permission
|
||||
.respond({ sessionID: perm.sessionID, permissionID: perm.id, response })
|
||||
.catch((err: unknown) => {
|
||||
const description = err instanceof Error ? err.message : String(err)
|
||||
showToast({ title: language.t("common.requestFailed"), description })
|
||||
})
|
||||
.finally(() => {
|
||||
setStore("responding", (id) => (id === perm.id ? undefined : id))
|
||||
})
|
||||
}
|
||||
|
||||
const done = createMemo(
|
||||
() => todos().length > 0 && todos().every((todo) => todo.status === "completed" || todo.status === "cancelled"),
|
||||
)
|
||||
|
||||
let timer: number | undefined
|
||||
let raf: number | undefined
|
||||
|
||||
const scheduleClose = () => {
|
||||
if (timer) window.clearTimeout(timer)
|
||||
timer = window.setTimeout(() => {
|
||||
setStore({ dock: false, closing: false })
|
||||
timer = undefined
|
||||
}, 400)
|
||||
}
|
||||
|
||||
createEffect(
|
||||
on(
|
||||
() => [todos().length, done()] as const,
|
||||
([count, complete], prev) => {
|
||||
if (raf) cancelAnimationFrame(raf)
|
||||
raf = undefined
|
||||
|
||||
if (count === 0) {
|
||||
if (timer) window.clearTimeout(timer)
|
||||
timer = undefined
|
||||
setStore({ dock: false, closing: false, opening: false })
|
||||
return
|
||||
}
|
||||
|
||||
if (!complete) {
|
||||
if (timer) window.clearTimeout(timer)
|
||||
timer = undefined
|
||||
const hidden = !store.dock || store.closing
|
||||
setStore({ dock: true, closing: false })
|
||||
if (hidden) {
|
||||
setStore("opening", true)
|
||||
raf = requestAnimationFrame(() => {
|
||||
setStore("opening", false)
|
||||
raf = undefined
|
||||
})
|
||||
return
|
||||
}
|
||||
setStore("opening", false)
|
||||
return
|
||||
}
|
||||
|
||||
if (prev && prev[1]) {
|
||||
if (store.closing && !timer) scheduleClose()
|
||||
return
|
||||
}
|
||||
|
||||
setStore({ dock: true, opening: false, closing: true })
|
||||
scheduleClose()
|
||||
},
|
||||
),
|
||||
)
|
||||
|
||||
onCleanup(() => {
|
||||
if (!timer) return
|
||||
window.clearTimeout(timer)
|
||||
})
|
||||
|
||||
onCleanup(() => {
|
||||
if (!raf) return
|
||||
cancelAnimationFrame(raf)
|
||||
})
|
||||
|
||||
return {
|
||||
blocked,
|
||||
questionRequest,
|
||||
permissionRequest,
|
||||
permissionResponding,
|
||||
decide,
|
||||
todos,
|
||||
dock: () => store.dock,
|
||||
closing: () => store.closing,
|
||||
opening: () => store.opening,
|
||||
}
|
||||
}
|
||||
|
||||
export type SessionComposerState = ReturnType<typeof createSessionComposerState>
|
||||
@@ -1,74 +0,0 @@
|
||||
import { For, Show } from "solid-js"
|
||||
import type { PermissionRequest } from "@opencode-ai/sdk/v2"
|
||||
import { Button } from "@opencode-ai/ui/button"
|
||||
import { DockPrompt } from "@opencode-ai/ui/dock-prompt"
|
||||
import { Icon } from "@opencode-ai/ui/icon"
|
||||
import { useLanguage } from "@/context/language"
|
||||
|
||||
export function SessionPermissionDock(props: {
|
||||
request: PermissionRequest
|
||||
responding: boolean
|
||||
onDecide: (response: "once" | "always" | "reject") => void
|
||||
}) {
|
||||
const language = useLanguage()
|
||||
|
||||
const toolDescription = () => {
|
||||
const key = `settings.permissions.tool.${props.request.permission}.description`
|
||||
const value = language.t(key as Parameters<typeof language.t>[0])
|
||||
if (value === key) return ""
|
||||
return value
|
||||
}
|
||||
|
||||
return (
|
||||
<DockPrompt
|
||||
kind="permission"
|
||||
header={
|
||||
<div data-slot="permission-row" data-variant="header">
|
||||
<span data-slot="permission-icon">
|
||||
<Icon name="warning" size="normal" />
|
||||
</span>
|
||||
<div data-slot="permission-header-title">{language.t("notification.permission.title")}</div>
|
||||
</div>
|
||||
}
|
||||
footer={
|
||||
<>
|
||||
<div />
|
||||
<div data-slot="permission-footer-actions">
|
||||
<Button variant="ghost" size="normal" onClick={() => props.onDecide("reject")} disabled={props.responding}>
|
||||
{language.t("ui.permission.deny")}
|
||||
</Button>
|
||||
<Button
|
||||
variant="secondary"
|
||||
size="normal"
|
||||
onClick={() => props.onDecide("always")}
|
||||
disabled={props.responding}
|
||||
>
|
||||
{language.t("ui.permission.allowAlways")}
|
||||
</Button>
|
||||
<Button variant="primary" size="normal" onClick={() => props.onDecide("once")} disabled={props.responding}>
|
||||
{language.t("ui.permission.allowOnce")}
|
||||
</Button>
|
||||
</div>
|
||||
</>
|
||||
}
|
||||
>
|
||||
<Show when={toolDescription()}>
|
||||
<div data-slot="permission-row">
|
||||
<span data-slot="permission-spacer" aria-hidden="true" />
|
||||
<div data-slot="permission-hint">{toolDescription()}</div>
|
||||
</div>
|
||||
</Show>
|
||||
|
||||
<Show when={props.request.patterns.length > 0}>
|
||||
<div data-slot="permission-row">
|
||||
<span data-slot="permission-spacer" aria-hidden="true" />
|
||||
<div data-slot="permission-patterns">
|
||||
<For each={props.request.patterns}>
|
||||
{(pattern) => <code class="text-12-regular text-text-base break-all">{pattern}</code>}
|
||||
</For>
|
||||
</div>
|
||||
</div>
|
||||
</Show>
|
||||
</DockPrompt>
|
||||
)
|
||||
}
|
||||
@@ -9,7 +9,6 @@ import { showToast } from "@opencode-ai/ui/toast"
|
||||
import { LineComment as LineCommentView, LineCommentEditor } from "@opencode-ai/ui/line-comment"
|
||||
import { Mark } from "@opencode-ai/ui/logo"
|
||||
import { Tabs } from "@opencode-ai/ui/tabs"
|
||||
import { ScrollView } from "@opencode-ai/ui/scroll-view"
|
||||
import { useLayout } from "@/context/layout"
|
||||
import { selectionFromLines, useFile, type FileSelection, type SelectedLineRange } from "@/context/file"
|
||||
import { useComments } from "@/context/comments"
|
||||
@@ -510,52 +509,51 @@ export function FileTabContent(props: { tab: string }) {
|
||||
)
|
||||
|
||||
return (
|
||||
<Tabs.Content value={props.tab} class="mt-3 relative h-full">
|
||||
<ScrollView
|
||||
class="h-full"
|
||||
viewportRef={(el: HTMLDivElement) => {
|
||||
scroll = el
|
||||
restoreScroll()
|
||||
}}
|
||||
onScroll={handleScroll as any}
|
||||
>
|
||||
<Switch>
|
||||
<Match when={state()?.loaded && isImage()}>
|
||||
<div class="px-6 py-4 pb-40">
|
||||
<img
|
||||
src={imageDataUrl()}
|
||||
alt={path()}
|
||||
class="max-w-full"
|
||||
onLoad={() => requestAnimationFrame(restoreScroll)}
|
||||
/>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded && isSvg()}>
|
||||
<div class="flex flex-col gap-4 px-6 py-4">
|
||||
{renderCode(svgContent() ?? "", "")}
|
||||
<Show when={svgPreviewUrl()}>
|
||||
<div class="flex justify-center pb-40">
|
||||
<img src={svgPreviewUrl()} alt={path()} class="max-w-full max-h-96" />
|
||||
</div>
|
||||
</Show>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded && isBinary()}>
|
||||
<div class="h-full px-6 pb-42 flex flex-col items-center justify-center text-center gap-6">
|
||||
<Mark class="w-14 opacity-10" />
|
||||
<div class="flex flex-col gap-2 max-w-md">
|
||||
<div class="text-14-semibold text-text-strong truncate">{path()?.split("/").pop()}</div>
|
||||
<div class="text-14-regular text-text-weak">{language.t("session.files.binaryContent")}</div>
|
||||
<Tabs.Content
|
||||
value={props.tab}
|
||||
class="mt-3 relative"
|
||||
ref={(el: HTMLDivElement) => {
|
||||
scroll = el
|
||||
restoreScroll()
|
||||
}}
|
||||
onScroll={handleScroll}
|
||||
>
|
||||
<Switch>
|
||||
<Match when={state()?.loaded && isImage()}>
|
||||
<div class="px-6 py-4 pb-40">
|
||||
<img
|
||||
src={imageDataUrl()}
|
||||
alt={path()}
|
||||
class="max-w-full"
|
||||
onLoad={() => requestAnimationFrame(restoreScroll)}
|
||||
/>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded && isSvg()}>
|
||||
<div class="flex flex-col gap-4 px-6 py-4">
|
||||
{renderCode(svgContent() ?? "", "")}
|
||||
<Show when={svgPreviewUrl()}>
|
||||
<div class="flex justify-center pb-40">
|
||||
<img src={svgPreviewUrl()} alt={path()} class="max-w-full max-h-96" />
|
||||
</div>
|
||||
</Show>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded && isBinary()}>
|
||||
<div class="h-full px-6 pb-42 flex flex-col items-center justify-center text-center gap-6">
|
||||
<Mark class="w-14 opacity-10" />
|
||||
<div class="flex flex-col gap-2 max-w-md">
|
||||
<div class="text-14-semibold text-text-strong truncate">{path()?.split("/").pop()}</div>
|
||||
<div class="text-14-regular text-text-weak">{language.t("session.files.binaryContent")}</div>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded}>{renderCode(contents(), "pb-40")}</Match>
|
||||
<Match when={state()?.loading}>
|
||||
<div class="px-6 py-4 text-text-weak">{language.t("common.loading")}...</div>
|
||||
</Match>
|
||||
<Match when={state()?.error}>{(err) => <div class="px-6 py-4 text-text-weak">{err()}</div>}</Match>
|
||||
</Switch>
|
||||
</ScrollView>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded}>{renderCode(contents(), "pb-40")}</Match>
|
||||
<Match when={state()?.loading}>
|
||||
<div class="px-6 py-4 text-text-weak">{language.t("common.loading")}...</div>
|
||||
</Match>
|
||||
<Match when={state()?.error}>{(err) => <div class="px-6 py-4 text-text-weak">{err()}</div>}</Match>
|
||||
</Switch>
|
||||
</Tabs.Content>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -8,14 +8,12 @@ import { DropdownMenu } from "@opencode-ai/ui/dropdown-menu"
|
||||
import { Dialog } from "@opencode-ai/ui/dialog"
|
||||
import { InlineInput } from "@opencode-ai/ui/inline-input"
|
||||
import { SessionTurn } from "@opencode-ai/ui/session-turn"
|
||||
import { ScrollView } from "@opencode-ai/ui/scroll-view"
|
||||
import type { UserMessage } from "@opencode-ai/sdk/v2"
|
||||
import { showToast } from "@opencode-ai/ui/toast"
|
||||
import { shouldMarkBoundaryGesture, normalizeWheelDelta } from "@/pages/session/message-gesture"
|
||||
import { SessionContextUsage } from "@/components/session-context-usage"
|
||||
import { useDialog } from "@opencode-ai/ui/context/dialog"
|
||||
import { useLanguage } from "@/context/language"
|
||||
import { useSettings } from "@/context/settings"
|
||||
import { useSDK } from "@/context/sdk"
|
||||
import { useSync } from "@/context/sync"
|
||||
|
||||
@@ -82,7 +80,6 @@ export function MessageTimeline(props: {
|
||||
const navigate = useNavigate()
|
||||
const sdk = useSDK()
|
||||
const sync = useSync()
|
||||
const settings = useSettings()
|
||||
const dialog = useDialog()
|
||||
const language = useLanguage()
|
||||
|
||||
@@ -323,8 +320,8 @@ export function MessageTimeline(props: {
|
||||
<Icon name="arrow-down-to-line" />
|
||||
</button>
|
||||
</div>
|
||||
<ScrollView
|
||||
viewportRef={props.setScrollRef}
|
||||
<div
|
||||
ref={props.setScrollRef}
|
||||
onWheel={(e) => {
|
||||
const root = e.currentTarget
|
||||
const delta = normalizeWheelDelta({
|
||||
@@ -368,10 +365,10 @@ export function MessageTimeline(props: {
|
||||
if (props.isDesktop) props.onScrollSpyScroll()
|
||||
}}
|
||||
onClick={props.onAutoScrollInteraction}
|
||||
class="relative min-w-0 w-full h-full"
|
||||
class="relative min-w-0 w-full h-full overflow-y-auto session-scroller"
|
||||
style={{
|
||||
"--session-title-height": showHeader() ? "40px" : "0px",
|
||||
"--sticky-accordion-top": showHeader() ? "48px" : "0px",
|
||||
"--sticky-accordion-top": showHeader() ? "64px" : "0px",
|
||||
}}
|
||||
>
|
||||
<Show when={showHeader()}>
|
||||
@@ -538,7 +535,6 @@ export function MessageTimeline(props: {
|
||||
sessionID={sessionID() ?? ""}
|
||||
messageID={message.id}
|
||||
lastUserMessageID={props.lastUserMessageID}
|
||||
showReasoningSummaries={settings.general.showReasoningSummaries()}
|
||||
classes={{
|
||||
root: "min-w-0 w-full relative",
|
||||
content: "flex flex-col justify-between !overflow-visible",
|
||||
@@ -549,7 +545,7 @@ export function MessageTimeline(props: {
|
||||
)}
|
||||
</For>
|
||||
</div>
|
||||
</ScrollView>
|
||||
</div>
|
||||
</div>
|
||||
</Show>
|
||||
)
|
||||
|
||||
@@ -143,9 +143,9 @@ export function SessionReviewTab(props: SessionReviewTabProps) {
|
||||
open={props.view().review.open()}
|
||||
onOpenChange={props.view().review.setOpen}
|
||||
classes={{
|
||||
root: props.classes?.root ?? "pb-6 pr-3",
|
||||
root: props.classes?.root ?? "pb-6",
|
||||
header: props.classes?.header ?? "px-3",
|
||||
container: props.classes?.container ?? "pl-3",
|
||||
container: props.classes?.container ?? "px-3",
|
||||
}}
|
||||
diffs={props.diffs()}
|
||||
diffStyle={props.diffStyle}
|
||||
|
||||
318
packages/app/src/pages/session/session-prompt-dock.tsx
Normal file
318
packages/app/src/pages/session/session-prompt-dock.tsx
Normal file
@@ -0,0 +1,318 @@
|
||||
import { For, Show, createEffect, createMemo, createSignal, on, onCleanup } from "solid-js"
|
||||
import type { PermissionRequest, QuestionRequest, Todo } from "@opencode-ai/sdk/v2"
|
||||
import { useParams } from "@solidjs/router"
|
||||
import { Button } from "@opencode-ai/ui/button"
|
||||
import { DockPrompt } from "@opencode-ai/ui/dock-prompt"
|
||||
import { Icon } from "@opencode-ai/ui/icon"
|
||||
import { showToast } from "@opencode-ai/ui/toast"
|
||||
import { PromptInput } from "@/components/prompt-input"
|
||||
import { QuestionDock } from "@/components/question-dock"
|
||||
import { SessionTodoDock } from "@/components/session-todo-dock"
|
||||
import { useGlobalSync } from "@/context/global-sync"
|
||||
import { useLanguage } from "@/context/language"
|
||||
import { usePrompt } from "@/context/prompt"
|
||||
import { useSDK } from "@/context/sdk"
|
||||
import { useSync } from "@/context/sync"
|
||||
import { getSessionHandoff, setSessionHandoff } from "@/pages/session/handoff"
|
||||
|
||||
export function SessionPromptDock(props: {
|
||||
centered: boolean
|
||||
inputRef: (el: HTMLDivElement) => void
|
||||
newSessionWorktree: string
|
||||
onNewSessionWorktreeReset: () => void
|
||||
onSubmit: () => void
|
||||
setPromptDockRef: (el: HTMLDivElement) => void
|
||||
}) {
|
||||
const params = useParams()
|
||||
const sdk = useSDK()
|
||||
const sync = useSync()
|
||||
const globalSync = useGlobalSync()
|
||||
const prompt = usePrompt()
|
||||
const language = useLanguage()
|
||||
|
||||
const sessionKey = createMemo(() => `${params.dir}${params.id ? "/" + params.id : ""}`)
|
||||
const handoffPrompt = createMemo(() => getSessionHandoff(sessionKey())?.prompt)
|
||||
|
||||
const todos = createMemo((): Todo[] => {
|
||||
const id = params.id
|
||||
if (!id) return []
|
||||
return globalSync.data.session_todo[id] ?? []
|
||||
})
|
||||
|
||||
const questionRequest = createMemo((): QuestionRequest | undefined => {
|
||||
const sessionID = params.id
|
||||
if (!sessionID) return
|
||||
return sync.data.question[sessionID]?.[0]
|
||||
})
|
||||
|
||||
const permissionRequest = createMemo((): PermissionRequest | undefined => {
|
||||
const sessionID = params.id
|
||||
if (!sessionID) return
|
||||
return sync.data.permission[sessionID]?.[0]
|
||||
})
|
||||
|
||||
const blocked = createMemo(() => !!permissionRequest() || !!questionRequest())
|
||||
|
||||
const previewPrompt = () =>
|
||||
prompt
|
||||
.current()
|
||||
.map((part) => {
|
||||
if (part.type === "file") return `[file:${part.path}]`
|
||||
if (part.type === "agent") return `@${part.name}`
|
||||
if (part.type === "image") return `[image:${part.filename}]`
|
||||
return part.content
|
||||
})
|
||||
.join("")
|
||||
.trim()
|
||||
|
||||
createEffect(() => {
|
||||
if (!prompt.ready()) return
|
||||
setSessionHandoff(sessionKey(), { prompt: previewPrompt() })
|
||||
})
|
||||
|
||||
const [responding, setResponding] = createSignal<string | undefined>()
|
||||
const permissionResponding = () => {
|
||||
const perm = permissionRequest()
|
||||
if (!perm) return false
|
||||
return responding() === perm.id
|
||||
}
|
||||
|
||||
const decide = (response: "once" | "always" | "reject") => {
|
||||
const perm = permissionRequest()
|
||||
if (!perm) return
|
||||
if (responding() === perm.id) return
|
||||
|
||||
setResponding(perm.id)
|
||||
sdk.client.permission
|
||||
.respond({ sessionID: perm.sessionID, permissionID: perm.id, response })
|
||||
.catch((err: unknown) => {
|
||||
const message = err instanceof Error ? err.message : String(err)
|
||||
showToast({ title: language.t("common.requestFailed"), description: message })
|
||||
})
|
||||
.finally(() => {
|
||||
setResponding((id) => (id === perm.id ? undefined : id))
|
||||
})
|
||||
}
|
||||
|
||||
const done = createMemo(
|
||||
() => todos().length > 0 && todos().every((todo) => todo.status === "completed" || todo.status === "cancelled"),
|
||||
)
|
||||
|
||||
const [dock, setDock] = createSignal(todos().length > 0)
|
||||
const [closing, setClosing] = createSignal(false)
|
||||
const [opening, setOpening] = createSignal(false)
|
||||
let timer: number | undefined
|
||||
let raf: number | undefined
|
||||
|
||||
const scheduleClose = () => {
|
||||
if (timer) window.clearTimeout(timer)
|
||||
timer = window.setTimeout(() => {
|
||||
setDock(false)
|
||||
setClosing(false)
|
||||
timer = undefined
|
||||
}, 400)
|
||||
}
|
||||
|
||||
createEffect(
|
||||
on(
|
||||
() => [todos().length, done()] as const,
|
||||
([count, complete], prev) => {
|
||||
if (raf) cancelAnimationFrame(raf)
|
||||
raf = undefined
|
||||
|
||||
if (count === 0) {
|
||||
if (timer) window.clearTimeout(timer)
|
||||
timer = undefined
|
||||
setDock(false)
|
||||
setClosing(false)
|
||||
setOpening(false)
|
||||
return
|
||||
}
|
||||
|
||||
if (!complete) {
|
||||
if (timer) window.clearTimeout(timer)
|
||||
timer = undefined
|
||||
const wasHidden = !dock() || closing()
|
||||
setDock(true)
|
||||
setClosing(false)
|
||||
if (wasHidden) {
|
||||
setOpening(true)
|
||||
raf = requestAnimationFrame(() => {
|
||||
setOpening(false)
|
||||
raf = undefined
|
||||
})
|
||||
return
|
||||
}
|
||||
setOpening(false)
|
||||
return
|
||||
}
|
||||
|
||||
if (prev && prev[1]) {
|
||||
if (closing() && !timer) scheduleClose()
|
||||
return
|
||||
}
|
||||
|
||||
setDock(true)
|
||||
setOpening(false)
|
||||
setClosing(true)
|
||||
scheduleClose()
|
||||
},
|
||||
),
|
||||
)
|
||||
|
||||
onCleanup(() => {
|
||||
if (!timer) return
|
||||
window.clearTimeout(timer)
|
||||
})
|
||||
|
||||
onCleanup(() => {
|
||||
if (!raf) return
|
||||
cancelAnimationFrame(raf)
|
||||
})
|
||||
|
||||
return (
|
||||
<div
|
||||
ref={props.setPromptDockRef}
|
||||
data-component="session-prompt-dock"
|
||||
class="shrink-0 w-full pb-3 flex flex-col justify-center items-center bg-background-stronger pointer-events-none"
|
||||
>
|
||||
<div
|
||||
classList={{
|
||||
"w-full px-3 pointer-events-auto": true,
|
||||
"md:max-w-200 md:mx-auto 2xl:max-w-[1000px]": props.centered,
|
||||
}}
|
||||
>
|
||||
<Show when={questionRequest()} keyed>
|
||||
{(req) => {
|
||||
return (
|
||||
<div>
|
||||
<QuestionDock request={req} />
|
||||
</div>
|
||||
)
|
||||
}}
|
||||
</Show>
|
||||
|
||||
<Show when={permissionRequest()} keyed>
|
||||
{(perm) => {
|
||||
const toolDescription = () => {
|
||||
const key = `settings.permissions.tool.${perm.permission}.description`
|
||||
const value = language.t(key as Parameters<typeof language.t>[0])
|
||||
if (value === key) return ""
|
||||
return value
|
||||
}
|
||||
|
||||
return (
|
||||
<div>
|
||||
<DockPrompt
|
||||
kind="permission"
|
||||
header={
|
||||
<div data-slot="permission-row" data-variant="header">
|
||||
<span data-slot="permission-icon">
|
||||
<Icon name="warning" size="normal" />
|
||||
</span>
|
||||
<div data-slot="permission-header-title">{language.t("notification.permission.title")}</div>
|
||||
</div>
|
||||
}
|
||||
footer={
|
||||
<>
|
||||
<div />
|
||||
<div data-slot="permission-footer-actions">
|
||||
<Button
|
||||
variant="ghost"
|
||||
size="normal"
|
||||
onClick={() => decide("reject")}
|
||||
disabled={permissionResponding()}
|
||||
>
|
||||
{language.t("ui.permission.deny")}
|
||||
</Button>
|
||||
<Button
|
||||
variant="secondary"
|
||||
size="normal"
|
||||
onClick={() => decide("always")}
|
||||
disabled={permissionResponding()}
|
||||
>
|
||||
{language.t("ui.permission.allowAlways")}
|
||||
</Button>
|
||||
<Button
|
||||
variant="primary"
|
||||
size="normal"
|
||||
onClick={() => decide("once")}
|
||||
disabled={permissionResponding()}
|
||||
>
|
||||
{language.t("ui.permission.allowOnce")}
|
||||
</Button>
|
||||
</div>
|
||||
</>
|
||||
}
|
||||
>
|
||||
<Show when={toolDescription()}>
|
||||
<div data-slot="permission-row">
|
||||
<span data-slot="permission-spacer" aria-hidden="true" />
|
||||
<div data-slot="permission-hint">{toolDescription()}</div>
|
||||
</div>
|
||||
</Show>
|
||||
|
||||
<Show when={perm.patterns.length > 0}>
|
||||
<div data-slot="permission-row">
|
||||
<span data-slot="permission-spacer" aria-hidden="true" />
|
||||
<div data-slot="permission-patterns">
|
||||
<For each={perm.patterns}>
|
||||
{(pattern) => <code class="text-12-regular text-text-base break-all">{pattern}</code>}
|
||||
</For>
|
||||
</div>
|
||||
</div>
|
||||
</Show>
|
||||
</DockPrompt>
|
||||
</div>
|
||||
)
|
||||
}}
|
||||
</Show>
|
||||
|
||||
<Show when={!blocked()}>
|
||||
<Show
|
||||
when={prompt.ready()}
|
||||
fallback={
|
||||
<div class="w-full min-h-32 md:min-h-40 rounded-md border border-border-weak-base bg-background-base/50 px-4 py-3 text-text-weak whitespace-pre-wrap pointer-events-none">
|
||||
{handoffPrompt() || language.t("prompt.loading")}
|
||||
</div>
|
||||
}
|
||||
>
|
||||
<Show when={dock()}>
|
||||
<div
|
||||
classList={{
|
||||
"transition-[max-height,opacity,transform] duration-[400ms] ease-out overflow-hidden": true,
|
||||
"max-h-[320px]": !closing(),
|
||||
"max-h-0 pointer-events-none": closing(),
|
||||
"opacity-0 translate-y-9": closing() || opening(),
|
||||
"opacity-100 translate-y-0": !closing() && !opening(),
|
||||
}}
|
||||
>
|
||||
<SessionTodoDock
|
||||
todos={todos()}
|
||||
title={language.t("session.todo.title")}
|
||||
collapseLabel={language.t("session.todo.collapse")}
|
||||
expandLabel={language.t("session.todo.expand")}
|
||||
/>
|
||||
</div>
|
||||
</Show>
|
||||
<div
|
||||
classList={{
|
||||
"relative z-10": true,
|
||||
"transition-[margin] duration-[400ms] ease-out": true,
|
||||
"-mt-9": dock() && !closing(),
|
||||
"mt-0": !dock() || closing(),
|
||||
}}
|
||||
>
|
||||
<PromptInput
|
||||
ref={props.inputRef}
|
||||
newSessionWorktree={props.newSessionWorktree}
|
||||
onNewSessionWorktreeReset={props.onNewSessionWorktreeReset}
|
||||
onSubmit={props.onSubmit}
|
||||
/>
|
||||
</div>
|
||||
</Show>
|
||||
</Show>
|
||||
</div>
|
||||
</div>
|
||||
)
|
||||
}
|
||||
@@ -38,9 +38,34 @@ export function TerminalPanel() {
|
||||
|
||||
const [store, setStore] = createStore({
|
||||
autoCreated: false,
|
||||
everOpened: false,
|
||||
activeDraggable: undefined as string | undefined,
|
||||
})
|
||||
|
||||
const rendered = createMemo(() => isDesktop() && (opened() || store.everOpened))
|
||||
|
||||
createEffect(
|
||||
on(open, (isOpen, prev) => {
|
||||
if (isOpen) {
|
||||
if (!store.everOpened) setStore("everOpened", true)
|
||||
const activeId = terminal.active()
|
||||
if (!activeId) return
|
||||
if (document.activeElement instanceof HTMLElement) {
|
||||
document.activeElement.blur()
|
||||
}
|
||||
setTimeout(() => focusTerminalById(activeId), 0)
|
||||
return
|
||||
}
|
||||
|
||||
if (!prev) return
|
||||
const panel = document.getElementById("terminal-panel")
|
||||
const activeElement = document.activeElement
|
||||
if (!panel || !(activeElement instanceof HTMLElement)) return
|
||||
if (!panel.contains(activeElement)) return
|
||||
activeElement.blur()
|
||||
}),
|
||||
)
|
||||
|
||||
createEffect(() => {
|
||||
if (!opened()) {
|
||||
setStore("autoCreated", false)
|
||||
@@ -71,7 +96,7 @@ export function TerminalPanel() {
|
||||
if (document.activeElement instanceof HTMLElement) {
|
||||
document.activeElement.blur()
|
||||
}
|
||||
setTimeout(() => focusTerminalById(activeId), 0)
|
||||
focusTerminalById(activeId)
|
||||
},
|
||||
),
|
||||
)
|
||||
@@ -133,23 +158,32 @@ export function TerminalPanel() {
|
||||
}
|
||||
|
||||
return (
|
||||
<Show when={open()}>
|
||||
<Show when={rendered()}>
|
||||
<div
|
||||
id="terminal-panel"
|
||||
role="region"
|
||||
aria-label={language.t("terminal.title")}
|
||||
class="relative w-full flex flex-col shrink-0 border-t border-border-weak-base"
|
||||
style={{ height: `${height()}px` }}
|
||||
classList={{
|
||||
"relative w-full flex flex-col shrink-0 overflow-hidden": true,
|
||||
"border-t border-border-weak-base": open(),
|
||||
"pointer-events-none": !open(),
|
||||
}}
|
||||
style={{
|
||||
height: `${height()}px`,
|
||||
display: open() ? "flex" : "none",
|
||||
}}
|
||||
>
|
||||
<ResizeHandle
|
||||
direction="vertical"
|
||||
size={height()}
|
||||
min={100}
|
||||
max={typeof window === "undefined" ? 1000 : window.innerHeight * 0.6}
|
||||
collapseThreshold={50}
|
||||
onResize={layout.terminal.resize}
|
||||
onCollapse={close}
|
||||
/>
|
||||
<Show when={open()}>
|
||||
<ResizeHandle
|
||||
direction="vertical"
|
||||
size={height()}
|
||||
min={100}
|
||||
max={typeof window === "undefined" ? 1000 : window.innerHeight * 0.6}
|
||||
collapseThreshold={50}
|
||||
onResize={layout.terminal.resize}
|
||||
onCollapse={close}
|
||||
/>
|
||||
</Show>
|
||||
<Show
|
||||
when={terminal.ready()}
|
||||
fallback={
|
||||
@@ -209,17 +243,21 @@ export function TerminalPanel() {
|
||||
</Tabs.List>
|
||||
</Tabs>
|
||||
<div class="flex-1 min-h-0 relative">
|
||||
<Show when={terminal.active()} keyed>
|
||||
{(id) => (
|
||||
<Show when={byId().get(id)}>
|
||||
{(pty) => (
|
||||
<div id={`terminal-wrapper-${id}`} class="absolute inset-0">
|
||||
<Terminal pty={pty()} onCleanup={terminal.update} onConnectError={() => terminal.clone(id)} />
|
||||
</div>
|
||||
)}
|
||||
</Show>
|
||||
<For each={all()}>
|
||||
{(pty) => (
|
||||
<div
|
||||
id={`terminal-wrapper-${pty.id}`}
|
||||
class="absolute inset-0"
|
||||
style={{
|
||||
display: terminal.active() === pty.id ? "block" : "none",
|
||||
}}
|
||||
>
|
||||
<Show when={pty.id} keyed>
|
||||
<Terminal pty={pty} onCleanup={terminal.update} onConnectError={() => terminal.clone(pty.id)} />
|
||||
</Show>
|
||||
</div>
|
||||
)}
|
||||
</Show>
|
||||
</For>
|
||||
</div>
|
||||
</div>
|
||||
<DragOverlay>
|
||||
|
||||
@@ -1,13 +1,13 @@
|
||||
{
|
||||
"name": "@opencode-ai/console-app",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
"typecheck": "tsgo --noEmit",
|
||||
"dev": "vite dev --host 0.0.0.0",
|
||||
"dev:remote": "VITE_AUTH_URL=https://auth.dev.opencode.ai VITE_STRIPE_PUBLISHABLE_KEY=pk_test_51RtuLNE7fOCwHSD4mewwzFejyytjdGoSDK7CAvhbffwaZnPbNb2rwJICw6LTOXCmWO320fSNXvb5NzI08RZVkAxd00syfqrW7t bun sst shell --stage=dev bun dev",
|
||||
"build": "./script/generate-sitemap.ts && vite build && ../../opencode/script/schema.ts ./.output/public/config.json",
|
||||
"build": "./script/generate-sitemap.ts && vite build && ../../opencode/script/schema.ts ./.output/public/config.json ./.output/public/tui.json",
|
||||
"start": "vite start"
|
||||
},
|
||||
"dependencies": {
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
import type { APIEvent } from "@solidjs/start"
|
||||
import type { DownloadPlatform } from "../types"
|
||||
import { APIEvent } from "@solidjs/start"
|
||||
import { DownloadPlatform } from "./types"
|
||||
|
||||
const assetNames: Record<string, string> = {
|
||||
"darwin-aarch64-dmg": "opencode-desktop-darwin-aarch64.dmg",
|
||||
@@ -17,20 +17,17 @@ const downloadNames: Record<string, string> = {
|
||||
"windows-x64-nsis": "OpenCode Desktop Installer.exe",
|
||||
} satisfies { [K in DownloadPlatform]?: string }
|
||||
|
||||
export async function GET({ params: { platform, channel } }: APIEvent) {
|
||||
export async function GET({ params: { platform } }: APIEvent) {
|
||||
const assetName = assetNames[platform]
|
||||
if (!assetName) return new Response("Not Found", { status: 404 })
|
||||
|
||||
const resp = await fetch(
|
||||
`https://github.com/anomalyco/${channel === "stable" ? "opencode" : "opencode-beta"}/releases/latest/download/${assetName}`,
|
||||
{
|
||||
cf: {
|
||||
// in case gh releases has rate limits
|
||||
cacheTtl: 60 * 5,
|
||||
cacheEverything: true,
|
||||
},
|
||||
} as any,
|
||||
)
|
||||
const resp = await fetch(`https://github.com/anomalyco/opencode/releases/latest/download/${assetName}`, {
|
||||
cf: {
|
||||
// in case gh releases has rate limits
|
||||
cacheTtl: 60 * 5,
|
||||
cacheEverything: true,
|
||||
},
|
||||
} as any)
|
||||
|
||||
const downloadName = downloadNames[platform]
|
||||
|
||||
@@ -1,18 +1,18 @@
|
||||
import "./index.css"
|
||||
import { Meta, Title } from "@solidjs/meta"
|
||||
import { A } from "@solidjs/router"
|
||||
import { createSignal, type JSX, onMount, Show } from "solid-js"
|
||||
import { Faq } from "~/component/faq"
|
||||
import { Footer } from "~/component/footer"
|
||||
import { Title, Meta } from "@solidjs/meta"
|
||||
import { A, createAsync, query } from "@solidjs/router"
|
||||
import { Header } from "~/component/header"
|
||||
import { IconCheck, IconCopy } from "~/component/icon"
|
||||
import { Footer } from "~/component/footer"
|
||||
import { IconCopy, IconCheck } from "~/component/icon"
|
||||
import { Faq } from "~/component/faq"
|
||||
import desktopAppIcon from "../../asset/lander/opencode-desktop-icon.png"
|
||||
import { Legal } from "~/component/legal"
|
||||
import { LocaleLinks } from "~/component/locale-links"
|
||||
import { config } from "~/config"
|
||||
import { createSignal, onMount, Show, JSX } from "solid-js"
|
||||
import { DownloadPlatform } from "./types"
|
||||
import { useI18n } from "~/context/i18n"
|
||||
import { useLanguage } from "~/context/language"
|
||||
import desktopAppIcon from "../../asset/lander/opencode-desktop-icon.png"
|
||||
import type { DownloadPlatform } from "./types"
|
||||
import { LocaleLinks } from "~/component/locale-links"
|
||||
|
||||
type OS = "macOS" | "Windows" | "Linux" | null
|
||||
|
||||
@@ -40,8 +40,8 @@ function getDownloadPlatform(os: OS): DownloadPlatform {
|
||||
}
|
||||
}
|
||||
|
||||
function getDownloadHref(platform: DownloadPlatform, channel: "stable" | "beta" = "stable") {
|
||||
return `/download/${channel}/${platform}`
|
||||
function getDownloadHref(platform: DownloadPlatform) {
|
||||
return `/download/${platform}`
|
||||
}
|
||||
|
||||
function IconDownload(props: JSX.SvgSVGAttributes<SVGSVGElement>) {
|
||||
|
||||
@@ -107,14 +107,11 @@ export async function handler(
|
||||
const startTimestamp = Date.now()
|
||||
const reqUrl = providerInfo.modifyUrl(providerInfo.api, isStream)
|
||||
const reqBody = JSON.stringify(
|
||||
providerInfo.modifyBody(
|
||||
{
|
||||
...createBodyConverter(opts.format, providerInfo.format)(body),
|
||||
model: providerInfo.model,
|
||||
...(providerInfo.payloadModifier ?? {}),
|
||||
},
|
||||
authInfo?.workspaceID,
|
||||
),
|
||||
providerInfo.modifyBody({
|
||||
...createBodyConverter(opts.format, providerInfo.format)(body),
|
||||
model: providerInfo.model,
|
||||
...(providerInfo.payloadModifier ?? {}),
|
||||
}),
|
||||
)
|
||||
logger.debug("REQUEST URL: " + reqUrl)
|
||||
logger.debug("REQUEST: " + reqBody.substring(0, 300) + "...")
|
||||
|
||||
@@ -18,10 +18,9 @@ export const openaiHelper: ProviderHelper = () => ({
|
||||
modifyHeaders: (headers: Headers, body: Record<string, any>, apiKey: string) => {
|
||||
headers.set("authorization", `Bearer ${apiKey}`)
|
||||
},
|
||||
modifyBody: (body: Record<string, any>, workspaceID?: string) => ({
|
||||
...body,
|
||||
...(workspaceID ? { safety_identifier: workspaceID } : {}),
|
||||
}),
|
||||
modifyBody: (body: Record<string, any>) => {
|
||||
return body
|
||||
},
|
||||
createBinaryStreamDecoder: () => undefined,
|
||||
streamSeparator: "\n\n",
|
||||
createUsageParser: () => {
|
||||
|
||||
@@ -37,7 +37,7 @@ export type ProviderHelper = (input: { reqModel: string; providerModel: string }
|
||||
format: ZenData.Format
|
||||
modifyUrl: (providerApi: string, isStream?: boolean) => string
|
||||
modifyHeaders: (headers: Headers, body: Record<string, any>, apiKey: string) => void
|
||||
modifyBody: (body: Record<string, any>, workspaceID?: string) => Record<string, any>
|
||||
modifyBody: (body: Record<string, any>) => Record<string, any>
|
||||
createBinaryStreamDecoder: () => ((chunk: Uint8Array) => Uint8Array | undefined) | undefined
|
||||
streamSeparator: string
|
||||
createUsageParser: () => {
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
{
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"name": "@opencode-ai/console-core",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/console-function",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/console-mail",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"dependencies": {
|
||||
"@jsx-email/all": "2.2.3",
|
||||
"@jsx-email/cli": "1.4.3",
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
{
|
||||
"name": "@opencode-ai/desktop",
|
||||
"private": true,
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
|
||||
@@ -320,7 +320,7 @@ pub fn spawn_command(
|
||||
};
|
||||
|
||||
let mut cmd = Command::new(shell);
|
||||
cmd.args(["-il", "-c", &line]);
|
||||
cmd.args(["-l", "-c", &line]);
|
||||
|
||||
for (key, value) in envs {
|
||||
cmd.env(key, value);
|
||||
|
||||
@@ -40,9 +40,7 @@ use crate::windows::{LoadingWindow, MainWindow};
|
||||
#[derive(Clone, serde::Serialize, specta::Type, Debug)]
|
||||
struct ServerReadyData {
|
||||
url: String,
|
||||
username: Option<String>,
|
||||
password: Option<String>,
|
||||
is_sidecar: bool
|
||||
}
|
||||
|
||||
#[derive(Clone, Copy, serde::Serialize, specta::Type, Debug)]
|
||||
@@ -607,7 +605,6 @@ async fn initialize(app: AppHandle) {
|
||||
child,
|
||||
health_check,
|
||||
url,
|
||||
username,
|
||||
password,
|
||||
} => {
|
||||
let app = app.clone();
|
||||
@@ -634,7 +631,7 @@ async fn initialize(app: AppHandle) {
|
||||
|
||||
app.state::<ServerState>().set_child(Some(child));
|
||||
|
||||
Ok(ServerReadyData { url, username,password, is_sidecar: true })
|
||||
Ok(ServerReadyData { url, password })
|
||||
}
|
||||
.map(move |res| {
|
||||
let _ = server_ready_tx.send(res);
|
||||
@@ -644,9 +641,7 @@ async fn initialize(app: AppHandle) {
|
||||
ServerConnection::Existing { url } => {
|
||||
let _ = server_ready_tx.send(Ok(ServerReadyData {
|
||||
url: url.to_string(),
|
||||
username: None,
|
||||
password: None,
|
||||
is_sidecar: false,
|
||||
}));
|
||||
None
|
||||
}
|
||||
@@ -724,7 +719,6 @@ enum ServerConnection {
|
||||
},
|
||||
CLI {
|
||||
url: String,
|
||||
username: Option<String>,
|
||||
password: Option<String>,
|
||||
child: CommandChild,
|
||||
health_check: server::HealthCheck,
|
||||
@@ -736,15 +730,11 @@ async fn setup_server_connection(app: AppHandle) -> ServerConnection {
|
||||
|
||||
tracing::info!(?custom_url, "Attempting server connection");
|
||||
|
||||
if let Some(url) = &custom_url
|
||||
&& server::check_health_or_ask_retry(&app, url).await
|
||||
if let Some(url) = custom_url
|
||||
&& server::check_health_or_ask_retry(&app, &url).await
|
||||
{
|
||||
tracing::info!(%url, "Connected to custom server");
|
||||
// If the default server is already local, no need to also spawn a sidecar
|
||||
if server::is_localhost_url(url) {
|
||||
return ServerConnection::Existing { url: url.clone() };
|
||||
}
|
||||
// Remote default server: fall through and also spawn a local sidecar
|
||||
return ServerConnection::Existing { url: url.clone() };
|
||||
}
|
||||
|
||||
let local_port = get_sidecar_port();
|
||||
@@ -765,7 +755,6 @@ async fn setup_server_connection(app: AppHandle) -> ServerConnection {
|
||||
|
||||
ServerConnection::CLI {
|
||||
url: local_url,
|
||||
username: Some("opencode".to_string()),
|
||||
password: Some(password),
|
||||
child,
|
||||
health_check,
|
||||
|
||||
@@ -150,7 +150,7 @@ pub async fn check_health(url: &str, password: Option<&str>) -> bool {
|
||||
return false;
|
||||
};
|
||||
|
||||
let mut builder = reqwest::Client::builder().timeout(Duration::from_secs(7));
|
||||
let mut builder = reqwest::Client::builder().timeout(Duration::from_secs(3));
|
||||
|
||||
if url_is_localhost(&url) {
|
||||
// Some environments set proxy variables (HTTP_PROXY/HTTPS_PROXY/ALL_PROXY) without
|
||||
@@ -178,10 +178,6 @@ pub async fn check_health(url: &str, password: Option<&str>) -> bool {
|
||||
.unwrap_or(false)
|
||||
}
|
||||
|
||||
pub fn is_localhost_url(url: &str) -> bool {
|
||||
reqwest::Url::parse(url).is_ok_and(|u| url_is_localhost(&u))
|
||||
}
|
||||
|
||||
fn url_is_localhost(url: &reqwest::Url) -> bool {
|
||||
url.host_str().is_some_and(|host| {
|
||||
host.eq_ignore_ascii_case("localhost")
|
||||
|
||||
@@ -1,21 +0,0 @@
|
||||
{
|
||||
"$schema": "https://schema.tauri.app/config/2",
|
||||
"productName": "OpenCode Beta",
|
||||
"identifier": "ai.opencode.desktop.beta",
|
||||
"bundle": {
|
||||
"createUpdaterArtifacts": true,
|
||||
"linux": {
|
||||
"rpm": {
|
||||
"compression": {
|
||||
"type": "none"
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"updater": {
|
||||
"pubkey": "dW50cnVzdGVkIGNvbW1lbnQ6IG1pbmlzaWduIHB1YmxpYyBrZXk6IEYwMDM5Nzg5OUMzOUExMDQKUldRRW9UbWNpWmNEOENYT01CV0lhOXR1UFhpaXJsK1Z3aU9lZnNtNzE0TDROWVMwVW9XQnFOelkK",
|
||||
"endpoints": ["https://github.com/anomalyco/opencode-beta/releases/latest/download/latest.json"]
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -35,9 +35,7 @@ export type LoadingWindowComplete = null;
|
||||
|
||||
export type ServerReadyData = {
|
||||
url: string,
|
||||
username: string | null,
|
||||
password: string | null,
|
||||
is_sidecar: boolean,
|
||||
};
|
||||
|
||||
export type SqliteMigrationProgress = { type: "InProgress"; value: number } | { type: "Done" };
|
||||
|
||||
@@ -23,7 +23,7 @@ import { relaunch } from "@tauri-apps/plugin-process"
|
||||
import { open as shellOpen } from "@tauri-apps/plugin-shell"
|
||||
import { Store } from "@tauri-apps/plugin-store"
|
||||
import { check, type Update } from "@tauri-apps/plugin-updater"
|
||||
import { createResource, type JSX, onCleanup, onMount, Show } from "solid-js"
|
||||
import { type Accessor, createResource, type JSX, onCleanup, onMount, Show } from "solid-js"
|
||||
import { render } from "solid-js/web"
|
||||
import pkg from "../package.json"
|
||||
import { initI18n, t } from "./i18n"
|
||||
@@ -31,7 +31,7 @@ import { UPDATER_ENABLED } from "./updater"
|
||||
import { webviewZoom } from "./webview-zoom"
|
||||
import "./styles.css"
|
||||
import { Channel } from "@tauri-apps/api/core"
|
||||
import { commands, ServerReadyData, type InitStep } from "./bindings"
|
||||
import { commands, type InitStep } from "./bindings"
|
||||
import { createMenu } from "./menu"
|
||||
|
||||
const root = document.getElementById("root")
|
||||
@@ -452,19 +452,16 @@ render(() => {
|
||||
<AppBaseProviders>
|
||||
<ServerGate>
|
||||
{(data) => {
|
||||
const http = {
|
||||
url: data.url,
|
||||
username: data.username ?? undefined,
|
||||
password: data.password ?? undefined,
|
||||
const server: ServerConnection.Sidecar = {
|
||||
displayName: "Local Server",
|
||||
type: "sidecar",
|
||||
variant: "base",
|
||||
http: {
|
||||
url: data().url,
|
||||
username: "opencode",
|
||||
password: data().password ?? undefined,
|
||||
},
|
||||
}
|
||||
const server: ServerConnection.Any = data.is_sidecar
|
||||
? {
|
||||
displayName: "Local Server",
|
||||
type: "sidecar",
|
||||
variant: "base",
|
||||
http,
|
||||
}
|
||||
: { type: "http", http }
|
||||
|
||||
function Inner() {
|
||||
const cmd = useCommand()
|
||||
@@ -475,10 +472,12 @@ render(() => {
|
||||
}
|
||||
|
||||
return (
|
||||
<Show when={!defaultServer.loading}>
|
||||
<AppInterface defaultServer={defaultServer.latest ?? ServerConnection.key(server)} servers={[server]}>
|
||||
<Inner />
|
||||
</AppInterface>
|
||||
<Show when={defaultServer.loading ? false : defaultServer.latest}>
|
||||
{(defaultServer) => (
|
||||
<AppInterface defaultServer={defaultServer() ?? ServerConnection.key(server)} servers={[server]}>
|
||||
<Inner />
|
||||
</AppInterface>
|
||||
)}
|
||||
</Show>
|
||||
)
|
||||
}}
|
||||
@@ -488,8 +487,10 @@ render(() => {
|
||||
)
|
||||
}, root!)
|
||||
|
||||
type ServerReadyData = { url: string; password: string | null }
|
||||
|
||||
// Gate component that waits for the server to be ready
|
||||
function ServerGate(props: { children: (data: ServerReadyData) => JSX.Element }) {
|
||||
function ServerGate(props: { children: (data: Accessor<ServerReadyData>) => JSX.Element }) {
|
||||
const [serverData] = createResource(() => commands.awaitInitialization(new Channel<InitStep>() as any))
|
||||
if (serverData.state === "errored") throw serverData.error
|
||||
|
||||
@@ -503,7 +504,7 @@ function ServerGate(props: { children: (data: ServerReadyData) => JSX.Element })
|
||||
</div>
|
||||
}
|
||||
>
|
||||
{(data) => props.children(data())}
|
||||
{(data) => props.children(data)}
|
||||
</Show>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/enterprise",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
id = "opencode"
|
||||
name = "OpenCode"
|
||||
description = "The open source coding agent."
|
||||
version = "1.2.10"
|
||||
version = "1.2.6"
|
||||
schema_version = 1
|
||||
authors = ["Anomaly"]
|
||||
repository = "https://github.com/anomalyco/opencode"
|
||||
@@ -11,26 +11,26 @@ name = "OpenCode"
|
||||
icon = "./icons/opencode.svg"
|
||||
|
||||
[agent_servers.opencode.targets.darwin-aarch64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-darwin-arm64.zip"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.6/opencode-darwin-arm64.zip"
|
||||
cmd = "./opencode"
|
||||
args = ["acp"]
|
||||
|
||||
[agent_servers.opencode.targets.darwin-x86_64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-darwin-x64.zip"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.6/opencode-darwin-x64.zip"
|
||||
cmd = "./opencode"
|
||||
args = ["acp"]
|
||||
|
||||
[agent_servers.opencode.targets.linux-aarch64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-linux-arm64.tar.gz"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.6/opencode-linux-arm64.tar.gz"
|
||||
cmd = "./opencode"
|
||||
args = ["acp"]
|
||||
|
||||
[agent_servers.opencode.targets.linux-x86_64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-linux-x64.tar.gz"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.6/opencode-linux-x64.tar.gz"
|
||||
cmd = "./opencode"
|
||||
args = ["acp"]
|
||||
|
||||
[agent_servers.opencode.targets.windows-x86_64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-windows-x64.zip"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.6/opencode-windows-x64.zip"
|
||||
cmd = "./opencode.exe"
|
||||
args = ["acp"]
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/function",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
|
||||
@@ -25,12 +25,6 @@ if (envPath) {
|
||||
const scriptPath = fs.realpathSync(__filename)
|
||||
const scriptDir = path.dirname(scriptPath)
|
||||
|
||||
//
|
||||
const cached = path.join(scriptDir, ".opencode")
|
||||
if (fs.existsSync(cached)) {
|
||||
run(cached)
|
||||
}
|
||||
|
||||
const platformMap = {
|
||||
darwin: "darwin",
|
||||
linux: "linux",
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"version": "1.2.10",
|
||||
"version": "1.2.6",
|
||||
"name": "opencode",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
@@ -55,22 +55,22 @@
|
||||
"@actions/core": "1.11.1",
|
||||
"@actions/github": "6.0.1",
|
||||
"@agentclientprotocol/sdk": "0.14.1",
|
||||
"@ai-sdk/amazon-bedrock": "3.0.82",
|
||||
"@ai-sdk/anthropic": "2.0.65",
|
||||
"@ai-sdk/amazon-bedrock": "3.0.79",
|
||||
"@ai-sdk/anthropic": "2.0.62",
|
||||
"@ai-sdk/azure": "2.0.91",
|
||||
"@ai-sdk/cerebras": "1.0.36",
|
||||
"@ai-sdk/cohere": "2.0.22",
|
||||
"@ai-sdk/deepinfra": "1.0.36",
|
||||
"@ai-sdk/gateway": "2.0.30",
|
||||
"@ai-sdk/google": "2.0.54",
|
||||
"@ai-sdk/google-vertex": "3.0.106",
|
||||
"@ai-sdk/google": "2.0.52",
|
||||
"@ai-sdk/google-vertex": "3.0.103",
|
||||
"@ai-sdk/groq": "2.0.34",
|
||||
"@ai-sdk/mistral": "2.0.27",
|
||||
"@ai-sdk/openai": "2.0.89",
|
||||
"@ai-sdk/openai-compatible": "1.0.32",
|
||||
"@ai-sdk/perplexity": "2.0.23",
|
||||
"@ai-sdk/provider": "2.0.1",
|
||||
"@ai-sdk/provider-utils": "3.0.21",
|
||||
"@ai-sdk/provider-utils": "3.0.20",
|
||||
"@ai-sdk/togetherai": "1.0.34",
|
||||
"@ai-sdk/vercel": "1.0.33",
|
||||
"@ai-sdk/xai": "2.0.51",
|
||||
@@ -107,7 +107,6 @@
|
||||
"diff": "catalog:",
|
||||
"drizzle-orm": "1.0.0-beta.12-a5629fb",
|
||||
"fuzzysort": "3.1.0",
|
||||
"glob": "13.0.5",
|
||||
"google-auth-library": "10.5.0",
|
||||
"gray-matter": "4.0.3",
|
||||
"hono": "catalog:",
|
||||
|
||||
@@ -1,10 +1,10 @@
|
||||
#!/usr/bin/env bun
|
||||
|
||||
import { $ } from "bun"
|
||||
import fs from "fs"
|
||||
import path from "path"
|
||||
import { fileURLToPath } from "url"
|
||||
import solidPlugin from "../node_modules/@opentui/solid/scripts/solid-plugin"
|
||||
import path from "path"
|
||||
import fs from "fs"
|
||||
import { $ } from "bun"
|
||||
import { fileURLToPath } from "url"
|
||||
|
||||
const __filename = fileURLToPath(import.meta.url)
|
||||
const __dirname = path.dirname(__filename)
|
||||
@@ -12,9 +12,8 @@ const dir = path.resolve(__dirname, "..")
|
||||
|
||||
process.chdir(dir)
|
||||
|
||||
import { Script } from "@opencode-ai/script"
|
||||
import pkg from "../package.json"
|
||||
|
||||
import { Script } from "@opencode-ai/script"
|
||||
const modelsUrl = process.env.OPENCODE_MODELS_URL || "https://models.dev"
|
||||
// Fetch and generate models.dev snapshot
|
||||
const modelsData = process.env.MODELS_DEV_API_JSON
|
||||
@@ -27,11 +26,7 @@ await Bun.write(
|
||||
console.log("Generated models-snapshot.ts")
|
||||
|
||||
// Load migrations from migration directories
|
||||
const migrationDirs = (
|
||||
await fs.promises.readdir(path.join(dir, "migration"), {
|
||||
withFileTypes: true,
|
||||
})
|
||||
)
|
||||
const migrationDirs = (await fs.promises.readdir(path.join(dir, "migration"), { withFileTypes: true }))
|
||||
.filter((entry) => entry.isDirectory() && /^\d{4}\d{2}\d{2}\d{2}\d{2}\d{2}/.test(entry.name))
|
||||
.map((entry) => entry.name)
|
||||
.sort()
|
||||
@@ -176,6 +171,7 @@ for (const item of targets) {
|
||||
compile: {
|
||||
autoloadBunfig: false,
|
||||
autoloadDotenv: false,
|
||||
//@ts-ignore (bun types aren't up to date)
|
||||
autoloadTsconfig: true,
|
||||
autoloadPackageJson: true,
|
||||
target: name.replace(pkg.name, "bun") as any,
|
||||
@@ -218,7 +214,7 @@ if (Script.release) {
|
||||
await $`zip -r ../../${key}.zip *`.cwd(`dist/${key}/bin`)
|
||||
}
|
||||
}
|
||||
await $`gh release upload v${Script.version} ./dist/*.zip ./dist/*.tar.gz --clobber --repo ${process.env.GH_REPO}`
|
||||
await $`gh release upload v${Script.version} ./dist/*.zip ./dist/*.tar.gz --clobber`
|
||||
}
|
||||
|
||||
export { binaries }
|
||||
|
||||
@@ -109,14 +109,8 @@ async function main() {
|
||||
// On non-Windows platforms, just verify the binary package exists
|
||||
// Don't replace the wrapper script - it handles binary execution
|
||||
const { binaryPath } = findBinary()
|
||||
const target = path.join(__dirname, "bin", ".opencode")
|
||||
if (fs.existsSync(target)) fs.unlinkSync(target)
|
||||
try {
|
||||
fs.linkSync(binaryPath, target)
|
||||
} catch {
|
||||
fs.copyFileSync(binaryPath, target)
|
||||
}
|
||||
fs.chmodSync(target, 0o755)
|
||||
console.log(`Platform binary verified at: ${binaryPath}`)
|
||||
console.log("Wrapper script will handle binary execution")
|
||||
} catch (error) {
|
||||
console.error("Failed to setup opencode binary:", error.message)
|
||||
process.exit(1)
|
||||
|
||||
@@ -2,46 +2,62 @@
|
||||
|
||||
import { z } from "zod"
|
||||
import { Config } from "../src/config/config"
|
||||
import { TuiConfig } from "../src/config/tui"
|
||||
|
||||
const file = process.argv[2]
|
||||
console.log(file)
|
||||
function generate(schema: z.ZodType) {
|
||||
const result = z.toJSONSchema(schema, {
|
||||
io: "input", // Generate input shape (treats optional().default() as not required)
|
||||
/**
|
||||
* We'll use the `default` values of the field as the only value in `examples`.
|
||||
* This will ensure no docs are needed to be read, as the configuration is
|
||||
* self-documenting.
|
||||
*
|
||||
* See https://json-schema.org/draft/2020-12/draft-bhutton-json-schema-validation-00#rfc.section.9.5
|
||||
*/
|
||||
override(ctx) {
|
||||
const schema = ctx.jsonSchema
|
||||
|
||||
const result = z.toJSONSchema(Config.Info, {
|
||||
io: "input", // Generate input shape (treats optional().default() as not required)
|
||||
/**
|
||||
* We'll use the `default` values of the field as the only value in `examples`.
|
||||
* This will ensure no docs are needed to be read, as the configuration is
|
||||
* self-documenting.
|
||||
*
|
||||
* See https://json-schema.org/draft/2020-12/draft-bhutton-json-schema-validation-00#rfc.section.9.5
|
||||
*/
|
||||
override(ctx) {
|
||||
const schema = ctx.jsonSchema
|
||||
|
||||
// Preserve strictness: set additionalProperties: false for objects
|
||||
if (schema && typeof schema === "object" && schema.type === "object" && schema.additionalProperties === undefined) {
|
||||
schema.additionalProperties = false
|
||||
}
|
||||
|
||||
// Add examples and default descriptions for string fields with defaults
|
||||
if (schema && typeof schema === "object" && "type" in schema && schema.type === "string" && schema?.default) {
|
||||
if (!schema.examples) {
|
||||
schema.examples = [schema.default]
|
||||
// Preserve strictness: set additionalProperties: false for objects
|
||||
if (
|
||||
schema &&
|
||||
typeof schema === "object" &&
|
||||
schema.type === "object" &&
|
||||
schema.additionalProperties === undefined
|
||||
) {
|
||||
schema.additionalProperties = false
|
||||
}
|
||||
|
||||
schema.description = [schema.description || "", `default: \`${schema.default}\``]
|
||||
.filter(Boolean)
|
||||
.join("\n\n")
|
||||
.trim()
|
||||
}
|
||||
},
|
||||
}) as Record<string, unknown> & {
|
||||
allowComments?: boolean
|
||||
allowTrailingCommas?: boolean
|
||||
// Add examples and default descriptions for string fields with defaults
|
||||
if (schema && typeof schema === "object" && "type" in schema && schema.type === "string" && schema?.default) {
|
||||
if (!schema.examples) {
|
||||
schema.examples = [schema.default]
|
||||
}
|
||||
|
||||
schema.description = [schema.description || "", `default: \`${schema.default}\``]
|
||||
.filter(Boolean)
|
||||
.join("\n\n")
|
||||
.trim()
|
||||
}
|
||||
},
|
||||
}) as Record<string, unknown> & {
|
||||
allowComments?: boolean
|
||||
allowTrailingCommas?: boolean
|
||||
}
|
||||
|
||||
// used for json lsps since config supports jsonc
|
||||
result.allowComments = true
|
||||
result.allowTrailingCommas = true
|
||||
|
||||
return result
|
||||
}
|
||||
|
||||
// used for json lsps since config supports jsonc
|
||||
result.allowComments = true
|
||||
result.allowTrailingCommas = true
|
||||
const configFile = process.argv[2]
|
||||
const tuiFile = process.argv[3]
|
||||
|
||||
await Bun.write(file, JSON.stringify(result, null, 2))
|
||||
console.log(configFile)
|
||||
await Bun.write(configFile, JSON.stringify(generate(Config.Info), null, 2))
|
||||
|
||||
if (tuiFile) {
|
||||
console.log(tuiFile)
|
||||
await Bun.write(tuiFile, JSON.stringify(generate(TuiConfig.Info), null, 2))
|
||||
}
|
||||
|
||||
@@ -450,7 +450,6 @@ export const GithubRunCommand = cmd({
|
||||
const isWorkflowDispatchEvent = context.eventName === "workflow_dispatch"
|
||||
|
||||
const { providerID, modelID } = normalizeModel()
|
||||
const variant = process.env["VARIANT"] || undefined
|
||||
const runId = normalizeRunId()
|
||||
const share = normalizeShare()
|
||||
const oidcBaseUrl = normalizeOidcBaseUrl()
|
||||
@@ -554,12 +553,8 @@ export const GithubRunCommand = cmd({
|
||||
const branch = await checkoutNewBranch(branchPrefix)
|
||||
const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
|
||||
const response = await chat(userPrompt, promptFiles)
|
||||
const { dirty, uncommittedChanges, switched } = await branchIsDirty(head, branch)
|
||||
if (switched) {
|
||||
// Agent switched branches (likely created its own branch/PR)
|
||||
console.log("Agent managed its own branch, skipping infrastructure push/PR")
|
||||
console.log("Response:", response)
|
||||
} else if (dirty) {
|
||||
const { dirty, uncommittedChanges } = await branchIsDirty(head)
|
||||
if (dirty) {
|
||||
const summary = await summarize(response)
|
||||
// workflow_dispatch has an actor for co-author attribution, schedule does not
|
||||
await pushToNewBranch(summary, branch, uncommittedChanges, isScheduleEvent)
|
||||
@@ -570,11 +565,7 @@ export const GithubRunCommand = cmd({
|
||||
summary,
|
||||
`${response}\n\nTriggered by ${triggerType}${footer({ image: true })}`,
|
||||
)
|
||||
if (pr) {
|
||||
console.log(`Created PR #${pr}`)
|
||||
} else {
|
||||
console.log("Skipped PR creation (no new commits)")
|
||||
}
|
||||
console.log(`Created PR #${pr}`)
|
||||
} else {
|
||||
console.log("Response:", response)
|
||||
}
|
||||
@@ -589,11 +580,8 @@ export const GithubRunCommand = cmd({
|
||||
const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
|
||||
const dataPrompt = buildPromptDataForPR(prData)
|
||||
const response = await chat(`${userPrompt}\n\n${dataPrompt}`, promptFiles)
|
||||
const { dirty, uncommittedChanges, switched } = await branchIsDirty(head, prData.headRefName)
|
||||
if (switched) {
|
||||
console.log("Agent managed its own branch, skipping infrastructure push")
|
||||
}
|
||||
if (dirty && !switched) {
|
||||
const { dirty, uncommittedChanges } = await branchIsDirty(head)
|
||||
if (dirty) {
|
||||
const summary = await summarize(response)
|
||||
await pushToLocalBranch(summary, uncommittedChanges)
|
||||
}
|
||||
@@ -603,15 +591,12 @@ export const GithubRunCommand = cmd({
|
||||
}
|
||||
// Fork PR
|
||||
else {
|
||||
const forkBranch = await checkoutForkBranch(prData)
|
||||
await checkoutForkBranch(prData)
|
||||
const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
|
||||
const dataPrompt = buildPromptDataForPR(prData)
|
||||
const response = await chat(`${userPrompt}\n\n${dataPrompt}`, promptFiles)
|
||||
const { dirty, uncommittedChanges, switched } = await branchIsDirty(head, forkBranch)
|
||||
if (switched) {
|
||||
console.log("Agent managed its own branch, skipping infrastructure push")
|
||||
}
|
||||
if (dirty && !switched) {
|
||||
const { dirty, uncommittedChanges } = await branchIsDirty(head)
|
||||
if (dirty) {
|
||||
const summary = await summarize(response)
|
||||
await pushToForkBranch(summary, prData, uncommittedChanges)
|
||||
}
|
||||
@@ -627,13 +612,8 @@ export const GithubRunCommand = cmd({
|
||||
const issueData = await fetchIssue()
|
||||
const dataPrompt = buildPromptDataForIssue(issueData)
|
||||
const response = await chat(`${userPrompt}\n\n${dataPrompt}`, promptFiles)
|
||||
const { dirty, uncommittedChanges, switched } = await branchIsDirty(head, branch)
|
||||
if (switched) {
|
||||
// Agent switched branches (likely created its own branch/PR).
|
||||
// Don't push the stale infrastructure branch — just comment.
|
||||
await createComment(`${response}${footer({ image: true })}`)
|
||||
await removeReaction(commentType)
|
||||
} else if (dirty) {
|
||||
const { dirty, uncommittedChanges } = await branchIsDirty(head)
|
||||
if (dirty) {
|
||||
const summary = await summarize(response)
|
||||
await pushToNewBranch(summary, branch, uncommittedChanges, false)
|
||||
const pr = await createPR(
|
||||
@@ -642,11 +622,7 @@ export const GithubRunCommand = cmd({
|
||||
summary,
|
||||
`${response}\n\nCloses #${issueId}${footer({ image: true })}`,
|
||||
)
|
||||
if (pr) {
|
||||
await createComment(`Created PR #${pr}${footer({ image: true })}`)
|
||||
} else {
|
||||
await createComment(`${response}${footer({ image: true })}`)
|
||||
}
|
||||
await createComment(`Created PR #${pr}${footer({ image: true })}`)
|
||||
await removeReaction(commentType)
|
||||
} else {
|
||||
await createComment(`${response}${footer({ image: true })}`)
|
||||
@@ -913,7 +889,6 @@ export const GithubRunCommand = cmd({
|
||||
const result = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
messageID: Identifier.ascending("message"),
|
||||
variant,
|
||||
model: {
|
||||
providerID,
|
||||
modelID,
|
||||
@@ -967,7 +942,6 @@ export const GithubRunCommand = cmd({
|
||||
const summary = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
messageID: Identifier.ascending("message"),
|
||||
variant,
|
||||
model: {
|
||||
providerID,
|
||||
modelID,
|
||||
@@ -1094,7 +1068,6 @@ export const GithubRunCommand = cmd({
|
||||
await $`git remote add fork https://github.com/${pr.headRepository.nameWithOwner}.git`
|
||||
await $`git fetch fork --depth=${depth} ${remoteBranch}`
|
||||
await $`git checkout -b ${localBranch} fork/${remoteBranch}`
|
||||
return localBranch
|
||||
}
|
||||
|
||||
function generateBranchName(type: "issue" | "pr" | "schedule" | "dispatch") {
|
||||
@@ -1152,44 +1125,23 @@ Co-authored-by: ${actor} <${actor}@users.noreply.github.com>"`
|
||||
await $`git push fork HEAD:${remoteBranch}`
|
||||
}
|
||||
|
||||
async function branchIsDirty(originalHead: string, expectedBranch: string) {
|
||||
async function branchIsDirty(originalHead: string) {
|
||||
console.log("Checking if branch is dirty...")
|
||||
// Detect if the agent switched branches during chat (e.g. created
|
||||
// its own branch, committed, and possibly pushed/created a PR).
|
||||
const current = (await $`git rev-parse --abbrev-ref HEAD`).stdout.toString().trim()
|
||||
if (current !== expectedBranch) {
|
||||
console.log(`Branch changed during chat: expected ${expectedBranch}, now on ${current}`)
|
||||
return { dirty: true, uncommittedChanges: false, switched: true }
|
||||
}
|
||||
|
||||
const ret = await $`git status --porcelain`
|
||||
const status = ret.stdout.toString().trim()
|
||||
if (status.length > 0) {
|
||||
return { dirty: true, uncommittedChanges: true, switched: false }
|
||||
return {
|
||||
dirty: true,
|
||||
uncommittedChanges: true,
|
||||
}
|
||||
}
|
||||
const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
|
||||
const head = await $`git rev-parse HEAD`
|
||||
return {
|
||||
dirty: head !== originalHead,
|
||||
dirty: head.stdout.toString().trim() !== originalHead,
|
||||
uncommittedChanges: false,
|
||||
switched: false,
|
||||
}
|
||||
}
|
||||
|
||||
// Verify commits exist between base ref and a branch using rev-list.
|
||||
// Falls back to fetching from origin when local refs are missing
|
||||
// (common in shallow clones from actions/checkout).
|
||||
async function hasNewCommits(base: string, head: string) {
|
||||
const result = await $`git rev-list --count ${base}..${head}`.nothrow()
|
||||
if (result.exitCode !== 0) {
|
||||
console.log(`rev-list failed, fetching origin/${base}...`)
|
||||
await $`git fetch origin ${base} --depth=1`.nothrow()
|
||||
const retry = await $`git rev-list --count origin/${base}..${head}`.nothrow()
|
||||
if (retry.exitCode !== 0) return true // assume dirty if we can't tell
|
||||
return parseInt(retry.stdout.toString().trim()) > 0
|
||||
}
|
||||
return parseInt(result.stdout.toString().trim()) > 0
|
||||
}
|
||||
|
||||
async function assertPermissions() {
|
||||
// Only called for non-schedule events, so actor is defined
|
||||
console.log(`Asserting permissions for user ${actor}...`)
|
||||
@@ -1309,7 +1261,7 @@ Co-authored-by: ${actor} <${actor}@users.noreply.github.com>"`
|
||||
})
|
||||
}
|
||||
|
||||
async function createPR(base: string, branch: string, title: string, body: string): Promise<number | null> {
|
||||
async function createPR(base: string, branch: string, title: string, body: string) {
|
||||
console.log("Creating pull request...")
|
||||
|
||||
// Check if an open PR already exists for this head→base combination
|
||||
@@ -1334,36 +1286,17 @@ Co-authored-by: ${actor} <${actor}@users.noreply.github.com>"`
|
||||
console.log(`Failed to check for existing PR: ${e}`)
|
||||
}
|
||||
|
||||
// Verify there are commits between base and head before creating the PR.
|
||||
// In shallow clones, the branch can appear dirty but share the same
|
||||
// commit as the base, causing a 422 from GitHub.
|
||||
if (!(await hasNewCommits(base, branch))) {
|
||||
console.log(`No commits between ${base} and ${branch}, skipping PR creation`)
|
||||
return null
|
||||
}
|
||||
|
||||
try {
|
||||
const pr = await withRetry(() =>
|
||||
octoRest.rest.pulls.create({
|
||||
owner,
|
||||
repo,
|
||||
head: branch,
|
||||
base,
|
||||
title,
|
||||
body,
|
||||
}),
|
||||
)
|
||||
return pr.data.number
|
||||
} catch (e: unknown) {
|
||||
// Handle "No commits between X and Y" validation error from GitHub.
|
||||
// This can happen when the branch was pushed but has no new commits
|
||||
// relative to the base (e.g. shallow clone edge cases).
|
||||
if (e instanceof Error && e.message.includes("No commits between")) {
|
||||
console.log(`GitHub rejected PR: ${e.message}`)
|
||||
return null
|
||||
}
|
||||
throw e
|
||||
}
|
||||
const pr = await withRetry(() =>
|
||||
octoRest.rest.pulls.create({
|
||||
owner,
|
||||
repo,
|
||||
head: branch,
|
||||
base,
|
||||
title,
|
||||
body,
|
||||
}),
|
||||
)
|
||||
return pr.data.number
|
||||
}
|
||||
|
||||
async function withRetry<T>(fn: () => Promise<T>, retries = 1, delayMs = 5000): Promise<T> {
|
||||
|
||||
@@ -38,6 +38,8 @@ import { ArgsProvider, useArgs, type Args } from "./context/args"
|
||||
import open from "open"
|
||||
import { writeHeapSnapshot } from "v8"
|
||||
import { PromptRefProvider, usePromptRef } from "./context/prompt"
|
||||
import { TuiConfigProvider } from "./context/tui-config"
|
||||
import { TuiConfig } from "@/config/tui"
|
||||
|
||||
async function getTerminalBackgroundColor(): Promise<"dark" | "light"> {
|
||||
// can't set raw mode if not a TTY
|
||||
@@ -104,6 +106,7 @@ import type { EventSource } from "./context/sdk"
|
||||
export function tui(input: {
|
||||
url: string
|
||||
args: Args
|
||||
config: TuiConfig.Info
|
||||
directory?: string
|
||||
fetch?: typeof fetch
|
||||
headers?: RequestInit["headers"]
|
||||
@@ -138,35 +141,37 @@ export function tui(input: {
|
||||
<KVProvider>
|
||||
<ToastProvider>
|
||||
<RouteProvider>
|
||||
<SDKProvider
|
||||
url={input.url}
|
||||
directory={input.directory}
|
||||
fetch={input.fetch}
|
||||
headers={input.headers}
|
||||
events={input.events}
|
||||
>
|
||||
<SyncProvider>
|
||||
<ThemeProvider mode={mode}>
|
||||
<LocalProvider>
|
||||
<KeybindProvider>
|
||||
<PromptStashProvider>
|
||||
<DialogProvider>
|
||||
<CommandProvider>
|
||||
<FrecencyProvider>
|
||||
<PromptHistoryProvider>
|
||||
<PromptRefProvider>
|
||||
<App />
|
||||
</PromptRefProvider>
|
||||
</PromptHistoryProvider>
|
||||
</FrecencyProvider>
|
||||
</CommandProvider>
|
||||
</DialogProvider>
|
||||
</PromptStashProvider>
|
||||
</KeybindProvider>
|
||||
</LocalProvider>
|
||||
</ThemeProvider>
|
||||
</SyncProvider>
|
||||
</SDKProvider>
|
||||
<TuiConfigProvider config={input.config}>
|
||||
<SDKProvider
|
||||
url={input.url}
|
||||
directory={input.directory}
|
||||
fetch={input.fetch}
|
||||
headers={input.headers}
|
||||
events={input.events}
|
||||
>
|
||||
<SyncProvider>
|
||||
<ThemeProvider mode={mode}>
|
||||
<LocalProvider>
|
||||
<KeybindProvider>
|
||||
<PromptStashProvider>
|
||||
<DialogProvider>
|
||||
<CommandProvider>
|
||||
<FrecencyProvider>
|
||||
<PromptHistoryProvider>
|
||||
<PromptRefProvider>
|
||||
<App />
|
||||
</PromptRefProvider>
|
||||
</PromptHistoryProvider>
|
||||
</FrecencyProvider>
|
||||
</CommandProvider>
|
||||
</DialogProvider>
|
||||
</PromptStashProvider>
|
||||
</KeybindProvider>
|
||||
</LocalProvider>
|
||||
</ThemeProvider>
|
||||
</SyncProvider>
|
||||
</SDKProvider>
|
||||
</TuiConfigProvider>
|
||||
</RouteProvider>
|
||||
</ToastProvider>
|
||||
</KVProvider>
|
||||
|
||||
@@ -2,6 +2,9 @@ import { cmd } from "../cmd"
|
||||
import { UI } from "@/cli/ui"
|
||||
import { tui } from "./app"
|
||||
import { win32DisableProcessedInput, win32InstallCtrlCGuard } from "./win32"
|
||||
import { TuiConfig } from "@/config/tui"
|
||||
import { Instance } from "@/project/instance"
|
||||
import { existsSync } from "fs"
|
||||
|
||||
export const AttachCommand = cmd({
|
||||
command: "attach <url>",
|
||||
@@ -63,8 +66,13 @@ export const AttachCommand = cmd({
|
||||
const auth = `Basic ${Buffer.from(`opencode:${password}`).toString("base64")}`
|
||||
return { Authorization: auth }
|
||||
})()
|
||||
const config = await Instance.provide({
|
||||
directory: directory && existsSync(directory) ? directory : process.cwd(),
|
||||
fn: () => TuiConfig.get(),
|
||||
})
|
||||
await tui({
|
||||
url: args.url,
|
||||
config,
|
||||
args: {
|
||||
continue: args.continue,
|
||||
sessionID: args.session,
|
||||
|
||||
@@ -2,7 +2,8 @@ import path from "path"
|
||||
import { Global } from "@/global"
|
||||
import { Filesystem } from "@/util/filesystem"
|
||||
import { onMount } from "solid-js"
|
||||
import { createStore, produce, unwrap } from "solid-js/store"
|
||||
import { createStore, produce } from "solid-js/store"
|
||||
import { clone } from "remeda"
|
||||
import { createSimpleContext } from "../../context/helper"
|
||||
import { appendFile, writeFile } from "fs/promises"
|
||||
import type { AgentPart, FilePart, TextPart } from "@opencode-ai/sdk/v2"
|
||||
@@ -82,7 +83,7 @@ export const { use: usePromptHistory, provider: PromptHistoryProvider } = create
|
||||
return store.history.at(store.index)
|
||||
},
|
||||
append(item: PromptInfo) {
|
||||
const entry = structuredClone(unwrap(item))
|
||||
const entry = clone(item)
|
||||
let trimmed = false
|
||||
setStore(
|
||||
produce((draft) => {
|
||||
|
||||
@@ -2,7 +2,8 @@ import path from "path"
|
||||
import { Global } from "@/global"
|
||||
import { Filesystem } from "@/util/filesystem"
|
||||
import { onMount } from "solid-js"
|
||||
import { createStore, produce, unwrap } from "solid-js/store"
|
||||
import { createStore, produce } from "solid-js/store"
|
||||
import { clone } from "remeda"
|
||||
import { createSimpleContext } from "../../context/helper"
|
||||
import { appendFile, writeFile } from "fs/promises"
|
||||
import type { PromptInfo } from "./history"
|
||||
@@ -52,7 +53,7 @@ export const { use: usePromptStash, provider: PromptStashProvider } = createSimp
|
||||
return store.entries
|
||||
},
|
||||
push(entry: Omit<StashEntry, "timestamp">) {
|
||||
const stash = structuredClone(unwrap({ ...entry, timestamp: Date.now() }))
|
||||
const stash = clone({ ...entry, timestamp: Date.now() })
|
||||
let trimmed = false
|
||||
setStore(
|
||||
produce((draft) => {
|
||||
|
||||
@@ -80,11 +80,11 @@ const TIPS = [
|
||||
"Switch to {highlight}Plan{/highlight} agent to get suggestions without making actual changes",
|
||||
"Use {highlight}@agent-name{/highlight} in prompts to invoke specialized subagents",
|
||||
"Press {highlight}Ctrl+X Right/Left{/highlight} to cycle through parent and child sessions",
|
||||
"Create {highlight}opencode.json{/highlight} in project root for project-specific settings",
|
||||
"Place settings in {highlight}~/.config/opencode/opencode.json{/highlight} for global config",
|
||||
"Create {highlight}opencode.json{/highlight} for server settings and {highlight}tui.json{/highlight} for TUI settings",
|
||||
"Place TUI settings in {highlight}~/.config/opencode/tui.json{/highlight} for global config",
|
||||
"Add {highlight}$schema{/highlight} to your config for autocomplete in your editor",
|
||||
"Configure {highlight}model{/highlight} in config to set your default model",
|
||||
"Override any keybind in config via the {highlight}keybinds{/highlight} section",
|
||||
"Override any keybind in {highlight}tui.json{/highlight} via the {highlight}keybinds{/highlight} section",
|
||||
"Set any keybind to {highlight}none{/highlight} to disable it completely",
|
||||
"Configure local or remote MCP servers in the {highlight}mcp{/highlight} config section",
|
||||
"OpenCode auto-handles OAuth for remote MCP servers requiring auth",
|
||||
@@ -140,7 +140,7 @@ const TIPS = [
|
||||
"Press {highlight}Ctrl+X G{/highlight} or {highlight}/timeline{/highlight} to jump to specific messages",
|
||||
"Press {highlight}Ctrl+X H{/highlight} to toggle code block visibility in messages",
|
||||
"Press {highlight}Ctrl+X S{/highlight} or {highlight}/status{/highlight} to see system status info",
|
||||
"Enable {highlight}tui.scroll_acceleration{/highlight} for smooth macOS-style scrolling",
|
||||
"Enable {highlight}scroll_acceleration{/highlight} in {highlight}tui.json{/highlight} for smooth macOS-style scrolling",
|
||||
"Toggle username display in chat via command palette ({highlight}Ctrl+P{/highlight})",
|
||||
"Run {highlight}docker run -it --rm ghcr.io/anomalyco/opencode{/highlight} for containerized use",
|
||||
"Use {highlight}/connect{/highlight} with OpenCode Zen for curated, tested models",
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
import { createMemo } from "solid-js"
|
||||
import { useSync } from "@tui/context/sync"
|
||||
import { Keybind } from "@/util/keybind"
|
||||
import { pipe, mapValues } from "remeda"
|
||||
import type { KeybindsConfig } from "@opencode-ai/sdk/v2"
|
||||
@@ -7,14 +6,15 @@ import type { ParsedKey, Renderable } from "@opentui/core"
|
||||
import { createStore } from "solid-js/store"
|
||||
import { useKeyboard, useRenderer } from "@opentui/solid"
|
||||
import { createSimpleContext } from "./helper"
|
||||
import { useTuiConfig } from "./tui-config"
|
||||
|
||||
export const { use: useKeybind, provider: KeybindProvider } = createSimpleContext({
|
||||
name: "Keybind",
|
||||
init: () => {
|
||||
const sync = useSync()
|
||||
const keybinds = createMemo(() => {
|
||||
const config = useTuiConfig()
|
||||
const keybinds = createMemo<Record<string, Keybind.Info[]>>(() => {
|
||||
return pipe(
|
||||
sync.data.config.keybinds ?? {},
|
||||
(config.keybinds ?? {}) as Record<string, string>,
|
||||
mapValues((value) => Keybind.parse(value)),
|
||||
)
|
||||
})
|
||||
|
||||
@@ -1,9 +1,7 @@
|
||||
import { SyntaxStyle, RGBA, type TerminalColors } from "@opentui/core"
|
||||
import path from "path"
|
||||
import { createEffect, createMemo, onMount } from "solid-js"
|
||||
import { useSync } from "@tui/context/sync"
|
||||
import { createSimpleContext } from "./helper"
|
||||
import { Glob } from "../../../../util/glob"
|
||||
import aura from "./theme/aura.json" with { type: "json" }
|
||||
import ayu from "./theme/ayu.json" with { type: "json" }
|
||||
import catppuccin from "./theme/catppuccin.json" with { type: "json" }
|
||||
@@ -42,6 +40,7 @@ import { useRenderer } from "@opentui/solid"
|
||||
import { createStore, produce } from "solid-js/store"
|
||||
import { Global } from "@/global"
|
||||
import { Filesystem } from "@/util/filesystem"
|
||||
import { useTuiConfig } from "./tui-config"
|
||||
|
||||
type ThemeColors = {
|
||||
primary: RGBA
|
||||
@@ -280,17 +279,17 @@ function ansiToRgba(code: number): RGBA {
|
||||
export const { use: useTheme, provider: ThemeProvider } = createSimpleContext({
|
||||
name: "Theme",
|
||||
init: (props: { mode: "dark" | "light" }) => {
|
||||
const sync = useSync()
|
||||
const config = useTuiConfig()
|
||||
const kv = useKV()
|
||||
const [store, setStore] = createStore({
|
||||
themes: DEFAULT_THEMES,
|
||||
mode: kv.get("theme_mode", props.mode),
|
||||
active: (sync.data.config.theme ?? kv.get("theme", "opencode")) as string,
|
||||
active: (config.theme ?? kv.get("theme", "opencode")) as string,
|
||||
ready: false,
|
||||
})
|
||||
|
||||
createEffect(() => {
|
||||
const theme = sync.data.config.theme
|
||||
const theme = config.theme
|
||||
if (theme) setStore("active", theme)
|
||||
})
|
||||
|
||||
@@ -392,6 +391,7 @@ export const { use: useTheme, provider: ThemeProvider } = createSimpleContext({
|
||||
},
|
||||
})
|
||||
|
||||
const CUSTOM_THEME_GLOB = new Bun.Glob("themes/*.json")
|
||||
async function getCustomThemes() {
|
||||
const directories = [
|
||||
Global.Path.config,
|
||||
@@ -405,11 +405,11 @@ async function getCustomThemes() {
|
||||
|
||||
const result: Record<string, ThemeJson> = {}
|
||||
for (const dir of directories) {
|
||||
for (const item of await Glob.scan("themes/*.json", {
|
||||
cwd: dir,
|
||||
for await (const item of CUSTOM_THEME_GLOB.scan({
|
||||
absolute: true,
|
||||
followSymlinks: true,
|
||||
dot: true,
|
||||
symlink: true,
|
||||
cwd: dir,
|
||||
})) {
|
||||
const name = path.basename(item, ".json")
|
||||
result[name] = await Filesystem.readJson(item)
|
||||
|
||||
9
packages/opencode/src/cli/cmd/tui/context/tui-config.tsx
Normal file
9
packages/opencode/src/cli/cmd/tui/context/tui-config.tsx
Normal file
@@ -0,0 +1,9 @@
|
||||
import { TuiConfig } from "@/config/tui"
|
||||
import { createSimpleContext } from "./helper"
|
||||
|
||||
export const { use: useTuiConfig, provider: TuiConfigProvider } = createSimpleContext({
|
||||
name: "TuiConfig",
|
||||
init: (props: { config: TuiConfig.Info }) => {
|
||||
return props.config
|
||||
},
|
||||
})
|
||||
@@ -78,6 +78,7 @@ import { QuestionPrompt } from "./question"
|
||||
import { DialogExportOptions } from "../../ui/dialog-export-options"
|
||||
import { formatTranscript } from "../../util/transcript"
|
||||
import { UI } from "@/cli/ui.ts"
|
||||
import { useTuiConfig } from "../../context/tui-config"
|
||||
|
||||
addDefaultParsers(parsers.parsers)
|
||||
|
||||
@@ -98,9 +99,9 @@ const context = createContext<{
|
||||
showThinking: () => boolean
|
||||
showTimestamps: () => boolean
|
||||
showDetails: () => boolean
|
||||
showGenericToolOutput: () => boolean
|
||||
diffWrapMode: () => "word" | "none"
|
||||
sync: ReturnType<typeof useSync>
|
||||
tui: ReturnType<typeof useTuiConfig>
|
||||
}>()
|
||||
|
||||
function use() {
|
||||
@@ -113,6 +114,7 @@ export function Session() {
|
||||
const route = useRouteData("session")
|
||||
const { navigate } = useRoute()
|
||||
const sync = useSync()
|
||||
const tuiConfig = useTuiConfig()
|
||||
const kv = useKV()
|
||||
const { theme } = useTheme()
|
||||
const promptRef = usePromptRef()
|
||||
@@ -153,7 +155,6 @@ export function Session() {
|
||||
const [showHeader, setShowHeader] = kv.signal("header_visible", true)
|
||||
const [diffWrapMode] = kv.signal<"word" | "none">("diff_wrap_mode", "word")
|
||||
const [animationsEnabled, setAnimationsEnabled] = kv.signal("animations_enabled", true)
|
||||
const [showGenericToolOutput, setShowGenericToolOutput] = kv.signal("generic_tool_output_visibility", false)
|
||||
|
||||
const wide = createMemo(() => dimensions().width > 120)
|
||||
const sidebarVisible = createMemo(() => {
|
||||
@@ -166,7 +167,7 @@ export function Session() {
|
||||
const contentWidth = createMemo(() => dimensions().width - (sidebarVisible() ? 42 : 0) - 4)
|
||||
|
||||
const scrollAcceleration = createMemo(() => {
|
||||
const tui = sync.data.config.tui
|
||||
const tui = tuiConfig
|
||||
if (tui?.scroll_acceleration?.enabled) {
|
||||
return new MacOSScrollAccel()
|
||||
}
|
||||
@@ -602,15 +603,6 @@ export function Session() {
|
||||
dialog.clear()
|
||||
},
|
||||
},
|
||||
{
|
||||
title: showGenericToolOutput() ? "Hide generic tool output" : "Show generic tool output",
|
||||
value: "session.toggle.generic_tool_output",
|
||||
category: "Session",
|
||||
onSelect: (dialog) => {
|
||||
setShowGenericToolOutput((prev) => !prev)
|
||||
dialog.clear()
|
||||
},
|
||||
},
|
||||
{
|
||||
title: "Page up",
|
||||
value: "session.page.up",
|
||||
@@ -985,9 +977,9 @@ export function Session() {
|
||||
showThinking,
|
||||
showTimestamps,
|
||||
showDetails,
|
||||
showGenericToolOutput,
|
||||
diffWrapMode,
|
||||
sync,
|
||||
tui: tuiConfig,
|
||||
}}
|
||||
>
|
||||
<box flexDirection="row">
|
||||
@@ -1520,40 +1512,10 @@ type ToolProps<T extends Tool.Info> = {
|
||||
part: ToolPart
|
||||
}
|
||||
function GenericTool(props: ToolProps<any>) {
|
||||
const { theme } = useTheme()
|
||||
const ctx = use()
|
||||
const output = createMemo(() => props.output?.trim() ?? "")
|
||||
const [expanded, setExpanded] = createSignal(false)
|
||||
const lines = createMemo(() => output().split("\n"))
|
||||
const maxLines = 3
|
||||
const overflow = createMemo(() => lines().length > maxLines)
|
||||
const limited = createMemo(() => {
|
||||
if (expanded() || !overflow()) return output()
|
||||
return [...lines().slice(0, maxLines), "…"].join("\n")
|
||||
})
|
||||
|
||||
return (
|
||||
<Show
|
||||
when={props.output && ctx.showGenericToolOutput()}
|
||||
fallback={
|
||||
<InlineTool icon="⚙" pending="Writing command..." complete={true} part={props.part}>
|
||||
{props.tool} {input(props.input)}
|
||||
</InlineTool>
|
||||
}
|
||||
>
|
||||
<BlockTool
|
||||
title={`# ${props.tool} ${input(props.input)}`}
|
||||
part={props.part}
|
||||
onClick={overflow() ? () => setExpanded((prev) => !prev) : undefined}
|
||||
>
|
||||
<box gap={1}>
|
||||
<text fg={theme.text}>{limited()}</text>
|
||||
<Show when={overflow()}>
|
||||
<text fg={theme.textMuted}>{expanded() ? "Click to collapse" : "Click to expand"}</text>
|
||||
</Show>
|
||||
</box>
|
||||
</BlockTool>
|
||||
</Show>
|
||||
<InlineTool icon="⚙" pending="Writing command..." complete={true} part={props.part}>
|
||||
{props.tool} {input(props.input)}
|
||||
</InlineTool>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -1962,7 +1924,7 @@ function Edit(props: ToolProps<typeof EditTool>) {
|
||||
const { theme, syntax } = useTheme()
|
||||
|
||||
const view = createMemo(() => {
|
||||
const diffStyle = ctx.sync.data.config.tui?.diff_style
|
||||
const diffStyle = ctx.tui.diff_style
|
||||
if (diffStyle === "stacked") return "unified"
|
||||
// Default to "auto" behavior
|
||||
return ctx.width > 120 ? "split" : "unified"
|
||||
@@ -2033,7 +1995,7 @@ function ApplyPatch(props: ToolProps<typeof ApplyPatchTool>) {
|
||||
const files = createMemo(() => props.metadata.files ?? [])
|
||||
|
||||
const view = createMemo(() => {
|
||||
const diffStyle = ctx.sync.data.config.tui?.diff_style
|
||||
const diffStyle = ctx.tui.diff_style
|
||||
if (diffStyle === "stacked") return "unified"
|
||||
return ctx.width > 120 ? "split" : "unified"
|
||||
})
|
||||
|
||||
@@ -15,6 +15,7 @@ import { Keybind } from "@/util/keybind"
|
||||
import { Locale } from "@/util/locale"
|
||||
import { Global } from "@/global"
|
||||
import { useDialog } from "../../ui/dialog"
|
||||
import { useTuiConfig } from "../../context/tui-config"
|
||||
|
||||
type PermissionStage = "permission" | "always" | "reject"
|
||||
|
||||
@@ -48,14 +49,14 @@ function EditBody(props: { request: PermissionRequest }) {
|
||||
const themeState = useTheme()
|
||||
const theme = themeState.theme
|
||||
const syntax = themeState.syntax
|
||||
const sync = useSync()
|
||||
const config = useTuiConfig()
|
||||
const dimensions = useTerminalDimensions()
|
||||
|
||||
const filepath = createMemo(() => (props.request.metadata?.filepath as string) ?? "")
|
||||
const diff = createMemo(() => (props.request.metadata?.diff as string) ?? "")
|
||||
|
||||
const view = createMemo(() => {
|
||||
const diffStyle = sync.data.config.tui?.diff_style
|
||||
const diffStyle = config.diff_style
|
||||
if (diffStyle === "stacked") return "unified"
|
||||
return dimensions().width > 120 ? "split" : "unified"
|
||||
})
|
||||
|
||||
@@ -12,6 +12,8 @@ import { Filesystem } from "@/util/filesystem"
|
||||
import type { Event } from "@opencode-ai/sdk/v2"
|
||||
import type { EventSource } from "./context/sdk"
|
||||
import { win32DisableProcessedInput, win32InstallCtrlCGuard } from "./win32"
|
||||
import { TuiConfig } from "@/config/tui"
|
||||
import { Instance } from "@/project/instance"
|
||||
|
||||
declare global {
|
||||
const OPENCODE_WORKER_PATH: string
|
||||
@@ -135,6 +137,10 @@ export const TuiThreadCommand = cmd({
|
||||
if (!args.prompt) return piped
|
||||
return piped ? piped + "\n" + args.prompt : args.prompt
|
||||
})
|
||||
const config = await Instance.provide({
|
||||
directory: cwd,
|
||||
fn: () => TuiConfig.get(),
|
||||
})
|
||||
|
||||
// Check if server should be started (port or hostname explicitly set in CLI or config)
|
||||
const networkOpts = await resolveNetworkOptions(args)
|
||||
@@ -163,6 +169,8 @@ export const TuiThreadCommand = cmd({
|
||||
|
||||
const tuiPromise = tui({
|
||||
url,
|
||||
config,
|
||||
directory: cwd,
|
||||
fetch: customFetch,
|
||||
events,
|
||||
args: {
|
||||
|
||||
@@ -3,7 +3,6 @@ import path from "path"
|
||||
import { pathToFileURL } from "url"
|
||||
import os from "os"
|
||||
import z from "zod"
|
||||
import { Filesystem } from "../util/filesystem"
|
||||
import { ModelsDev } from "../provider/models"
|
||||
import { mergeDeep, pipe, unique } from "remeda"
|
||||
import { Global } from "../global"
|
||||
@@ -28,11 +27,12 @@ import { constants, existsSync } from "fs"
|
||||
import { Bus } from "@/bus"
|
||||
import { GlobalBus } from "@/bus/global"
|
||||
import { Event } from "../server/event"
|
||||
import { Glob } from "../util/glob"
|
||||
import { PackageRegistry } from "@/bun/registry"
|
||||
import { proxied } from "@/util/proxied"
|
||||
import { iife } from "@/util/iife"
|
||||
import { Control } from "@/control"
|
||||
import { ConfigPaths } from "./paths"
|
||||
import { Filesystem } from "@/util/filesystem"
|
||||
|
||||
export namespace Config {
|
||||
const ModelId = z.string().meta({ $ref: "https://models.dev/model-schema.json#/$defs/Model" })
|
||||
@@ -41,7 +41,7 @@ export namespace Config {
|
||||
|
||||
// Managed settings directory for enterprise deployments (highest priority, admin-controlled)
|
||||
// These settings override all user and project settings
|
||||
function getManagedConfigDir(): string {
|
||||
function systemManagedConfigDir(): string {
|
||||
switch (process.platform) {
|
||||
case "darwin":
|
||||
return "/Library/Application Support/opencode"
|
||||
@@ -52,10 +52,14 @@ export namespace Config {
|
||||
}
|
||||
}
|
||||
|
||||
const managedConfigDir = process.env.OPENCODE_TEST_MANAGED_CONFIG_DIR || getManagedConfigDir()
|
||||
export function managedConfigDir() {
|
||||
return process.env.OPENCODE_TEST_MANAGED_CONFIG_DIR || systemManagedConfigDir()
|
||||
}
|
||||
|
||||
const managedDir = managedConfigDir()
|
||||
|
||||
// Custom merge function that concatenates array fields instead of replacing them
|
||||
function merge(target: Info, source: Info): Info {
|
||||
function mergeConfigConcatArrays(target: Info, source: Info): Info {
|
||||
const merged = mergeDeep(target, source)
|
||||
if (target.plugin && source.plugin) {
|
||||
merged.plugin = Array.from(new Set([...target.plugin, ...source.plugin]))
|
||||
@@ -90,7 +94,7 @@ export namespace Config {
|
||||
const remoteConfig = wellknown.config ?? {}
|
||||
// Add $schema to prevent load() from trying to write back to a non-existent file
|
||||
if (!remoteConfig.$schema) remoteConfig.$schema = "https://opencode.ai/config.json"
|
||||
result = merge(
|
||||
result = mergeConfigConcatArrays(
|
||||
result,
|
||||
await load(JSON.stringify(remoteConfig), {
|
||||
dir: path.dirname(`${key}/.well-known/opencode`),
|
||||
@@ -106,21 +110,18 @@ export namespace Config {
|
||||
}
|
||||
|
||||
// Global user config overrides remote config.
|
||||
result = merge(result, await global())
|
||||
result = mergeConfigConcatArrays(result, await global())
|
||||
|
||||
// Custom config path overrides global config.
|
||||
if (Flag.OPENCODE_CONFIG) {
|
||||
result = merge(result, await loadFile(Flag.OPENCODE_CONFIG))
|
||||
result = mergeConfigConcatArrays(result, await loadFile(Flag.OPENCODE_CONFIG))
|
||||
log.debug("loaded custom config", { path: Flag.OPENCODE_CONFIG })
|
||||
}
|
||||
|
||||
// Project config overrides global and remote config.
|
||||
if (!Flag.OPENCODE_DISABLE_PROJECT_CONFIG) {
|
||||
for (const file of ["opencode.jsonc", "opencode.json"]) {
|
||||
const found = await Filesystem.findUp(file, Instance.directory, Instance.worktree)
|
||||
for (const resolved of found.toReversed()) {
|
||||
result = merge(result, await loadFile(resolved))
|
||||
}
|
||||
for (const file of await ConfigPaths.projectFiles("opencode", Instance.directory, Instance.worktree)) {
|
||||
result = mergeConfigConcatArrays(result, await loadFile(file))
|
||||
}
|
||||
}
|
||||
|
||||
@@ -128,31 +129,10 @@ export namespace Config {
|
||||
result.mode = result.mode || {}
|
||||
result.plugin = result.plugin || []
|
||||
|
||||
const directories = [
|
||||
Global.Path.config,
|
||||
// Only scan project .opencode/ directories when project discovery is enabled
|
||||
...(!Flag.OPENCODE_DISABLE_PROJECT_CONFIG
|
||||
? await Array.fromAsync(
|
||||
Filesystem.up({
|
||||
targets: [".opencode"],
|
||||
start: Instance.directory,
|
||||
stop: Instance.worktree,
|
||||
}),
|
||||
)
|
||||
: []),
|
||||
// Always scan ~/.opencode/ (user home directory)
|
||||
...(await Array.fromAsync(
|
||||
Filesystem.up({
|
||||
targets: [".opencode"],
|
||||
start: Global.Path.home,
|
||||
stop: Global.Path.home,
|
||||
}),
|
||||
)),
|
||||
]
|
||||
const directories = await ConfigPaths.directories(Instance.directory, Instance.worktree)
|
||||
|
||||
// .opencode directory config overrides (project and global) config sources.
|
||||
if (Flag.OPENCODE_CONFIG_DIR) {
|
||||
directories.push(Flag.OPENCODE_CONFIG_DIR)
|
||||
log.debug("loading config from OPENCODE_CONFIG_DIR", { path: Flag.OPENCODE_CONFIG_DIR })
|
||||
}
|
||||
|
||||
@@ -162,7 +142,7 @@ export namespace Config {
|
||||
if (dir.endsWith(".opencode") || dir === Flag.OPENCODE_CONFIG_DIR) {
|
||||
for (const file of ["opencode.jsonc", "opencode.json"]) {
|
||||
log.debug(`loading config from ${path.join(dir, file)}`)
|
||||
result = merge(result, await loadFile(path.join(dir, file)))
|
||||
result = mergeConfigConcatArrays(result, await loadFile(path.join(dir, file)))
|
||||
// to satisfy the type checker
|
||||
result.agent ??= {}
|
||||
result.mode ??= {}
|
||||
@@ -185,7 +165,7 @@ export namespace Config {
|
||||
|
||||
// Inline config content overrides all non-managed config sources.
|
||||
if (process.env.OPENCODE_CONFIG_CONTENT) {
|
||||
result = merge(
|
||||
result = mergeConfigConcatArrays(
|
||||
result,
|
||||
await load(process.env.OPENCODE_CONFIG_CONTENT, {
|
||||
dir: Instance.directory,
|
||||
@@ -199,9 +179,9 @@ export namespace Config {
|
||||
// Kept separate from directories array to avoid write operations when installing plugins
|
||||
// which would fail on system directories requiring elevated permissions
|
||||
// This way it only loads config file and not skills/plugins/commands
|
||||
if (existsSync(managedConfigDir)) {
|
||||
if (existsSync(managedDir)) {
|
||||
for (const file of ["opencode.jsonc", "opencode.json"]) {
|
||||
result = merge(result, await loadFile(path.join(managedConfigDir, file)))
|
||||
result = mergeConfigConcatArrays(result, await loadFile(path.join(managedDir, file)))
|
||||
}
|
||||
}
|
||||
|
||||
@@ -240,8 +220,6 @@ export namespace Config {
|
||||
result.share = "auto"
|
||||
}
|
||||
|
||||
if (!result.keybinds) result.keybinds = Info.shape.keybinds.parse({})
|
||||
|
||||
// Apply flag overrides for compaction settings
|
||||
if (Flag.OPENCODE_DISABLE_AUTOCOMPACT) {
|
||||
result.compaction = { ...result.compaction, auto: false }
|
||||
@@ -292,9 +270,7 @@ export namespace Config {
|
||||
...(proxied() ? ["--no-cache"] : []),
|
||||
],
|
||||
{ cwd: dir },
|
||||
).catch((err) => {
|
||||
log.warn("failed to install dependencies", { dir, error: err })
|
||||
})
|
||||
).catch(() => {})
|
||||
}
|
||||
|
||||
async function isWritable(dir: string) {
|
||||
@@ -306,7 +282,7 @@ export namespace Config {
|
||||
}
|
||||
}
|
||||
|
||||
async function needsInstall(dir: string) {
|
||||
export async function needsInstall(dir: string) {
|
||||
// Some config dirs may be read-only.
|
||||
// Installing deps there will fail; skip installation in that case.
|
||||
const writable = await isWritable(dir)
|
||||
@@ -354,13 +330,14 @@ export namespace Config {
|
||||
return ext.length ? file.slice(0, -ext.length) : file
|
||||
}
|
||||
|
||||
const COMMAND_GLOB = new Bun.Glob("{command,commands}/**/*.md")
|
||||
async function loadCommand(dir: string) {
|
||||
const result: Record<string, Command> = {}
|
||||
for (const item of await Glob.scan("{command,commands}/**/*.md", {
|
||||
cwd: dir,
|
||||
for await (const item of COMMAND_GLOB.scan({
|
||||
absolute: true,
|
||||
followSymlinks: true,
|
||||
dot: true,
|
||||
symlink: true,
|
||||
cwd: dir,
|
||||
})) {
|
||||
const md = await ConfigMarkdown.parse(item).catch(async (err) => {
|
||||
const message = ConfigMarkdown.FrontmatterError.isInstance(err)
|
||||
@@ -392,14 +369,15 @@ export namespace Config {
|
||||
return result
|
||||
}
|
||||
|
||||
const AGENT_GLOB = new Bun.Glob("{agent,agents}/**/*.md")
|
||||
async function loadAgent(dir: string) {
|
||||
const result: Record<string, Agent> = {}
|
||||
|
||||
for (const item of await Glob.scan("{agent,agents}/**/*.md", {
|
||||
cwd: dir,
|
||||
for await (const item of AGENT_GLOB.scan({
|
||||
absolute: true,
|
||||
followSymlinks: true,
|
||||
dot: true,
|
||||
symlink: true,
|
||||
cwd: dir,
|
||||
})) {
|
||||
const md = await ConfigMarkdown.parse(item).catch(async (err) => {
|
||||
const message = ConfigMarkdown.FrontmatterError.isInstance(err)
|
||||
@@ -431,13 +409,14 @@ export namespace Config {
|
||||
return result
|
||||
}
|
||||
|
||||
const MODE_GLOB = new Bun.Glob("{mode,modes}/*.md")
|
||||
async function loadMode(dir: string) {
|
||||
const result: Record<string, Agent> = {}
|
||||
for (const item of await Glob.scan("{mode,modes}/*.md", {
|
||||
cwd: dir,
|
||||
for await (const item of MODE_GLOB.scan({
|
||||
absolute: true,
|
||||
followSymlinks: true,
|
||||
dot: true,
|
||||
symlink: true,
|
||||
cwd: dir,
|
||||
})) {
|
||||
const md = await ConfigMarkdown.parse(item).catch(async (err) => {
|
||||
const message = ConfigMarkdown.FrontmatterError.isInstance(err)
|
||||
@@ -467,14 +446,15 @@ export namespace Config {
|
||||
return result
|
||||
}
|
||||
|
||||
const PLUGIN_GLOB = new Bun.Glob("{plugin,plugins}/*.{ts,js}")
|
||||
async function loadPlugin(dir: string) {
|
||||
const plugins: string[] = []
|
||||
|
||||
for (const item of await Glob.scan("{plugin,plugins}/*.{ts,js}", {
|
||||
cwd: dir,
|
||||
for await (const item of PLUGIN_GLOB.scan({
|
||||
absolute: true,
|
||||
followSymlinks: true,
|
||||
dot: true,
|
||||
symlink: true,
|
||||
cwd: dir,
|
||||
})) {
|
||||
plugins.push(pathToFileURL(item).href)
|
||||
}
|
||||
@@ -929,20 +909,6 @@ export namespace Config {
|
||||
ref: "KeybindsConfig",
|
||||
})
|
||||
|
||||
export const TUI = z.object({
|
||||
scroll_speed: z.number().min(0.001).optional().describe("TUI scroll speed"),
|
||||
scroll_acceleration: z
|
||||
.object({
|
||||
enabled: z.boolean().describe("Enable scroll acceleration"),
|
||||
})
|
||||
.optional()
|
||||
.describe("Scroll acceleration settings"),
|
||||
diff_style: z
|
||||
.enum(["auto", "stacked"])
|
||||
.optional()
|
||||
.describe("Control diff rendering style: 'auto' adapts to terminal width, 'stacked' always shows single column"),
|
||||
})
|
||||
|
||||
export const Server = z
|
||||
.object({
|
||||
port: z.number().int().positive().optional().describe("Port to listen on"),
|
||||
@@ -1017,10 +983,7 @@ export namespace Config {
|
||||
export const Info = z
|
||||
.object({
|
||||
$schema: z.string().optional().describe("JSON schema reference for configuration validation"),
|
||||
theme: z.string().optional().describe("Theme name to use for the interface"),
|
||||
keybinds: Keybinds.optional().describe("Custom keybind configurations"),
|
||||
logLevel: Log.Level.optional().describe("Log level"),
|
||||
tui: TUI.optional().describe("TUI specific settings"),
|
||||
server: Server.optional().describe("Server configuration for opencode serve and web commands"),
|
||||
command: z
|
||||
.record(z.string(), Command)
|
||||
@@ -1240,86 +1203,37 @@ export namespace Config {
|
||||
return result
|
||||
})
|
||||
|
||||
export const { readFile } = ConfigPaths
|
||||
|
||||
async function loadFile(filepath: string): Promise<Info> {
|
||||
log.info("loading", { path: filepath })
|
||||
let text = await Filesystem.readText(filepath).catch((err: any) => {
|
||||
if (err.code === "ENOENT") return
|
||||
throw new JsonError({ path: filepath }, { cause: err })
|
||||
})
|
||||
const text = await readFile(filepath)
|
||||
if (!text) return {}
|
||||
return load(text, { path: filepath })
|
||||
}
|
||||
|
||||
async function load(text: string, options: { path: string } | { dir: string; source: string }) {
|
||||
const original = text
|
||||
const configDir = "path" in options ? path.dirname(options.path) : options.dir
|
||||
const source = "path" in options ? options.path : options.source
|
||||
const isFile = "path" in options
|
||||
const data = await ConfigPaths.parseText(
|
||||
text,
|
||||
"path" in options ? options.path : { source: options.source, dir: options.dir },
|
||||
)
|
||||
|
||||
text = text.replace(/\{env:([^}]+)\}/g, (_, varName) => {
|
||||
return process.env[varName] || ""
|
||||
})
|
||||
const normalized = (() => {
|
||||
if (!data || typeof data !== "object" || Array.isArray(data)) return data
|
||||
const copy = { ...(data as Record<string, unknown>) }
|
||||
const hadLegacy = "theme" in copy || "keybinds" in copy || "tui" in copy
|
||||
if (!hadLegacy) return copy
|
||||
delete copy.theme
|
||||
delete copy.keybinds
|
||||
delete copy.tui
|
||||
log.warn("tui keys in opencode config are deprecated; move them to tui.json", { path: source })
|
||||
return copy
|
||||
})()
|
||||
|
||||
const fileMatches = text.match(/\{file:[^}]+\}/g)
|
||||
if (fileMatches) {
|
||||
const lines = text.split("\n")
|
||||
|
||||
for (const match of fileMatches) {
|
||||
const lineIndex = lines.findIndex((line) => line.includes(match))
|
||||
if (lineIndex !== -1 && lines[lineIndex].trim().startsWith("//")) {
|
||||
continue
|
||||
}
|
||||
let filePath = match.replace(/^\{file:/, "").replace(/\}$/, "")
|
||||
if (filePath.startsWith("~/")) {
|
||||
filePath = path.join(os.homedir(), filePath.slice(2))
|
||||
}
|
||||
const resolvedPath = path.isAbsolute(filePath) ? filePath : path.resolve(configDir, filePath)
|
||||
const fileContent = (
|
||||
await Bun.file(resolvedPath)
|
||||
.text()
|
||||
.catch((error) => {
|
||||
const errMsg = `bad file reference: "${match}"`
|
||||
if (error.code === "ENOENT") {
|
||||
throw new InvalidError(
|
||||
{
|
||||
path: source,
|
||||
message: errMsg + ` ${resolvedPath} does not exist`,
|
||||
},
|
||||
{ cause: error },
|
||||
)
|
||||
}
|
||||
throw new InvalidError({ path: source, message: errMsg }, { cause: error })
|
||||
})
|
||||
).trim()
|
||||
text = text.replace(match, () => JSON.stringify(fileContent).slice(1, -1))
|
||||
}
|
||||
}
|
||||
|
||||
const errors: JsoncParseError[] = []
|
||||
const data = parseJsonc(text, errors, { allowTrailingComma: true })
|
||||
if (errors.length) {
|
||||
const lines = text.split("\n")
|
||||
const errorDetails = errors
|
||||
.map((e) => {
|
||||
const beforeOffset = text.substring(0, e.offset).split("\n")
|
||||
const line = beforeOffset.length
|
||||
const column = beforeOffset[beforeOffset.length - 1].length + 1
|
||||
const problemLine = lines[line - 1]
|
||||
|
||||
const error = `${printParseErrorCode(e.error)} at line ${line}, column ${column}`
|
||||
if (!problemLine) return error
|
||||
|
||||
return `${error}\n Line ${line}: ${problemLine}\n${"".padStart(column + 9)}^`
|
||||
})
|
||||
.join("\n")
|
||||
|
||||
throw new JsonError({
|
||||
path: source,
|
||||
message: `\n--- JSONC Input ---\n${text}\n--- Errors ---\n${errorDetails}\n--- End ---`,
|
||||
})
|
||||
}
|
||||
|
||||
const parsed = Info.safeParse(data)
|
||||
const parsed = Info.safeParse(normalized)
|
||||
if (parsed.success) {
|
||||
if (!parsed.data.$schema && isFile) {
|
||||
parsed.data.$schema = "https://opencode.ai/config.json"
|
||||
@@ -1343,13 +1257,7 @@ export namespace Config {
|
||||
issues: parsed.error.issues,
|
||||
})
|
||||
}
|
||||
export const JsonError = NamedError.create(
|
||||
"ConfigJsonError",
|
||||
z.object({
|
||||
path: z.string(),
|
||||
message: z.string().optional(),
|
||||
}),
|
||||
)
|
||||
export const { JsonError, InvalidError } = ConfigPaths
|
||||
|
||||
export const ConfigDirectoryTypoError = NamedError.create(
|
||||
"ConfigDirectoryTypoError",
|
||||
@@ -1360,15 +1268,6 @@ export namespace Config {
|
||||
}),
|
||||
)
|
||||
|
||||
export const InvalidError = NamedError.create(
|
||||
"ConfigInvalidError",
|
||||
z.object({
|
||||
path: z.string(),
|
||||
issues: z.custom<z.core.$ZodIssue[]>().optional(),
|
||||
message: z.string().optional(),
|
||||
}),
|
||||
)
|
||||
|
||||
export async function get() {
|
||||
return state().then((x) => x.config)
|
||||
}
|
||||
|
||||
155
packages/opencode/src/config/migrate-tui-config.ts
Normal file
155
packages/opencode/src/config/migrate-tui-config.ts
Normal file
@@ -0,0 +1,155 @@
|
||||
import path from "path"
|
||||
import { type ParseError as JsoncParseError, applyEdits, modify, parse as parseJsonc } from "jsonc-parser"
|
||||
import { unique } from "remeda"
|
||||
import z from "zod"
|
||||
import { ConfigPaths } from "./paths"
|
||||
import { TuiInfo, TuiOptions } from "./tui-schema"
|
||||
import { Instance } from "@/project/instance"
|
||||
import { Flag } from "@/flag/flag"
|
||||
import { Log } from "@/util/log"
|
||||
import { Filesystem } from "@/util/filesystem"
|
||||
import { Global } from "@/global"
|
||||
|
||||
const log = Log.create({ service: "tui.migrate" })
|
||||
|
||||
const TUI_SCHEMA_URL = "https://opencode.ai/tui.json"
|
||||
|
||||
const LegacyTheme = TuiInfo.shape.theme.optional()
|
||||
const LegacyRecord = z.record(z.string(), z.unknown()).optional()
|
||||
|
||||
const TuiLegacy = z
|
||||
.object({
|
||||
scroll_speed: TuiOptions.shape.scroll_speed.catch(undefined),
|
||||
scroll_acceleration: TuiOptions.shape.scroll_acceleration.catch(undefined),
|
||||
diff_style: TuiOptions.shape.diff_style.catch(undefined),
|
||||
})
|
||||
.strip()
|
||||
|
||||
interface MigrateInput {
|
||||
directories: string[]
|
||||
custom?: string
|
||||
managed: string
|
||||
}
|
||||
|
||||
/**
|
||||
* Migrates tui-specific keys (theme, keybinds, tui) from opencode.json files
|
||||
* into dedicated tui.json files. Migration is performed per-directory and
|
||||
* skips only locations where a tui.json already exists.
|
||||
*/
|
||||
export async function migrateTuiConfig(input: MigrateInput) {
|
||||
const opencode = await opencodeFiles(input)
|
||||
for (const file of opencode) {
|
||||
const source = await Filesystem.readText(file).catch((error) => {
|
||||
log.warn("failed to read config for tui migration", { path: file, error })
|
||||
return undefined
|
||||
})
|
||||
if (!source) continue
|
||||
const errors: JsoncParseError[] = []
|
||||
const data = parseJsonc(source, errors, { allowTrailingComma: true })
|
||||
if (errors.length || !data || typeof data !== "object" || Array.isArray(data)) continue
|
||||
|
||||
const theme = LegacyTheme.safeParse("theme" in data ? data.theme : undefined)
|
||||
const keybinds = LegacyRecord.safeParse("keybinds" in data ? data.keybinds : undefined)
|
||||
const legacyTui = LegacyRecord.safeParse("tui" in data ? data.tui : undefined)
|
||||
const extracted = {
|
||||
theme: theme.success ? theme.data : undefined,
|
||||
keybinds: keybinds.success ? keybinds.data : undefined,
|
||||
tui: legacyTui.success ? legacyTui.data : undefined,
|
||||
}
|
||||
const tui = extracted.tui ? normalizeTui(extracted.tui) : undefined
|
||||
if (extracted.theme === undefined && extracted.keybinds === undefined && !tui) continue
|
||||
|
||||
const target = path.join(path.dirname(file), "tui.json")
|
||||
const targetExists = await Filesystem.exists(target)
|
||||
if (targetExists) continue
|
||||
|
||||
const payload: Record<string, unknown> = {
|
||||
$schema: TUI_SCHEMA_URL,
|
||||
}
|
||||
if (extracted.theme !== undefined) payload.theme = extracted.theme
|
||||
if (extracted.keybinds !== undefined) payload.keybinds = extracted.keybinds
|
||||
if (tui) Object.assign(payload, tui)
|
||||
|
||||
const wrote = await Bun.write(target, JSON.stringify(payload, null, 2))
|
||||
.then(() => true)
|
||||
.catch((error) => {
|
||||
log.warn("failed to write tui migration target", { from: file, to: target, error })
|
||||
return false
|
||||
})
|
||||
if (!wrote) continue
|
||||
|
||||
const stripped = await backupAndStripLegacy(file, source)
|
||||
if (!stripped) {
|
||||
log.warn("tui config migrated but source file was not stripped", { from: file, to: target })
|
||||
continue
|
||||
}
|
||||
log.info("migrated tui config", { from: file, to: target })
|
||||
}
|
||||
}
|
||||
|
||||
function normalizeTui(data: Record<string, unknown>) {
|
||||
const parsed = TuiLegacy.parse(data)
|
||||
if (
|
||||
parsed.scroll_speed === undefined &&
|
||||
parsed.diff_style === undefined &&
|
||||
parsed.scroll_acceleration === undefined
|
||||
) {
|
||||
return
|
||||
}
|
||||
return parsed
|
||||
}
|
||||
|
||||
async function backupAndStripLegacy(file: string, source: string) {
|
||||
const backup = file + ".tui-migration.bak"
|
||||
const hasBackup = await Filesystem.exists(backup)
|
||||
const backed = hasBackup
|
||||
? true
|
||||
: await Bun.write(backup, source)
|
||||
.then(() => true)
|
||||
.catch((error) => {
|
||||
log.warn("failed to backup source config during tui migration", { path: file, backup, error })
|
||||
return false
|
||||
})
|
||||
if (!backed) return false
|
||||
|
||||
const text = ["theme", "keybinds", "tui"].reduce((acc, key) => {
|
||||
const edits = modify(acc, [key], undefined, {
|
||||
formattingOptions: {
|
||||
insertSpaces: true,
|
||||
tabSize: 2,
|
||||
},
|
||||
})
|
||||
if (!edits.length) return acc
|
||||
return applyEdits(acc, edits)
|
||||
}, source)
|
||||
|
||||
return Bun.write(file, text)
|
||||
.then(() => {
|
||||
log.info("stripped tui keys from server config", { path: file, backup })
|
||||
return true
|
||||
})
|
||||
.catch((error) => {
|
||||
log.warn("failed to strip legacy tui keys from server config", { path: file, backup, error })
|
||||
return false
|
||||
})
|
||||
}
|
||||
|
||||
async function opencodeFiles(input: { directories: string[]; managed: string }) {
|
||||
const project = Flag.OPENCODE_DISABLE_PROJECT_CONFIG
|
||||
? []
|
||||
: await ConfigPaths.projectFiles("opencode", Instance.directory, Instance.worktree)
|
||||
const files = [...project, ...ConfigPaths.fileInDirectory(Global.Path.config, "opencode")]
|
||||
for (const dir of unique(input.directories)) {
|
||||
files.push(...ConfigPaths.fileInDirectory(dir, "opencode"))
|
||||
}
|
||||
if (Flag.OPENCODE_CONFIG) files.push(Flag.OPENCODE_CONFIG)
|
||||
files.push(...ConfigPaths.fileInDirectory(input.managed, "opencode"))
|
||||
|
||||
const existing = await Promise.all(
|
||||
unique(files).map(async (file) => {
|
||||
const ok = await Filesystem.exists(file)
|
||||
return ok ? file : undefined
|
||||
}),
|
||||
)
|
||||
return existing.filter((file): file is string => !!file)
|
||||
}
|
||||
174
packages/opencode/src/config/paths.ts
Normal file
174
packages/opencode/src/config/paths.ts
Normal file
@@ -0,0 +1,174 @@
|
||||
import path from "path"
|
||||
import os from "os"
|
||||
import z from "zod"
|
||||
import { type ParseError as JsoncParseError, parse as parseJsonc, printParseErrorCode } from "jsonc-parser"
|
||||
import { NamedError } from "@opencode-ai/util/error"
|
||||
import { Filesystem } from "@/util/filesystem"
|
||||
import { Flag } from "@/flag/flag"
|
||||
import { Global } from "@/global"
|
||||
|
||||
export namespace ConfigPaths {
|
||||
export async function projectFiles(name: string, directory: string, worktree: string) {
|
||||
const files: string[] = []
|
||||
for (const file of [`${name}.jsonc`, `${name}.json`]) {
|
||||
const found = await Filesystem.findUp(file, directory, worktree)
|
||||
for (const resolved of found.toReversed()) {
|
||||
files.push(resolved)
|
||||
}
|
||||
}
|
||||
return files
|
||||
}
|
||||
|
||||
export async function directories(directory: string, worktree: string) {
|
||||
return [
|
||||
Global.Path.config,
|
||||
...(!Flag.OPENCODE_DISABLE_PROJECT_CONFIG
|
||||
? await Array.fromAsync(
|
||||
Filesystem.up({
|
||||
targets: [".opencode"],
|
||||
start: directory,
|
||||
stop: worktree,
|
||||
}),
|
||||
)
|
||||
: []),
|
||||
...(await Array.fromAsync(
|
||||
Filesystem.up({
|
||||
targets: [".opencode"],
|
||||
start: Global.Path.home,
|
||||
stop: Global.Path.home,
|
||||
}),
|
||||
)),
|
||||
...(Flag.OPENCODE_CONFIG_DIR ? [Flag.OPENCODE_CONFIG_DIR] : []),
|
||||
]
|
||||
}
|
||||
|
||||
export function fileInDirectory(dir: string, name: string) {
|
||||
return [path.join(dir, `${name}.jsonc`), path.join(dir, `${name}.json`)]
|
||||
}
|
||||
|
||||
export const JsonError = NamedError.create(
|
||||
"ConfigJsonError",
|
||||
z.object({
|
||||
path: z.string(),
|
||||
message: z.string().optional(),
|
||||
}),
|
||||
)
|
||||
|
||||
export const InvalidError = NamedError.create(
|
||||
"ConfigInvalidError",
|
||||
z.object({
|
||||
path: z.string(),
|
||||
issues: z.custom<z.core.$ZodIssue[]>().optional(),
|
||||
message: z.string().optional(),
|
||||
}),
|
||||
)
|
||||
|
||||
/** Read a config file, returning undefined for missing files and throwing JsonError for other failures. */
|
||||
export async function readFile(filepath: string) {
|
||||
return Filesystem.readText(filepath).catch((err: NodeJS.ErrnoException) => {
|
||||
if (err.code === "ENOENT") return
|
||||
throw new JsonError({ path: filepath }, { cause: err })
|
||||
})
|
||||
}
|
||||
|
||||
type ParseSource = string | { source: string; dir: string }
|
||||
|
||||
function source(input: ParseSource) {
|
||||
return typeof input === "string" ? input : input.source
|
||||
}
|
||||
|
||||
function dir(input: ParseSource) {
|
||||
return typeof input === "string" ? path.dirname(input) : input.dir
|
||||
}
|
||||
|
||||
/** Apply {env:VAR} and {file:path} substitutions to config text. */
|
||||
async function substitute(text: string, input: ParseSource, missing: "error" | "empty" = "error") {
|
||||
text = text.replace(/\{env:([^}]+)\}/g, (_, varName) => {
|
||||
return process.env[varName] || ""
|
||||
})
|
||||
|
||||
const fileMatches = Array.from(text.matchAll(/\{file:[^}]+\}/g))
|
||||
if (!fileMatches.length) return text
|
||||
|
||||
const configDir = dir(input)
|
||||
const configSource = source(input)
|
||||
let out = ""
|
||||
let cursor = 0
|
||||
|
||||
for (const match of fileMatches) {
|
||||
const token = match[0]
|
||||
const index = match.index!
|
||||
out += text.slice(cursor, index)
|
||||
|
||||
const lineStart = text.lastIndexOf("\n", index - 1) + 1
|
||||
const prefix = text.slice(lineStart, index).trimStart()
|
||||
if (prefix.startsWith("//")) {
|
||||
out += token
|
||||
cursor = index + token.length
|
||||
continue
|
||||
}
|
||||
|
||||
let filePath = token.replace(/^\{file:/, "").replace(/\}$/, "")
|
||||
if (filePath.startsWith("~/")) {
|
||||
filePath = path.join(os.homedir(), filePath.slice(2))
|
||||
}
|
||||
|
||||
const resolvedPath = path.isAbsolute(filePath) ? filePath : path.resolve(configDir, filePath)
|
||||
const fileContent = (
|
||||
await Filesystem.readText(resolvedPath).catch((error: NodeJS.ErrnoException) => {
|
||||
if (missing === "empty") return ""
|
||||
|
||||
const errMsg = `bad file reference: "${token}"`
|
||||
if (error.code === "ENOENT") {
|
||||
throw new InvalidError(
|
||||
{
|
||||
path: configSource,
|
||||
message: errMsg + ` ${resolvedPath} does not exist`,
|
||||
},
|
||||
{ cause: error },
|
||||
)
|
||||
}
|
||||
throw new InvalidError({ path: configSource, message: errMsg }, { cause: error })
|
||||
})
|
||||
).trim()
|
||||
|
||||
out += JSON.stringify(fileContent).slice(1, -1)
|
||||
cursor = index + token.length
|
||||
}
|
||||
|
||||
out += text.slice(cursor)
|
||||
return out
|
||||
}
|
||||
|
||||
/** Substitute and parse JSONC text, throwing JsonError on syntax errors. */
|
||||
export async function parseText(text: string, input: ParseSource, missing: "error" | "empty" = "error") {
|
||||
const configSource = source(input)
|
||||
text = await substitute(text, input, missing)
|
||||
|
||||
const errors: JsoncParseError[] = []
|
||||
const data = parseJsonc(text, errors, { allowTrailingComma: true })
|
||||
if (errors.length) {
|
||||
const lines = text.split("\n")
|
||||
const errorDetails = errors
|
||||
.map((e) => {
|
||||
const beforeOffset = text.substring(0, e.offset).split("\n")
|
||||
const line = beforeOffset.length
|
||||
const column = beforeOffset[beforeOffset.length - 1].length + 1
|
||||
const problemLine = lines[line - 1]
|
||||
|
||||
const error = `${printParseErrorCode(e.error)} at line ${line}, column ${column}`
|
||||
if (!problemLine) return error
|
||||
|
||||
return `${error}\n Line ${line}: ${problemLine}\n${"".padStart(column + 9)}^`
|
||||
})
|
||||
.join("\n")
|
||||
|
||||
throw new JsonError({
|
||||
path: configSource,
|
||||
message: `\n--- JSONC Input ---\n${text}\n--- Errors ---\n${errorDetails}\n--- End ---`,
|
||||
})
|
||||
}
|
||||
|
||||
return data
|
||||
}
|
||||
}
|
||||
34
packages/opencode/src/config/tui-schema.ts
Normal file
34
packages/opencode/src/config/tui-schema.ts
Normal file
@@ -0,0 +1,34 @@
|
||||
import z from "zod"
|
||||
import { Config } from "./config"
|
||||
|
||||
const KeybindOverride = z
|
||||
.object(
|
||||
Object.fromEntries(Object.keys(Config.Keybinds.shape).map((key) => [key, z.string().optional()])) as Record<
|
||||
string,
|
||||
z.ZodOptional<z.ZodString>
|
||||
>,
|
||||
)
|
||||
.strict()
|
||||
|
||||
export const TuiOptions = z.object({
|
||||
scroll_speed: z.number().min(0.001).optional().describe("TUI scroll speed"),
|
||||
scroll_acceleration: z
|
||||
.object({
|
||||
enabled: z.boolean().describe("Enable scroll acceleration"),
|
||||
})
|
||||
.optional()
|
||||
.describe("Scroll acceleration settings"),
|
||||
diff_style: z
|
||||
.enum(["auto", "stacked"])
|
||||
.optional()
|
||||
.describe("Control diff rendering style: 'auto' adapts to terminal width, 'stacked' always shows single column"),
|
||||
})
|
||||
|
||||
export const TuiInfo = z
|
||||
.object({
|
||||
$schema: z.string().optional(),
|
||||
theme: z.string().optional(),
|
||||
keybinds: KeybindOverride.optional(),
|
||||
})
|
||||
.extend(TuiOptions.shape)
|
||||
.strict()
|
||||
118
packages/opencode/src/config/tui.ts
Normal file
118
packages/opencode/src/config/tui.ts
Normal file
@@ -0,0 +1,118 @@
|
||||
import { existsSync } from "fs"
|
||||
import z from "zod"
|
||||
import { mergeDeep, unique } from "remeda"
|
||||
import { Config } from "./config"
|
||||
import { ConfigPaths } from "./paths"
|
||||
import { migrateTuiConfig } from "./migrate-tui-config"
|
||||
import { TuiInfo } from "./tui-schema"
|
||||
import { Instance } from "@/project/instance"
|
||||
import { Flag } from "@/flag/flag"
|
||||
import { Log } from "@/util/log"
|
||||
import { Global } from "@/global"
|
||||
|
||||
export namespace TuiConfig {
|
||||
const log = Log.create({ service: "tui.config" })
|
||||
|
||||
export const Info = TuiInfo
|
||||
|
||||
export type Info = z.output<typeof Info>
|
||||
|
||||
function mergeInfo(target: Info, source: Info): Info {
|
||||
return mergeDeep(target, source)
|
||||
}
|
||||
|
||||
function customPath() {
|
||||
return Flag.OPENCODE_TUI_CONFIG
|
||||
}
|
||||
|
||||
const state = Instance.state(async () => {
|
||||
let projectFiles = Flag.OPENCODE_DISABLE_PROJECT_CONFIG
|
||||
? []
|
||||
: await ConfigPaths.projectFiles("tui", Instance.directory, Instance.worktree)
|
||||
const directories = await ConfigPaths.directories(Instance.directory, Instance.worktree)
|
||||
const custom = customPath()
|
||||
const managed = Config.managedConfigDir()
|
||||
await migrateTuiConfig({ directories, custom, managed })
|
||||
// Re-compute after migration since migrateTuiConfig may have created new tui.json files
|
||||
projectFiles = Flag.OPENCODE_DISABLE_PROJECT_CONFIG
|
||||
? []
|
||||
: await ConfigPaths.projectFiles("tui", Instance.directory, Instance.worktree)
|
||||
|
||||
let result: Info = {}
|
||||
|
||||
for (const file of ConfigPaths.fileInDirectory(Global.Path.config, "tui")) {
|
||||
result = mergeInfo(result, await loadFile(file))
|
||||
}
|
||||
|
||||
if (custom) {
|
||||
result = mergeInfo(result, await loadFile(custom))
|
||||
log.debug("loaded custom tui config", { path: custom })
|
||||
}
|
||||
|
||||
for (const file of projectFiles) {
|
||||
result = mergeInfo(result, await loadFile(file))
|
||||
}
|
||||
|
||||
for (const dir of unique(directories)) {
|
||||
if (!dir.endsWith(".opencode") && dir !== Flag.OPENCODE_CONFIG_DIR) continue
|
||||
for (const file of ConfigPaths.fileInDirectory(dir, "tui")) {
|
||||
result = mergeInfo(result, await loadFile(file))
|
||||
}
|
||||
}
|
||||
|
||||
if (existsSync(managed)) {
|
||||
for (const file of ConfigPaths.fileInDirectory(managed, "tui")) {
|
||||
result = mergeInfo(result, await loadFile(file))
|
||||
}
|
||||
}
|
||||
|
||||
result.keybinds = Config.Keybinds.parse(result.keybinds ?? {})
|
||||
|
||||
return {
|
||||
config: result,
|
||||
}
|
||||
})
|
||||
|
||||
export async function get() {
|
||||
return state().then((x) => x.config)
|
||||
}
|
||||
|
||||
async function loadFile(filepath: string): Promise<Info> {
|
||||
const text = await ConfigPaths.readFile(filepath)
|
||||
if (!text) return {}
|
||||
return load(text, filepath).catch((error) => {
|
||||
log.warn("failed to load tui config", { path: filepath, error })
|
||||
return {}
|
||||
})
|
||||
}
|
||||
|
||||
async function load(text: string, configFilepath: string): Promise<Info> {
|
||||
const data = await ConfigPaths.parseText(text, configFilepath, "empty")
|
||||
if (!data || typeof data !== "object" || Array.isArray(data)) return {}
|
||||
|
||||
// Flatten a nested "tui" key so users who wrote `{ "tui": { ... } }` inside tui.json
|
||||
// (mirroring the old opencode.json shape) still get their settings applied.
|
||||
const normalized = (() => {
|
||||
const copy = { ...(data as Record<string, unknown>) }
|
||||
if (!("tui" in copy)) return copy
|
||||
if (!copy.tui || typeof copy.tui !== "object" || Array.isArray(copy.tui)) {
|
||||
delete copy.tui
|
||||
return copy
|
||||
}
|
||||
const tui = copy.tui as Record<string, unknown>
|
||||
delete copy.tui
|
||||
return {
|
||||
...tui,
|
||||
...copy,
|
||||
}
|
||||
})()
|
||||
|
||||
const parsed = Info.safeParse(normalized)
|
||||
if (!parsed.success) {
|
||||
log.warn("invalid tui config", { path: configFilepath, issues: parsed.error.issues })
|
||||
return {}
|
||||
}
|
||||
|
||||
return parsed.data
|
||||
}
|
||||
}
|
||||
@@ -1,5 +1,4 @@
|
||||
import { sep } from "node:path"
|
||||
import { Glob } from "../util/glob"
|
||||
|
||||
export namespace FileIgnore {
|
||||
const FOLDERS = new Set([
|
||||
@@ -54,17 +53,19 @@ export namespace FileIgnore {
|
||||
"**/.nyc_output/**",
|
||||
]
|
||||
|
||||
const FILE_GLOBS = FILES.map((p) => new Bun.Glob(p))
|
||||
|
||||
export const PATTERNS = [...FILES, ...FOLDERS]
|
||||
|
||||
export function match(
|
||||
filepath: string,
|
||||
opts?: {
|
||||
extra?: string[]
|
||||
whitelist?: string[]
|
||||
extra?: Bun.Glob[]
|
||||
whitelist?: Bun.Glob[]
|
||||
},
|
||||
) {
|
||||
for (const pattern of opts?.whitelist || []) {
|
||||
if (Glob.match(pattern, filepath)) return false
|
||||
for (const glob of opts?.whitelist || []) {
|
||||
if (glob.match(filepath)) return false
|
||||
}
|
||||
|
||||
const parts = filepath.split(sep)
|
||||
@@ -73,8 +74,8 @@ export namespace FileIgnore {
|
||||
}
|
||||
|
||||
const extra = opts?.extra || []
|
||||
for (const pattern of [...FILES, ...extra]) {
|
||||
if (Glob.match(pattern, filepath)) return true
|
||||
for (const glob of [...FILE_GLOBS, ...extra]) {
|
||||
if (glob.match(filepath)) return true
|
||||
}
|
||||
|
||||
return false
|
||||
|
||||
@@ -482,13 +482,10 @@ export namespace File {
|
||||
}
|
||||
}
|
||||
|
||||
return changedFiles.map((x) => {
|
||||
const full = path.isAbsolute(x.path) ? x.path : path.join(Instance.directory, x.path)
|
||||
return {
|
||||
...x,
|
||||
path: path.relative(Instance.directory, full),
|
||||
}
|
||||
})
|
||||
return changedFiles.map((x) => ({
|
||||
...x,
|
||||
path: path.relative(Instance.directory, x.path),
|
||||
}))
|
||||
}
|
||||
|
||||
export async function read(file: string): Promise<Content> {
|
||||
|
||||
@@ -7,6 +7,7 @@ export namespace Flag {
|
||||
export const OPENCODE_AUTO_SHARE = truthy("OPENCODE_AUTO_SHARE")
|
||||
export const OPENCODE_GIT_BASH_PATH = process.env["OPENCODE_GIT_BASH_PATH"]
|
||||
export const OPENCODE_CONFIG = process.env["OPENCODE_CONFIG"]
|
||||
export declare const OPENCODE_TUI_CONFIG: string | undefined
|
||||
export declare const OPENCODE_CONFIG_DIR: string | undefined
|
||||
export const OPENCODE_CONFIG_CONTENT = process.env["OPENCODE_CONFIG_CONTENT"]
|
||||
export const OPENCODE_DISABLE_AUTOUPDATE = truthy("OPENCODE_DISABLE_AUTOUPDATE")
|
||||
@@ -74,6 +75,17 @@ Object.defineProperty(Flag, "OPENCODE_DISABLE_PROJECT_CONFIG", {
|
||||
configurable: false,
|
||||
})
|
||||
|
||||
// Dynamic getter for OPENCODE_TUI_CONFIG
|
||||
// This must be evaluated at access time, not module load time,
|
||||
// because tests and external tooling may set this env var at runtime
|
||||
Object.defineProperty(Flag, "OPENCODE_TUI_CONFIG", {
|
||||
get() {
|
||||
return process.env["OPENCODE_TUI_CONFIG"]
|
||||
},
|
||||
enumerable: true,
|
||||
configurable: false,
|
||||
})
|
||||
|
||||
// Dynamic getter for OPENCODE_CONFIG_DIR
|
||||
// This must be evaluated at access time, not module load time,
|
||||
// because external tooling may set this env var at runtime
|
||||
|
||||
@@ -41,10 +41,8 @@ export namespace Plugin {
|
||||
|
||||
for (const plugin of INTERNAL_PLUGINS) {
|
||||
log.info("loading internal plugin", { name: plugin.name })
|
||||
const init = await plugin(input).catch((err) => {
|
||||
log.error("failed to load internal plugin", { name: plugin.name, error: err })
|
||||
})
|
||||
if (init) hooks.push(init)
|
||||
const init = await plugin(input)
|
||||
hooks.push(init)
|
||||
}
|
||||
|
||||
let plugins = config.plugin ?? []
|
||||
@@ -61,40 +59,37 @@ export namespace Plugin {
|
||||
const lastAtIndex = plugin.lastIndexOf("@")
|
||||
const pkg = lastAtIndex > 0 ? plugin.substring(0, lastAtIndex) : plugin
|
||||
const version = lastAtIndex > 0 ? plugin.substring(lastAtIndex + 1) : "latest"
|
||||
const builtin = BUILTIN.some((x) => x.startsWith(pkg + "@"))
|
||||
plugin = await BunProc.install(pkg, version).catch((err) => {
|
||||
const cause = err instanceof Error ? err.cause : err
|
||||
const detail = cause instanceof Error ? cause.message : String(cause ?? err)
|
||||
log.error("failed to install plugin", { pkg, version, error: detail })
|
||||
if (!builtin) throw err
|
||||
|
||||
const message = err instanceof Error ? err.message : String(err)
|
||||
log.error("failed to install builtin plugin", {
|
||||
pkg,
|
||||
version,
|
||||
error: message,
|
||||
})
|
||||
Bus.publish(Session.Event.Error, {
|
||||
error: new NamedError.Unknown({
|
||||
message: `Failed to install plugin ${pkg}@${version}: ${detail}`,
|
||||
message: `Failed to install built-in plugin ${pkg}@${version}: ${message}`,
|
||||
}).toObject(),
|
||||
})
|
||||
|
||||
return ""
|
||||
})
|
||||
if (!plugin) continue
|
||||
}
|
||||
const mod = await import(plugin)
|
||||
// Prevent duplicate initialization when plugins export the same function
|
||||
// as both a named export and default export (e.g., `export const X` and `export default X`).
|
||||
// Object.entries(mod) would return both entries pointing to the same function reference.
|
||||
await import(plugin)
|
||||
.then(async (mod) => {
|
||||
const seen = new Set<PluginInstance>()
|
||||
for (const [_name, fn] of Object.entries<PluginInstance>(mod)) {
|
||||
if (seen.has(fn)) continue
|
||||
seen.add(fn)
|
||||
hooks.push(await fn(input))
|
||||
}
|
||||
})
|
||||
.catch((err) => {
|
||||
const message = err instanceof Error ? err.message : String(err)
|
||||
log.error("failed to load plugin", { path: plugin, error: message })
|
||||
Bus.publish(Session.Event.Error, {
|
||||
error: new NamedError.Unknown({
|
||||
message: `Failed to load plugin ${plugin}: ${message}`,
|
||||
}).toObject(),
|
||||
})
|
||||
})
|
||||
const seen = new Set<PluginInstance>()
|
||||
for (const [_name, fn] of Object.entries<PluginInstance>(mod)) {
|
||||
if (seen.has(fn)) continue
|
||||
seen.add(fn)
|
||||
const init = await fn(input)
|
||||
hooks.push(init)
|
||||
}
|
||||
}
|
||||
|
||||
return {
|
||||
|
||||
@@ -13,7 +13,6 @@ import { iife } from "@/util/iife"
|
||||
import { GlobalBus } from "@/bus/global"
|
||||
import { existsSync } from "fs"
|
||||
import { git } from "../util/git"
|
||||
import { Glob } from "../util/glob"
|
||||
|
||||
export namespace Project {
|
||||
const log = Log.create({ service: "project" })
|
||||
@@ -263,11 +262,16 @@ export namespace Project {
|
||||
if (input.vcs !== "git") return
|
||||
if (input.icon?.override) return
|
||||
if (input.icon?.url) return
|
||||
const matches = await Glob.scan("**/favicon.{ico,png,svg,jpg,jpeg,webp}", {
|
||||
cwd: input.worktree,
|
||||
absolute: true,
|
||||
include: "file",
|
||||
})
|
||||
const glob = new Bun.Glob("**/{favicon}.{ico,png,svg,jpg,jpeg,webp}")
|
||||
const matches = await Array.fromAsync(
|
||||
glob.scan({
|
||||
cwd: input.worktree,
|
||||
absolute: true,
|
||||
onlyFiles: true,
|
||||
followSymlinks: false,
|
||||
dot: false,
|
||||
}),
|
||||
)
|
||||
const shortest = matches.sort((a, b) => a.length - b.length)[0]
|
||||
if (!shortest) return
|
||||
const buffer = await Filesystem.readBytes(shortest)
|
||||
|
||||
@@ -65,13 +65,7 @@ export namespace ModelsDev {
|
||||
status: z.enum(["alpha", "beta", "deprecated"]).optional(),
|
||||
options: z.record(z.string(), z.any()),
|
||||
headers: z.record(z.string(), z.string()).optional(),
|
||||
provider: z
|
||||
.object({
|
||||
npm: z.string().optional(),
|
||||
api: z.string().optional(),
|
||||
shape: z.enum(["responses", "completions"]).optional(),
|
||||
})
|
||||
.optional(),
|
||||
provider: z.object({ npm: z.string().optional(), api: z.string().optional() }).optional(),
|
||||
variants: z.record(z.string(), z.record(z.string(), z.any())).optional(),
|
||||
})
|
||||
export type Model = z.infer<typeof Model>
|
||||
|
||||
@@ -109,7 +109,7 @@ export namespace Provider {
|
||||
"@ai-sdk/github-copilot": createGitHubCopilotOpenAICompatible,
|
||||
}
|
||||
|
||||
type CustomModelLoader = (sdk: any, model: Model, options?: Record<string, any>) => Promise<any>
|
||||
type CustomModelLoader = (sdk: any, modelID: string, options?: Record<string, any>) => Promise<any>
|
||||
type CustomLoader = (provider: Info) => Promise<{
|
||||
autoload: boolean
|
||||
getModel?: CustomModelLoader
|
||||
@@ -153,9 +153,8 @@ export namespace Provider {
|
||||
openai: async () => {
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
|
||||
if (model.api.shape === "completions") return sdk.chat(model.api.id)
|
||||
return sdk.responses(model.api.id)
|
||||
async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
|
||||
return sdk.responses(modelID)
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -163,12 +162,9 @@ export namespace Provider {
|
||||
"github-copilot": async () => {
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
|
||||
const shape = model.api.shape
|
||||
if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(model.api.id)
|
||||
if (shape === "responses") return sdk.responses(model.api.id)
|
||||
if (shape === "completions") return sdk.chat(model.api.id)
|
||||
return shouldUseCopilotResponsesApi(model.api.id) ? sdk.responses(model.api.id) : sdk.chat(model.api.id)
|
||||
async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
|
||||
if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(modelID)
|
||||
return shouldUseCopilotResponsesApi(modelID) ? sdk.responses(modelID) : sdk.chat(modelID)
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -176,12 +172,9 @@ export namespace Provider {
|
||||
"github-copilot-enterprise": async () => {
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
|
||||
const shape = model.api.shape
|
||||
if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(model.api.id)
|
||||
if (shape === "responses") return sdk.responses(model.api.id)
|
||||
if (shape === "completions") return sdk.chat(model.api.id)
|
||||
return shouldUseCopilotResponsesApi(model.api.id) ? sdk.responses(model.api.id) : sdk.chat(model.api.id)
|
||||
async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
|
||||
if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(modelID)
|
||||
return shouldUseCopilotResponsesApi(modelID) ? sdk.responses(modelID) : sdk.chat(modelID)
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -189,12 +182,12 @@ export namespace Provider {
|
||||
azure: async () => {
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, model: Model, options?: Record<string, any>) {
|
||||
if (sdk.responses === undefined || sdk.chat === undefined) return sdk.languageModel(model.api.id)
|
||||
if (model.api.shape === "completions") return sdk.chat(model.api.id)
|
||||
if (model.api.shape === "responses") return sdk.responses(model.api.id)
|
||||
if (options?.["useCompletionUrls"]) return sdk.chat(model.api.id)
|
||||
return sdk.responses(model.api.id)
|
||||
async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
|
||||
if (options?.["useCompletionUrls"]) {
|
||||
return sdk.chat(modelID)
|
||||
} else {
|
||||
return sdk.responses(modelID)
|
||||
}
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -203,12 +196,12 @@ export namespace Provider {
|
||||
const resourceName = Env.get("AZURE_COGNITIVE_SERVICES_RESOURCE_NAME")
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, model: Model, options?: Record<string, any>) {
|
||||
if (sdk.responses === undefined || sdk.chat === undefined) return sdk.languageModel(model.api.id)
|
||||
if (model.api.shape === "completions") return sdk.chat(model.api.id)
|
||||
if (model.api.shape === "responses") return sdk.responses(model.api.id)
|
||||
if (options?.["useCompletionUrls"]) return sdk.chat(model.api.id)
|
||||
return sdk.responses(model.api.id)
|
||||
async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
|
||||
if (options?.["useCompletionUrls"]) {
|
||||
return sdk.chat(modelID)
|
||||
} else {
|
||||
return sdk.responses(modelID)
|
||||
}
|
||||
},
|
||||
options: {
|
||||
baseURL: resourceName ? `https://${resourceName}.cognitiveservices.azure.com/openai` : undefined,
|
||||
@@ -276,8 +269,7 @@ export namespace Provider {
|
||||
return {
|
||||
autoload: true,
|
||||
options: providerOptions,
|
||||
async getModel(sdk: any, model: Model, options?: Record<string, any>) {
|
||||
let modelID = model.api.id
|
||||
async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
|
||||
// Skip region prefixing if model already has a cross-region inference profile prefix
|
||||
// Models from models.dev may already include prefixes like us., eu., global., etc.
|
||||
const crossRegionPrefixes = ["global.", "us.", "eu.", "jp.", "apac.", "au."]
|
||||
@@ -414,8 +406,8 @@ export namespace Provider {
|
||||
return fetch(input, { ...init, headers })
|
||||
},
|
||||
},
|
||||
async getModel(sdk: any, model: Model) {
|
||||
const id = String(model.api.id).trim()
|
||||
async getModel(sdk: any, modelID: string) {
|
||||
const id = String(modelID).trim()
|
||||
return sdk.languageModel(id)
|
||||
},
|
||||
}
|
||||
@@ -431,8 +423,8 @@ export namespace Provider {
|
||||
project,
|
||||
location,
|
||||
},
|
||||
async getModel(sdk: any, model: Model) {
|
||||
const id = String(model.api.id).trim()
|
||||
async getModel(sdk: any, modelID) {
|
||||
const id = String(modelID).trim()
|
||||
return sdk.languageModel(id)
|
||||
},
|
||||
}
|
||||
@@ -456,8 +448,8 @@ export namespace Provider {
|
||||
return {
|
||||
autoload: !!envServiceKey,
|
||||
options: envServiceKey ? { deploymentId, resourceGroup } : {},
|
||||
async getModel(sdk: any, model: Model) {
|
||||
return sdk(model.api.id)
|
||||
async getModel(sdk: any, modelID: string) {
|
||||
return sdk(modelID)
|
||||
},
|
||||
}
|
||||
},
|
||||
@@ -502,8 +494,8 @@ export namespace Provider {
|
||||
...(providerConfig?.options?.featureFlags || {}),
|
||||
},
|
||||
},
|
||||
async getModel(sdk: ReturnType<typeof createGitLab>, model: Model) {
|
||||
return sdk.agenticChat(model.api.id, {
|
||||
async getModel(sdk: ReturnType<typeof createGitLab>, modelID: string) {
|
||||
return sdk.agenticChat(modelID, {
|
||||
aiGatewayHeaders,
|
||||
featureFlags: {
|
||||
duo_agent_platform_agentic_chat: true,
|
||||
@@ -532,8 +524,8 @@ export namespace Provider {
|
||||
apiKey,
|
||||
baseURL: `https://api.cloudflare.com/client/v4/accounts/${accountId}/ai/v1`,
|
||||
},
|
||||
async getModel(sdk: any, model: Model) {
|
||||
return sdk.languageModel(model.api.id)
|
||||
async getModel(sdk: any, modelID: string) {
|
||||
return sdk.languageModel(modelID)
|
||||
},
|
||||
}
|
||||
},
|
||||
@@ -568,9 +560,9 @@ export namespace Provider {
|
||||
|
||||
return {
|
||||
autoload: true,
|
||||
async getModel(_sdk: any, model: Model, _options?: Record<string, any>) {
|
||||
async getModel(_sdk: any, modelID: string, _options?: Record<string, any>) {
|
||||
// Model IDs use Unified API format: provider/model (e.g., "anthropic/claude-sonnet-4-5")
|
||||
return aigateway(unified(model.api.id))
|
||||
return aigateway(unified(modelID))
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -606,7 +598,6 @@ export namespace Provider {
|
||||
id: z.string(),
|
||||
url: z.string(),
|
||||
npm: z.string(),
|
||||
shape: z.enum(["responses", "completions"]).optional(),
|
||||
}),
|
||||
name: z.string(),
|
||||
family: z.string().optional(),
|
||||
@@ -695,7 +686,6 @@ export namespace Provider {
|
||||
id: model.id,
|
||||
url: model.provider?.api ?? provider.api!,
|
||||
npm: model.provider?.npm ?? provider.npm ?? "@ai-sdk/openai-compatible",
|
||||
shape: model.provider?.shape,
|
||||
},
|
||||
status: model.status ?? "active",
|
||||
headers: model.headers ?? {},
|
||||
@@ -846,7 +836,6 @@ export namespace Provider {
|
||||
existingModel?.api.npm ??
|
||||
modelsDev[providerID]?.npm ??
|
||||
"@ai-sdk/openai-compatible",
|
||||
shape: model.provider?.shape ?? existingModel?.api.shape,
|
||||
url: model.provider?.api ?? provider?.api ?? existingModel?.api.url ?? modelsDev[providerID]?.api,
|
||||
},
|
||||
status: model.status ?? existingModel?.status ?? "active",
|
||||
@@ -1188,7 +1177,7 @@ export namespace Provider {
|
||||
|
||||
try {
|
||||
const language = s.modelLoaders[model.providerID]
|
||||
? await s.modelLoaders[model.providerID](sdk, model, provider.options)
|
||||
? await s.modelLoaders[model.providerID](sdk, model.api.id, provider.options)
|
||||
: sdk.languageModel(model.api.id)
|
||||
s.models.set(key, language)
|
||||
return language
|
||||
|
||||
@@ -333,10 +333,6 @@ export namespace ProviderTransform {
|
||||
if (!model.capabilities.reasoning) return {}
|
||||
|
||||
const id = model.id.toLowerCase()
|
||||
const isAnthropicAdaptive = ["opus-4-6", "opus-4.6", "sonnet-4-6", "sonnet-4.6"].some((v) =>
|
||||
model.api.id.includes(v),
|
||||
)
|
||||
const adaptiveEfforts = ["low", "medium", "high", "max"]
|
||||
if (
|
||||
id.includes("deepseek") ||
|
||||
id.includes("minimax") ||
|
||||
@@ -370,19 +366,6 @@ export namespace ProviderTransform {
|
||||
|
||||
case "@ai-sdk/gateway":
|
||||
if (model.id.includes("anthropic")) {
|
||||
if (isAnthropicAdaptive) {
|
||||
return Object.fromEntries(
|
||||
adaptiveEfforts.map((effort) => [
|
||||
effort,
|
||||
{
|
||||
thinking: {
|
||||
type: "adaptive",
|
||||
},
|
||||
effort,
|
||||
},
|
||||
]),
|
||||
)
|
||||
}
|
||||
return {
|
||||
high: {
|
||||
thinking: {
|
||||
@@ -519,9 +502,10 @@ export namespace ProviderTransform {
|
||||
case "@ai-sdk/google-vertex/anthropic":
|
||||
// https://v5.ai-sdk.dev/providers/ai-sdk-providers/google-vertex#anthropic-provider
|
||||
|
||||
if (isAnthropicAdaptive) {
|
||||
if (model.api.id.includes("opus-4-6") || model.api.id.includes("opus-4.6")) {
|
||||
const efforts = ["low", "medium", "high", "max"]
|
||||
return Object.fromEntries(
|
||||
adaptiveEfforts.map((effort) => [
|
||||
efforts.map((effort) => [
|
||||
effort,
|
||||
{
|
||||
thinking: {
|
||||
@@ -550,9 +534,10 @@ export namespace ProviderTransform {
|
||||
|
||||
case "@ai-sdk/amazon-bedrock":
|
||||
// https://v5.ai-sdk.dev/providers/ai-sdk-providers/amazon-bedrock
|
||||
if (isAnthropicAdaptive) {
|
||||
if (model.api.id.includes("opus-4-6") || model.api.id.includes("opus-4.6")) {
|
||||
const efforts = ["low", "medium", "high", "max"]
|
||||
return Object.fromEntries(
|
||||
adaptiveEfforts.map((effort) => [
|
||||
efforts.map((effort) => [
|
||||
effort,
|
||||
{
|
||||
reasoningConfig: {
|
||||
@@ -614,19 +599,12 @@ export namespace ProviderTransform {
|
||||
},
|
||||
}
|
||||
}
|
||||
let levels = ["low", "high"]
|
||||
if (id.includes("3.1")) {
|
||||
levels = ["low", "medium", "high"]
|
||||
}
|
||||
|
||||
return Object.fromEntries(
|
||||
levels.map((effort) => [
|
||||
["low", "high"].map((effort) => [
|
||||
effort,
|
||||
{
|
||||
thinkingConfig: {
|
||||
includeThoughts: true,
|
||||
thinkingLevel: effort,
|
||||
},
|
||||
includeThoughts: true,
|
||||
thinkingLevel: effort,
|
||||
},
|
||||
]),
|
||||
)
|
||||
@@ -646,7 +624,8 @@ export namespace ProviderTransform {
|
||||
groqEffort.map((effort) => [
|
||||
effort,
|
||||
{
|
||||
reasoningEffort: effort,
|
||||
includeThoughts: true,
|
||||
thinkingLevel: effort,
|
||||
},
|
||||
]),
|
||||
)
|
||||
|
||||
@@ -18,14 +18,12 @@ export namespace Pty {
|
||||
|
||||
type Socket = {
|
||||
readyState: number
|
||||
data?: unknown
|
||||
send: (data: string | Uint8Array | ArrayBuffer) => void
|
||||
close: (code?: number, reason?: string) => void
|
||||
}
|
||||
|
||||
type Subscriber = {
|
||||
id: number
|
||||
token: unknown
|
||||
}
|
||||
|
||||
const sockets = new WeakMap<object, number>()
|
||||
@@ -39,44 +37,6 @@ export namespace Pty {
|
||||
return next
|
||||
}
|
||||
|
||||
const token = (ws: Socket) => {
|
||||
const data = ws.data
|
||||
if (data === undefined) return
|
||||
if (data === null) return
|
||||
if (typeof data !== "object") return data
|
||||
|
||||
const id = (data as { connId?: unknown }).connId
|
||||
if (typeof id === "number" || typeof id === "string") return id
|
||||
|
||||
const href = (data as { href?: unknown }).href
|
||||
if (typeof href === "string") return href
|
||||
|
||||
const url = (data as { url?: unknown }).url
|
||||
if (typeof url === "string") return url
|
||||
if (url && typeof url === "object") {
|
||||
const href = (url as { href?: unknown }).href
|
||||
if (typeof href === "string") return href
|
||||
return url
|
||||
}
|
||||
|
||||
const events = (data as { events?: unknown }).events
|
||||
if (typeof events === "number" || typeof events === "string") return events
|
||||
if (events && typeof events === "object") {
|
||||
const id = (events as { connId?: unknown }).connId
|
||||
if (typeof id === "number" || typeof id === "string") return id
|
||||
|
||||
const id2 = (events as { connection?: unknown }).connection
|
||||
if (typeof id2 === "number" || typeof id2 === "string") return id2
|
||||
|
||||
const id3 = (events as { id?: unknown }).id
|
||||
if (typeof id3 === "number" || typeof id3 === "string") return id3
|
||||
|
||||
return events
|
||||
}
|
||||
|
||||
return data
|
||||
}
|
||||
|
||||
// WebSocket control frame: 0x00 + UTF-8 JSON.
|
||||
const meta = (cursor: number) => {
|
||||
const json = JSON.stringify({ cursor })
|
||||
@@ -234,12 +194,6 @@ export namespace Pty {
|
||||
session.subscribers.delete(ws)
|
||||
continue
|
||||
}
|
||||
|
||||
if (token(ws) !== sub.token) {
|
||||
session.subscribers.delete(ws)
|
||||
continue
|
||||
}
|
||||
|
||||
try {
|
||||
ws.send(chunk)
|
||||
} catch {
|
||||
@@ -337,7 +291,7 @@ export namespace Pty {
|
||||
}
|
||||
|
||||
owners.set(ws, id)
|
||||
session.subscribers.set(ws, { id: socketId, token: token(ws) })
|
||||
session.subscribers.set(ws, { id: socketId })
|
||||
|
||||
const cleanup = () => {
|
||||
session.subscribers.delete(ws)
|
||||
|
||||
@@ -6,7 +6,6 @@ import { Worktree } from "../../worktree"
|
||||
import { Instance } from "../../project/instance"
|
||||
import { Project } from "../../project/project"
|
||||
import { MCP } from "../../mcp"
|
||||
import { Session } from "../../session"
|
||||
import { zodToJsonSchema } from "zod-to-json-schema"
|
||||
import { errors } from "../error"
|
||||
import { lazy } from "../../util/lazy"
|
||||
@@ -185,65 +184,6 @@ export const ExperimentalRoutes = lazy(() =>
|
||||
return c.json(true)
|
||||
},
|
||||
)
|
||||
.get(
|
||||
"/session",
|
||||
describeRoute({
|
||||
summary: "List sessions",
|
||||
description:
|
||||
"Get a list of all OpenCode sessions across projects, sorted by most recently updated. Archived sessions are excluded by default.",
|
||||
operationId: "experimental.session.list",
|
||||
responses: {
|
||||
200: {
|
||||
description: "List of sessions",
|
||||
content: {
|
||||
"application/json": {
|
||||
schema: resolver(Session.GlobalInfo.array()),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}),
|
||||
validator(
|
||||
"query",
|
||||
z.object({
|
||||
directory: z.string().optional().meta({ description: "Filter sessions by project directory" }),
|
||||
roots: z.coerce.boolean().optional().meta({ description: "Only return root sessions (no parentID)" }),
|
||||
start: z.coerce
|
||||
.number()
|
||||
.optional()
|
||||
.meta({ description: "Filter sessions updated on or after this timestamp (milliseconds since epoch)" }),
|
||||
cursor: z.coerce
|
||||
.number()
|
||||
.optional()
|
||||
.meta({ description: "Return sessions updated before this timestamp (milliseconds since epoch)" }),
|
||||
search: z.string().optional().meta({ description: "Filter sessions by title (case-insensitive)" }),
|
||||
limit: z.coerce.number().optional().meta({ description: "Maximum number of sessions to return" }),
|
||||
archived: z.coerce.boolean().optional().meta({ description: "Include archived sessions (default false)" }),
|
||||
}),
|
||||
),
|
||||
async (c) => {
|
||||
const query = c.req.valid("query")
|
||||
const limit = query.limit ?? 100
|
||||
const sessions: Session.GlobalInfo[] = []
|
||||
for await (const session of Session.listGlobal({
|
||||
directory: query.directory,
|
||||
roots: query.roots,
|
||||
start: query.start,
|
||||
cursor: query.cursor,
|
||||
search: query.search,
|
||||
limit: limit + 1,
|
||||
archived: query.archived,
|
||||
})) {
|
||||
sessions.push(session)
|
||||
}
|
||||
const hasMore = sessions.length > limit
|
||||
const list = hasMore ? sessions.slice(0, limit) : sessions
|
||||
if (hasMore && list.length > 0) {
|
||||
c.header("x-next-cursor", String(list[list.length - 1].time.updated))
|
||||
}
|
||||
return c.json(list)
|
||||
},
|
||||
)
|
||||
.get(
|
||||
"/resource",
|
||||
describeRoute({
|
||||
|
||||
@@ -10,10 +10,8 @@ import { Flag } from "../flag/flag"
|
||||
import { Identifier } from "../id/id"
|
||||
import { Installation } from "../installation"
|
||||
|
||||
import { Database, NotFoundError, eq, and, or, gte, isNull, desc, like, inArray, lt } from "../storage/db"
|
||||
import type { SQL } from "../storage/db"
|
||||
import { Database, NotFoundError, eq, and, or, gte, isNull, desc, like } from "../storage/db"
|
||||
import { SessionTable, MessageTable, PartTable } from "./session.sql"
|
||||
import { ProjectTable } from "../project/project.sql"
|
||||
import { Storage } from "@/storage/storage"
|
||||
import { Log } from "../util/log"
|
||||
import { MessageV2 } from "./message-v2"
|
||||
@@ -156,24 +154,6 @@ export namespace Session {
|
||||
})
|
||||
export type Info = z.output<typeof Info>
|
||||
|
||||
export const ProjectInfo = z
|
||||
.object({
|
||||
id: z.string(),
|
||||
name: z.string().optional(),
|
||||
worktree: z.string(),
|
||||
})
|
||||
.meta({
|
||||
ref: "ProjectSummary",
|
||||
})
|
||||
export type ProjectInfo = z.output<typeof ProjectInfo>
|
||||
|
||||
export const GlobalInfo = Info.extend({
|
||||
project: ProjectInfo.nullable(),
|
||||
}).meta({
|
||||
ref: "GlobalSession",
|
||||
})
|
||||
export type GlobalInfo = z.output<typeof GlobalInfo>
|
||||
|
||||
export const Event = {
|
||||
Created: BusEvent.define(
|
||||
"session.created",
|
||||
@@ -564,75 +544,6 @@ export namespace Session {
|
||||
}
|
||||
}
|
||||
|
||||
export function* listGlobal(input?: {
|
||||
directory?: string
|
||||
roots?: boolean
|
||||
start?: number
|
||||
cursor?: number
|
||||
search?: string
|
||||
limit?: number
|
||||
archived?: boolean
|
||||
}) {
|
||||
const conditions: SQL[] = []
|
||||
|
||||
if (input?.directory) {
|
||||
conditions.push(eq(SessionTable.directory, input.directory))
|
||||
}
|
||||
if (input?.roots) {
|
||||
conditions.push(isNull(SessionTable.parent_id))
|
||||
}
|
||||
if (input?.start) {
|
||||
conditions.push(gte(SessionTable.time_updated, input.start))
|
||||
}
|
||||
if (input?.cursor) {
|
||||
conditions.push(lt(SessionTable.time_updated, input.cursor))
|
||||
}
|
||||
if (input?.search) {
|
||||
conditions.push(like(SessionTable.title, `%${input.search}%`))
|
||||
}
|
||||
if (!input?.archived) {
|
||||
conditions.push(isNull(SessionTable.time_archived))
|
||||
}
|
||||
|
||||
const limit = input?.limit ?? 100
|
||||
|
||||
const rows = Database.use((db) => {
|
||||
const query =
|
||||
conditions.length > 0
|
||||
? db
|
||||
.select()
|
||||
.from(SessionTable)
|
||||
.where(and(...conditions))
|
||||
: db.select().from(SessionTable)
|
||||
return query.orderBy(desc(SessionTable.time_updated), desc(SessionTable.id)).limit(limit).all()
|
||||
})
|
||||
|
||||
const ids = [...new Set(rows.map((row) => row.project_id))]
|
||||
const projects = new Map<string, ProjectInfo>()
|
||||
|
||||
if (ids.length > 0) {
|
||||
const items = Database.use((db) =>
|
||||
db
|
||||
.select({ id: ProjectTable.id, name: ProjectTable.name, worktree: ProjectTable.worktree })
|
||||
.from(ProjectTable)
|
||||
.where(inArray(ProjectTable.id, ids))
|
||||
.all(),
|
||||
)
|
||||
for (const item of items) {
|
||||
projects.set(item.id, {
|
||||
id: item.id,
|
||||
name: item.name ?? undefined,
|
||||
worktree: item.worktree,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
for (const row of rows) {
|
||||
const project = projects.get(row.project_id) ?? null
|
||||
yield { ...fromRow(row), project }
|
||||
}
|
||||
}
|
||||
|
||||
export const children = fn(Identifier.schema("session"), async (parentID) => {
|
||||
const project = Instance.project
|
||||
const rows = Database.use((db) =>
|
||||
|
||||
@@ -6,7 +6,6 @@ import { Config } from "../config/config"
|
||||
import { Instance } from "../project/instance"
|
||||
import { Flag } from "@/flag/flag"
|
||||
import { Log } from "../util/log"
|
||||
import { Glob } from "../util/glob"
|
||||
import type { MessageV2 } from "./message-v2"
|
||||
|
||||
const log = Log.create({ service: "instruction" })
|
||||
@@ -99,11 +98,13 @@ export namespace InstructionPrompt {
|
||||
instruction = path.join(os.homedir(), instruction.slice(2))
|
||||
}
|
||||
const matches = path.isAbsolute(instruction)
|
||||
? await Glob.scan(path.basename(instruction), {
|
||||
cwd: path.dirname(instruction),
|
||||
absolute: true,
|
||||
include: "file",
|
||||
}).catch(() => [])
|
||||
? await Array.fromAsync(
|
||||
new Bun.Glob(path.basename(instruction)).scan({
|
||||
cwd: path.dirname(instruction),
|
||||
absolute: true,
|
||||
onlyFiles: true,
|
||||
}),
|
||||
).catch(() => [])
|
||||
: await resolveRelative(instruction)
|
||||
matches.forEach((p) => {
|
||||
paths.add(path.resolve(p))
|
||||
|
||||
@@ -11,7 +11,7 @@ import {
|
||||
tool,
|
||||
jsonSchema,
|
||||
} from "ai"
|
||||
import { mergeDeep, pipe } from "remeda"
|
||||
import { clone, mergeDeep, pipe } from "remeda"
|
||||
import { ProviderTransform } from "@/provider/transform"
|
||||
import { Config } from "@/config/config"
|
||||
import { Instance } from "@/project/instance"
|
||||
@@ -80,11 +80,15 @@ export namespace LLM {
|
||||
)
|
||||
|
||||
const header = system[0]
|
||||
const original = clone(system)
|
||||
await Plugin.trigger(
|
||||
"experimental.chat.system.transform",
|
||||
{ sessionID: input.sessionID, model: input.model },
|
||||
{ system },
|
||||
)
|
||||
if (system.length === 0) {
|
||||
system.push(...original)
|
||||
}
|
||||
// rejoin to maintain 2-part structure for caching if header unchanged
|
||||
if (system.length > 2 && system[0] === header) {
|
||||
const rest = system.slice(1)
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user