mirror of
https://github.com/anomalyco/opencode.git
synced 2026-02-22 16:54:29 +00:00
Compare commits
45 Commits
commit-his
...
add-api-sh
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
e6a49ed85c | ||
|
|
77cdfcdb64 | ||
|
|
950df3de19 | ||
|
|
1d9f05e4f5 | ||
|
|
46361cf35c | ||
|
|
c09d3dd5a7 | ||
|
|
fe89bedfcc | ||
|
|
1e48d7fe82 | ||
|
|
2a904ec56f | ||
|
|
0ce61c817b | ||
|
|
1ffed2fa6c | ||
|
|
c79f1a72d8 | ||
|
|
9c5bbba6ea | ||
|
|
ce17f9dd94 | ||
|
|
92ab4217c2 | ||
|
|
7867ba441f | ||
|
|
7419ebc872 | ||
|
|
7e681b0bc0 | ||
|
|
4e9ef3ecc1 | ||
|
|
7e0e35af3f | ||
|
|
2410593023 | ||
|
|
1de12604cf | ||
|
|
ac0b37a7b7 | ||
|
|
7e1051af07 | ||
|
|
93615bef28 | ||
|
|
a04e4e81fb | ||
|
|
296250f1b7 | ||
|
|
443214871e | ||
|
|
1c2416b6de | ||
|
|
d86c10816d | ||
|
|
04a634a80d | ||
|
|
1eb6caa3c6 | ||
|
|
1a329ba47d | ||
|
|
8d781b08ce | ||
|
|
8b99ac6513 | ||
|
|
63a469d0ce | ||
|
|
ae98be83b3 | ||
|
|
a3181d5fbd | ||
|
|
998c8bf3a5 | ||
|
|
d2d7a37bca | ||
|
|
8ad60b1ec2 | ||
|
|
01d518708a | ||
|
|
ae50f24c06 | ||
|
|
d32dd4d7fd | ||
|
|
cb5a0de42f |
35
.github/workflows/publish.yml
vendored
35
.github/workflows/publish.yml
vendored
@@ -41,6 +41,13 @@ jobs:
|
||||
|
||||
- uses: ./.github/actions/setup-bun
|
||||
|
||||
- name: Setup git committer
|
||||
id: committer
|
||||
uses: ./.github/actions/setup-git-committer
|
||||
with:
|
||||
opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
|
||||
opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
|
||||
|
||||
- name: Install OpenCode
|
||||
if: inputs.bump || inputs.version
|
||||
run: bun i -g opencode-ai
|
||||
@@ -49,14 +56,16 @@ jobs:
|
||||
run: |
|
||||
./script/version.ts
|
||||
env:
|
||||
GH_TOKEN: ${{ github.token }}
|
||||
GH_TOKEN: ${{ steps.committer.outputs.token }}
|
||||
OPENCODE_BUMP: ${{ inputs.bump }}
|
||||
OPENCODE_VERSION: ${{ inputs.version }}
|
||||
OPENCODE_API_KEY: ${{ secrets.OPENCODE_API_KEY }}
|
||||
GH_REPO: ${{ (github.ref_name == 'beta' && 'anomalyco/opencode-beta') || github.repository }}
|
||||
outputs:
|
||||
version: ${{ steps.version.outputs.version }}
|
||||
release: ${{ steps.version.outputs.release }}
|
||||
tag: ${{ steps.version.outputs.tag }}
|
||||
repo: ${{ steps.version.outputs.repo }}
|
||||
|
||||
build-cli:
|
||||
needs: version
|
||||
@@ -69,6 +78,13 @@ jobs:
|
||||
|
||||
- uses: ./.github/actions/setup-bun
|
||||
|
||||
- name: Setup git committer
|
||||
id: committer
|
||||
uses: ./.github/actions/setup-git-committer
|
||||
with:
|
||||
opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
|
||||
opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
|
||||
|
||||
- name: Build
|
||||
id: build
|
||||
run: |
|
||||
@@ -76,7 +92,8 @@ jobs:
|
||||
env:
|
||||
OPENCODE_VERSION: ${{ needs.version.outputs.version }}
|
||||
OPENCODE_RELEASE: ${{ needs.version.outputs.release }}
|
||||
GH_TOKEN: ${{ github.token }}
|
||||
GH_REPO: ${{ needs.version.outputs.repo }}
|
||||
GH_TOKEN: ${{ steps.committer.outputs.token }}
|
||||
|
||||
- uses: actions/upload-artifact@v4
|
||||
with:
|
||||
@@ -189,6 +206,13 @@ jobs:
|
||||
if: contains(matrix.settings.host, 'ubuntu')
|
||||
run: cargo tauri --version
|
||||
|
||||
- name: Setup git committer
|
||||
id: committer
|
||||
uses: ./.github/actions/setup-git-committer
|
||||
with:
|
||||
opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
|
||||
opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
|
||||
|
||||
- name: Build and upload artifacts
|
||||
uses: tauri-apps/tauri-action@390cbe447412ced1303d35abe75287949e43437a
|
||||
timeout-minutes: 60
|
||||
@@ -196,14 +220,16 @@ jobs:
|
||||
projectPath: packages/desktop
|
||||
uploadWorkflowArtifacts: true
|
||||
tauriScript: ${{ (contains(matrix.settings.host, 'ubuntu') && 'cargo tauri') || '' }}
|
||||
args: --target ${{ matrix.settings.target }} --config ./src-tauri/tauri.prod.conf.json --verbose
|
||||
args: --target ${{ matrix.settings.target }} --config ${{ (github.ref_name == 'beta' && './src-tauri/tauri.beta.conf.json') || './src-tauri/tauri.prod.conf.json' }} --verbose
|
||||
updaterJsonPreferNsis: true
|
||||
releaseId: ${{ needs.version.outputs.release }}
|
||||
tagName: ${{ needs.version.outputs.tag }}
|
||||
releaseDraft: true
|
||||
releaseAssetNamePattern: opencode-desktop-[platform]-[arch][ext]
|
||||
repo: ${{ (github.ref_name == 'beta' && 'opencode-beta') || '' }}
|
||||
releaseCommitish: ${{ github.sha }}
|
||||
env:
|
||||
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||
GITHUB_TOKEN: ${{ steps.committer.outputs.token }}
|
||||
TAURI_BUNDLER_NEW_APPIMAGE_FORMAT: true
|
||||
TAURI_SIGNING_PRIVATE_KEY: ${{ secrets.TAURI_SIGNING_PRIVATE_KEY }}
|
||||
TAURI_SIGNING_PRIVATE_KEY_PASSWORD: ${{ secrets.TAURI_SIGNING_PRIVATE_KEY_PASSWORD }}
|
||||
@@ -280,4 +306,5 @@ jobs:
|
||||
OPENCODE_RELEASE: ${{ needs.version.outputs.release }}
|
||||
AUR_KEY: ${{ secrets.AUR_KEY }}
|
||||
GITHUB_TOKEN: ${{ steps.committer.outputs.token }}
|
||||
GH_REPO: ${{ needs.version.outputs.repo }}
|
||||
NPM_CONFIG_PROVENANCE: false
|
||||
|
||||
1
.gitignore
vendored
1
.gitignore
vendored
@@ -27,3 +27,4 @@ target
|
||||
opencode-dev
|
||||
logs/
|
||||
*.bun-build
|
||||
tsconfig.tsbuildinfo
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
---
|
||||
description: Translate content for a specified locale while preserving technical terms
|
||||
mode: subagent
|
||||
model: opencode/gemini-3-pro
|
||||
model: opencode/gemini-3.1-pro
|
||||
---
|
||||
|
||||
You are a professional translator and localization specialist.
|
||||
|
||||
@@ -5,8 +5,16 @@ import DESCRIPTION from "./github-triage.txt"
|
||||
const TEAM = {
|
||||
desktop: ["adamdotdevin", "iamdavidhill", "Brendonovich", "nexxeln"],
|
||||
zen: ["fwang", "MrMushrooooom"],
|
||||
tui: ["thdxr", "kommander", "rekram1-node"],
|
||||
core: ["thdxr", "rekram1-node", "jlongster"],
|
||||
tui: [
|
||||
"thdxr",
|
||||
"kommander",
|
||||
// "rekram1-node" (on vacation)
|
||||
],
|
||||
core: [
|
||||
"thdxr",
|
||||
// "rekram1-node", (on vacation)
|
||||
"jlongster",
|
||||
],
|
||||
docs: ["R44VC0RP"],
|
||||
windows: ["Hona"],
|
||||
} as const
|
||||
@@ -42,10 +50,7 @@ async function githubFetch(endpoint: string, options: RequestInit = {}) {
|
||||
export default tool({
|
||||
description: DESCRIPTION,
|
||||
args: {
|
||||
assignee: tool.schema
|
||||
.enum(ASSIGNEES as [string, ...string[]])
|
||||
.describe("The username of the assignee")
|
||||
.default("rekram1-node"),
|
||||
assignee: tool.schema.enum(ASSIGNEES as [string, ...string[]]).describe("The username of the assignee"),
|
||||
labels: tool.schema
|
||||
.array(tool.schema.enum(["nix", "opentui", "perf", "web", "desktop", "zen", "docs", "windows", "core"]))
|
||||
.describe("The labels(s) to add to the issue")
|
||||
@@ -68,7 +73,8 @@ export default tool({
|
||||
results.push("Dropped label: nix (issue does not mention nix)")
|
||||
}
|
||||
|
||||
const assignee = nix ? "rekram1-node" : web ? pick(TEAM.desktop) : args.assignee
|
||||
// const assignee = nix ? "rekram1-node" : web ? pick(TEAM.desktop) : args.assignee
|
||||
const assignee = web ? pick(TEAM.desktop) : args.assignee
|
||||
|
||||
if (labels.includes("zen") && !zen) {
|
||||
throw new Error("Only add the zen label when issue title/body contains 'zen'")
|
||||
|
||||
@@ -4,3 +4,5 @@ Choose labels and assignee using the current triage policy and ownership rules.
|
||||
Pick the most fitting labels for the issue and assign one owner.
|
||||
|
||||
If unsure, choose the team/section with the most overlap with the issue and assign a member from that team at random.
|
||||
|
||||
(Note: rekram1-node is on vacation, do not assign issues to him.)
|
||||
|
||||
30
bun.lock
30
bun.lock
@@ -25,7 +25,7 @@
|
||||
},
|
||||
"packages/app": {
|
||||
"name": "@opencode-ai/app",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@kobalte/core": "catalog:",
|
||||
"@opencode-ai/sdk": "workspace:*",
|
||||
@@ -75,7 +75,7 @@
|
||||
},
|
||||
"packages/console/app": {
|
||||
"name": "@opencode-ai/console-app",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@cloudflare/vite-plugin": "1.15.2",
|
||||
"@ibm/plex": "6.4.1",
|
||||
@@ -109,7 +109,7 @@
|
||||
},
|
||||
"packages/console/core": {
|
||||
"name": "@opencode-ai/console-core",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@aws-sdk/client-sts": "3.782.0",
|
||||
"@jsx-email/render": "1.1.1",
|
||||
@@ -136,7 +136,7 @@
|
||||
},
|
||||
"packages/console/function": {
|
||||
"name": "@opencode-ai/console-function",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@ai-sdk/anthropic": "2.0.0",
|
||||
"@ai-sdk/openai": "2.0.2",
|
||||
@@ -160,7 +160,7 @@
|
||||
},
|
||||
"packages/console/mail": {
|
||||
"name": "@opencode-ai/console-mail",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@jsx-email/all": "2.2.3",
|
||||
"@jsx-email/cli": "1.4.3",
|
||||
@@ -184,7 +184,7 @@
|
||||
},
|
||||
"packages/desktop": {
|
||||
"name": "@opencode-ai/desktop",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@opencode-ai/app": "workspace:*",
|
||||
"@opencode-ai/ui": "workspace:*",
|
||||
@@ -217,7 +217,7 @@
|
||||
},
|
||||
"packages/enterprise": {
|
||||
"name": "@opencode-ai/enterprise",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@opencode-ai/ui": "workspace:*",
|
||||
"@opencode-ai/util": "workspace:*",
|
||||
@@ -246,7 +246,7 @@
|
||||
},
|
||||
"packages/function": {
|
||||
"name": "@opencode-ai/function",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@octokit/auth-app": "8.0.1",
|
||||
"@octokit/rest": "catalog:",
|
||||
@@ -262,7 +262,7 @@
|
||||
},
|
||||
"packages/opencode": {
|
||||
"name": "opencode",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"bin": {
|
||||
"opencode": "./bin/opencode",
|
||||
},
|
||||
@@ -376,7 +376,7 @@
|
||||
},
|
||||
"packages/plugin": {
|
||||
"name": "@opencode-ai/plugin",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@opencode-ai/sdk": "workspace:*",
|
||||
"zod": "catalog:",
|
||||
@@ -396,7 +396,7 @@
|
||||
},
|
||||
"packages/sdk/js": {
|
||||
"name": "@opencode-ai/sdk",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"devDependencies": {
|
||||
"@hey-api/openapi-ts": "0.90.10",
|
||||
"@tsconfig/node22": "catalog:",
|
||||
@@ -407,7 +407,7 @@
|
||||
},
|
||||
"packages/slack": {
|
||||
"name": "@opencode-ai/slack",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@opencode-ai/sdk": "workspace:*",
|
||||
"@slack/bolt": "^3.17.1",
|
||||
@@ -420,7 +420,7 @@
|
||||
},
|
||||
"packages/ui": {
|
||||
"name": "@opencode-ai/ui",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@kobalte/core": "catalog:",
|
||||
"@opencode-ai/sdk": "workspace:*",
|
||||
@@ -462,7 +462,7 @@
|
||||
},
|
||||
"packages/util": {
|
||||
"name": "@opencode-ai/util",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"zod": "catalog:",
|
||||
},
|
||||
@@ -473,7 +473,7 @@
|
||||
},
|
||||
"packages/web": {
|
||||
"name": "@opencode-ai/web",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@astrojs/cloudflare": "12.6.3",
|
||||
"@astrojs/markdown-remark": "6.3.1",
|
||||
|
||||
@@ -30,6 +30,10 @@ inputs:
|
||||
description: "Comma-separated list of trigger phrases (case-insensitive). Defaults to '/opencode,/oc'"
|
||||
required: false
|
||||
|
||||
variant:
|
||||
description: "Model variant for provider-specific reasoning effort (e.g., high, max, minimal)"
|
||||
required: false
|
||||
|
||||
oidc_base_url:
|
||||
description: "Base URL for OIDC token exchange API. Only required when running a custom GitHub App install. Defaults to https://api.opencode.ai"
|
||||
required: false
|
||||
@@ -71,4 +75,5 @@ runs:
|
||||
PROMPT: ${{ inputs.prompt }}
|
||||
USE_GITHUB_TOKEN: ${{ inputs.use_github_token }}
|
||||
MENTIONS: ${{ inputs.mentions }}
|
||||
VARIANT: ${{ inputs.variant }}
|
||||
OIDC_BASE_URL: ${{ inputs.oidc_base_url }}
|
||||
|
||||
@@ -225,7 +225,7 @@ export async function hoverSessionItem(page: Page, sessionID: string) {
|
||||
export async function openSessionMoreMenu(page: Page, sessionID: string) {
|
||||
await expect(page).toHaveURL(new RegExp(`/session/${sessionID}(?:[/?#]|$)`))
|
||||
|
||||
const scroller = page.locator(".session-scroller").first()
|
||||
const scroller = page.locator(".scroll-view__viewport").first()
|
||||
await expect(scroller).toBeVisible()
|
||||
await expect(scroller.getByRole("heading", { level: 1 }).first()).toBeVisible({ timeout: 30_000 })
|
||||
|
||||
|
||||
@@ -44,7 +44,7 @@ test("session can be renamed via header menu", async ({ page, sdk, gotoSession }
|
||||
const menu = await openSessionMoreMenu(page, session.id)
|
||||
await clickMenuItem(menu, /rename/i)
|
||||
|
||||
const input = page.locator(".session-scroller").locator(inlineInputSelector).first()
|
||||
const input = page.locator(".scroll-view__viewport").locator(inlineInputSelector).first()
|
||||
await expect(input).toBeVisible()
|
||||
await expect(input).toBeFocused()
|
||||
await input.fill(renamedTitle)
|
||||
|
||||
@@ -6,6 +6,7 @@ test("smoke terminal mounts and can create a second tab", async ({ page, gotoSes
|
||||
await gotoSession()
|
||||
|
||||
const terminals = page.locator(terminalSelector)
|
||||
const tabs = page.locator('#terminal-panel [data-slot="tabs-trigger"]')
|
||||
const opened = await terminals.first().isVisible()
|
||||
|
||||
if (!opened) {
|
||||
@@ -21,6 +22,7 @@ test("smoke terminal mounts and can create a second tab", async ({ page, gotoSes
|
||||
await page.locator(promptSelector).click()
|
||||
await page.keyboard.press("Control+Alt+T")
|
||||
|
||||
await expect(terminals).toHaveCount(2)
|
||||
await expect(terminals.nth(1).locator("textarea")).toHaveCount(1)
|
||||
await expect(tabs).toHaveCount(2)
|
||||
await expect(terminals).toHaveCount(1)
|
||||
await expect(terminals.first().locator("textarea")).toHaveCount(1)
|
||||
})
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/app",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"description": "",
|
||||
"type": "module",
|
||||
"exports": {
|
||||
|
||||
@@ -89,6 +89,8 @@ const EXAMPLES = [
|
||||
"prompt.example.25",
|
||||
] as const
|
||||
|
||||
const NON_EMPTY_TEXT = /[^\s\u200B]/
|
||||
|
||||
export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
const sdk = useSDK()
|
||||
const sync = useSync()
|
||||
@@ -636,7 +638,9 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
let buffer = ""
|
||||
|
||||
const flushText = () => {
|
||||
const content = buffer.replace(/\r\n?/g, "\n").replace(/\u200B/g, "")
|
||||
let content = buffer
|
||||
if (content.includes("\r")) content = content.replace(/\r\n?/g, "\n")
|
||||
if (content.includes("\u200B")) content = content.replace(/\u200B/g, "")
|
||||
buffer = ""
|
||||
if (!content) return
|
||||
parts.push({ type: "text", content, start: position, end: position + content.length })
|
||||
@@ -714,10 +718,12 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
const rawParts = parseFromDOM()
|
||||
const images = imageAttachments()
|
||||
const cursorPosition = getCursorPosition(editorRef)
|
||||
const rawText = rawParts.map((p) => ("content" in p ? p.content : "")).join("")
|
||||
const trimmed = rawText.replace(/\u200B/g, "").trim()
|
||||
const rawText =
|
||||
rawParts.length === 1 && rawParts[0]?.type === "text"
|
||||
? rawParts[0].content
|
||||
: rawParts.map((p) => ("content" in p ? p.content : "")).join("")
|
||||
const hasNonText = rawParts.some((part) => part.type !== "text")
|
||||
const shouldReset = trimmed.length === 0 && !hasNonText && images.length === 0
|
||||
const shouldReset = !NON_EMPTY_TEXT.test(rawText) && !hasNonText && images.length === 0
|
||||
|
||||
if (shouldReset) {
|
||||
closePopover()
|
||||
@@ -757,19 +763,31 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
}
|
||||
|
||||
const addPart = (part: ContentPart) => {
|
||||
const selection = window.getSelection()
|
||||
if (!selection || selection.rangeCount === 0) return
|
||||
if (part.type === "image") return false
|
||||
|
||||
const cursorPosition = getCursorPosition(editorRef)
|
||||
const currentPrompt = prompt.current()
|
||||
const rawText = currentPrompt.map((p) => ("content" in p ? p.content : "")).join("")
|
||||
const textBeforeCursor = rawText.substring(0, cursorPosition)
|
||||
const atMatch = textBeforeCursor.match(/@(\S*)$/)
|
||||
const selection = window.getSelection()
|
||||
if (!selection) return false
|
||||
|
||||
if (selection.rangeCount === 0 || !editorRef.contains(selection.anchorNode)) {
|
||||
editorRef.focus()
|
||||
const cursor = prompt.cursor() ?? promptLength(prompt.current())
|
||||
setCursorPosition(editorRef, cursor)
|
||||
}
|
||||
|
||||
if (selection.rangeCount === 0) return false
|
||||
const range = selection.getRangeAt(0)
|
||||
if (!editorRef.contains(range.startContainer)) return false
|
||||
|
||||
if (part.type === "file" || part.type === "agent") {
|
||||
const cursorPosition = getCursorPosition(editorRef)
|
||||
const rawText = prompt
|
||||
.current()
|
||||
.map((p) => ("content" in p ? p.content : ""))
|
||||
.join("")
|
||||
const textBeforeCursor = rawText.substring(0, cursorPosition)
|
||||
const atMatch = textBeforeCursor.match(/@(\S*)$/)
|
||||
const pill = createPill(part)
|
||||
const gap = document.createTextNode(" ")
|
||||
const range = selection.getRangeAt(0)
|
||||
|
||||
if (atMatch) {
|
||||
const start = atMatch.index ?? cursorPosition - atMatch[0].length
|
||||
@@ -784,8 +802,9 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
range.collapse(true)
|
||||
selection.removeAllRanges()
|
||||
selection.addRange(range)
|
||||
} else if (part.type === "text") {
|
||||
const range = selection.getRangeAt(0)
|
||||
}
|
||||
|
||||
if (part.type === "text") {
|
||||
const fragment = createTextFragment(part.content)
|
||||
const last = fragment.lastChild
|
||||
range.deleteContents()
|
||||
@@ -821,6 +840,7 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
|
||||
|
||||
handleInput()
|
||||
closePopover()
|
||||
return true
|
||||
}
|
||||
|
||||
const addToHistory = (prompt: Prompt, mode: "normal" | "shell") => {
|
||||
|
||||
@@ -7,6 +7,19 @@ import { getCursorPosition } from "./editor-dom"
|
||||
|
||||
export const ACCEPTED_IMAGE_TYPES = ["image/png", "image/jpeg", "image/gif", "image/webp"]
|
||||
export const ACCEPTED_FILE_TYPES = [...ACCEPTED_IMAGE_TYPES, "application/pdf"]
|
||||
const LARGE_PASTE_CHARS = 8000
|
||||
const LARGE_PASTE_BREAKS = 120
|
||||
|
||||
function largePaste(text: string) {
|
||||
if (text.length >= LARGE_PASTE_CHARS) return true
|
||||
let breaks = 0
|
||||
for (const char of text) {
|
||||
if (char !== "\n") continue
|
||||
breaks += 1
|
||||
if (breaks >= LARGE_PASTE_BREAKS) return true
|
||||
}
|
||||
return false
|
||||
}
|
||||
|
||||
type PromptAttachmentsInput = {
|
||||
editor: () => HTMLDivElement | undefined
|
||||
@@ -14,7 +27,7 @@ type PromptAttachmentsInput = {
|
||||
isDialogActive: () => boolean
|
||||
setDraggingType: (type: "image" | "@mention" | null) => void
|
||||
focusEditor: () => void
|
||||
addPart: (part: ContentPart) => void
|
||||
addPart: (part: ContentPart) => boolean
|
||||
readClipboardImage?: () => Promise<File | null>
|
||||
}
|
||||
|
||||
@@ -89,6 +102,13 @@ export function createPromptAttachments(input: PromptAttachmentsInput) {
|
||||
}
|
||||
|
||||
if (!plainText) return
|
||||
|
||||
if (largePaste(plainText)) {
|
||||
if (input.addPart({ type: "text", content: plainText, start: 0, end: 0 })) return
|
||||
input.focusEditor()
|
||||
if (input.addPart({ type: "text", content: plainText, start: 0, end: 0 })) return
|
||||
}
|
||||
|
||||
const inserted = typeof document.execCommand === "function" && document.execCommand("insertText", false, plainText)
|
||||
if (inserted) return
|
||||
|
||||
|
||||
@@ -24,6 +24,28 @@ describe("prompt-input editor dom", () => {
|
||||
expect((container.childNodes[1] as HTMLElement).tagName).toBe("BR")
|
||||
})
|
||||
|
||||
test("createTextFragment avoids break-node explosion for large multiline content", () => {
|
||||
const content = Array.from({ length: 220 }, () => "line").join("\n")
|
||||
const fragment = createTextFragment(content)
|
||||
const container = document.createElement("div")
|
||||
container.appendChild(fragment)
|
||||
|
||||
expect(container.childNodes.length).toBe(1)
|
||||
expect(container.childNodes[0]?.nodeType).toBe(Node.TEXT_NODE)
|
||||
expect(container.textContent).toBe(content)
|
||||
})
|
||||
|
||||
test("createTextFragment keeps terminal break in large multiline fallback", () => {
|
||||
const content = `${Array.from({ length: 220 }, () => "line").join("\n")}\n`
|
||||
const fragment = createTextFragment(content)
|
||||
const container = document.createElement("div")
|
||||
container.appendChild(fragment)
|
||||
|
||||
expect(container.childNodes.length).toBe(2)
|
||||
expect(container.childNodes[0]?.textContent).toBe(content.slice(0, -1))
|
||||
expect((container.childNodes[1] as HTMLElement).tagName).toBe("BR")
|
||||
})
|
||||
|
||||
test("length helpers treat breaks as one char and ignore zero-width chars", () => {
|
||||
const container = document.createElement("div")
|
||||
container.appendChild(document.createTextNode("ab\u200B"))
|
||||
|
||||
@@ -1,5 +1,20 @@
|
||||
const MAX_BREAKS = 200
|
||||
|
||||
export function createTextFragment(content: string): DocumentFragment {
|
||||
const fragment = document.createDocumentFragment()
|
||||
let breaks = 0
|
||||
for (const char of content) {
|
||||
if (char !== "\n") continue
|
||||
breaks += 1
|
||||
if (breaks > MAX_BREAKS) {
|
||||
const tail = content.endsWith("\n")
|
||||
const text = tail ? content.slice(0, -1) : content
|
||||
if (text) fragment.appendChild(document.createTextNode(text))
|
||||
if (tail) fragment.appendChild(document.createElement("br"))
|
||||
return fragment
|
||||
}
|
||||
}
|
||||
|
||||
const segments = content.split("\n")
|
||||
segments.forEach((segment, index) => {
|
||||
if (segment) {
|
||||
|
||||
@@ -11,6 +11,7 @@ import { Accordion } from "@opencode-ai/ui/accordion"
|
||||
import { StickyAccordionHeader } from "@opencode-ai/ui/sticky-accordion-header"
|
||||
import { Code } from "@opencode-ai/ui/code"
|
||||
import { Markdown } from "@opencode-ai/ui/markdown"
|
||||
import { ScrollView } from "@opencode-ai/ui/scroll-view"
|
||||
import type { Message, Part, UserMessage } from "@opencode-ai/sdk/v2/client"
|
||||
import { useLanguage } from "@/context/language"
|
||||
import { getSessionContextMetrics } from "./session-context-metrics"
|
||||
@@ -268,9 +269,9 @@ export function SessionContextTab() {
|
||||
})
|
||||
|
||||
return (
|
||||
<div
|
||||
class="@container h-full overflow-y-auto no-scrollbar pb-10"
|
||||
ref={(el) => {
|
||||
<ScrollView
|
||||
class="@container h-full pb-10"
|
||||
viewportRef={(el) => {
|
||||
scroll = el
|
||||
restoreScroll()
|
||||
}}
|
||||
@@ -336,6 +337,6 @@ export function SessionContextTab() {
|
||||
</Accordion>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</ScrollView>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -250,6 +250,18 @@ export const SettingsGeneral: Component = () => {
|
||||
)}
|
||||
</Select>
|
||||
</SettingsRow>
|
||||
|
||||
<SettingsRow
|
||||
title={language.t("settings.general.row.reasoningSummaries.title")}
|
||||
description={language.t("settings.general.row.reasoningSummaries.description")}
|
||||
>
|
||||
<div data-action="settings-reasoning-summaries">
|
||||
<Switch
|
||||
checked={settings.general.showReasoningSummaries()}
|
||||
onChange={(checked) => settings.general.setShowReasoningSummaries(checked)}
|
||||
/>
|
||||
</div>
|
||||
</SettingsRow>
|
||||
</div>
|
||||
</div>
|
||||
)
|
||||
@@ -418,7 +430,7 @@ export const SettingsGeneral: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-1 pt-6 pb-8">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.tab.general")}</h2>
|
||||
</div>
|
||||
|
||||
@@ -370,7 +370,7 @@ export const SettingsKeybinds: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-4 pt-6 pb-6 max-w-[720px]">
|
||||
<div class="flex items-center justify-between gap-4">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.shortcuts.title")}</h2>
|
||||
|
||||
@@ -59,7 +59,7 @@ export const SettingsModels: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-4 pt-6 pb-6 max-w-[720px]">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.models.title")}</h2>
|
||||
<div class="flex items-center gap-2 px-3 h-9 rounded-lg bg-surface-base">
|
||||
|
||||
@@ -177,7 +177,7 @@ export const SettingsPermissions: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-1 px-4 py-8 sm:p-8 max-w-[720px]">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.permissions.title")}</h2>
|
||||
<p class="text-14-regular text-text-weak">{language.t("settings.permissions.description")}</p>
|
||||
|
||||
@@ -132,7 +132,7 @@ export const SettingsProviders: Component = () => {
|
||||
|
||||
return (
|
||||
<div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
|
||||
<div class="flex flex-col gap-1 pt-6 pb-8 max-w-[720px]">
|
||||
<h2 class="text-16-medium text-text-strong">{language.t("settings.providers.title")}</h2>
|
||||
</div>
|
||||
|
||||
@@ -540,7 +540,7 @@ export const Terminal = (props: TerminalProps) => {
|
||||
disposed = true
|
||||
if (fitFrame !== undefined) cancelAnimationFrame(fitFrame)
|
||||
if (sizeTimer !== undefined) clearTimeout(sizeTimer)
|
||||
if (ws && ws.readyState !== WebSocket.CLOSED && ws.readyState !== WebSocket.CLOSING) ws.close()
|
||||
if (ws && ws.readyState !== WebSocket.CLOSED && ws.readyState !== WebSocket.CLOSING) ws.close(1000)
|
||||
|
||||
const finalize = () => {
|
||||
persistTerminal({ term, addon: serializeAddon, cursor, pty: local.pty, onCleanup: props.onCleanup })
|
||||
|
||||
@@ -22,6 +22,7 @@ export interface Settings {
|
||||
general: {
|
||||
autoSave: boolean
|
||||
releaseNotes: boolean
|
||||
showReasoningSummaries: boolean
|
||||
}
|
||||
updates: {
|
||||
startup: boolean
|
||||
@@ -42,6 +43,7 @@ const defaultSettings: Settings = {
|
||||
general: {
|
||||
autoSave: true,
|
||||
releaseNotes: true,
|
||||
showReasoningSummaries: false,
|
||||
},
|
||||
updates: {
|
||||
startup: true,
|
||||
@@ -120,6 +122,13 @@ export const { use: useSettings, provider: SettingsProvider } = createSimpleCont
|
||||
setReleaseNotes(value: boolean) {
|
||||
setStore("general", "releaseNotes", value)
|
||||
},
|
||||
showReasoningSummaries: withFallback(
|
||||
() => store.general?.showReasoningSummaries,
|
||||
defaultSettings.general.showReasoningSummaries,
|
||||
),
|
||||
setShowReasoningSummaries(value: boolean) {
|
||||
setStore("general", "showReasoningSummaries", value)
|
||||
},
|
||||
},
|
||||
updates: {
|
||||
startup: withFallback(() => store.updates?.startup, defaultSettings.updates.startup),
|
||||
|
||||
@@ -610,6 +610,8 @@ export const dict = {
|
||||
"settings.general.row.theme.description": "Customise how OpenCode is themed.",
|
||||
"settings.general.row.font.title": "Font",
|
||||
"settings.general.row.font.description": "Customise the mono font used in code blocks",
|
||||
"settings.general.row.reasoningSummaries.title": "Show reasoning summaries",
|
||||
"settings.general.row.reasoningSummaries.description": "Display model reasoning summaries in the timeline",
|
||||
|
||||
"settings.general.row.wayland.title": "Use native Wayland",
|
||||
"settings.general.row.wayland.description": "Disable X11 fallback on Wayland. Requires restart.",
|
||||
|
||||
@@ -943,15 +943,12 @@ export default function Page() {
|
||||
if (next === dockHeight) return
|
||||
|
||||
const el = scroller
|
||||
const stick = el ? el.scrollHeight - el.clientHeight - el.scrollTop < 10 : false
|
||||
const delta = next - dockHeight
|
||||
const stick = el ? el.scrollHeight - el.clientHeight - el.scrollTop < 10 + Math.max(0, delta) : false
|
||||
|
||||
dockHeight = next
|
||||
|
||||
if (stick && el) {
|
||||
requestAnimationFrame(() => {
|
||||
el.scrollTo({ top: el.scrollHeight, behavior: "auto" })
|
||||
})
|
||||
}
|
||||
if (stick) autoScroll.forceScrollToBottom()
|
||||
|
||||
if (el) scheduleScrollState(el)
|
||||
scrollSpy.markDirty()
|
||||
|
||||
@@ -62,7 +62,7 @@ export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit
|
||||
const measure = () => {
|
||||
if (!root) return
|
||||
|
||||
const scroller = document.querySelector(".session-scroller")
|
||||
const scroller = document.querySelector(".scroll-view__viewport")
|
||||
const head = scroller instanceof HTMLElement ? scroller.firstElementChild : undefined
|
||||
const top =
|
||||
head instanceof HTMLElement && head.classList.contains("sticky") ? head.getBoundingClientRect().bottom : 0
|
||||
@@ -95,7 +95,7 @@ export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit
|
||||
window.addEventListener("resize", update)
|
||||
|
||||
const dock = root?.closest('[data-component="session-prompt-dock"]')
|
||||
const scroller = document.querySelector(".session-scroller")
|
||||
const scroller = document.querySelector(".scroll-view__viewport")
|
||||
const observer = new ResizeObserver(update)
|
||||
if (dock instanceof HTMLElement) observer.observe(dock)
|
||||
if (scroller instanceof HTMLElement) observer.observe(scroller)
|
||||
|
||||
@@ -9,6 +9,7 @@ import { showToast } from "@opencode-ai/ui/toast"
|
||||
import { LineComment as LineCommentView, LineCommentEditor } from "@opencode-ai/ui/line-comment"
|
||||
import { Mark } from "@opencode-ai/ui/logo"
|
||||
import { Tabs } from "@opencode-ai/ui/tabs"
|
||||
import { ScrollView } from "@opencode-ai/ui/scroll-view"
|
||||
import { useLayout } from "@/context/layout"
|
||||
import { selectionFromLines, useFile, type FileSelection, type SelectedLineRange } from "@/context/file"
|
||||
import { useComments } from "@/context/comments"
|
||||
@@ -509,51 +510,52 @@ export function FileTabContent(props: { tab: string }) {
|
||||
)
|
||||
|
||||
return (
|
||||
<Tabs.Content
|
||||
value={props.tab}
|
||||
class="mt-3 relative"
|
||||
ref={(el: HTMLDivElement) => {
|
||||
scroll = el
|
||||
restoreScroll()
|
||||
}}
|
||||
onScroll={handleScroll}
|
||||
>
|
||||
<Switch>
|
||||
<Match when={state()?.loaded && isImage()}>
|
||||
<div class="px-6 py-4 pb-40">
|
||||
<img
|
||||
src={imageDataUrl()}
|
||||
alt={path()}
|
||||
class="max-w-full"
|
||||
onLoad={() => requestAnimationFrame(restoreScroll)}
|
||||
/>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded && isSvg()}>
|
||||
<div class="flex flex-col gap-4 px-6 py-4">
|
||||
{renderCode(svgContent() ?? "", "")}
|
||||
<Show when={svgPreviewUrl()}>
|
||||
<div class="flex justify-center pb-40">
|
||||
<img src={svgPreviewUrl()} alt={path()} class="max-w-full max-h-96" />
|
||||
</div>
|
||||
</Show>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded && isBinary()}>
|
||||
<div class="h-full px-6 pb-42 flex flex-col items-center justify-center text-center gap-6">
|
||||
<Mark class="w-14 opacity-10" />
|
||||
<div class="flex flex-col gap-2 max-w-md">
|
||||
<div class="text-14-semibold text-text-strong truncate">{path()?.split("/").pop()}</div>
|
||||
<div class="text-14-regular text-text-weak">{language.t("session.files.binaryContent")}</div>
|
||||
<Tabs.Content value={props.tab} class="mt-3 relative h-full">
|
||||
<ScrollView
|
||||
class="h-full"
|
||||
viewportRef={(el: HTMLDivElement) => {
|
||||
scroll = el
|
||||
restoreScroll()
|
||||
}}
|
||||
onScroll={handleScroll as any}
|
||||
>
|
||||
<Switch>
|
||||
<Match when={state()?.loaded && isImage()}>
|
||||
<div class="px-6 py-4 pb-40">
|
||||
<img
|
||||
src={imageDataUrl()}
|
||||
alt={path()}
|
||||
class="max-w-full"
|
||||
onLoad={() => requestAnimationFrame(restoreScroll)}
|
||||
/>
|
||||
</div>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded}>{renderCode(contents(), "pb-40")}</Match>
|
||||
<Match when={state()?.loading}>
|
||||
<div class="px-6 py-4 text-text-weak">{language.t("common.loading")}...</div>
|
||||
</Match>
|
||||
<Match when={state()?.error}>{(err) => <div class="px-6 py-4 text-text-weak">{err()}</div>}</Match>
|
||||
</Switch>
|
||||
</Match>
|
||||
<Match when={state()?.loaded && isSvg()}>
|
||||
<div class="flex flex-col gap-4 px-6 py-4">
|
||||
{renderCode(svgContent() ?? "", "")}
|
||||
<Show when={svgPreviewUrl()}>
|
||||
<div class="flex justify-center pb-40">
|
||||
<img src={svgPreviewUrl()} alt={path()} class="max-w-full max-h-96" />
|
||||
</div>
|
||||
</Show>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded && isBinary()}>
|
||||
<div class="h-full px-6 pb-42 flex flex-col items-center justify-center text-center gap-6">
|
||||
<Mark class="w-14 opacity-10" />
|
||||
<div class="flex flex-col gap-2 max-w-md">
|
||||
<div class="text-14-semibold text-text-strong truncate">{path()?.split("/").pop()}</div>
|
||||
<div class="text-14-regular text-text-weak">{language.t("session.files.binaryContent")}</div>
|
||||
</div>
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={state()?.loaded}>{renderCode(contents(), "pb-40")}</Match>
|
||||
<Match when={state()?.loading}>
|
||||
<div class="px-6 py-4 text-text-weak">{language.t("common.loading")}...</div>
|
||||
</Match>
|
||||
<Match when={state()?.error}>{(err) => <div class="px-6 py-4 text-text-weak">{err()}</div>}</Match>
|
||||
</Switch>
|
||||
</ScrollView>
|
||||
</Tabs.Content>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -8,12 +8,14 @@ import { DropdownMenu } from "@opencode-ai/ui/dropdown-menu"
|
||||
import { Dialog } from "@opencode-ai/ui/dialog"
|
||||
import { InlineInput } from "@opencode-ai/ui/inline-input"
|
||||
import { SessionTurn } from "@opencode-ai/ui/session-turn"
|
||||
import { ScrollView } from "@opencode-ai/ui/scroll-view"
|
||||
import type { UserMessage } from "@opencode-ai/sdk/v2"
|
||||
import { showToast } from "@opencode-ai/ui/toast"
|
||||
import { shouldMarkBoundaryGesture, normalizeWheelDelta } from "@/pages/session/message-gesture"
|
||||
import { SessionContextUsage } from "@/components/session-context-usage"
|
||||
import { useDialog } from "@opencode-ai/ui/context/dialog"
|
||||
import { useLanguage } from "@/context/language"
|
||||
import { useSettings } from "@/context/settings"
|
||||
import { useSDK } from "@/context/sdk"
|
||||
import { useSync } from "@/context/sync"
|
||||
|
||||
@@ -80,6 +82,7 @@ export function MessageTimeline(props: {
|
||||
const navigate = useNavigate()
|
||||
const sdk = useSDK()
|
||||
const sync = useSync()
|
||||
const settings = useSettings()
|
||||
const dialog = useDialog()
|
||||
const language = useLanguage()
|
||||
|
||||
@@ -320,8 +323,8 @@ export function MessageTimeline(props: {
|
||||
<Icon name="arrow-down-to-line" />
|
||||
</button>
|
||||
</div>
|
||||
<div
|
||||
ref={props.setScrollRef}
|
||||
<ScrollView
|
||||
viewportRef={props.setScrollRef}
|
||||
onWheel={(e) => {
|
||||
const root = e.currentTarget
|
||||
const delta = normalizeWheelDelta({
|
||||
@@ -365,7 +368,7 @@ export function MessageTimeline(props: {
|
||||
if (props.isDesktop) props.onScrollSpyScroll()
|
||||
}}
|
||||
onClick={props.onAutoScrollInteraction}
|
||||
class="relative min-w-0 w-full h-full overflow-y-auto session-scroller"
|
||||
class="relative min-w-0 w-full h-full"
|
||||
style={{
|
||||
"--session-title-height": showHeader() ? "40px" : "0px",
|
||||
"--sticky-accordion-top": showHeader() ? "48px" : "0px",
|
||||
@@ -535,6 +538,7 @@ export function MessageTimeline(props: {
|
||||
sessionID={sessionID() ?? ""}
|
||||
messageID={message.id}
|
||||
lastUserMessageID={props.lastUserMessageID}
|
||||
showReasoningSummaries={settings.general.showReasoningSummaries()}
|
||||
classes={{
|
||||
root: "min-w-0 w-full relative",
|
||||
content: "flex flex-col justify-between !overflow-visible",
|
||||
@@ -545,7 +549,7 @@ export function MessageTimeline(props: {
|
||||
)}
|
||||
</For>
|
||||
</div>
|
||||
</div>
|
||||
</ScrollView>
|
||||
</div>
|
||||
</Show>
|
||||
)
|
||||
|
||||
@@ -143,9 +143,9 @@ export function SessionReviewTab(props: SessionReviewTabProps) {
|
||||
open={props.view().review.open()}
|
||||
onOpenChange={props.view().review.setOpen}
|
||||
classes={{
|
||||
root: props.classes?.root ?? "pb-6",
|
||||
root: props.classes?.root ?? "pb-6 pr-3",
|
||||
header: props.classes?.header ?? "px-3",
|
||||
container: props.classes?.container ?? "px-3",
|
||||
container: props.classes?.container ?? "pl-3",
|
||||
}}
|
||||
diffs={props.diffs()}
|
||||
diffStyle={props.diffStyle}
|
||||
|
||||
@@ -67,11 +67,11 @@ export function TerminalPanel() {
|
||||
on(
|
||||
() => terminal.active(),
|
||||
(activeId) => {
|
||||
if (!activeId || !opened()) return
|
||||
if (!activeId || !open()) return
|
||||
if (document.activeElement instanceof HTMLElement) {
|
||||
document.activeElement.blur()
|
||||
}
|
||||
focusTerminalById(activeId)
|
||||
setTimeout(() => focusTerminalById(activeId), 0)
|
||||
},
|
||||
),
|
||||
)
|
||||
@@ -209,21 +209,17 @@ export function TerminalPanel() {
|
||||
</Tabs.List>
|
||||
</Tabs>
|
||||
<div class="flex-1 min-h-0 relative">
|
||||
<For each={all()}>
|
||||
{(pty) => (
|
||||
<div
|
||||
id={`terminal-wrapper-${pty.id}`}
|
||||
class="absolute inset-0"
|
||||
style={{
|
||||
display: terminal.active() === pty.id ? "block" : "none",
|
||||
}}
|
||||
>
|
||||
<Show when={pty.id} keyed>
|
||||
<Terminal pty={pty} onCleanup={terminal.update} onConnectError={() => terminal.clone(pty.id)} />
|
||||
</Show>
|
||||
</div>
|
||||
<Show when={terminal.active()} keyed>
|
||||
{(id) => (
|
||||
<Show when={byId().get(id)}>
|
||||
{(pty) => (
|
||||
<div id={`terminal-wrapper-${id}`} class="absolute inset-0">
|
||||
<Terminal pty={pty()} onCleanup={terminal.update} onConnectError={() => terminal.clone(id)} />
|
||||
</div>
|
||||
)}
|
||||
</Show>
|
||||
)}
|
||||
</For>
|
||||
</Show>
|
||||
</div>
|
||||
</div>
|
||||
<DragOverlay>
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/console-app",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
import { APIEvent } from "@solidjs/start"
|
||||
import { DownloadPlatform } from "./types"
|
||||
import type { APIEvent } from "@solidjs/start"
|
||||
import type { DownloadPlatform } from "../types"
|
||||
|
||||
const assetNames: Record<string, string> = {
|
||||
"darwin-aarch64-dmg": "opencode-desktop-darwin-aarch64.dmg",
|
||||
@@ -17,17 +17,20 @@ const downloadNames: Record<string, string> = {
|
||||
"windows-x64-nsis": "OpenCode Desktop Installer.exe",
|
||||
} satisfies { [K in DownloadPlatform]?: string }
|
||||
|
||||
export async function GET({ params: { platform } }: APIEvent) {
|
||||
export async function GET({ params: { platform, channel } }: APIEvent) {
|
||||
const assetName = assetNames[platform]
|
||||
if (!assetName) return new Response("Not Found", { status: 404 })
|
||||
|
||||
const resp = await fetch(`https://github.com/anomalyco/opencode/releases/latest/download/${assetName}`, {
|
||||
cf: {
|
||||
// in case gh releases has rate limits
|
||||
cacheTtl: 60 * 5,
|
||||
cacheEverything: true,
|
||||
},
|
||||
} as any)
|
||||
const resp = await fetch(
|
||||
`https://github.com/anomalyco/${channel === "stable" ? "opencode" : "opencode-beta"}/releases/latest/download/${assetName}`,
|
||||
{
|
||||
cf: {
|
||||
// in case gh releases has rate limits
|
||||
cacheTtl: 60 * 5,
|
||||
cacheEverything: true,
|
||||
},
|
||||
} as any,
|
||||
)
|
||||
|
||||
const downloadName = downloadNames[platform]
|
||||
|
||||
@@ -1,18 +1,18 @@
|
||||
import "./index.css"
|
||||
import { Title, Meta } from "@solidjs/meta"
|
||||
import { A, createAsync, query } from "@solidjs/router"
|
||||
import { Header } from "~/component/header"
|
||||
import { Footer } from "~/component/footer"
|
||||
import { IconCopy, IconCheck } from "~/component/icon"
|
||||
import { Meta, Title } from "@solidjs/meta"
|
||||
import { A } from "@solidjs/router"
|
||||
import { createSignal, type JSX, onMount, Show } from "solid-js"
|
||||
import { Faq } from "~/component/faq"
|
||||
import desktopAppIcon from "../../asset/lander/opencode-desktop-icon.png"
|
||||
import { Footer } from "~/component/footer"
|
||||
import { Header } from "~/component/header"
|
||||
import { IconCheck, IconCopy } from "~/component/icon"
|
||||
import { Legal } from "~/component/legal"
|
||||
import { LocaleLinks } from "~/component/locale-links"
|
||||
import { config } from "~/config"
|
||||
import { createSignal, onMount, Show, JSX } from "solid-js"
|
||||
import { DownloadPlatform } from "./types"
|
||||
import { useI18n } from "~/context/i18n"
|
||||
import { useLanguage } from "~/context/language"
|
||||
import { LocaleLinks } from "~/component/locale-links"
|
||||
import desktopAppIcon from "../../asset/lander/opencode-desktop-icon.png"
|
||||
import type { DownloadPlatform } from "./types"
|
||||
|
||||
type OS = "macOS" | "Windows" | "Linux" | null
|
||||
|
||||
@@ -40,8 +40,8 @@ function getDownloadPlatform(os: OS): DownloadPlatform {
|
||||
}
|
||||
}
|
||||
|
||||
function getDownloadHref(platform: DownloadPlatform) {
|
||||
return `/download/${platform}`
|
||||
function getDownloadHref(platform: DownloadPlatform, channel: "stable" | "beta" = "stable") {
|
||||
return `/download/${channel}/${platform}`
|
||||
}
|
||||
|
||||
function IconDownload(props: JSX.SvgSVGAttributes<SVGSVGElement>) {
|
||||
|
||||
@@ -107,11 +107,14 @@ export async function handler(
|
||||
const startTimestamp = Date.now()
|
||||
const reqUrl = providerInfo.modifyUrl(providerInfo.api, isStream)
|
||||
const reqBody = JSON.stringify(
|
||||
providerInfo.modifyBody({
|
||||
...createBodyConverter(opts.format, providerInfo.format)(body),
|
||||
model: providerInfo.model,
|
||||
...(providerInfo.payloadModifier ?? {}),
|
||||
}),
|
||||
providerInfo.modifyBody(
|
||||
{
|
||||
...createBodyConverter(opts.format, providerInfo.format)(body),
|
||||
model: providerInfo.model,
|
||||
...(providerInfo.payloadModifier ?? {}),
|
||||
},
|
||||
authInfo?.workspaceID,
|
||||
),
|
||||
)
|
||||
logger.debug("REQUEST URL: " + reqUrl)
|
||||
logger.debug("REQUEST: " + reqBody.substring(0, 300) + "...")
|
||||
|
||||
@@ -18,9 +18,10 @@ export const openaiHelper: ProviderHelper = () => ({
|
||||
modifyHeaders: (headers: Headers, body: Record<string, any>, apiKey: string) => {
|
||||
headers.set("authorization", `Bearer ${apiKey}`)
|
||||
},
|
||||
modifyBody: (body: Record<string, any>) => {
|
||||
return body
|
||||
},
|
||||
modifyBody: (body: Record<string, any>, workspaceID?: string) => ({
|
||||
...body,
|
||||
...(workspaceID ? { safety_identifier: workspaceID } : {}),
|
||||
}),
|
||||
createBinaryStreamDecoder: () => undefined,
|
||||
streamSeparator: "\n\n",
|
||||
createUsageParser: () => {
|
||||
|
||||
@@ -37,7 +37,7 @@ export type ProviderHelper = (input: { reqModel: string; providerModel: string }
|
||||
format: ZenData.Format
|
||||
modifyUrl: (providerApi: string, isStream?: boolean) => string
|
||||
modifyHeaders: (headers: Headers, body: Record<string, any>, apiKey: string) => void
|
||||
modifyBody: (body: Record<string, any>) => Record<string, any>
|
||||
modifyBody: (body: Record<string, any>, workspaceID?: string) => Record<string, any>
|
||||
createBinaryStreamDecoder: () => ((chunk: Uint8Array) => Uint8Array | undefined) | undefined
|
||||
streamSeparator: string
|
||||
createUsageParser: () => {
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
{
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"name": "@opencode-ai/console-core",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/console-function",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/console-mail",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"dependencies": {
|
||||
"@jsx-email/all": "2.2.3",
|
||||
"@jsx-email/cli": "1.4.3",
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
{
|
||||
"name": "@opencode-ai/desktop",
|
||||
"private": true,
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
|
||||
@@ -320,7 +320,7 @@ pub fn spawn_command(
|
||||
};
|
||||
|
||||
let mut cmd = Command::new(shell);
|
||||
cmd.args(["-l", "-c", &line]);
|
||||
cmd.args(["-il", "-c", &line]);
|
||||
|
||||
for (key, value) in envs {
|
||||
cmd.env(key, value);
|
||||
|
||||
@@ -40,7 +40,9 @@ use crate::windows::{LoadingWindow, MainWindow};
|
||||
#[derive(Clone, serde::Serialize, specta::Type, Debug)]
|
||||
struct ServerReadyData {
|
||||
url: String,
|
||||
username: Option<String>,
|
||||
password: Option<String>,
|
||||
is_sidecar: bool
|
||||
}
|
||||
|
||||
#[derive(Clone, Copy, serde::Serialize, specta::Type, Debug)]
|
||||
@@ -605,6 +607,7 @@ async fn initialize(app: AppHandle) {
|
||||
child,
|
||||
health_check,
|
||||
url,
|
||||
username,
|
||||
password,
|
||||
} => {
|
||||
let app = app.clone();
|
||||
@@ -631,7 +634,7 @@ async fn initialize(app: AppHandle) {
|
||||
|
||||
app.state::<ServerState>().set_child(Some(child));
|
||||
|
||||
Ok(ServerReadyData { url, password })
|
||||
Ok(ServerReadyData { url, username,password, is_sidecar: true })
|
||||
}
|
||||
.map(move |res| {
|
||||
let _ = server_ready_tx.send(res);
|
||||
@@ -641,7 +644,9 @@ async fn initialize(app: AppHandle) {
|
||||
ServerConnection::Existing { url } => {
|
||||
let _ = server_ready_tx.send(Ok(ServerReadyData {
|
||||
url: url.to_string(),
|
||||
username: None,
|
||||
password: None,
|
||||
is_sidecar: false,
|
||||
}));
|
||||
None
|
||||
}
|
||||
@@ -719,6 +724,7 @@ enum ServerConnection {
|
||||
},
|
||||
CLI {
|
||||
url: String,
|
||||
username: Option<String>,
|
||||
password: Option<String>,
|
||||
child: CommandChild,
|
||||
health_check: server::HealthCheck,
|
||||
@@ -730,11 +736,15 @@ async fn setup_server_connection(app: AppHandle) -> ServerConnection {
|
||||
|
||||
tracing::info!(?custom_url, "Attempting server connection");
|
||||
|
||||
if let Some(url) = custom_url
|
||||
&& server::check_health_or_ask_retry(&app, &url).await
|
||||
if let Some(url) = &custom_url
|
||||
&& server::check_health_or_ask_retry(&app, url).await
|
||||
{
|
||||
tracing::info!(%url, "Connected to custom server");
|
||||
return ServerConnection::Existing { url: url.clone() };
|
||||
// If the default server is already local, no need to also spawn a sidecar
|
||||
if server::is_localhost_url(url) {
|
||||
return ServerConnection::Existing { url: url.clone() };
|
||||
}
|
||||
// Remote default server: fall through and also spawn a local sidecar
|
||||
}
|
||||
|
||||
let local_port = get_sidecar_port();
|
||||
@@ -755,6 +765,7 @@ async fn setup_server_connection(app: AppHandle) -> ServerConnection {
|
||||
|
||||
ServerConnection::CLI {
|
||||
url: local_url,
|
||||
username: Some("opencode".to_string()),
|
||||
password: Some(password),
|
||||
child,
|
||||
health_check,
|
||||
|
||||
@@ -150,7 +150,7 @@ pub async fn check_health(url: &str, password: Option<&str>) -> bool {
|
||||
return false;
|
||||
};
|
||||
|
||||
let mut builder = reqwest::Client::builder().timeout(Duration::from_secs(3));
|
||||
let mut builder = reqwest::Client::builder().timeout(Duration::from_secs(7));
|
||||
|
||||
if url_is_localhost(&url) {
|
||||
// Some environments set proxy variables (HTTP_PROXY/HTTPS_PROXY/ALL_PROXY) without
|
||||
@@ -178,6 +178,10 @@ pub async fn check_health(url: &str, password: Option<&str>) -> bool {
|
||||
.unwrap_or(false)
|
||||
}
|
||||
|
||||
pub fn is_localhost_url(url: &str) -> bool {
|
||||
reqwest::Url::parse(url).is_ok_and(|u| url_is_localhost(&u))
|
||||
}
|
||||
|
||||
fn url_is_localhost(url: &reqwest::Url) -> bool {
|
||||
url.host_str().is_some_and(|host| {
|
||||
host.eq_ignore_ascii_case("localhost")
|
||||
|
||||
21
packages/desktop/src-tauri/tauri.beta.conf.json
Normal file
21
packages/desktop/src-tauri/tauri.beta.conf.json
Normal file
@@ -0,0 +1,21 @@
|
||||
{
|
||||
"$schema": "https://schema.tauri.app/config/2",
|
||||
"productName": "OpenCode Beta",
|
||||
"identifier": "ai.opencode.desktop.beta",
|
||||
"bundle": {
|
||||
"createUpdaterArtifacts": true,
|
||||
"linux": {
|
||||
"rpm": {
|
||||
"compression": {
|
||||
"type": "none"
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"plugins": {
|
||||
"updater": {
|
||||
"pubkey": "dW50cnVzdGVkIGNvbW1lbnQ6IG1pbmlzaWduIHB1YmxpYyBrZXk6IEYwMDM5Nzg5OUMzOUExMDQKUldRRW9UbWNpWmNEOENYT01CV0lhOXR1UFhpaXJsK1Z3aU9lZnNtNzE0TDROWVMwVW9XQnFOelkK",
|
||||
"endpoints": ["https://github.com/anomalyco/opencode-beta/releases/latest/download/latest.json"]
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -35,7 +35,9 @@ export type LoadingWindowComplete = null;
|
||||
|
||||
export type ServerReadyData = {
|
||||
url: string,
|
||||
username: string | null,
|
||||
password: string | null,
|
||||
is_sidecar: boolean,
|
||||
};
|
||||
|
||||
export type SqliteMigrationProgress = { type: "InProgress"; value: number } | { type: "Done" };
|
||||
|
||||
@@ -23,7 +23,7 @@ import { relaunch } from "@tauri-apps/plugin-process"
|
||||
import { open as shellOpen } from "@tauri-apps/plugin-shell"
|
||||
import { Store } from "@tauri-apps/plugin-store"
|
||||
import { check, type Update } from "@tauri-apps/plugin-updater"
|
||||
import { type Accessor, createResource, type JSX, onCleanup, onMount, Show } from "solid-js"
|
||||
import { createResource, type JSX, onCleanup, onMount, Show } from "solid-js"
|
||||
import { render } from "solid-js/web"
|
||||
import pkg from "../package.json"
|
||||
import { initI18n, t } from "./i18n"
|
||||
@@ -31,7 +31,7 @@ import { UPDATER_ENABLED } from "./updater"
|
||||
import { webviewZoom } from "./webview-zoom"
|
||||
import "./styles.css"
|
||||
import { Channel } from "@tauri-apps/api/core"
|
||||
import { commands, type InitStep } from "./bindings"
|
||||
import { commands, ServerReadyData, type InitStep } from "./bindings"
|
||||
import { createMenu } from "./menu"
|
||||
|
||||
const root = document.getElementById("root")
|
||||
@@ -452,16 +452,19 @@ render(() => {
|
||||
<AppBaseProviders>
|
||||
<ServerGate>
|
||||
{(data) => {
|
||||
const server: ServerConnection.Sidecar = {
|
||||
displayName: "Local Server",
|
||||
type: "sidecar",
|
||||
variant: "base",
|
||||
http: {
|
||||
url: data().url,
|
||||
username: "opencode",
|
||||
password: data().password ?? undefined,
|
||||
},
|
||||
const http = {
|
||||
url: data.url,
|
||||
username: data.username ?? undefined,
|
||||
password: data.password ?? undefined,
|
||||
}
|
||||
const server: ServerConnection.Any = data.is_sidecar
|
||||
? {
|
||||
displayName: "Local Server",
|
||||
type: "sidecar",
|
||||
variant: "base",
|
||||
http,
|
||||
}
|
||||
: { type: "http", http }
|
||||
|
||||
function Inner() {
|
||||
const cmd = useCommand()
|
||||
@@ -485,39 +488,22 @@ render(() => {
|
||||
)
|
||||
}, root!)
|
||||
|
||||
type ServerReadyData = { url: string; password: string | null }
|
||||
|
||||
// Gate component that waits for the server to be ready
|
||||
function ServerGate(props: { children: (data: Accessor<ServerReadyData>) => JSX.Element }) {
|
||||
function ServerGate(props: { children: (data: ServerReadyData) => JSX.Element }) {
|
||||
const [serverData] = createResource(() => commands.awaitInitialization(new Channel<InitStep>() as any))
|
||||
if (serverData.state === "errored") throw serverData.error
|
||||
|
||||
return (
|
||||
<Show
|
||||
when={serverData.state !== "errored"}
|
||||
when={serverData.state !== "pending" && serverData()}
|
||||
fallback={
|
||||
<div class="h-screen w-screen flex flex-col items-center justify-center bg-background-base gap-4">
|
||||
<Splash class="w-16 h-20 opacity-50" />
|
||||
<div class="max-w-md px-4 text-center">
|
||||
<p class="text-sm font-medium text-red-400">Failed to start server</p>
|
||||
<p class="mt-2 text-xs text-zinc-400 break-words whitespace-pre-wrap">
|
||||
{String(serverData.error ?? "Unknown error")}
|
||||
</p>
|
||||
</div>
|
||||
<div class="h-screen w-screen flex flex-col items-center justify-center bg-background-base">
|
||||
<Splash class="w-16 h-20 opacity-50 animate-pulse" />
|
||||
<div data-tauri-decorum-tb class="flex flex-row absolute top-0 right-0 z-10 h-10" />
|
||||
</div>
|
||||
}
|
||||
>
|
||||
<Show
|
||||
when={serverData.state !== "pending" && serverData()}
|
||||
fallback={
|
||||
<div class="h-screen w-screen flex flex-col items-center justify-center bg-background-base">
|
||||
<Splash class="w-16 h-20 opacity-50 animate-pulse" />
|
||||
<div data-tauri-decorum-tb class="flex flex-row absolute top-0 right-0 z-10 h-10" />
|
||||
</div>
|
||||
}
|
||||
>
|
||||
{(data) => props.children(data)}
|
||||
</Show>
|
||||
{(data) => props.children(data())}
|
||||
</Show>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/enterprise",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
id = "opencode"
|
||||
name = "OpenCode"
|
||||
description = "The open source coding agent."
|
||||
version = "1.2.8"
|
||||
version = "1.2.10"
|
||||
schema_version = 1
|
||||
authors = ["Anomaly"]
|
||||
repository = "https://github.com/anomalyco/opencode"
|
||||
@@ -11,26 +11,26 @@ name = "OpenCode"
|
||||
icon = "./icons/opencode.svg"
|
||||
|
||||
[agent_servers.opencode.targets.darwin-aarch64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.8/opencode-darwin-arm64.zip"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-darwin-arm64.zip"
|
||||
cmd = "./opencode"
|
||||
args = ["acp"]
|
||||
|
||||
[agent_servers.opencode.targets.darwin-x86_64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.8/opencode-darwin-x64.zip"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-darwin-x64.zip"
|
||||
cmd = "./opencode"
|
||||
args = ["acp"]
|
||||
|
||||
[agent_servers.opencode.targets.linux-aarch64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.8/opencode-linux-arm64.tar.gz"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-linux-arm64.tar.gz"
|
||||
cmd = "./opencode"
|
||||
args = ["acp"]
|
||||
|
||||
[agent_servers.opencode.targets.linux-x86_64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.8/opencode-linux-x64.tar.gz"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-linux-x64.tar.gz"
|
||||
cmd = "./opencode"
|
||||
args = ["acp"]
|
||||
|
||||
[agent_servers.opencode.targets.windows-x86_64]
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.8/opencode-windows-x64.zip"
|
||||
archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-windows-x64.zip"
|
||||
cmd = "./opencode.exe"
|
||||
args = ["acp"]
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/function",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
|
||||
@@ -25,6 +25,12 @@ if (envPath) {
|
||||
const scriptPath = fs.realpathSync(__filename)
|
||||
const scriptDir = path.dirname(scriptPath)
|
||||
|
||||
//
|
||||
const cached = path.join(scriptDir, ".opencode")
|
||||
if (fs.existsSync(cached)) {
|
||||
run(cached)
|
||||
}
|
||||
|
||||
const platformMap = {
|
||||
darwin: "darwin",
|
||||
linux: "linux",
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"name": "opencode",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
|
||||
@@ -1,10 +1,10 @@
|
||||
#!/usr/bin/env bun
|
||||
|
||||
import solidPlugin from "../node_modules/@opentui/solid/scripts/solid-plugin"
|
||||
import path from "path"
|
||||
import fs from "fs"
|
||||
import { $ } from "bun"
|
||||
import fs from "fs"
|
||||
import path from "path"
|
||||
import { fileURLToPath } from "url"
|
||||
import solidPlugin from "../node_modules/@opentui/solid/scripts/solid-plugin"
|
||||
|
||||
const __filename = fileURLToPath(import.meta.url)
|
||||
const __dirname = path.dirname(__filename)
|
||||
@@ -12,8 +12,9 @@ const dir = path.resolve(__dirname, "..")
|
||||
|
||||
process.chdir(dir)
|
||||
|
||||
import pkg from "../package.json"
|
||||
import { Script } from "@opencode-ai/script"
|
||||
import pkg from "../package.json"
|
||||
|
||||
const modelsUrl = process.env.OPENCODE_MODELS_URL || "https://models.dev"
|
||||
// Fetch and generate models.dev snapshot
|
||||
const modelsData = process.env.MODELS_DEV_API_JSON
|
||||
@@ -26,7 +27,11 @@ await Bun.write(
|
||||
console.log("Generated models-snapshot.ts")
|
||||
|
||||
// Load migrations from migration directories
|
||||
const migrationDirs = (await fs.promises.readdir(path.join(dir, "migration"), { withFileTypes: true }))
|
||||
const migrationDirs = (
|
||||
await fs.promises.readdir(path.join(dir, "migration"), {
|
||||
withFileTypes: true,
|
||||
})
|
||||
)
|
||||
.filter((entry) => entry.isDirectory() && /^\d{4}\d{2}\d{2}\d{2}\d{2}\d{2}/.test(entry.name))
|
||||
.map((entry) => entry.name)
|
||||
.sort()
|
||||
@@ -171,7 +176,6 @@ for (const item of targets) {
|
||||
compile: {
|
||||
autoloadBunfig: false,
|
||||
autoloadDotenv: false,
|
||||
//@ts-ignore (bun types aren't up to date)
|
||||
autoloadTsconfig: true,
|
||||
autoloadPackageJson: true,
|
||||
target: name.replace(pkg.name, "bun") as any,
|
||||
@@ -214,7 +218,7 @@ if (Script.release) {
|
||||
await $`zip -r ../../${key}.zip *`.cwd(`dist/${key}/bin`)
|
||||
}
|
||||
}
|
||||
await $`gh release upload v${Script.version} ./dist/*.zip ./dist/*.tar.gz --clobber`
|
||||
await $`gh release upload v${Script.version} ./dist/*.zip ./dist/*.tar.gz --clobber --repo ${process.env.GH_REPO}`
|
||||
}
|
||||
|
||||
export { binaries }
|
||||
|
||||
@@ -109,8 +109,14 @@ async function main() {
|
||||
// On non-Windows platforms, just verify the binary package exists
|
||||
// Don't replace the wrapper script - it handles binary execution
|
||||
const { binaryPath } = findBinary()
|
||||
console.log(`Platform binary verified at: ${binaryPath}`)
|
||||
console.log("Wrapper script will handle binary execution")
|
||||
const target = path.join(__dirname, "bin", ".opencode")
|
||||
if (fs.existsSync(target)) fs.unlinkSync(target)
|
||||
try {
|
||||
fs.linkSync(binaryPath, target)
|
||||
} catch {
|
||||
fs.copyFileSync(binaryPath, target)
|
||||
}
|
||||
fs.chmodSync(target, 0o755)
|
||||
} catch (error) {
|
||||
console.error("Failed to setup opencode binary:", error.message)
|
||||
process.exit(1)
|
||||
|
||||
@@ -450,6 +450,7 @@ export const GithubRunCommand = cmd({
|
||||
const isWorkflowDispatchEvent = context.eventName === "workflow_dispatch"
|
||||
|
||||
const { providerID, modelID } = normalizeModel()
|
||||
const variant = process.env["VARIANT"] || undefined
|
||||
const runId = normalizeRunId()
|
||||
const share = normalizeShare()
|
||||
const oidcBaseUrl = normalizeOidcBaseUrl()
|
||||
@@ -912,6 +913,7 @@ export const GithubRunCommand = cmd({
|
||||
const result = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
messageID: Identifier.ascending("message"),
|
||||
variant,
|
||||
model: {
|
||||
providerID,
|
||||
modelID,
|
||||
@@ -965,6 +967,7 @@ export const GithubRunCommand = cmd({
|
||||
const summary = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
messageID: Identifier.ascending("message"),
|
||||
variant,
|
||||
model: {
|
||||
providerID,
|
||||
modelID,
|
||||
|
||||
@@ -2,8 +2,7 @@ import path from "path"
|
||||
import { Global } from "@/global"
|
||||
import { Filesystem } from "@/util/filesystem"
|
||||
import { onMount } from "solid-js"
|
||||
import { createStore, produce } from "solid-js/store"
|
||||
import { clone } from "remeda"
|
||||
import { createStore, produce, unwrap } from "solid-js/store"
|
||||
import { createSimpleContext } from "../../context/helper"
|
||||
import { appendFile, writeFile } from "fs/promises"
|
||||
import type { AgentPart, FilePart, TextPart } from "@opencode-ai/sdk/v2"
|
||||
@@ -83,7 +82,7 @@ export const { use: usePromptHistory, provider: PromptHistoryProvider } = create
|
||||
return store.history.at(store.index)
|
||||
},
|
||||
append(item: PromptInfo) {
|
||||
const entry = clone(item)
|
||||
const entry = structuredClone(unwrap(item))
|
||||
let trimmed = false
|
||||
setStore(
|
||||
produce((draft) => {
|
||||
|
||||
@@ -2,8 +2,7 @@ import path from "path"
|
||||
import { Global } from "@/global"
|
||||
import { Filesystem } from "@/util/filesystem"
|
||||
import { onMount } from "solid-js"
|
||||
import { createStore, produce } from "solid-js/store"
|
||||
import { clone } from "remeda"
|
||||
import { createStore, produce, unwrap } from "solid-js/store"
|
||||
import { createSimpleContext } from "../../context/helper"
|
||||
import { appendFile, writeFile } from "fs/promises"
|
||||
import type { PromptInfo } from "./history"
|
||||
@@ -53,7 +52,7 @@ export const { use: usePromptStash, provider: PromptStashProvider } = createSimp
|
||||
return store.entries
|
||||
},
|
||||
push(entry: Omit<StashEntry, "timestamp">) {
|
||||
const stash = clone({ ...entry, timestamp: Date.now() })
|
||||
const stash = structuredClone(unwrap({ ...entry, timestamp: Date.now() }))
|
||||
let trimmed = false
|
||||
setStore(
|
||||
produce((draft) => {
|
||||
|
||||
@@ -292,7 +292,9 @@ export namespace Config {
|
||||
...(proxied() ? ["--no-cache"] : []),
|
||||
],
|
||||
{ cwd: dir },
|
||||
).catch(() => {})
|
||||
).catch((err) => {
|
||||
log.warn("failed to install dependencies", { dir, error: err })
|
||||
})
|
||||
}
|
||||
|
||||
async function isWritable(dir: string) {
|
||||
|
||||
@@ -41,8 +41,10 @@ export namespace Plugin {
|
||||
|
||||
for (const plugin of INTERNAL_PLUGINS) {
|
||||
log.info("loading internal plugin", { name: plugin.name })
|
||||
const init = await plugin(input)
|
||||
hooks.push(init)
|
||||
const init = await plugin(input).catch((err) => {
|
||||
log.error("failed to load internal plugin", { name: plugin.name, error: err })
|
||||
})
|
||||
if (init) hooks.push(init)
|
||||
}
|
||||
|
||||
let plugins = config.plugin ?? []
|
||||
@@ -59,37 +61,40 @@ export namespace Plugin {
|
||||
const lastAtIndex = plugin.lastIndexOf("@")
|
||||
const pkg = lastAtIndex > 0 ? plugin.substring(0, lastAtIndex) : plugin
|
||||
const version = lastAtIndex > 0 ? plugin.substring(lastAtIndex + 1) : "latest"
|
||||
const builtin = BUILTIN.some((x) => x.startsWith(pkg + "@"))
|
||||
plugin = await BunProc.install(pkg, version).catch((err) => {
|
||||
if (!builtin) throw err
|
||||
|
||||
const message = err instanceof Error ? err.message : String(err)
|
||||
log.error("failed to install builtin plugin", {
|
||||
pkg,
|
||||
version,
|
||||
error: message,
|
||||
})
|
||||
const cause = err instanceof Error ? err.cause : err
|
||||
const detail = cause instanceof Error ? cause.message : String(cause ?? err)
|
||||
log.error("failed to install plugin", { pkg, version, error: detail })
|
||||
Bus.publish(Session.Event.Error, {
|
||||
error: new NamedError.Unknown({
|
||||
message: `Failed to install built-in plugin ${pkg}@${version}: ${message}`,
|
||||
message: `Failed to install plugin ${pkg}@${version}: ${detail}`,
|
||||
}).toObject(),
|
||||
})
|
||||
|
||||
return ""
|
||||
})
|
||||
if (!plugin) continue
|
||||
}
|
||||
const mod = await import(plugin)
|
||||
// Prevent duplicate initialization when plugins export the same function
|
||||
// as both a named export and default export (e.g., `export const X` and `export default X`).
|
||||
// Object.entries(mod) would return both entries pointing to the same function reference.
|
||||
const seen = new Set<PluginInstance>()
|
||||
for (const [_name, fn] of Object.entries<PluginInstance>(mod)) {
|
||||
if (seen.has(fn)) continue
|
||||
seen.add(fn)
|
||||
const init = await fn(input)
|
||||
hooks.push(init)
|
||||
}
|
||||
await import(plugin)
|
||||
.then(async (mod) => {
|
||||
const seen = new Set<PluginInstance>()
|
||||
for (const [_name, fn] of Object.entries<PluginInstance>(mod)) {
|
||||
if (seen.has(fn)) continue
|
||||
seen.add(fn)
|
||||
hooks.push(await fn(input))
|
||||
}
|
||||
})
|
||||
.catch((err) => {
|
||||
const message = err instanceof Error ? err.message : String(err)
|
||||
log.error("failed to load plugin", { path: plugin, error: message })
|
||||
Bus.publish(Session.Event.Error, {
|
||||
error: new NamedError.Unknown({
|
||||
message: `Failed to load plugin ${plugin}: ${message}`,
|
||||
}).toObject(),
|
||||
})
|
||||
})
|
||||
}
|
||||
|
||||
return {
|
||||
|
||||
@@ -65,7 +65,13 @@ export namespace ModelsDev {
|
||||
status: z.enum(["alpha", "beta", "deprecated"]).optional(),
|
||||
options: z.record(z.string(), z.any()),
|
||||
headers: z.record(z.string(), z.string()).optional(),
|
||||
provider: z.object({ npm: z.string().optional(), api: z.string().optional() }).optional(),
|
||||
provider: z
|
||||
.object({
|
||||
npm: z.string().optional(),
|
||||
api: z.string().optional(),
|
||||
shape: z.enum(["responses", "completions"]).optional(),
|
||||
})
|
||||
.optional(),
|
||||
variants: z.record(z.string(), z.record(z.string(), z.any())).optional(),
|
||||
})
|
||||
export type Model = z.infer<typeof Model>
|
||||
|
||||
@@ -109,7 +109,7 @@ export namespace Provider {
|
||||
"@ai-sdk/github-copilot": createGitHubCopilotOpenAICompatible,
|
||||
}
|
||||
|
||||
type CustomModelLoader = (sdk: any, modelID: string, options?: Record<string, any>) => Promise<any>
|
||||
type CustomModelLoader = (sdk: any, model: Model, options?: Record<string, any>) => Promise<any>
|
||||
type CustomLoader = (provider: Info) => Promise<{
|
||||
autoload: boolean
|
||||
getModel?: CustomModelLoader
|
||||
@@ -153,8 +153,9 @@ export namespace Provider {
|
||||
openai: async () => {
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
|
||||
return sdk.responses(modelID)
|
||||
async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
|
||||
if (model.api.shape === "completions") return sdk.chat(model.api.id)
|
||||
return sdk.responses(model.api.id)
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -162,9 +163,12 @@ export namespace Provider {
|
||||
"github-copilot": async () => {
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
|
||||
if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(modelID)
|
||||
return shouldUseCopilotResponsesApi(modelID) ? sdk.responses(modelID) : sdk.chat(modelID)
|
||||
async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
|
||||
const shape = model.api.shape
|
||||
if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(model.api.id)
|
||||
if (shape === "responses") return sdk.responses(model.api.id)
|
||||
if (shape === "completions") return sdk.chat(model.api.id)
|
||||
return shouldUseCopilotResponsesApi(model.api.id) ? sdk.responses(model.api.id) : sdk.chat(model.api.id)
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -172,9 +176,12 @@ export namespace Provider {
|
||||
"github-copilot-enterprise": async () => {
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
|
||||
if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(modelID)
|
||||
return shouldUseCopilotResponsesApi(modelID) ? sdk.responses(modelID) : sdk.chat(modelID)
|
||||
async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
|
||||
const shape = model.api.shape
|
||||
if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(model.api.id)
|
||||
if (shape === "responses") return sdk.responses(model.api.id)
|
||||
if (shape === "completions") return sdk.chat(model.api.id)
|
||||
return shouldUseCopilotResponsesApi(model.api.id) ? sdk.responses(model.api.id) : sdk.chat(model.api.id)
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -182,12 +189,12 @@ export namespace Provider {
|
||||
azure: async () => {
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
|
||||
if (options?.["useCompletionUrls"]) {
|
||||
return sdk.chat(modelID)
|
||||
} else {
|
||||
return sdk.responses(modelID)
|
||||
}
|
||||
async getModel(sdk: any, model: Model, options?: Record<string, any>) {
|
||||
if (sdk.responses === undefined || sdk.chat === undefined) return sdk.languageModel(model.api.id)
|
||||
if (model.api.shape === "completions") return sdk.chat(model.api.id)
|
||||
if (model.api.shape === "responses") return sdk.responses(model.api.id)
|
||||
if (options?.["useCompletionUrls"]) return sdk.chat(model.api.id)
|
||||
return sdk.responses(model.api.id)
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -196,12 +203,12 @@ export namespace Provider {
|
||||
const resourceName = Env.get("AZURE_COGNITIVE_SERVICES_RESOURCE_NAME")
|
||||
return {
|
||||
autoload: false,
|
||||
async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
|
||||
if (options?.["useCompletionUrls"]) {
|
||||
return sdk.chat(modelID)
|
||||
} else {
|
||||
return sdk.responses(modelID)
|
||||
}
|
||||
async getModel(sdk: any, model: Model, options?: Record<string, any>) {
|
||||
if (sdk.responses === undefined || sdk.chat === undefined) return sdk.languageModel(model.api.id)
|
||||
if (model.api.shape === "completions") return sdk.chat(model.api.id)
|
||||
if (model.api.shape === "responses") return sdk.responses(model.api.id)
|
||||
if (options?.["useCompletionUrls"]) return sdk.chat(model.api.id)
|
||||
return sdk.responses(model.api.id)
|
||||
},
|
||||
options: {
|
||||
baseURL: resourceName ? `https://${resourceName}.cognitiveservices.azure.com/openai` : undefined,
|
||||
@@ -269,7 +276,8 @@ export namespace Provider {
|
||||
return {
|
||||
autoload: true,
|
||||
options: providerOptions,
|
||||
async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
|
||||
async getModel(sdk: any, model: Model, options?: Record<string, any>) {
|
||||
let modelID = model.api.id
|
||||
// Skip region prefixing if model already has a cross-region inference profile prefix
|
||||
// Models from models.dev may already include prefixes like us., eu., global., etc.
|
||||
const crossRegionPrefixes = ["global.", "us.", "eu.", "jp.", "apac.", "au."]
|
||||
@@ -406,8 +414,8 @@ export namespace Provider {
|
||||
return fetch(input, { ...init, headers })
|
||||
},
|
||||
},
|
||||
async getModel(sdk: any, modelID: string) {
|
||||
const id = String(modelID).trim()
|
||||
async getModel(sdk: any, model: Model) {
|
||||
const id = String(model.api.id).trim()
|
||||
return sdk.languageModel(id)
|
||||
},
|
||||
}
|
||||
@@ -423,8 +431,8 @@ export namespace Provider {
|
||||
project,
|
||||
location,
|
||||
},
|
||||
async getModel(sdk: any, modelID) {
|
||||
const id = String(modelID).trim()
|
||||
async getModel(sdk: any, model: Model) {
|
||||
const id = String(model.api.id).trim()
|
||||
return sdk.languageModel(id)
|
||||
},
|
||||
}
|
||||
@@ -448,8 +456,8 @@ export namespace Provider {
|
||||
return {
|
||||
autoload: !!envServiceKey,
|
||||
options: envServiceKey ? { deploymentId, resourceGroup } : {},
|
||||
async getModel(sdk: any, modelID: string) {
|
||||
return sdk(modelID)
|
||||
async getModel(sdk: any, model: Model) {
|
||||
return sdk(model.api.id)
|
||||
},
|
||||
}
|
||||
},
|
||||
@@ -494,8 +502,8 @@ export namespace Provider {
|
||||
...(providerConfig?.options?.featureFlags || {}),
|
||||
},
|
||||
},
|
||||
async getModel(sdk: ReturnType<typeof createGitLab>, modelID: string) {
|
||||
return sdk.agenticChat(modelID, {
|
||||
async getModel(sdk: ReturnType<typeof createGitLab>, model: Model) {
|
||||
return sdk.agenticChat(model.api.id, {
|
||||
aiGatewayHeaders,
|
||||
featureFlags: {
|
||||
duo_agent_platform_agentic_chat: true,
|
||||
@@ -524,8 +532,8 @@ export namespace Provider {
|
||||
apiKey,
|
||||
baseURL: `https://api.cloudflare.com/client/v4/accounts/${accountId}/ai/v1`,
|
||||
},
|
||||
async getModel(sdk: any, modelID: string) {
|
||||
return sdk.languageModel(modelID)
|
||||
async getModel(sdk: any, model: Model) {
|
||||
return sdk.languageModel(model.api.id)
|
||||
},
|
||||
}
|
||||
},
|
||||
@@ -560,9 +568,9 @@ export namespace Provider {
|
||||
|
||||
return {
|
||||
autoload: true,
|
||||
async getModel(_sdk: any, modelID: string, _options?: Record<string, any>) {
|
||||
async getModel(_sdk: any, model: Model, _options?: Record<string, any>) {
|
||||
// Model IDs use Unified API format: provider/model (e.g., "anthropic/claude-sonnet-4-5")
|
||||
return aigateway(unified(modelID))
|
||||
return aigateway(unified(model.api.id))
|
||||
},
|
||||
options: {},
|
||||
}
|
||||
@@ -598,6 +606,7 @@ export namespace Provider {
|
||||
id: z.string(),
|
||||
url: z.string(),
|
||||
npm: z.string(),
|
||||
shape: z.enum(["responses", "completions"]).optional(),
|
||||
}),
|
||||
name: z.string(),
|
||||
family: z.string().optional(),
|
||||
@@ -686,6 +695,7 @@ export namespace Provider {
|
||||
id: model.id,
|
||||
url: model.provider?.api ?? provider.api!,
|
||||
npm: model.provider?.npm ?? provider.npm ?? "@ai-sdk/openai-compatible",
|
||||
shape: model.provider?.shape,
|
||||
},
|
||||
status: model.status ?? "active",
|
||||
headers: model.headers ?? {},
|
||||
@@ -836,6 +846,7 @@ export namespace Provider {
|
||||
existingModel?.api.npm ??
|
||||
modelsDev[providerID]?.npm ??
|
||||
"@ai-sdk/openai-compatible",
|
||||
shape: model.provider?.shape ?? existingModel?.api.shape,
|
||||
url: model.provider?.api ?? provider?.api ?? existingModel?.api.url ?? modelsDev[providerID]?.api,
|
||||
},
|
||||
status: model.status ?? existingModel?.status ?? "active",
|
||||
@@ -1177,7 +1188,7 @@ export namespace Provider {
|
||||
|
||||
try {
|
||||
const language = s.modelLoaders[model.providerID]
|
||||
? await s.modelLoaders[model.providerID](sdk, model.api.id, provider.options)
|
||||
? await s.modelLoaders[model.providerID](sdk, model, provider.options)
|
||||
: sdk.languageModel(model.api.id)
|
||||
s.models.set(key, language)
|
||||
return language
|
||||
|
||||
@@ -41,13 +41,38 @@ export namespace Pty {
|
||||
|
||||
const token = (ws: Socket) => {
|
||||
const data = ws.data
|
||||
if (!data || typeof data !== "object") return
|
||||
if (data === undefined) return
|
||||
if (data === null) return
|
||||
if (typeof data !== "object") return data
|
||||
|
||||
const events = (data as { events?: unknown }).events
|
||||
if (events && typeof events === "object") return events
|
||||
const id = (data as { connId?: unknown }).connId
|
||||
if (typeof id === "number" || typeof id === "string") return id
|
||||
|
||||
const href = (data as { href?: unknown }).href
|
||||
if (typeof href === "string") return href
|
||||
|
||||
const url = (data as { url?: unknown }).url
|
||||
if (url && typeof url === "object") return url
|
||||
if (typeof url === "string") return url
|
||||
if (url && typeof url === "object") {
|
||||
const href = (url as { href?: unknown }).href
|
||||
if (typeof href === "string") return href
|
||||
return url
|
||||
}
|
||||
|
||||
const events = (data as { events?: unknown }).events
|
||||
if (typeof events === "number" || typeof events === "string") return events
|
||||
if (events && typeof events === "object") {
|
||||
const id = (events as { connId?: unknown }).connId
|
||||
if (typeof id === "number" || typeof id === "string") return id
|
||||
|
||||
const id2 = (events as { connection?: unknown }).connection
|
||||
if (typeof id2 === "number" || typeof id2 === "string") return id2
|
||||
|
||||
const id3 = (events as { id?: unknown }).id
|
||||
if (typeof id3 === "number" || typeof id3 === "string") return id3
|
||||
|
||||
return events
|
||||
}
|
||||
|
||||
return data
|
||||
}
|
||||
@@ -210,7 +235,7 @@ export namespace Pty {
|
||||
continue
|
||||
}
|
||||
|
||||
if (sub.token !== undefined && token(ws) !== sub.token) {
|
||||
if (token(ws) !== sub.token) {
|
||||
session.subscribers.delete(ws)
|
||||
continue
|
||||
}
|
||||
|
||||
@@ -6,6 +6,7 @@ import { Worktree } from "../../worktree"
|
||||
import { Instance } from "../../project/instance"
|
||||
import { Project } from "../../project/project"
|
||||
import { MCP } from "../../mcp"
|
||||
import { Session } from "../../session"
|
||||
import { zodToJsonSchema } from "zod-to-json-schema"
|
||||
import { errors } from "../error"
|
||||
import { lazy } from "../../util/lazy"
|
||||
@@ -184,6 +185,65 @@ export const ExperimentalRoutes = lazy(() =>
|
||||
return c.json(true)
|
||||
},
|
||||
)
|
||||
.get(
|
||||
"/session",
|
||||
describeRoute({
|
||||
summary: "List sessions",
|
||||
description:
|
||||
"Get a list of all OpenCode sessions across projects, sorted by most recently updated. Archived sessions are excluded by default.",
|
||||
operationId: "experimental.session.list",
|
||||
responses: {
|
||||
200: {
|
||||
description: "List of sessions",
|
||||
content: {
|
||||
"application/json": {
|
||||
schema: resolver(Session.GlobalInfo.array()),
|
||||
},
|
||||
},
|
||||
},
|
||||
},
|
||||
}),
|
||||
validator(
|
||||
"query",
|
||||
z.object({
|
||||
directory: z.string().optional().meta({ description: "Filter sessions by project directory" }),
|
||||
roots: z.coerce.boolean().optional().meta({ description: "Only return root sessions (no parentID)" }),
|
||||
start: z.coerce
|
||||
.number()
|
||||
.optional()
|
||||
.meta({ description: "Filter sessions updated on or after this timestamp (milliseconds since epoch)" }),
|
||||
cursor: z.coerce
|
||||
.number()
|
||||
.optional()
|
||||
.meta({ description: "Return sessions updated before this timestamp (milliseconds since epoch)" }),
|
||||
search: z.string().optional().meta({ description: "Filter sessions by title (case-insensitive)" }),
|
||||
limit: z.coerce.number().optional().meta({ description: "Maximum number of sessions to return" }),
|
||||
archived: z.coerce.boolean().optional().meta({ description: "Include archived sessions (default false)" }),
|
||||
}),
|
||||
),
|
||||
async (c) => {
|
||||
const query = c.req.valid("query")
|
||||
const limit = query.limit ?? 100
|
||||
const sessions: Session.GlobalInfo[] = []
|
||||
for await (const session of Session.listGlobal({
|
||||
directory: query.directory,
|
||||
roots: query.roots,
|
||||
start: query.start,
|
||||
cursor: query.cursor,
|
||||
search: query.search,
|
||||
limit: limit + 1,
|
||||
archived: query.archived,
|
||||
})) {
|
||||
sessions.push(session)
|
||||
}
|
||||
const hasMore = sessions.length > limit
|
||||
const list = hasMore ? sessions.slice(0, limit) : sessions
|
||||
if (hasMore && list.length > 0) {
|
||||
c.header("x-next-cursor", String(list[list.length - 1].time.updated))
|
||||
}
|
||||
return c.json(list)
|
||||
},
|
||||
)
|
||||
.get(
|
||||
"/resource",
|
||||
describeRoute({
|
||||
|
||||
@@ -10,8 +10,10 @@ import { Flag } from "../flag/flag"
|
||||
import { Identifier } from "../id/id"
|
||||
import { Installation } from "../installation"
|
||||
|
||||
import { Database, NotFoundError, eq, and, or, gte, isNull, desc, like } from "../storage/db"
|
||||
import { Database, NotFoundError, eq, and, or, gte, isNull, desc, like, inArray, lt } from "../storage/db"
|
||||
import type { SQL } from "../storage/db"
|
||||
import { SessionTable, MessageTable, PartTable } from "./session.sql"
|
||||
import { ProjectTable } from "../project/project.sql"
|
||||
import { Storage } from "@/storage/storage"
|
||||
import { Log } from "../util/log"
|
||||
import { MessageV2 } from "./message-v2"
|
||||
@@ -154,6 +156,24 @@ export namespace Session {
|
||||
})
|
||||
export type Info = z.output<typeof Info>
|
||||
|
||||
export const ProjectInfo = z
|
||||
.object({
|
||||
id: z.string(),
|
||||
name: z.string().optional(),
|
||||
worktree: z.string(),
|
||||
})
|
||||
.meta({
|
||||
ref: "ProjectSummary",
|
||||
})
|
||||
export type ProjectInfo = z.output<typeof ProjectInfo>
|
||||
|
||||
export const GlobalInfo = Info.extend({
|
||||
project: ProjectInfo.nullable(),
|
||||
}).meta({
|
||||
ref: "GlobalSession",
|
||||
})
|
||||
export type GlobalInfo = z.output<typeof GlobalInfo>
|
||||
|
||||
export const Event = {
|
||||
Created: BusEvent.define(
|
||||
"session.created",
|
||||
@@ -544,6 +564,75 @@ export namespace Session {
|
||||
}
|
||||
}
|
||||
|
||||
export function* listGlobal(input?: {
|
||||
directory?: string
|
||||
roots?: boolean
|
||||
start?: number
|
||||
cursor?: number
|
||||
search?: string
|
||||
limit?: number
|
||||
archived?: boolean
|
||||
}) {
|
||||
const conditions: SQL[] = []
|
||||
|
||||
if (input?.directory) {
|
||||
conditions.push(eq(SessionTable.directory, input.directory))
|
||||
}
|
||||
if (input?.roots) {
|
||||
conditions.push(isNull(SessionTable.parent_id))
|
||||
}
|
||||
if (input?.start) {
|
||||
conditions.push(gte(SessionTable.time_updated, input.start))
|
||||
}
|
||||
if (input?.cursor) {
|
||||
conditions.push(lt(SessionTable.time_updated, input.cursor))
|
||||
}
|
||||
if (input?.search) {
|
||||
conditions.push(like(SessionTable.title, `%${input.search}%`))
|
||||
}
|
||||
if (!input?.archived) {
|
||||
conditions.push(isNull(SessionTable.time_archived))
|
||||
}
|
||||
|
||||
const limit = input?.limit ?? 100
|
||||
|
||||
const rows = Database.use((db) => {
|
||||
const query =
|
||||
conditions.length > 0
|
||||
? db
|
||||
.select()
|
||||
.from(SessionTable)
|
||||
.where(and(...conditions))
|
||||
: db.select().from(SessionTable)
|
||||
return query.orderBy(desc(SessionTable.time_updated), desc(SessionTable.id)).limit(limit).all()
|
||||
})
|
||||
|
||||
const ids = [...new Set(rows.map((row) => row.project_id))]
|
||||
const projects = new Map<string, ProjectInfo>()
|
||||
|
||||
if (ids.length > 0) {
|
||||
const items = Database.use((db) =>
|
||||
db
|
||||
.select({ id: ProjectTable.id, name: ProjectTable.name, worktree: ProjectTable.worktree })
|
||||
.from(ProjectTable)
|
||||
.where(inArray(ProjectTable.id, ids))
|
||||
.all(),
|
||||
)
|
||||
for (const item of items) {
|
||||
projects.set(item.id, {
|
||||
id: item.id,
|
||||
name: item.name ?? undefined,
|
||||
worktree: item.worktree,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
for (const row of rows) {
|
||||
const project = projects.get(row.project_id) ?? null
|
||||
yield { ...fromRow(row), project }
|
||||
}
|
||||
}
|
||||
|
||||
export const children = fn(Identifier.schema("session"), async (parentID) => {
|
||||
const project = Instance.project
|
||||
const rows = Database.use((db) =>
|
||||
|
||||
@@ -11,7 +11,7 @@ import {
|
||||
tool,
|
||||
jsonSchema,
|
||||
} from "ai"
|
||||
import { clone, mergeDeep, pipe } from "remeda"
|
||||
import { mergeDeep, pipe } from "remeda"
|
||||
import { ProviderTransform } from "@/provider/transform"
|
||||
import { Config } from "@/config/config"
|
||||
import { Instance } from "@/project/instance"
|
||||
@@ -80,15 +80,11 @@ export namespace LLM {
|
||||
)
|
||||
|
||||
const header = system[0]
|
||||
const original = clone(system)
|
||||
await Plugin.trigger(
|
||||
"experimental.chat.system.transform",
|
||||
{ sessionID: input.sessionID, model: input.model },
|
||||
{ system },
|
||||
)
|
||||
if (system.length === 0) {
|
||||
system.push(...original)
|
||||
}
|
||||
// rejoin to maintain 2-part structure for caching if header unchanged
|
||||
if (system.length > 2 && system[0] === header) {
|
||||
const rest = system.slice(1)
|
||||
|
||||
@@ -22,7 +22,6 @@ import PROMPT_PLAN from "../session/prompt/plan.txt"
|
||||
import BUILD_SWITCH from "../session/prompt/build-switch.txt"
|
||||
import MAX_STEPS from "../session/prompt/max-steps.txt"
|
||||
import { defer } from "../util/defer"
|
||||
import { clone } from "remeda"
|
||||
import { ToolRegistry } from "../tool/registry"
|
||||
import { MCP } from "../mcp"
|
||||
import { LSP } from "../lsp"
|
||||
@@ -627,11 +626,9 @@ export namespace SessionPrompt {
|
||||
})
|
||||
}
|
||||
|
||||
const sessionMessages = clone(msgs)
|
||||
|
||||
// Ephemerally wrap queued user messages with a reminder to stay on track
|
||||
if (step > 1 && lastFinished) {
|
||||
for (const msg of sessionMessages) {
|
||||
for (const msg of msgs) {
|
||||
if (msg.info.role !== "user" || msg.info.id <= lastFinished.id) continue
|
||||
for (const part of msg.parts) {
|
||||
if (part.type !== "text" || part.ignored || part.synthetic) continue
|
||||
@@ -648,7 +645,7 @@ export namespace SessionPrompt {
|
||||
}
|
||||
}
|
||||
|
||||
await Plugin.trigger("experimental.chat.messages.transform", {}, { messages: sessionMessages })
|
||||
await Plugin.trigger("experimental.chat.messages.transform", {}, { messages: msgs })
|
||||
|
||||
// Build system prompt, adding structured output instruction if needed
|
||||
const system = [...(await SystemPrompt.environment(model)), ...(await InstructionPrompt.system())]
|
||||
@@ -664,7 +661,7 @@ export namespace SessionPrompt {
|
||||
sessionID,
|
||||
system,
|
||||
messages: [
|
||||
...MessageV2.toModelMessages(sessionMessages, model),
|
||||
...MessageV2.toModelMessages(msgs, model),
|
||||
...(isLastStep
|
||||
? [
|
||||
{
|
||||
@@ -909,7 +906,12 @@ export namespace SessionPrompt {
|
||||
title: "",
|
||||
metadata,
|
||||
output: truncated.content,
|
||||
attachments,
|
||||
attachments: attachments.map((attachment) => ({
|
||||
...attachment,
|
||||
id: Identifier.ascending("part"),
|
||||
sessionID: ctx.sessionID,
|
||||
messageID: input.processor.message.id,
|
||||
})),
|
||||
content: result.content, // directly return content to preserve ordering when outputting to model
|
||||
}
|
||||
}
|
||||
|
||||
@@ -66,7 +66,7 @@ export namespace Snapshot {
|
||||
await $`git --git-dir ${git} config core.autocrlf false`.quiet().nothrow()
|
||||
log.info("initialized")
|
||||
}
|
||||
await $`git --git-dir ${git} --work-tree ${Instance.worktree} add .`.quiet().cwd(Instance.directory).nothrow()
|
||||
await add(git)
|
||||
const hash = await $`git --git-dir ${git} --work-tree ${Instance.worktree} write-tree`
|
||||
.quiet()
|
||||
.cwd(Instance.directory)
|
||||
@@ -84,7 +84,7 @@ export namespace Snapshot {
|
||||
|
||||
export async function patch(hash: string): Promise<Patch> {
|
||||
const git = gitdir()
|
||||
await $`git --git-dir ${git} --work-tree ${Instance.worktree} add .`.quiet().cwd(Instance.directory).nothrow()
|
||||
await add(git)
|
||||
const result =
|
||||
await $`git -c core.autocrlf=false -c core.quotepath=false --git-dir ${git} --work-tree ${Instance.worktree} diff --no-ext-diff --name-only ${hash} -- .`
|
||||
.quiet()
|
||||
@@ -162,7 +162,7 @@ export namespace Snapshot {
|
||||
|
||||
export async function diff(hash: string) {
|
||||
const git = gitdir()
|
||||
await $`git --git-dir ${git} --work-tree ${Instance.worktree} add .`.quiet().cwd(Instance.directory).nothrow()
|
||||
await add(git)
|
||||
const result =
|
||||
await $`git -c core.autocrlf=false -c core.quotepath=false --git-dir ${git} --work-tree ${Instance.worktree} diff --no-ext-diff ${hash} -- .`
|
||||
.quiet()
|
||||
@@ -253,4 +253,38 @@ export namespace Snapshot {
|
||||
const project = Instance.project
|
||||
return path.join(Global.Path.data, "snapshot", project.id)
|
||||
}
|
||||
|
||||
async function add(git: string) {
|
||||
await syncExclude(git)
|
||||
await $`git --git-dir ${git} --work-tree ${Instance.worktree} add .`.quiet().cwd(Instance.directory).nothrow()
|
||||
}
|
||||
|
||||
async function syncExclude(git: string) {
|
||||
const file = await excludes()
|
||||
const target = path.join(git, "info", "exclude")
|
||||
await fs.mkdir(path.join(git, "info"), { recursive: true })
|
||||
if (!file) {
|
||||
await Bun.write(target, "")
|
||||
return
|
||||
}
|
||||
const text = await Bun.file(file)
|
||||
.text()
|
||||
.catch(() => "")
|
||||
await Bun.write(target, text)
|
||||
}
|
||||
|
||||
async function excludes() {
|
||||
const file = await $`git rev-parse --path-format=absolute --git-path info/exclude`
|
||||
.quiet()
|
||||
.cwd(Instance.worktree)
|
||||
.nothrow()
|
||||
.text()
|
||||
if (!file.trim()) return
|
||||
const exists = await fs
|
||||
.stat(file.trim())
|
||||
.then(() => true)
|
||||
.catch(() => false)
|
||||
if (!exists) return
|
||||
return file.trim()
|
||||
}
|
||||
}
|
||||
|
||||
@@ -97,4 +97,48 @@ describe("pty", () => {
|
||||
},
|
||||
})
|
||||
})
|
||||
|
||||
test("does not leak output when socket data mutates in-place", async () => {
|
||||
await using dir = await tmpdir({ git: true })
|
||||
|
||||
await Instance.provide({
|
||||
directory: dir.path,
|
||||
fn: async () => {
|
||||
const a = await Pty.create({ command: "cat", title: "a" })
|
||||
try {
|
||||
const outA: string[] = []
|
||||
const outB: string[] = []
|
||||
|
||||
const ctx = { connId: 1 }
|
||||
const ws = {
|
||||
readyState: 1,
|
||||
data: ctx,
|
||||
send: (data: unknown) => {
|
||||
outA.push(typeof data === "string" ? data : Buffer.from(data as Uint8Array).toString("utf8"))
|
||||
},
|
||||
close: () => {
|
||||
// no-op
|
||||
},
|
||||
}
|
||||
|
||||
Pty.connect(a.id, ws as any)
|
||||
outA.length = 0
|
||||
|
||||
// Simulate the runtime mutating per-connection data without
|
||||
// swapping the reference (ws.data stays the same object).
|
||||
ctx.connId = 2
|
||||
ws.send = (data: unknown) => {
|
||||
outB.push(typeof data === "string" ? data : Buffer.from(data as Uint8Array).toString("utf8"))
|
||||
}
|
||||
|
||||
Pty.write(a.id, "AAA\n")
|
||||
await Bun.sleep(100)
|
||||
|
||||
expect(outB.join("")).not.toContain("AAA")
|
||||
} finally {
|
||||
await Pty.remove(a.id)
|
||||
}
|
||||
},
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
89
packages/opencode/test/server/global-session-list.test.ts
Normal file
89
packages/opencode/test/server/global-session-list.test.ts
Normal file
@@ -0,0 +1,89 @@
|
||||
import { describe, expect, test } from "bun:test"
|
||||
import { Instance } from "../../src/project/instance"
|
||||
import { Project } from "../../src/project/project"
|
||||
import { Session } from "../../src/session"
|
||||
import { Log } from "../../src/util/log"
|
||||
import { tmpdir } from "../fixture/fixture"
|
||||
|
||||
Log.init({ print: false })
|
||||
|
||||
describe("Session.listGlobal", () => {
|
||||
test("lists sessions across projects with project metadata", async () => {
|
||||
await using first = await tmpdir({ git: true })
|
||||
await using second = await tmpdir({ git: true })
|
||||
|
||||
const firstSession = await Instance.provide({
|
||||
directory: first.path,
|
||||
fn: async () => Session.create({ title: "first-session" }),
|
||||
})
|
||||
const secondSession = await Instance.provide({
|
||||
directory: second.path,
|
||||
fn: async () => Session.create({ title: "second-session" }),
|
||||
})
|
||||
|
||||
const sessions = [...Session.listGlobal({ limit: 200 })]
|
||||
const ids = sessions.map((session) => session.id)
|
||||
|
||||
expect(ids).toContain(firstSession.id)
|
||||
expect(ids).toContain(secondSession.id)
|
||||
|
||||
const firstProject = Project.get(firstSession.projectID)
|
||||
const secondProject = Project.get(secondSession.projectID)
|
||||
|
||||
const firstItem = sessions.find((session) => session.id === firstSession.id)
|
||||
const secondItem = sessions.find((session) => session.id === secondSession.id)
|
||||
|
||||
expect(firstItem?.project?.id).toBe(firstProject?.id)
|
||||
expect(firstItem?.project?.worktree).toBe(firstProject?.worktree)
|
||||
expect(secondItem?.project?.id).toBe(secondProject?.id)
|
||||
expect(secondItem?.project?.worktree).toBe(secondProject?.worktree)
|
||||
})
|
||||
|
||||
test("excludes archived sessions by default", async () => {
|
||||
await using tmp = await tmpdir({ git: true })
|
||||
|
||||
const archived = await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => Session.create({ title: "archived-session" }),
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => Session.setArchived({ sessionID: archived.id, time: Date.now() }),
|
||||
})
|
||||
|
||||
const sessions = [...Session.listGlobal({ limit: 200 })]
|
||||
const ids = sessions.map((session) => session.id)
|
||||
|
||||
expect(ids).not.toContain(archived.id)
|
||||
|
||||
const allSessions = [...Session.listGlobal({ limit: 200, archived: true })]
|
||||
const allIds = allSessions.map((session) => session.id)
|
||||
|
||||
expect(allIds).toContain(archived.id)
|
||||
})
|
||||
|
||||
test("supports cursor pagination", async () => {
|
||||
await using tmp = await tmpdir({ git: true })
|
||||
|
||||
const first = await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => Session.create({ title: "page-one" }),
|
||||
})
|
||||
await new Promise((resolve) => setTimeout(resolve, 5))
|
||||
const second = await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => Session.create({ title: "page-two" }),
|
||||
})
|
||||
|
||||
const page = [...Session.listGlobal({ directory: tmp.path, limit: 1 })]
|
||||
expect(page.length).toBe(1)
|
||||
expect(page[0].id).toBe(second.id)
|
||||
|
||||
const next = [...Session.listGlobal({ directory: tmp.path, limit: 10, cursor: page[0].time.updated })]
|
||||
const ids = next.map((session) => session.id)
|
||||
|
||||
expect(ids).toContain(first.id)
|
||||
expect(ids).not.toContain(second.id)
|
||||
})
|
||||
})
|
||||
@@ -307,7 +307,6 @@ describe("session.llm.stream", () => {
|
||||
expect(url.pathname.startsWith("/v1/")).toBe(true)
|
||||
expect(url.pathname.endsWith("/chat/completions")).toBe(true)
|
||||
expect(headers.get("Authorization")).toBe("Bearer test-key")
|
||||
expect(headers.get("User-Agent") ?? "").toMatch(/^opencode\//)
|
||||
|
||||
expect(body.model).toBe(resolved.api.id)
|
||||
expect(body.temperature).toBe(0.4)
|
||||
|
||||
@@ -1,104 +0,0 @@
|
||||
import path from "path"
|
||||
import { describe, expect, test } from "bun:test"
|
||||
import { Instance } from "../../src/project/instance"
|
||||
import { Session } from "../../src/session"
|
||||
import { MessageV2 } from "../../src/session/message-v2"
|
||||
import { SessionPrompt } from "../../src/session/prompt"
|
||||
import { tmpdir } from "../fixture/fixture"
|
||||
|
||||
describe("session.prompt missing file", () => {
|
||||
test("does not fail the prompt when a file part is missing", async () => {
|
||||
await using tmp = await tmpdir({
|
||||
git: true,
|
||||
config: {
|
||||
agent: {
|
||||
build: {
|
||||
model: "openai/gpt-5.2",
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const session = await Session.create({})
|
||||
|
||||
const missing = path.join(tmp.path, "does-not-exist.ts")
|
||||
const msg = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
noReply: true,
|
||||
parts: [
|
||||
{ type: "text", text: "please review @does-not-exist.ts" },
|
||||
{
|
||||
type: "file",
|
||||
mime: "text/plain",
|
||||
url: `file://${missing}`,
|
||||
filename: "does-not-exist.ts",
|
||||
},
|
||||
],
|
||||
})
|
||||
|
||||
if (msg.info.role !== "user") throw new Error("expected user message")
|
||||
|
||||
const hasFailure = msg.parts.some(
|
||||
(part) => part.type === "text" && part.synthetic && part.text.includes("Read tool failed to read"),
|
||||
)
|
||||
expect(hasFailure).toBe(true)
|
||||
|
||||
await Session.remove(session.id)
|
||||
},
|
||||
})
|
||||
})
|
||||
|
||||
test("keeps stored part order stable when file resolution is async", async () => {
|
||||
await using tmp = await tmpdir({
|
||||
git: true,
|
||||
config: {
|
||||
agent: {
|
||||
build: {
|
||||
model: "openai/gpt-5.2",
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const session = await Session.create({})
|
||||
|
||||
const missing = path.join(tmp.path, "still-missing.ts")
|
||||
const msg = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
noReply: true,
|
||||
parts: [
|
||||
{
|
||||
type: "file",
|
||||
mime: "text/plain",
|
||||
url: `file://${missing}`,
|
||||
filename: "still-missing.ts",
|
||||
},
|
||||
{ type: "text", text: "after-file" },
|
||||
],
|
||||
})
|
||||
|
||||
if (msg.info.role !== "user") throw new Error("expected user message")
|
||||
|
||||
const stored = await MessageV2.get({
|
||||
sessionID: session.id,
|
||||
messageID: msg.info.id,
|
||||
})
|
||||
const text = stored.parts.filter((part) => part.type === "text").map((part) => part.text)
|
||||
|
||||
expect(text[0]?.startsWith("Called the Read tool with the following input:")).toBe(true)
|
||||
expect(text[1]?.includes("Read tool failed to read")).toBe(true)
|
||||
expect(text[2]).toBe("after-file")
|
||||
|
||||
await Session.remove(session.id)
|
||||
},
|
||||
})
|
||||
})
|
||||
})
|
||||
@@ -1,56 +0,0 @@
|
||||
import path from "path"
|
||||
import { describe, expect, test } from "bun:test"
|
||||
import { fileURLToPath } from "url"
|
||||
import { Instance } from "../../src/project/instance"
|
||||
import { Log } from "../../src/util/log"
|
||||
import { Session } from "../../src/session"
|
||||
import { SessionPrompt } from "../../src/session/prompt"
|
||||
import { MessageV2 } from "../../src/session/message-v2"
|
||||
import { tmpdir } from "../fixture/fixture"
|
||||
|
||||
Log.init({ print: false })
|
||||
|
||||
describe("session.prompt special characters", () => {
|
||||
test("handles filenames with # character", async () => {
|
||||
await using tmp = await tmpdir({
|
||||
git: true,
|
||||
init: async (dir) => {
|
||||
await Bun.write(path.join(dir, "file#name.txt"), "special content\n")
|
||||
},
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const session = await Session.create({})
|
||||
const template = "Read @file#name.txt"
|
||||
const parts = await SessionPrompt.resolvePromptParts(template)
|
||||
const fileParts = parts.filter((part) => part.type === "file")
|
||||
|
||||
expect(fileParts.length).toBe(1)
|
||||
expect(fileParts[0].filename).toBe("file#name.txt")
|
||||
|
||||
// Verify the URL is properly encoded (# should be %23)
|
||||
expect(fileParts[0].url).toContain("%23")
|
||||
|
||||
// Verify the URL can be correctly converted back to a file path
|
||||
const decodedPath = fileURLToPath(fileParts[0].url)
|
||||
expect(decodedPath).toBe(path.join(tmp.path, "file#name.txt"))
|
||||
|
||||
const message = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
parts,
|
||||
noReply: true,
|
||||
})
|
||||
const stored = await MessageV2.get({ sessionID: session.id, messageID: message.info.id })
|
||||
|
||||
// Verify the file content was read correctly
|
||||
const textParts = stored.parts.filter((part) => part.type === "text")
|
||||
const hasContent = textParts.some((part) => part.text.includes("special content"))
|
||||
expect(hasContent).toBe(true)
|
||||
|
||||
await Session.remove(session.id)
|
||||
},
|
||||
})
|
||||
})
|
||||
})
|
||||
@@ -1,68 +0,0 @@
|
||||
import { describe, expect, test } from "bun:test"
|
||||
import { Instance } from "../../src/project/instance"
|
||||
import { Session } from "../../src/session"
|
||||
import { SessionPrompt } from "../../src/session/prompt"
|
||||
import { tmpdir } from "../fixture/fixture"
|
||||
|
||||
describe("session.prompt agent variant", () => {
|
||||
test("applies agent variant only when using agent model", async () => {
|
||||
const prev = process.env.OPENAI_API_KEY
|
||||
process.env.OPENAI_API_KEY = "test-openai-key"
|
||||
|
||||
try {
|
||||
await using tmp = await tmpdir({
|
||||
git: true,
|
||||
config: {
|
||||
agent: {
|
||||
build: {
|
||||
model: "openai/gpt-5.2",
|
||||
variant: "xhigh",
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const session = await Session.create({})
|
||||
|
||||
const other = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
model: { providerID: "opencode", modelID: "kimi-k2.5-free" },
|
||||
noReply: true,
|
||||
parts: [{ type: "text", text: "hello" }],
|
||||
})
|
||||
if (other.info.role !== "user") throw new Error("expected user message")
|
||||
expect(other.info.variant).toBeUndefined()
|
||||
|
||||
const match = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
noReply: true,
|
||||
parts: [{ type: "text", text: "hello again" }],
|
||||
})
|
||||
if (match.info.role !== "user") throw new Error("expected user message")
|
||||
expect(match.info.model).toEqual({ providerID: "openai", modelID: "gpt-5.2" })
|
||||
expect(match.info.variant).toBe("xhigh")
|
||||
|
||||
const override = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
noReply: true,
|
||||
variant: "high",
|
||||
parts: [{ type: "text", text: "hello third" }],
|
||||
})
|
||||
if (override.info.role !== "user") throw new Error("expected user message")
|
||||
expect(override.info.variant).toBe("high")
|
||||
|
||||
await Session.remove(session.id)
|
||||
},
|
||||
})
|
||||
} finally {
|
||||
if (prev === undefined) delete process.env.OPENAI_API_KEY
|
||||
else process.env.OPENAI_API_KEY = prev
|
||||
}
|
||||
})
|
||||
})
|
||||
211
packages/opencode/test/session/prompt.test.ts
Normal file
211
packages/opencode/test/session/prompt.test.ts
Normal file
@@ -0,0 +1,211 @@
|
||||
import path from "path"
|
||||
import { describe, expect, test } from "bun:test"
|
||||
import { fileURLToPath } from "url"
|
||||
import { Instance } from "../../src/project/instance"
|
||||
import { Session } from "../../src/session"
|
||||
import { MessageV2 } from "../../src/session/message-v2"
|
||||
import { SessionPrompt } from "../../src/session/prompt"
|
||||
import { Log } from "../../src/util/log"
|
||||
import { tmpdir } from "../fixture/fixture"
|
||||
|
||||
Log.init({ print: false })
|
||||
|
||||
describe("session.prompt missing file", () => {
|
||||
test("does not fail the prompt when a file part is missing", async () => {
|
||||
await using tmp = await tmpdir({
|
||||
git: true,
|
||||
config: {
|
||||
agent: {
|
||||
build: {
|
||||
model: "openai/gpt-5.2",
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const session = await Session.create({})
|
||||
|
||||
const missing = path.join(tmp.path, "does-not-exist.ts")
|
||||
const msg = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
noReply: true,
|
||||
parts: [
|
||||
{ type: "text", text: "please review @does-not-exist.ts" },
|
||||
{
|
||||
type: "file",
|
||||
mime: "text/plain",
|
||||
url: `file://${missing}`,
|
||||
filename: "does-not-exist.ts",
|
||||
},
|
||||
],
|
||||
})
|
||||
|
||||
if (msg.info.role !== "user") throw new Error("expected user message")
|
||||
|
||||
const hasFailure = msg.parts.some(
|
||||
(part) => part.type === "text" && part.synthetic && part.text.includes("Read tool failed to read"),
|
||||
)
|
||||
expect(hasFailure).toBe(true)
|
||||
|
||||
await Session.remove(session.id)
|
||||
},
|
||||
})
|
||||
})
|
||||
|
||||
test("keeps stored part order stable when file resolution is async", async () => {
|
||||
await using tmp = await tmpdir({
|
||||
git: true,
|
||||
config: {
|
||||
agent: {
|
||||
build: {
|
||||
model: "openai/gpt-5.2",
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const session = await Session.create({})
|
||||
|
||||
const missing = path.join(tmp.path, "still-missing.ts")
|
||||
const msg = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
noReply: true,
|
||||
parts: [
|
||||
{
|
||||
type: "file",
|
||||
mime: "text/plain",
|
||||
url: `file://${missing}`,
|
||||
filename: "still-missing.ts",
|
||||
},
|
||||
{ type: "text", text: "after-file" },
|
||||
],
|
||||
})
|
||||
|
||||
if (msg.info.role !== "user") throw new Error("expected user message")
|
||||
|
||||
const stored = await MessageV2.get({
|
||||
sessionID: session.id,
|
||||
messageID: msg.info.id,
|
||||
})
|
||||
const text = stored.parts.filter((part) => part.type === "text").map((part) => part.text)
|
||||
|
||||
expect(text[0]?.startsWith("Called the Read tool with the following input:")).toBe(true)
|
||||
expect(text[1]?.includes("Read tool failed to read")).toBe(true)
|
||||
expect(text[2]).toBe("after-file")
|
||||
|
||||
await Session.remove(session.id)
|
||||
},
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
describe("session.prompt special characters", () => {
|
||||
test("handles filenames with # character", async () => {
|
||||
await using tmp = await tmpdir({
|
||||
git: true,
|
||||
init: async (dir) => {
|
||||
await Bun.write(path.join(dir, "file#name.txt"), "special content\n")
|
||||
},
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const session = await Session.create({})
|
||||
const template = "Read @file#name.txt"
|
||||
const parts = await SessionPrompt.resolvePromptParts(template)
|
||||
const fileParts = parts.filter((part) => part.type === "file")
|
||||
|
||||
expect(fileParts.length).toBe(1)
|
||||
expect(fileParts[0].filename).toBe("file#name.txt")
|
||||
expect(fileParts[0].url).toContain("%23")
|
||||
|
||||
const decodedPath = fileURLToPath(fileParts[0].url)
|
||||
expect(decodedPath).toBe(path.join(tmp.path, "file#name.txt"))
|
||||
|
||||
const message = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
parts,
|
||||
noReply: true,
|
||||
})
|
||||
const stored = await MessageV2.get({ sessionID: session.id, messageID: message.info.id })
|
||||
const textParts = stored.parts.filter((part) => part.type === "text")
|
||||
const hasContent = textParts.some((part) => part.text.includes("special content"))
|
||||
expect(hasContent).toBe(true)
|
||||
|
||||
await Session.remove(session.id)
|
||||
},
|
||||
})
|
||||
})
|
||||
})
|
||||
|
||||
describe("session.prompt agent variant", () => {
|
||||
test("applies agent variant only when using agent model", async () => {
|
||||
const prev = process.env.OPENAI_API_KEY
|
||||
process.env.OPENAI_API_KEY = "test-openai-key"
|
||||
|
||||
try {
|
||||
await using tmp = await tmpdir({
|
||||
git: true,
|
||||
config: {
|
||||
agent: {
|
||||
build: {
|
||||
model: "openai/gpt-5.2",
|
||||
variant: "xhigh",
|
||||
},
|
||||
},
|
||||
},
|
||||
})
|
||||
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const session = await Session.create({})
|
||||
|
||||
const other = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
model: { providerID: "opencode", modelID: "kimi-k2.5-free" },
|
||||
noReply: true,
|
||||
parts: [{ type: "text", text: "hello" }],
|
||||
})
|
||||
if (other.info.role !== "user") throw new Error("expected user message")
|
||||
expect(other.info.variant).toBeUndefined()
|
||||
|
||||
const match = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
noReply: true,
|
||||
parts: [{ type: "text", text: "hello again" }],
|
||||
})
|
||||
if (match.info.role !== "user") throw new Error("expected user message")
|
||||
expect(match.info.model).toEqual({ providerID: "openai", modelID: "gpt-5.2" })
|
||||
expect(match.info.variant).toBe("xhigh")
|
||||
|
||||
const override = await SessionPrompt.prompt({
|
||||
sessionID: session.id,
|
||||
agent: "build",
|
||||
noReply: true,
|
||||
variant: "high",
|
||||
parts: [{ type: "text", text: "hello third" }],
|
||||
})
|
||||
if (override.info.role !== "user") throw new Error("expected user message")
|
||||
expect(override.info.variant).toBe("high")
|
||||
|
||||
await Session.remove(session.id)
|
||||
},
|
||||
})
|
||||
} finally {
|
||||
if (prev === undefined) delete process.env.OPENAI_API_KEY
|
||||
else process.env.OPENAI_API_KEY = prev
|
||||
}
|
||||
})
|
||||
})
|
||||
@@ -508,6 +508,68 @@ test("gitignore changes", async () => {
|
||||
})
|
||||
})
|
||||
|
||||
test("git info exclude changes", async () => {
|
||||
await using tmp = await bootstrap()
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const before = await Snapshot.track()
|
||||
expect(before).toBeTruthy()
|
||||
|
||||
const file = `${tmp.path}/.git/info/exclude`
|
||||
const text = await Bun.file(file).text()
|
||||
await Bun.write(file, `${text.trimEnd()}\nignored.txt\n`)
|
||||
await Bun.write(`${tmp.path}/ignored.txt`, "ignored content")
|
||||
await Bun.write(`${tmp.path}/normal.txt`, "normal content")
|
||||
|
||||
const patch = await Snapshot.patch(before!)
|
||||
expect(patch.files).toContain(`${tmp.path}/normal.txt`)
|
||||
expect(patch.files).not.toContain(`${tmp.path}/ignored.txt`)
|
||||
|
||||
const after = await Snapshot.track()
|
||||
const diffs = await Snapshot.diffFull(before!, after!)
|
||||
expect(diffs.some((x) => x.file === "normal.txt")).toBe(true)
|
||||
expect(diffs.some((x) => x.file === "ignored.txt")).toBe(false)
|
||||
},
|
||||
})
|
||||
})
|
||||
|
||||
test("git info exclude keeps global excludes", async () => {
|
||||
await using tmp = await bootstrap()
|
||||
await Instance.provide({
|
||||
directory: tmp.path,
|
||||
fn: async () => {
|
||||
const global = `${tmp.path}/global.ignore`
|
||||
const config = `${tmp.path}/global.gitconfig`
|
||||
await Bun.write(global, "global.tmp\n")
|
||||
await Bun.write(config, `[core]\n\texcludesFile = ${global}\n`)
|
||||
|
||||
const prev = process.env.GIT_CONFIG_GLOBAL
|
||||
process.env.GIT_CONFIG_GLOBAL = config
|
||||
try {
|
||||
const before = await Snapshot.track()
|
||||
expect(before).toBeTruthy()
|
||||
|
||||
const file = `${tmp.path}/.git/info/exclude`
|
||||
const text = await Bun.file(file).text()
|
||||
await Bun.write(file, `${text.trimEnd()}\ninfo.tmp\n`)
|
||||
|
||||
await Bun.write(`${tmp.path}/global.tmp`, "global content")
|
||||
await Bun.write(`${tmp.path}/info.tmp`, "info content")
|
||||
await Bun.write(`${tmp.path}/normal.txt`, "normal content")
|
||||
|
||||
const patch = await Snapshot.patch(before!)
|
||||
expect(patch.files).toContain(`${tmp.path}/normal.txt`)
|
||||
expect(patch.files).not.toContain(`${tmp.path}/global.tmp`)
|
||||
expect(patch.files).not.toContain(`${tmp.path}/info.tmp`)
|
||||
} finally {
|
||||
if (prev) process.env.GIT_CONFIG_GLOBAL = prev
|
||||
else delete process.env.GIT_CONFIG_GLOBAL
|
||||
}
|
||||
},
|
||||
})
|
||||
})
|
||||
|
||||
test("concurrent file operations during patch", async () => {
|
||||
await using tmp = await bootstrap()
|
||||
await Instance.provide({
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
{
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"name": "@opencode-ai/plugin",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
{
|
||||
"$schema": "https://json.schemastore.org/package.json",
|
||||
"name": "@opencode-ai/sdk",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
@@ -13,15 +13,15 @@
|
||||
"./client": "./src/client.ts",
|
||||
"./server": "./src/server.ts",
|
||||
"./v2": {
|
||||
"types": "./dist/src/v2/index.d.ts",
|
||||
"types": "./dist/v2/index.d.ts",
|
||||
"default": "./src/v2/index.ts"
|
||||
},
|
||||
"./v2/client": {
|
||||
"types": "./dist/src/v2/client.d.ts",
|
||||
"types": "./dist/v2/client.d.ts",
|
||||
"default": "./src/v2/client.ts"
|
||||
},
|
||||
"./v2/gen/client": {
|
||||
"types": "./dist/src/v2/gen/client/index.d.ts",
|
||||
"types": "./dist/v2/gen/client/index.d.ts",
|
||||
"default": "./src/v2/gen/client/index.ts"
|
||||
},
|
||||
"./v2/server": "./src/v2/server.ts"
|
||||
|
||||
@@ -25,6 +25,7 @@ import type {
|
||||
EventTuiSessionSelect,
|
||||
EventTuiToastShow,
|
||||
ExperimentalResourceListResponses,
|
||||
ExperimentalSessionListResponses,
|
||||
FileListResponses,
|
||||
FilePartInput,
|
||||
FilePartSource,
|
||||
@@ -898,6 +899,48 @@ export class Worktree extends HeyApiClient {
|
||||
}
|
||||
}
|
||||
|
||||
export class Session extends HeyApiClient {
|
||||
/**
|
||||
* List sessions
|
||||
*
|
||||
* Get a list of all OpenCode sessions across projects, sorted by most recently updated. Archived sessions are excluded by default.
|
||||
*/
|
||||
public list<ThrowOnError extends boolean = false>(
|
||||
parameters?: {
|
||||
directory?: string
|
||||
roots?: boolean
|
||||
start?: number
|
||||
cursor?: number
|
||||
search?: string
|
||||
limit?: number
|
||||
archived?: boolean
|
||||
},
|
||||
options?: Options<never, ThrowOnError>,
|
||||
) {
|
||||
const params = buildClientParams(
|
||||
[parameters],
|
||||
[
|
||||
{
|
||||
args: [
|
||||
{ in: "query", key: "directory" },
|
||||
{ in: "query", key: "roots" },
|
||||
{ in: "query", key: "start" },
|
||||
{ in: "query", key: "cursor" },
|
||||
{ in: "query", key: "search" },
|
||||
{ in: "query", key: "limit" },
|
||||
{ in: "query", key: "archived" },
|
||||
],
|
||||
},
|
||||
],
|
||||
)
|
||||
return (options?.client ?? this.client).get<ExperimentalSessionListResponses, unknown, ThrowOnError>({
|
||||
url: "/experimental/session",
|
||||
...options,
|
||||
...params,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
export class Resource extends HeyApiClient {
|
||||
/**
|
||||
* Get MCP resources
|
||||
@@ -920,13 +963,18 @@ export class Resource extends HeyApiClient {
|
||||
}
|
||||
|
||||
export class Experimental extends HeyApiClient {
|
||||
private _session?: Session
|
||||
get session(): Session {
|
||||
return (this._session ??= new Session({ client: this.client }))
|
||||
}
|
||||
|
||||
private _resource?: Resource
|
||||
get resource(): Resource {
|
||||
return (this._resource ??= new Resource({ client: this.client }))
|
||||
}
|
||||
}
|
||||
|
||||
export class Session extends HeyApiClient {
|
||||
export class Session2 extends HeyApiClient {
|
||||
/**
|
||||
* List sessions
|
||||
*
|
||||
@@ -3231,9 +3279,9 @@ export class OpencodeClient extends HeyApiClient {
|
||||
return (this._experimental ??= new Experimental({ client: this.client }))
|
||||
}
|
||||
|
||||
private _session?: Session
|
||||
get session(): Session {
|
||||
return (this._session ??= new Session({ client: this.client }))
|
||||
private _session?: Session2
|
||||
get session(): Session2 {
|
||||
return (this._session ??= new Session2({ client: this.client }))
|
||||
}
|
||||
|
||||
private _part?: Part
|
||||
|
||||
@@ -2044,6 +2044,45 @@ export type WorktreeResetInput = {
|
||||
directory: string
|
||||
}
|
||||
|
||||
export type ProjectSummary = {
|
||||
id: string
|
||||
name?: string
|
||||
worktree: string
|
||||
}
|
||||
|
||||
export type GlobalSession = {
|
||||
id: string
|
||||
slug: string
|
||||
projectID: string
|
||||
directory: string
|
||||
parentID?: string
|
||||
summary?: {
|
||||
additions: number
|
||||
deletions: number
|
||||
files: number
|
||||
diffs?: Array<FileDiff>
|
||||
}
|
||||
share?: {
|
||||
url: string
|
||||
}
|
||||
title: string
|
||||
version: string
|
||||
time: {
|
||||
created: number
|
||||
updated: number
|
||||
compacting?: number
|
||||
archived?: number
|
||||
}
|
||||
permission?: PermissionRuleset
|
||||
revert?: {
|
||||
messageID: string
|
||||
partID?: string
|
||||
snapshot?: string
|
||||
diff?: string
|
||||
}
|
||||
project: ProjectSummary | null
|
||||
}
|
||||
|
||||
export type McpResource = {
|
||||
name: string
|
||||
uri: string
|
||||
@@ -2870,6 +2909,51 @@ export type WorktreeResetResponses = {
|
||||
|
||||
export type WorktreeResetResponse = WorktreeResetResponses[keyof WorktreeResetResponses]
|
||||
|
||||
export type ExperimentalSessionListData = {
|
||||
body?: never
|
||||
path?: never
|
||||
query?: {
|
||||
/**
|
||||
* Filter sessions by project directory
|
||||
*/
|
||||
directory?: string
|
||||
/**
|
||||
* Only return root sessions (no parentID)
|
||||
*/
|
||||
roots?: boolean
|
||||
/**
|
||||
* Filter sessions updated on or after this timestamp (milliseconds since epoch)
|
||||
*/
|
||||
start?: number
|
||||
/**
|
||||
* Return sessions updated before this timestamp (milliseconds since epoch)
|
||||
*/
|
||||
cursor?: number
|
||||
/**
|
||||
* Filter sessions by title (case-insensitive)
|
||||
*/
|
||||
search?: string
|
||||
/**
|
||||
* Maximum number of sessions to return
|
||||
*/
|
||||
limit?: number
|
||||
/**
|
||||
* Include archived sessions (default false)
|
||||
*/
|
||||
archived?: boolean
|
||||
}
|
||||
url: "/experimental/session"
|
||||
}
|
||||
|
||||
export type ExperimentalSessionListResponses = {
|
||||
/**
|
||||
* List of sessions
|
||||
*/
|
||||
200: Array<GlobalSession>
|
||||
}
|
||||
|
||||
export type ExperimentalSessionListResponse = ExperimentalSessionListResponses[keyof ExperimentalSessionListResponses]
|
||||
|
||||
export type ExperimentalResourceListData = {
|
||||
body?: never
|
||||
path?: never
|
||||
|
||||
@@ -7,7 +7,8 @@
|
||||
"declaration": true,
|
||||
"moduleResolution": "nodenext",
|
||||
"lib": ["es2022", "dom", "dom.iterable"],
|
||||
"composite": true
|
||||
"composite": true,
|
||||
"rootDir": "src"
|
||||
},
|
||||
"include": ["src"]
|
||||
}
|
||||
|
||||
@@ -1202,6 +1202,92 @@
|
||||
]
|
||||
}
|
||||
},
|
||||
"/experimental/session": {
|
||||
"get": {
|
||||
"operationId": "experimental.session.list",
|
||||
"parameters": [
|
||||
{
|
||||
"in": "query",
|
||||
"name": "directory",
|
||||
"schema": {
|
||||
"type": "string"
|
||||
},
|
||||
"description": "Filter sessions by project directory"
|
||||
},
|
||||
{
|
||||
"in": "query",
|
||||
"name": "roots",
|
||||
"schema": {
|
||||
"type": "boolean"
|
||||
},
|
||||
"description": "Only return root sessions (no parentID)"
|
||||
},
|
||||
{
|
||||
"in": "query",
|
||||
"name": "start",
|
||||
"schema": {
|
||||
"type": "number"
|
||||
},
|
||||
"description": "Filter sessions updated on or after this timestamp (milliseconds since epoch)"
|
||||
},
|
||||
{
|
||||
"in": "query",
|
||||
"name": "cursor",
|
||||
"schema": {
|
||||
"type": "number"
|
||||
},
|
||||
"description": "Return sessions updated before this timestamp (milliseconds since epoch)"
|
||||
},
|
||||
{
|
||||
"in": "query",
|
||||
"name": "search",
|
||||
"schema": {
|
||||
"type": "string"
|
||||
},
|
||||
"description": "Filter sessions by title (case-insensitive)"
|
||||
},
|
||||
{
|
||||
"in": "query",
|
||||
"name": "limit",
|
||||
"schema": {
|
||||
"type": "number"
|
||||
},
|
||||
"description": "Maximum number of sessions to return"
|
||||
},
|
||||
{
|
||||
"in": "query",
|
||||
"name": "archived",
|
||||
"schema": {
|
||||
"type": "boolean"
|
||||
},
|
||||
"description": "Include archived sessions (default false)"
|
||||
}
|
||||
],
|
||||
"summary": "List sessions",
|
||||
"description": "Get a list of all OpenCode sessions across projects, sorted by most recently updated. Archived sessions are excluded by default.",
|
||||
"responses": {
|
||||
"200": {
|
||||
"description": "List of sessions",
|
||||
"content": {
|
||||
"application/json": {
|
||||
"schema": {
|
||||
"type": "array",
|
||||
"items": {
|
||||
"$ref": "#/components/schemas/GlobalSession"
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
"x-codeSamples": [
|
||||
{
|
||||
"lang": "js",
|
||||
"source": "import { createOpencodeClient } from \"@opencode-ai/sdk\n\nconst client = createOpencodeClient()\nawait client.experimental.session.list({\n ...\n})"
|
||||
}
|
||||
]
|
||||
}
|
||||
},
|
||||
"/experimental/resource": {
|
||||
"get": {
|
||||
"operationId": "experimental.resource.list",
|
||||
@@ -10499,6 +10585,129 @@
|
||||
},
|
||||
"required": ["directory"]
|
||||
},
|
||||
"ProjectSummary": {
|
||||
"type": "object",
|
||||
"properties": {
|
||||
"id": {
|
||||
"type": "string"
|
||||
},
|
||||
"name": {
|
||||
"type": "string"
|
||||
},
|
||||
"worktree": {
|
||||
"type": "string"
|
||||
}
|
||||
},
|
||||
"required": ["id", "worktree"]
|
||||
},
|
||||
"GlobalSession": {
|
||||
"type": "object",
|
||||
"properties": {
|
||||
"id": {
|
||||
"type": "string",
|
||||
"pattern": "^ses.*"
|
||||
},
|
||||
"slug": {
|
||||
"type": "string"
|
||||
},
|
||||
"projectID": {
|
||||
"type": "string"
|
||||
},
|
||||
"directory": {
|
||||
"type": "string"
|
||||
},
|
||||
"parentID": {
|
||||
"type": "string",
|
||||
"pattern": "^ses.*"
|
||||
},
|
||||
"summary": {
|
||||
"type": "object",
|
||||
"properties": {
|
||||
"additions": {
|
||||
"type": "number"
|
||||
},
|
||||
"deletions": {
|
||||
"type": "number"
|
||||
},
|
||||
"files": {
|
||||
"type": "number"
|
||||
},
|
||||
"diffs": {
|
||||
"type": "array",
|
||||
"items": {
|
||||
"$ref": "#/components/schemas/FileDiff"
|
||||
}
|
||||
}
|
||||
},
|
||||
"required": ["additions", "deletions", "files"]
|
||||
},
|
||||
"share": {
|
||||
"type": "object",
|
||||
"properties": {
|
||||
"url": {
|
||||
"type": "string"
|
||||
}
|
||||
},
|
||||
"required": ["url"]
|
||||
},
|
||||
"title": {
|
||||
"type": "string"
|
||||
},
|
||||
"version": {
|
||||
"type": "string"
|
||||
},
|
||||
"time": {
|
||||
"type": "object",
|
||||
"properties": {
|
||||
"created": {
|
||||
"type": "number"
|
||||
},
|
||||
"updated": {
|
||||
"type": "number"
|
||||
},
|
||||
"compacting": {
|
||||
"type": "number"
|
||||
},
|
||||
"archived": {
|
||||
"type": "number"
|
||||
}
|
||||
},
|
||||
"required": ["created", "updated"]
|
||||
},
|
||||
"permission": {
|
||||
"$ref": "#/components/schemas/PermissionRuleset"
|
||||
},
|
||||
"revert": {
|
||||
"type": "object",
|
||||
"properties": {
|
||||
"messageID": {
|
||||
"type": "string"
|
||||
},
|
||||
"partID": {
|
||||
"type": "string"
|
||||
},
|
||||
"snapshot": {
|
||||
"type": "string"
|
||||
},
|
||||
"diff": {
|
||||
"type": "string"
|
||||
}
|
||||
},
|
||||
"required": ["messageID"]
|
||||
},
|
||||
"project": {
|
||||
"anyOf": [
|
||||
{
|
||||
"$ref": "#/components/schemas/ProjectSummary"
|
||||
},
|
||||
{
|
||||
"type": "null"
|
||||
}
|
||||
]
|
||||
}
|
||||
},
|
||||
"required": ["id", "slug", "projectID", "directory", "title", "version", "time", "project"]
|
||||
},
|
||||
"McpResource": {
|
||||
"type": "object",
|
||||
"properties": {
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/slack",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"scripts": {
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/ui",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"exports": {
|
||||
|
||||
@@ -26,13 +26,16 @@
|
||||
[data-slot="collapsible-arrow"] {
|
||||
opacity: 0;
|
||||
transition: opacity 0.15s ease;
|
||||
will-change: opacity;
|
||||
transform: translateZ(0);
|
||||
}
|
||||
|
||||
[data-slot="collapsible-arrow-icon"] {
|
||||
display: inline-flex;
|
||||
color: var(--icon-weaker);
|
||||
transform: rotate(-90deg);
|
||||
transform: translateZ(0) rotate(-90deg);
|
||||
transition: transform 0.15s ease;
|
||||
will-change: transform;
|
||||
}
|
||||
|
||||
&:hover [data-slot="collapsible-arrow"] {
|
||||
@@ -74,7 +77,7 @@
|
||||
}
|
||||
|
||||
[data-slot="collapsible-arrow-icon"] {
|
||||
transform: rotate(0deg);
|
||||
transform: translateZ(0) rotate(0deg);
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -179,6 +179,7 @@
|
||||
|
||||
[data-component="text-part"] {
|
||||
width: 100%;
|
||||
margin-top: 24px;
|
||||
|
||||
[data-slot="text-part-body"] {
|
||||
margin-top: 0;
|
||||
@@ -227,13 +228,18 @@
|
||||
[data-component="reasoning-part"] {
|
||||
width: 100%;
|
||||
color: var(--text-base);
|
||||
font-size: var(--font-size-small);
|
||||
line-height: var(--line-height-large);
|
||||
line-height: var(--line-height-normal);
|
||||
|
||||
[data-component="markdown"] {
|
||||
margin-top: 24px;
|
||||
font-style: normal;
|
||||
font-size: inherit;
|
||||
color: var(--text-weak);
|
||||
|
||||
strong,
|
||||
b {
|
||||
color: var(--text-weak);
|
||||
}
|
||||
|
||||
p:has(strong) {
|
||||
margin-top: 24px;
|
||||
|
||||
@@ -96,6 +96,7 @@ export interface MessageProps {
|
||||
parts: PartType[]
|
||||
showAssistantCopyPartID?: string | null
|
||||
interrupted?: boolean
|
||||
showReasoningSummaries?: boolean
|
||||
}
|
||||
|
||||
export interface MessagePartProps {
|
||||
@@ -104,6 +105,7 @@ export interface MessagePartProps {
|
||||
hideDetails?: boolean
|
||||
defaultOpen?: boolean
|
||||
showAssistantCopyPartID?: string | null
|
||||
turnDurationMs?: number
|
||||
}
|
||||
|
||||
export type PartComponent = Component<MessagePartProps>
|
||||
@@ -149,6 +151,8 @@ function createThrottledValue(getValue: () => string) {
|
||||
function relativizeProjectPaths(text: string, directory?: string) {
|
||||
if (!text) return ""
|
||||
if (!directory) return text
|
||||
if (directory === "/") return text
|
||||
if (directory === "\\") return text
|
||||
return text.split(directory).join("")
|
||||
}
|
||||
|
||||
@@ -261,21 +265,23 @@ function list<T>(value: T[] | undefined | null, fallback: T[]) {
|
||||
return fallback
|
||||
}
|
||||
|
||||
function renderable(part: PartType) {
|
||||
function renderable(part: PartType, showReasoningSummaries = true) {
|
||||
if (part.type === "tool") {
|
||||
if (HIDDEN_TOOLS.has(part.tool)) return false
|
||||
if (part.tool === "question") return part.state.status !== "pending" && part.state.status !== "running"
|
||||
return true
|
||||
}
|
||||
if (part.type === "text") return !!part.text?.trim()
|
||||
if (part.type === "reasoning") return !!part.text?.trim()
|
||||
if (part.type === "reasoning") return showReasoningSummaries && !!part.text?.trim()
|
||||
return !!PART_MAPPING[part.type]
|
||||
}
|
||||
|
||||
export function AssistantParts(props: {
|
||||
messages: AssistantMessage[]
|
||||
showAssistantCopyPartID?: string | null
|
||||
turnDurationMs?: number
|
||||
working?: boolean
|
||||
showReasoningSummaries?: boolean
|
||||
}) {
|
||||
const data = useData()
|
||||
const emptyParts: PartType[] = []
|
||||
@@ -296,7 +302,7 @@ export function AssistantParts(props: {
|
||||
|
||||
const parts = props.messages.flatMap((message) =>
|
||||
list(data.store.part?.[message.id], emptyParts)
|
||||
.filter(renderable)
|
||||
.filter((part) => renderable(part, props.showReasoningSummaries ?? true))
|
||||
.map((part) => ({ message, part })),
|
||||
)
|
||||
|
||||
@@ -365,6 +371,7 @@ export function AssistantParts(props: {
|
||||
part={entry().part}
|
||||
message={entry().message}
|
||||
showAssistantCopyPartID={props.showAssistantCopyPartID}
|
||||
turnDurationMs={props.turnDurationMs}
|
||||
/>
|
||||
)}
|
||||
</Show>
|
||||
@@ -475,6 +482,7 @@ export function Message(props: MessageProps) {
|
||||
message={assistantMessage() as AssistantMessage}
|
||||
parts={props.parts}
|
||||
showAssistantCopyPartID={props.showAssistantCopyPartID}
|
||||
showReasoningSummaries={props.showReasoningSummaries}
|
||||
/>
|
||||
)}
|
||||
</Match>
|
||||
@@ -486,6 +494,7 @@ export function AssistantMessageDisplay(props: {
|
||||
message: AssistantMessage
|
||||
parts: PartType[]
|
||||
showAssistantCopyPartID?: string | null
|
||||
showReasoningSummaries?: boolean
|
||||
}) {
|
||||
const grouped = createMemo(() => {
|
||||
const keys: string[] = []
|
||||
@@ -514,7 +523,7 @@ export function AssistantMessageDisplay(props: {
|
||||
}
|
||||
|
||||
parts.forEach((part, index) => {
|
||||
if (!renderable(part)) return
|
||||
if (!renderable(part, props.showReasoningSummaries ?? true)) return
|
||||
|
||||
if (isContextGroupTool(part)) {
|
||||
if (start < 0) start = index
|
||||
@@ -849,6 +858,7 @@ export function Part(props: MessagePartProps) {
|
||||
hideDetails={props.hideDetails}
|
||||
defaultOpen={props.defaultOpen}
|
||||
showAssistantCopyPartID={props.showAssistantCopyPartID}
|
||||
turnDurationMs={props.turnDurationMs}
|
||||
/>
|
||||
</Show>
|
||||
)
|
||||
@@ -1060,8 +1070,12 @@ PART_MAPPING["text"] = function TextPartDisplay(props) {
|
||||
if (props.message.role !== "assistant") return ""
|
||||
const message = props.message as AssistantMessage
|
||||
const completed = message.time.completed
|
||||
if (typeof completed !== "number") return ""
|
||||
const ms = completed - message.time.created
|
||||
const ms =
|
||||
typeof props.turnDurationMs === "number"
|
||||
? props.turnDurationMs
|
||||
: typeof completed === "number"
|
||||
? completed - message.time.created
|
||||
: -1
|
||||
if (!(ms >= 0)) return ""
|
||||
const total = Math.round(ms / 1000)
|
||||
if (total < 60) return `${total}s`
|
||||
@@ -1593,6 +1607,12 @@ ToolRegistry.register({
|
||||
const i18n = useI18n()
|
||||
const diffComponent = useDiffComponent()
|
||||
const files = createMemo(() => (props.metadata.files ?? []) as ApplyPatchFile[])
|
||||
const pending = createMemo(() => props.status === "pending" || props.status === "running")
|
||||
const single = createMemo(() => {
|
||||
const list = files()
|
||||
if (list.length !== 1) return
|
||||
return list[0]
|
||||
})
|
||||
const [expanded, setExpanded] = createSignal<string[]>([])
|
||||
let seeded = false
|
||||
|
||||
@@ -1611,100 +1631,147 @@ ToolRegistry.register({
|
||||
})
|
||||
|
||||
return (
|
||||
<div data-component="apply-patch-tool">
|
||||
<BasicTool
|
||||
{...props}
|
||||
icon="code-lines"
|
||||
defer
|
||||
trigger={{
|
||||
title: i18n.t("ui.tool.patch"),
|
||||
subtitle: subtitle(),
|
||||
}}
|
||||
>
|
||||
<Show when={files().length > 0}>
|
||||
<Accordion
|
||||
multiple
|
||||
data-scope="apply-patch"
|
||||
style={{ "--sticky-accordion-offset": "40px" }}
|
||||
value={expanded()}
|
||||
onChange={(value) => setExpanded(Array.isArray(value) ? value : value ? [value] : [])}
|
||||
<Show
|
||||
when={single()}
|
||||
fallback={
|
||||
<div data-component="apply-patch-tool">
|
||||
<BasicTool
|
||||
{...props}
|
||||
icon="code-lines"
|
||||
defer
|
||||
trigger={{
|
||||
title: i18n.t("ui.tool.patch"),
|
||||
subtitle: subtitle(),
|
||||
}}
|
||||
>
|
||||
<For each={files()}>
|
||||
{(file) => {
|
||||
const active = createMemo(() => expanded().includes(file.filePath))
|
||||
const [visible, setVisible] = createSignal(false)
|
||||
<Show when={files().length > 0}>
|
||||
<Accordion
|
||||
multiple
|
||||
data-scope="apply-patch"
|
||||
style={{ "--sticky-accordion-offset": "40px" }}
|
||||
value={expanded()}
|
||||
onChange={(value) => setExpanded(Array.isArray(value) ? value : value ? [value] : [])}
|
||||
>
|
||||
<For each={files()}>
|
||||
{(file) => {
|
||||
const active = createMemo(() => expanded().includes(file.filePath))
|
||||
const [visible, setVisible] = createSignal(false)
|
||||
|
||||
createEffect(() => {
|
||||
if (!active()) {
|
||||
setVisible(false)
|
||||
return
|
||||
}
|
||||
createEffect(() => {
|
||||
if (!active()) {
|
||||
setVisible(false)
|
||||
return
|
||||
}
|
||||
|
||||
requestAnimationFrame(() => {
|
||||
if (!active()) return
|
||||
setVisible(true)
|
||||
})
|
||||
})
|
||||
requestAnimationFrame(() => {
|
||||
if (!active()) return
|
||||
setVisible(true)
|
||||
})
|
||||
})
|
||||
|
||||
return (
|
||||
<Accordion.Item value={file.filePath} data-type={file.type}>
|
||||
<StickyAccordionHeader>
|
||||
<Accordion.Trigger>
|
||||
<div data-slot="apply-patch-trigger-content">
|
||||
<div data-slot="apply-patch-file-info">
|
||||
<FileIcon node={{ path: file.relativePath, type: "file" }} />
|
||||
<div data-slot="apply-patch-file-name-container">
|
||||
<Show when={file.relativePath.includes("/")}>
|
||||
<span data-slot="apply-patch-directory">{`\u202A${getDirectory(file.relativePath)}\u202C`}</span>
|
||||
</Show>
|
||||
<span data-slot="apply-patch-filename">{getFilename(file.relativePath)}</span>
|
||||
return (
|
||||
<Accordion.Item value={file.filePath} data-type={file.type}>
|
||||
<StickyAccordionHeader>
|
||||
<Accordion.Trigger>
|
||||
<div data-slot="apply-patch-trigger-content">
|
||||
<div data-slot="apply-patch-file-info">
|
||||
<FileIcon node={{ path: file.relativePath, type: "file" }} />
|
||||
<div data-slot="apply-patch-file-name-container">
|
||||
<Show when={file.relativePath.includes("/")}>
|
||||
<span data-slot="apply-patch-directory">{`\u202A${getDirectory(file.relativePath)}\u202C`}</span>
|
||||
</Show>
|
||||
<span data-slot="apply-patch-filename">{getFilename(file.relativePath)}</span>
|
||||
</div>
|
||||
</div>
|
||||
<div data-slot="apply-patch-trigger-actions">
|
||||
<Switch>
|
||||
<Match when={file.type === "add"}>
|
||||
<span data-slot="apply-patch-change" data-type="added">
|
||||
{i18n.t("ui.patch.action.created")}
|
||||
</span>
|
||||
</Match>
|
||||
<Match when={file.type === "delete"}>
|
||||
<span data-slot="apply-patch-change" data-type="removed">
|
||||
{i18n.t("ui.patch.action.deleted")}
|
||||
</span>
|
||||
</Match>
|
||||
<Match when={file.type === "move"}>
|
||||
<span data-slot="apply-patch-change" data-type="modified">
|
||||
{i18n.t("ui.patch.action.moved")}
|
||||
</span>
|
||||
</Match>
|
||||
<Match when={true}>
|
||||
<DiffChanges changes={{ additions: file.additions, deletions: file.deletions }} />
|
||||
</Match>
|
||||
</Switch>
|
||||
<Icon name="chevron-grabber-vertical" size="small" />
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
<div data-slot="apply-patch-trigger-actions">
|
||||
<Switch>
|
||||
<Match when={file.type === "add"}>
|
||||
<span data-slot="apply-patch-change" data-type="added">
|
||||
{i18n.t("ui.patch.action.created")}
|
||||
</span>
|
||||
</Match>
|
||||
<Match when={file.type === "delete"}>
|
||||
<span data-slot="apply-patch-change" data-type="removed">
|
||||
{i18n.t("ui.patch.action.deleted")}
|
||||
</span>
|
||||
</Match>
|
||||
<Match when={file.type === "move"}>
|
||||
<span data-slot="apply-patch-change" data-type="modified">
|
||||
{i18n.t("ui.patch.action.moved")}
|
||||
</span>
|
||||
</Match>
|
||||
<Match when={true}>
|
||||
<DiffChanges changes={{ additions: file.additions, deletions: file.deletions }} />
|
||||
</Match>
|
||||
</Switch>
|
||||
<Icon name="chevron-grabber-vertical" size="small" />
|
||||
</div>
|
||||
</div>
|
||||
</Accordion.Trigger>
|
||||
</StickyAccordionHeader>
|
||||
<Accordion.Content>
|
||||
<Show when={visible()}>
|
||||
<div data-component="apply-patch-file-diff">
|
||||
<Dynamic
|
||||
component={diffComponent}
|
||||
before={{ name: file.filePath, contents: file.before }}
|
||||
after={{ name: file.movePath ?? file.filePath, contents: file.after }}
|
||||
/>
|
||||
</div>
|
||||
</Show>
|
||||
</Accordion.Content>
|
||||
</Accordion.Item>
|
||||
)
|
||||
}}
|
||||
</For>
|
||||
</Accordion>
|
||||
</Show>
|
||||
</BasicTool>
|
||||
</div>
|
||||
</Accordion.Trigger>
|
||||
</StickyAccordionHeader>
|
||||
<Accordion.Content>
|
||||
<Show when={visible()}>
|
||||
<div data-component="apply-patch-file-diff">
|
||||
<Dynamic
|
||||
component={diffComponent}
|
||||
before={{ name: file.filePath, contents: file.before }}
|
||||
after={{ name: file.movePath ?? file.filePath, contents: file.after }}
|
||||
/>
|
||||
</div>
|
||||
</Show>
|
||||
</Accordion.Content>
|
||||
</Accordion.Item>
|
||||
)
|
||||
}}
|
||||
</For>
|
||||
</Accordion>
|
||||
</Show>
|
||||
</BasicTool>
|
||||
</div>
|
||||
}
|
||||
>
|
||||
{(file) => (
|
||||
<BasicTool
|
||||
{...props}
|
||||
icon="code-lines"
|
||||
defer
|
||||
trigger={
|
||||
<div data-component="edit-trigger">
|
||||
<div data-slot="message-part-title-area">
|
||||
<div data-slot="message-part-title">
|
||||
<span data-slot="message-part-title-text">
|
||||
<Show when={pending()} fallback={i18n.t("ui.tool.patch")}>
|
||||
<TextShimmer text={i18n.t("ui.tool.patch")} />
|
||||
</Show>
|
||||
</span>
|
||||
<Show when={!pending()}>
|
||||
<span data-slot="message-part-title-filename">{getFilename(file().relativePath)}</span>
|
||||
</Show>
|
||||
</div>
|
||||
<Show when={!pending() && file().relativePath.includes("/")}>
|
||||
<div data-slot="message-part-path">
|
||||
<span data-slot="message-part-directory">{getDirectory(file().relativePath)}</span>
|
||||
</div>
|
||||
</Show>
|
||||
</div>
|
||||
<div data-slot="message-part-actions">
|
||||
<Show when={!pending()}>
|
||||
<DiffChanges changes={{ additions: file().additions, deletions: file().deletions }} />
|
||||
</Show>
|
||||
</div>
|
||||
</div>
|
||||
}
|
||||
>
|
||||
<div data-component="edit-content">
|
||||
<Dynamic
|
||||
component={diffComponent}
|
||||
before={{ name: file().filePath, contents: file().before }}
|
||||
after={{ name: file().movePath ?? file().filePath, contents: file().after }}
|
||||
/>
|
||||
</div>
|
||||
</BasicTool>
|
||||
)}
|
||||
</Show>
|
||||
)
|
||||
},
|
||||
})
|
||||
|
||||
61
packages/ui/src/components/scroll-view.css
Normal file
61
packages/ui/src/components/scroll-view.css
Normal file
@@ -0,0 +1,61 @@
|
||||
.scroll-view {
|
||||
position: relative;
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.scroll-view__viewport {
|
||||
height: 100%;
|
||||
width: 100%;
|
||||
overflow-y: auto;
|
||||
scrollbar-width: none;
|
||||
outline: none;
|
||||
}
|
||||
|
||||
.scroll-view__viewport::-webkit-scrollbar {
|
||||
display: none;
|
||||
}
|
||||
|
||||
.scroll-view__thumb {
|
||||
position: absolute;
|
||||
right: 0;
|
||||
top: 0;
|
||||
width: 16px;
|
||||
transition: opacity 200ms ease;
|
||||
cursor: default;
|
||||
user-select: none;
|
||||
opacity: 0;
|
||||
}
|
||||
|
||||
.scroll-view__thumb::after {
|
||||
content: "";
|
||||
position: absolute;
|
||||
right: 4px;
|
||||
top: 0;
|
||||
bottom: 0;
|
||||
width: 6px;
|
||||
border-radius: 9999px;
|
||||
background-color: var(--border-weak-base);
|
||||
backdrop-filter: blur(4px);
|
||||
transition: background-color 150ms ease;
|
||||
}
|
||||
|
||||
.scroll-view__thumb:hover::after,
|
||||
.scroll-view__thumb[data-dragging="true"]::after {
|
||||
background-color: var(--border-strong-base);
|
||||
}
|
||||
|
||||
.dark .scroll-view__thumb::after,
|
||||
[data-theme="dark"] .scroll-view__thumb::after {
|
||||
background-color: var(--border-weak-base);
|
||||
}
|
||||
|
||||
.dark .scroll-view__thumb:hover::after,
|
||||
[data-theme="dark"] .scroll-view__thumb:hover::after,
|
||||
.dark .scroll-view__thumb[data-dragging="true"]::after,
|
||||
[data-theme="dark"] .scroll-view__thumb[data-dragging="true"]::after {
|
||||
background-color: var(--border-strong-base);
|
||||
}
|
||||
|
||||
.scroll-view__thumb[data-visible="true"] {
|
||||
opacity: 1;
|
||||
}
|
||||
217
packages/ui/src/components/scroll-view.tsx
Normal file
217
packages/ui/src/components/scroll-view.tsx
Normal file
@@ -0,0 +1,217 @@
|
||||
import { createSignal, onCleanup, onMount, splitProps, type ComponentProps, Show, mergeProps } from "solid-js"
|
||||
|
||||
export interface ScrollViewProps extends ComponentProps<"div"> {
|
||||
viewportRef?: (el: HTMLDivElement) => void
|
||||
orientation?: "vertical" | "horizontal" // currently only vertical is fully implemented for thumb
|
||||
}
|
||||
|
||||
export function ScrollView(props: ScrollViewProps) {
|
||||
const merged = mergeProps({ orientation: "vertical" }, props)
|
||||
const [local, events, rest] = splitProps(
|
||||
merged,
|
||||
["class", "children", "viewportRef", "orientation", "style"],
|
||||
[
|
||||
"onScroll",
|
||||
"onWheel",
|
||||
"onTouchStart",
|
||||
"onTouchMove",
|
||||
"onTouchEnd",
|
||||
"onTouchCancel",
|
||||
"onPointerDown",
|
||||
"onClick",
|
||||
"onKeyDown",
|
||||
],
|
||||
)
|
||||
|
||||
let rootRef!: HTMLDivElement
|
||||
let viewportRef!: HTMLDivElement
|
||||
let thumbRef!: HTMLDivElement
|
||||
|
||||
const [isHovered, setIsHovered] = createSignal(false)
|
||||
const [isDragging, setIsDragging] = createSignal(false)
|
||||
|
||||
const [thumbHeight, setThumbHeight] = createSignal(0)
|
||||
const [thumbTop, setThumbTop] = createSignal(0)
|
||||
const [showThumb, setShowThumb] = createSignal(false)
|
||||
|
||||
const updateThumb = () => {
|
||||
if (!viewportRef) return
|
||||
const { scrollTop, scrollHeight, clientHeight } = viewportRef
|
||||
|
||||
if (scrollHeight <= clientHeight || scrollHeight === 0) {
|
||||
setShowThumb(false)
|
||||
return
|
||||
}
|
||||
|
||||
setShowThumb(true)
|
||||
const trackPadding = 8
|
||||
const trackHeight = clientHeight - trackPadding * 2
|
||||
|
||||
const minThumbHeight = 32
|
||||
// Calculate raw thumb height based on ratio
|
||||
let height = (clientHeight / scrollHeight) * trackHeight
|
||||
height = Math.max(height, minThumbHeight)
|
||||
|
||||
const maxScrollTop = scrollHeight - clientHeight
|
||||
const maxThumbTop = trackHeight - height
|
||||
|
||||
const top = maxScrollTop > 0 ? (scrollTop / maxScrollTop) * maxThumbTop : 0
|
||||
|
||||
// Ensure thumb stays within bounds (shouldn't be necessary due to math above, but good for safety)
|
||||
const boundedTop = trackPadding + Math.max(0, Math.min(top, maxThumbTop))
|
||||
|
||||
setThumbHeight(height)
|
||||
setThumbTop(boundedTop)
|
||||
}
|
||||
|
||||
onMount(() => {
|
||||
if (local.viewportRef) {
|
||||
local.viewportRef(viewportRef)
|
||||
}
|
||||
|
||||
const observer = new ResizeObserver(() => {
|
||||
updateThumb()
|
||||
})
|
||||
|
||||
observer.observe(viewportRef)
|
||||
// Also observe the first child if possible to catch content changes
|
||||
if (viewportRef.firstElementChild) {
|
||||
observer.observe(viewportRef.firstElementChild)
|
||||
}
|
||||
|
||||
onCleanup(() => {
|
||||
observer.disconnect()
|
||||
})
|
||||
|
||||
updateThumb()
|
||||
})
|
||||
|
||||
let startY = 0
|
||||
let startScrollTop = 0
|
||||
|
||||
const onThumbPointerDown = (e: PointerEvent) => {
|
||||
e.preventDefault()
|
||||
e.stopPropagation()
|
||||
setIsDragging(true)
|
||||
startY = e.clientY
|
||||
startScrollTop = viewportRef.scrollTop
|
||||
|
||||
thumbRef.setPointerCapture(e.pointerId)
|
||||
|
||||
const onPointerMove = (e: PointerEvent) => {
|
||||
const deltaY = e.clientY - startY
|
||||
const { scrollHeight, clientHeight } = viewportRef
|
||||
const maxScrollTop = scrollHeight - clientHeight
|
||||
const maxThumbTop = clientHeight - thumbHeight()
|
||||
|
||||
if (maxThumbTop > 0) {
|
||||
const scrollDelta = deltaY * (maxScrollTop / maxThumbTop)
|
||||
viewportRef.scrollTop = startScrollTop + scrollDelta
|
||||
}
|
||||
}
|
||||
|
||||
const onPointerUp = (e: PointerEvent) => {
|
||||
setIsDragging(false)
|
||||
thumbRef.releasePointerCapture(e.pointerId)
|
||||
thumbRef.removeEventListener("pointermove", onPointerMove)
|
||||
thumbRef.removeEventListener("pointerup", onPointerUp)
|
||||
}
|
||||
|
||||
thumbRef.addEventListener("pointermove", onPointerMove)
|
||||
thumbRef.addEventListener("pointerup", onPointerUp)
|
||||
}
|
||||
|
||||
// Keybinds implementation
|
||||
// We ensure the viewport has a tabindex so it can receive focus
|
||||
// We can also explicitly catch PageUp/Down if we want smooth scroll or specific behavior,
|
||||
// but native usually handles this perfectly. Let's explicitly ensure it behaves well.
|
||||
const onKeyDown = (e: KeyboardEvent) => {
|
||||
// If user is focused on an input inside the scroll view, don't hijack keys
|
||||
if (document.activeElement && ["INPUT", "TEXTAREA", "SELECT"].includes(document.activeElement.tagName)) {
|
||||
return
|
||||
}
|
||||
|
||||
const scrollAmount = viewportRef.clientHeight * 0.8
|
||||
const lineAmount = 40
|
||||
|
||||
switch (e.key) {
|
||||
case "PageDown":
|
||||
e.preventDefault()
|
||||
viewportRef.scrollBy({ top: scrollAmount, behavior: "smooth" })
|
||||
break
|
||||
case "PageUp":
|
||||
e.preventDefault()
|
||||
viewportRef.scrollBy({ top: -scrollAmount, behavior: "smooth" })
|
||||
break
|
||||
case "Home":
|
||||
e.preventDefault()
|
||||
viewportRef.scrollTo({ top: 0, behavior: "smooth" })
|
||||
break
|
||||
case "End":
|
||||
e.preventDefault()
|
||||
viewportRef.scrollTo({ top: viewportRef.scrollHeight, behavior: "smooth" })
|
||||
break
|
||||
case "ArrowUp":
|
||||
e.preventDefault()
|
||||
viewportRef.scrollBy({ top: -lineAmount, behavior: "smooth" })
|
||||
break
|
||||
case "ArrowDown":
|
||||
e.preventDefault()
|
||||
viewportRef.scrollBy({ top: lineAmount, behavior: "smooth" })
|
||||
break
|
||||
}
|
||||
}
|
||||
|
||||
return (
|
||||
<div
|
||||
ref={rootRef}
|
||||
class={`scroll-view ${local.class || ""}`}
|
||||
style={local.style}
|
||||
onPointerEnter={() => setIsHovered(true)}
|
||||
onPointerLeave={() => setIsHovered(false)}
|
||||
{...rest}
|
||||
>
|
||||
{/* Viewport */}
|
||||
<div
|
||||
ref={viewportRef}
|
||||
class="scroll-view__viewport"
|
||||
onScroll={(e) => {
|
||||
updateThumb()
|
||||
if (typeof events.onScroll === "function") events.onScroll(e as any)
|
||||
}}
|
||||
onWheel={events.onWheel as any}
|
||||
onTouchStart={events.onTouchStart as any}
|
||||
onTouchMove={events.onTouchMove as any}
|
||||
onTouchEnd={events.onTouchEnd as any}
|
||||
onTouchCancel={events.onTouchCancel as any}
|
||||
onPointerDown={events.onPointerDown as any}
|
||||
onClick={events.onClick as any}
|
||||
tabIndex={0}
|
||||
role="region"
|
||||
aria-label="scrollable content"
|
||||
onKeyDown={(e) => {
|
||||
onKeyDown(e)
|
||||
if (typeof events.onKeyDown === "function") events.onKeyDown(e as any)
|
||||
}}
|
||||
>
|
||||
{local.children}
|
||||
</div>
|
||||
|
||||
{/* Thumb Overlay */}
|
||||
<Show when={showThumb()}>
|
||||
<div
|
||||
ref={thumbRef}
|
||||
onPointerDown={onThumbPointerDown}
|
||||
class="scroll-view__thumb"
|
||||
data-visible={isHovered() || isDragging()}
|
||||
data-dragging={isDragging()}
|
||||
style={{
|
||||
height: `${thumbHeight()}px`,
|
||||
transform: `translateY(${thumbTop()}px)`,
|
||||
"z-index": 100, // ensure it displays over content
|
||||
}}
|
||||
/>
|
||||
</Show>
|
||||
</div>
|
||||
)
|
||||
}
|
||||
@@ -12,6 +12,7 @@
|
||||
|
||||
[data-slot="session-review-container"] {
|
||||
flex: 1 1 auto;
|
||||
padding-right: 4px;
|
||||
}
|
||||
|
||||
[data-slot="session-review-header"] {
|
||||
@@ -40,7 +41,6 @@
|
||||
display: flex;
|
||||
align-items: center;
|
||||
column-gap: 12px;
|
||||
padding-right: 1px;
|
||||
}
|
||||
|
||||
[data-slot="session-review-actions"] [data-component="radio-group"] {
|
||||
|
||||
@@ -7,6 +7,7 @@ import { Icon } from "./icon"
|
||||
import { LineComment, LineCommentEditor } from "./line-comment"
|
||||
import { StickyAccordionHeader } from "./sticky-accordion-header"
|
||||
import { Tooltip } from "./tooltip"
|
||||
import { ScrollView } from "./scroll-view"
|
||||
import { useDiffComponent } from "../context/diff"
|
||||
import { useI18n } from "../context/i18n"
|
||||
import { getDirectory, getFilename } from "@opencode-ai/util/path"
|
||||
@@ -188,8 +189,10 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
const [opened, setOpened] = createSignal<SessionReviewFocus | null>(null)
|
||||
|
||||
const open = () => props.open ?? store.open
|
||||
const files = createMemo(() => props.diffs.map((d) => d.file))
|
||||
const diffs = createMemo(() => new Map(props.diffs.map((d) => [d.file, d] as const)))
|
||||
const diffStyle = () => props.diffStyle ?? (props.split ? "split" : "unified")
|
||||
const hasDiffs = () => props.diffs.length > 0
|
||||
const hasDiffs = () => files().length > 0
|
||||
|
||||
const handleChange = (open: string[]) => {
|
||||
props.onOpenChange?.(open)
|
||||
@@ -198,7 +201,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
}
|
||||
|
||||
const handleExpandOrCollapseAll = () => {
|
||||
const next = open().length > 0 ? [] : props.diffs.map((d) => d.file)
|
||||
const next = open().length > 0 ? [] : files()
|
||||
handleChange(next)
|
||||
}
|
||||
|
||||
@@ -274,13 +277,13 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
})
|
||||
|
||||
return (
|
||||
<div
|
||||
<ScrollView
|
||||
data-component="session-review"
|
||||
ref={(el) => {
|
||||
viewportRef={(el) => {
|
||||
scroll = el
|
||||
props.scrollRef?.(el)
|
||||
}}
|
||||
onScroll={props.onScroll}
|
||||
onScroll={props.onScroll as any}
|
||||
classList={{
|
||||
...(props.classList ?? {}),
|
||||
[props.classes?.root ?? ""]: !!props.classes?.root,
|
||||
@@ -321,51 +324,54 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
<div data-slot="session-review-container" class={props.classes?.container}>
|
||||
<Show when={hasDiffs()} fallback={props.empty}>
|
||||
<Accordion multiple value={open()} onChange={handleChange}>
|
||||
<For each={props.diffs}>
|
||||
{(diff) => {
|
||||
<For each={files()}>
|
||||
{(file) => {
|
||||
let wrapper: HTMLDivElement | undefined
|
||||
|
||||
const expanded = createMemo(() => open().includes(diff.file))
|
||||
const diff = createMemo(() => diffs().get(file))
|
||||
const item = () => diff()!
|
||||
|
||||
const expanded = createMemo(() => open().includes(file))
|
||||
const [force, setForce] = createSignal(false)
|
||||
|
||||
const comments = createMemo(() => (props.comments ?? []).filter((c) => c.file === diff.file))
|
||||
const comments = createMemo(() => (props.comments ?? []).filter((c) => c.file === file))
|
||||
const commentedLines = createMemo(() => comments().map((c) => c.selection))
|
||||
|
||||
const beforeText = () => (typeof diff.before === "string" ? diff.before : "")
|
||||
const afterText = () => (typeof diff.after === "string" ? diff.after : "")
|
||||
const changedLines = () => diff.additions + diff.deletions
|
||||
const beforeText = () => (typeof item().before === "string" ? item().before : "")
|
||||
const afterText = () => (typeof item().after === "string" ? item().after : "")
|
||||
const changedLines = () => item().additions + item().deletions
|
||||
|
||||
const tooLarge = createMemo(() => {
|
||||
if (!expanded()) return false
|
||||
if (force()) return false
|
||||
if (isImageFile(diff.file)) return false
|
||||
if (isImageFile(file)) return false
|
||||
return changedLines() > MAX_DIFF_CHANGED_LINES
|
||||
})
|
||||
|
||||
const isAdded = () => diff.status === "added" || (beforeText().length === 0 && afterText().length > 0)
|
||||
const isAdded = () => item().status === "added" || (beforeText().length === 0 && afterText().length > 0)
|
||||
const isDeleted = () =>
|
||||
diff.status === "deleted" || (afterText().length === 0 && beforeText().length > 0)
|
||||
const isImage = () => isImageFile(diff.file)
|
||||
const isAudio = () => isAudioFile(diff.file)
|
||||
item().status === "deleted" || (afterText().length === 0 && beforeText().length > 0)
|
||||
const isImage = () => isImageFile(file)
|
||||
const isAudio = () => isAudioFile(file)
|
||||
|
||||
const diffImageSrc = dataUrlFromValue(diff.after) ?? dataUrlFromValue(diff.before)
|
||||
const [imageSrc, setImageSrc] = createSignal<string | undefined>(diffImageSrc)
|
||||
const diffImageSrc = createMemo(() => dataUrlFromValue(item().after) ?? dataUrlFromValue(item().before))
|
||||
const [imageSrc, setImageSrc] = createSignal<string | undefined>(diffImageSrc())
|
||||
const [imageStatus, setImageStatus] = createSignal<"idle" | "loading" | "error">("idle")
|
||||
|
||||
const diffAudioSrc = dataUrlFromValue(diff.after) ?? dataUrlFromValue(diff.before)
|
||||
const [audioSrc, setAudioSrc] = createSignal<string | undefined>(diffAudioSrc)
|
||||
const diffAudioSrc = createMemo(() => dataUrlFromValue(item().after) ?? dataUrlFromValue(item().before))
|
||||
const [audioSrc, setAudioSrc] = createSignal<string | undefined>(diffAudioSrc())
|
||||
const [audioStatus, setAudioStatus] = createSignal<"idle" | "loading" | "error">("idle")
|
||||
const [audioMime, setAudioMime] = createSignal<string | undefined>(undefined)
|
||||
|
||||
const selectedLines = createMemo(() => {
|
||||
const current = selection()
|
||||
if (!current || current.file !== diff.file) return null
|
||||
if (!current || current.file !== file) return null
|
||||
return current.range
|
||||
})
|
||||
|
||||
const draftRange = createMemo(() => {
|
||||
const current = commenting()
|
||||
if (!current || current.file !== diff.file) return null
|
||||
if (!current || current.file !== file) return null
|
||||
return current.range
|
||||
})
|
||||
|
||||
@@ -416,6 +422,21 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
requestAnimationFrame(updateAnchors)
|
||||
}
|
||||
|
||||
createEffect(() => {
|
||||
if (!isImage()) return
|
||||
const src = diffImageSrc()
|
||||
setImageSrc(src)
|
||||
setImageStatus("idle")
|
||||
})
|
||||
|
||||
createEffect(() => {
|
||||
if (!isAudio()) return
|
||||
const src = diffAudioSrc()
|
||||
setAudioSrc(src)
|
||||
setAudioStatus("idle")
|
||||
setAudioMime(undefined)
|
||||
})
|
||||
|
||||
createEffect(() => {
|
||||
comments()
|
||||
scheduleAnchors()
|
||||
@@ -429,7 +450,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
})
|
||||
|
||||
createEffect(() => {
|
||||
if (!open().includes(diff.file)) return
|
||||
if (!open().includes(file)) return
|
||||
if (!isImage()) return
|
||||
if (imageSrc()) return
|
||||
if (imageStatus() !== "idle") return
|
||||
@@ -439,7 +460,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
if (!reader) return
|
||||
|
||||
setImageStatus("loading")
|
||||
reader(diff.file)
|
||||
reader(file)
|
||||
.then((result) => {
|
||||
const src = dataUrl(result)
|
||||
if (!src) {
|
||||
@@ -455,7 +476,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
})
|
||||
|
||||
createEffect(() => {
|
||||
if (!open().includes(diff.file)) return
|
||||
if (!open().includes(file)) return
|
||||
if (!isAudio()) return
|
||||
if (audioSrc()) return
|
||||
if (audioStatus() !== "idle") return
|
||||
@@ -464,7 +485,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
if (!reader) return
|
||||
|
||||
setAudioStatus("loading")
|
||||
reader(diff.file)
|
||||
reader(file)
|
||||
.then((result) => {
|
||||
const src = dataUrl(result)
|
||||
if (!src) {
|
||||
@@ -488,7 +509,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
return
|
||||
}
|
||||
|
||||
setSelection({ file: diff.file, range })
|
||||
setSelection({ file, range })
|
||||
}
|
||||
|
||||
const handleLineSelectionEnd = (range: SelectedLineRange | null) => {
|
||||
@@ -499,8 +520,8 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
return
|
||||
}
|
||||
|
||||
setSelection({ file: diff.file, range })
|
||||
setCommenting({ file: diff.file, range })
|
||||
setSelection({ file, range })
|
||||
setCommenting({ file, range })
|
||||
}
|
||||
|
||||
const openComment = (comment: SessionReviewComment) => {
|
||||
@@ -516,22 +537,22 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
|
||||
return (
|
||||
<Accordion.Item
|
||||
value={diff.file}
|
||||
id={diffId(diff.file)}
|
||||
data-file={diff.file}
|
||||
value={file}
|
||||
id={diffId(file)}
|
||||
data-file={file}
|
||||
data-slot="session-review-accordion-item"
|
||||
data-selected={props.focusedFile === diff.file ? "" : undefined}
|
||||
data-selected={props.focusedFile === file ? "" : undefined}
|
||||
>
|
||||
<StickyAccordionHeader>
|
||||
<Accordion.Trigger>
|
||||
<div data-slot="session-review-trigger-content">
|
||||
<div data-slot="session-review-file-info">
|
||||
<FileIcon node={{ path: diff.file, type: "file" }} />
|
||||
<FileIcon node={{ path: file, type: "file" }} />
|
||||
<div data-slot="session-review-file-name-container">
|
||||
<Show when={diff.file.includes("/")}>
|
||||
<span data-slot="session-review-directory">{`\u202A${getDirectory(diff.file)}\u202C`}</span>
|
||||
<Show when={file.includes("/")}>
|
||||
<span data-slot="session-review-directory">{`\u202A${getDirectory(file)}\u202C`}</span>
|
||||
</Show>
|
||||
<span data-slot="session-review-filename">{getFilename(diff.file)}</span>
|
||||
<span data-slot="session-review-filename">{getFilename(file)}</span>
|
||||
<Show when={props.onViewFile}>
|
||||
<Tooltip value="Open file" placement="top" gutter={4}>
|
||||
<button
|
||||
@@ -540,7 +561,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
aria-label="Open file"
|
||||
onClick={(e) => {
|
||||
e.stopPropagation()
|
||||
props.onViewFile?.(diff.file)
|
||||
props.onViewFile?.(file)
|
||||
}}
|
||||
>
|
||||
<Icon name="open-file" size="small" />
|
||||
@@ -556,7 +577,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
<span data-slot="session-review-change" data-type="added">
|
||||
{i18n.t("ui.sessionReview.change.added")}
|
||||
</span>
|
||||
<DiffChanges changes={diff} />
|
||||
<DiffChanges changes={item()} />
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={isDeleted()}>
|
||||
@@ -570,7 +591,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
</span>
|
||||
</Match>
|
||||
<Match when={true}>
|
||||
<DiffChanges changes={diff} />
|
||||
<DiffChanges changes={item()} />
|
||||
</Match>
|
||||
</Switch>
|
||||
<span data-slot="session-review-diff-chevron">
|
||||
@@ -585,7 +606,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
data-slot="session-review-diff-wrapper"
|
||||
ref={(el) => {
|
||||
wrapper = el
|
||||
anchors.set(diff.file, el)
|
||||
anchors.set(file, el)
|
||||
scheduleAnchors()
|
||||
}}
|
||||
>
|
||||
@@ -593,7 +614,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
<Switch>
|
||||
<Match when={isImage() && imageSrc()}>
|
||||
<div data-slot="session-review-image-container">
|
||||
<img data-slot="session-review-image" src={imageSrc()} alt={diff.file} />
|
||||
<img data-slot="session-review-image" src={imageSrc()} alt={file} />
|
||||
</div>
|
||||
</Match>
|
||||
<Match when={isImage() && isDeleted()}>
|
||||
@@ -633,7 +654,7 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
<Match when={!isImage()}>
|
||||
<Dynamic
|
||||
component={diffComponent}
|
||||
preloadedDiff={diff.preloaded}
|
||||
preloadedDiff={item().preloaded}
|
||||
diffStyle={diffStyle()}
|
||||
onRendered={() => {
|
||||
props.onDiffRendered?.()
|
||||
@@ -645,12 +666,12 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
selectedLines={selectedLines()}
|
||||
commentedLines={commentedLines()}
|
||||
before={{
|
||||
name: diff.file!,
|
||||
contents: typeof diff.before === "string" ? diff.before : "",
|
||||
name: file,
|
||||
contents: typeof item().before === "string" ? item().before : "",
|
||||
}}
|
||||
after={{
|
||||
name: diff.file!,
|
||||
contents: typeof diff.after === "string" ? diff.after : "",
|
||||
name: file,
|
||||
contents: typeof item().after === "string" ? item().after : "",
|
||||
}}
|
||||
/>
|
||||
</Match>
|
||||
@@ -688,10 +709,10 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
onCancel={() => setCommenting(null)}
|
||||
onSubmit={(comment) => {
|
||||
props.onLineComment?.({
|
||||
file: diff.file,
|
||||
file,
|
||||
selection: range(),
|
||||
comment,
|
||||
preview: selectionPreview(diff, range()),
|
||||
preview: selectionPreview(item(), range()),
|
||||
})
|
||||
setCommenting(null)
|
||||
}}
|
||||
@@ -709,6 +730,6 @@ export const SessionReview = (props: SessionReviewProps) => {
|
||||
</Accordion>
|
||||
</Show>
|
||||
</div>
|
||||
</div>
|
||||
</ScrollView>
|
||||
)
|
||||
}
|
||||
|
||||
@@ -41,6 +41,8 @@
|
||||
display: flex;
|
||||
align-items: center;
|
||||
gap: 8px;
|
||||
width: 100%;
|
||||
min-width: 0;
|
||||
color: var(--text-weak);
|
||||
font-family: var(--font-family-sans);
|
||||
font-size: var(--font-size-base);
|
||||
@@ -52,6 +54,16 @@
|
||||
width: 16px;
|
||||
height: 16px;
|
||||
}
|
||||
|
||||
[data-slot="session-turn-thinking-heading"] {
|
||||
flex: 1 1 auto;
|
||||
min-width: 0;
|
||||
overflow: hidden;
|
||||
text-overflow: ellipsis;
|
||||
white-space: nowrap;
|
||||
color: var(--text-weaker);
|
||||
font-weight: var(--font-weight-regular);
|
||||
}
|
||||
}
|
||||
|
||||
.error-card {
|
||||
@@ -129,6 +141,11 @@
|
||||
gap: 8px;
|
||||
flex-shrink: 0;
|
||||
|
||||
[data-slot="collapsible-arrow"] {
|
||||
margin-left: -6px;
|
||||
transform: translateY(2px);
|
||||
}
|
||||
|
||||
[data-component="diff-changes"][data-variant="bars"] {
|
||||
transform: translateY(1px);
|
||||
}
|
||||
|
||||
@@ -6,7 +6,7 @@ import { Binary } from "@opencode-ai/util/binary"
|
||||
import { getDirectory, getFilename } from "@opencode-ai/util/path"
|
||||
import { createEffect, createMemo, createSignal, For, on, ParentProps, Show } from "solid-js"
|
||||
import { Dynamic } from "solid-js/web"
|
||||
import { AssistantParts, Message } from "./message-part"
|
||||
import { AssistantParts, Message, PART_MAPPING } from "./message-part"
|
||||
import { Card } from "./card"
|
||||
import { Accordion } from "./accordion"
|
||||
import { StickyAccordionHeader } from "./sticky-accordion-header"
|
||||
@@ -83,15 +83,55 @@ function list<T>(value: T[] | undefined | null, fallback: T[]) {
|
||||
|
||||
const hidden = new Set(["todowrite", "todoread"])
|
||||
|
||||
function visible(part: PartType) {
|
||||
function partState(part: PartType, showReasoningSummaries: boolean) {
|
||||
if (part.type === "tool") {
|
||||
if (hidden.has(part.tool)) return false
|
||||
if (part.tool === "question") return part.state.status !== "pending" && part.state.status !== "running"
|
||||
return true
|
||||
if (hidden.has(part.tool)) return
|
||||
if (part.tool === "question" && (part.state.status === "pending" || part.state.status === "running")) return
|
||||
return "visible" as const
|
||||
}
|
||||
if (part.type === "text") return part.text?.trim() ? ("visible" as const) : undefined
|
||||
if (part.type === "reasoning") {
|
||||
if (showReasoningSummaries) return "visible" as const
|
||||
return
|
||||
}
|
||||
if (PART_MAPPING[part.type]) return "visible" as const
|
||||
return
|
||||
}
|
||||
|
||||
function clean(value: string) {
|
||||
return value
|
||||
.replace(/`([^`]+)`/g, "$1")
|
||||
.replace(/\[([^\]]+)\]\([^\)]+\)/g, "$1")
|
||||
.replace(/[*_~]+/g, "")
|
||||
.trim()
|
||||
}
|
||||
|
||||
function heading(text: string) {
|
||||
const markdown = text.replace(/\r\n?/g, "\n")
|
||||
|
||||
const html = markdown.match(/<h[1-6][^>]*>([\s\S]*?)<\/h[1-6]>/i)
|
||||
if (html?.[1]) {
|
||||
const value = clean(html[1].replace(/<[^>]+>/g, " "))
|
||||
if (value) return value
|
||||
}
|
||||
|
||||
const atx = markdown.match(/^\s{0,3}#{1,6}[ \t]+(.+?)(?:[ \t]+#+[ \t]*)?$/m)
|
||||
if (atx?.[1]) {
|
||||
const value = clean(atx[1])
|
||||
if (value) return value
|
||||
}
|
||||
|
||||
const setext = markdown.match(/^([^\n]+)\n(?:=+|-+)\s*$/m)
|
||||
if (setext?.[1]) {
|
||||
const value = clean(setext[1])
|
||||
if (value) return value
|
||||
}
|
||||
|
||||
const strong = markdown.match(/^\s*(?:\*\*|__)(.+?)(?:\*\*|__)\s*$/m)
|
||||
if (strong?.[1]) {
|
||||
const value = clean(strong[1])
|
||||
if (value) return value
|
||||
}
|
||||
if (part.type === "text") return !!part.text?.trim()
|
||||
if (part.type === "reasoning") return !!part.text?.trim()
|
||||
return false
|
||||
}
|
||||
|
||||
export function SessionTurn(
|
||||
@@ -99,6 +139,7 @@ export function SessionTurn(
|
||||
sessionID: string
|
||||
messageID: string
|
||||
lastUserMessageID?: string
|
||||
showReasoningSummaries?: boolean
|
||||
onUserInteracted?: () => void
|
||||
classes?: {
|
||||
root?: string
|
||||
@@ -242,17 +283,57 @@ export function SessionTurn(
|
||||
|
||||
const status = createMemo(() => data.store.session_status[props.sessionID] ?? idle)
|
||||
const working = createMemo(() => status().type !== "idle" && isLastUserMessage())
|
||||
const showReasoningSummaries = createMemo(() => props.showReasoningSummaries ?? true)
|
||||
|
||||
const assistantCopyPartID = createMemo(() => {
|
||||
if (working()) return null
|
||||
return showAssistantCopyPartID() ?? null
|
||||
})
|
||||
const turnDurationMs = createMemo(() => {
|
||||
const start = message()?.time.created
|
||||
if (typeof start !== "number") return undefined
|
||||
|
||||
const end = assistantMessages().reduce<number | undefined>((max, item) => {
|
||||
const completed = item.time.completed
|
||||
if (typeof completed !== "number") return max
|
||||
if (max === undefined) return completed
|
||||
return Math.max(max, completed)
|
||||
}, undefined)
|
||||
|
||||
if (typeof end !== "number") return undefined
|
||||
if (end < start) return undefined
|
||||
return end - start
|
||||
})
|
||||
const assistantVisible = createMemo(() =>
|
||||
assistantMessages().reduce((count, message) => {
|
||||
const parts = list(data.store.part?.[message.id], emptyParts)
|
||||
return count + parts.filter(visible).length
|
||||
return count + parts.filter((part) => partState(part, showReasoningSummaries()) === "visible").length
|
||||
}, 0),
|
||||
)
|
||||
const assistantTailVisible = createMemo(() =>
|
||||
assistantMessages()
|
||||
.flatMap((message) => list(data.store.part?.[message.id], emptyParts))
|
||||
.flatMap((part) => {
|
||||
if (partState(part, showReasoningSummaries()) !== "visible") return []
|
||||
if (part.type === "text") return ["text" as const]
|
||||
return ["other" as const]
|
||||
})
|
||||
.at(-1),
|
||||
)
|
||||
const reasoningHeading = createMemo(() =>
|
||||
assistantMessages()
|
||||
.flatMap((message) => list(data.store.part?.[message.id], emptyParts))
|
||||
.filter((part): part is PartType & { type: "reasoning"; text: string } => part.type === "reasoning")
|
||||
.map((part) => heading(part.text))
|
||||
.filter((text): text is string => !!text)
|
||||
.at(-1),
|
||||
)
|
||||
const showThinking = createMemo(() => {
|
||||
if (!working() || !!error()) return false
|
||||
if (showReasoningSummaries()) return assistantVisible() === 0
|
||||
if (assistantTailVisible() === "text") return false
|
||||
return true
|
||||
})
|
||||
|
||||
const autoScroll = createAutoScroll({
|
||||
working,
|
||||
@@ -280,20 +361,25 @@ export function SessionTurn(
|
||||
<div data-slot="session-turn-message-content" aria-live="off">
|
||||
<Message message={msg()} parts={parts()} interrupted={interrupted()} />
|
||||
</div>
|
||||
<Show when={working() && assistantVisible() === 0 && !error()}>
|
||||
<div data-slot="session-turn-thinking">
|
||||
<TextShimmer text={i18n.t("ui.sessionTurn.status.thinking")} />
|
||||
</div>
|
||||
</Show>
|
||||
<Show when={assistantMessages().length > 0}>
|
||||
<div data-slot="session-turn-assistant-content" aria-hidden={working()}>
|
||||
<AssistantParts
|
||||
messages={assistantMessages()}
|
||||
showAssistantCopyPartID={assistantCopyPartID()}
|
||||
turnDurationMs={turnDurationMs()}
|
||||
working={working()}
|
||||
showReasoningSummaries={showReasoningSummaries()}
|
||||
/>
|
||||
</div>
|
||||
</Show>
|
||||
<Show when={showThinking()}>
|
||||
<div data-slot="session-turn-thinking">
|
||||
<TextShimmer text={i18n.t("ui.sessionTurn.status.thinking")} />
|
||||
<Show when={!showReasoningSummaries() && reasoningHeading()}>
|
||||
{(text) => <span data-slot="session-turn-thinking-heading">{text()}</span>}
|
||||
</Show>
|
||||
</div>
|
||||
</Show>
|
||||
<Show when={edited() > 0 && !working()}>
|
||||
<div data-slot="session-turn-diffs">
|
||||
<Collapsible open={open()} onOpenChange={setOpen} variant="ghost">
|
||||
|
||||
@@ -37,10 +37,11 @@ function target(container: HTMLElement): Target | undefined {
|
||||
|
||||
const review = container.closest("[data-component='session-review']")
|
||||
if (review instanceof HTMLElement) {
|
||||
const root = scrollRoot(container) ?? review
|
||||
const content = review.querySelector("[data-slot='session-review-container']")
|
||||
return {
|
||||
key: review,
|
||||
root: review,
|
||||
root,
|
||||
content: content instanceof HTMLElement ? content : undefined,
|
||||
}
|
||||
}
|
||||
|
||||
@@ -44,6 +44,7 @@
|
||||
@import "../components/select.css" layer(components);
|
||||
@import "../components/spinner.css" layer(components);
|
||||
@import "../components/switch.css" layer(components);
|
||||
@import "../components/scroll-view.css" layer(components);
|
||||
@import "../components/session-review.css" layer(components);
|
||||
@import "../components/session-turn.css" layer(components);
|
||||
@import "../components/sticky-accordion-header.css" layer(components);
|
||||
|
||||
@@ -8,34 +8,6 @@
|
||||
}
|
||||
}
|
||||
|
||||
@utility session-scroller {
|
||||
&::-webkit-scrollbar {
|
||||
width: 10px;
|
||||
height: 10px;
|
||||
}
|
||||
|
||||
&::-webkit-scrollbar-track {
|
||||
background: transparent;
|
||||
border-radius: 5px;
|
||||
}
|
||||
|
||||
&::-webkit-scrollbar-thumb {
|
||||
background: var(--border-weak-base);
|
||||
border-radius: 5px;
|
||||
border: 3px solid transparent;
|
||||
background-clip: padding-box;
|
||||
}
|
||||
|
||||
&::-webkit-scrollbar-thumb:hover {
|
||||
background: var(--border-weak-base);
|
||||
}
|
||||
|
||||
& {
|
||||
scrollbar-width: thin;
|
||||
scrollbar-color: var(--border-weak-base) transparent;
|
||||
}
|
||||
}
|
||||
|
||||
@utility badge-mask {
|
||||
-webkit-mask-image: radial-gradient(circle 5px at calc(100% - 4px) 4px, transparent 5px, black 5.5px);
|
||||
mask-image: radial-gradient(circle 5px at calc(100% - 4px) 4px, transparent 5px, black 5.5px);
|
||||
|
||||
@@ -117,6 +117,7 @@
|
||||
--surface-weak: var(--smoke-light-alpha-3);
|
||||
--surface-weaker: var(--smoke-light-alpha-4);
|
||||
--surface-strong: #ffffff;
|
||||
--surface-stronger-non-alpha: var(--surface-raised-stronger-non-alpha);
|
||||
--surface-raised-stronger-non-alpha: var(--white);
|
||||
--surface-brand-base: var(--yuzu-light-9);
|
||||
--surface-brand-hover: var(--yuzu-light-10);
|
||||
@@ -375,6 +376,7 @@
|
||||
--surface-weak: var(--smoke-dark-alpha-4);
|
||||
--surface-weaker: var(--smoke-dark-alpha-5);
|
||||
--surface-strong: var(--smoke-dark-alpha-7);
|
||||
--surface-stronger-non-alpha: var(--surface-raised-stronger-non-alpha);
|
||||
--surface-raised-stronger-non-alpha: var(--smoke-dark-3);
|
||||
--surface-brand-base: var(--yuzu-light-9);
|
||||
--surface-brand-hover: var(--yuzu-light-10);
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@opencode-ai/util",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"private": true,
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
|
||||
@@ -178,7 +178,30 @@ export default defineConfig({
|
||||
"network",
|
||||
"enterprise",
|
||||
"troubleshooting",
|
||||
"windows-wsl",
|
||||
{
|
||||
label: "Windows",
|
||||
translations: {
|
||||
en: "Windows",
|
||||
ar: "Windows",
|
||||
"bs-BA": "Windows",
|
||||
"da-DK": "Windows",
|
||||
"de-DE": "Windows",
|
||||
"es-ES": "Windows",
|
||||
"fr-FR": "Windows",
|
||||
"it-IT": "Windows",
|
||||
"ja-JP": "Windows",
|
||||
"ko-KR": "Windows",
|
||||
"nb-NO": "Windows",
|
||||
"pl-PL": "Windows",
|
||||
"pt-BR": "Windows",
|
||||
"ru-RU": "Windows",
|
||||
"th-TH": "Windows",
|
||||
"tr-TR": "Windows",
|
||||
"zh-CN": "Windows",
|
||||
"zh-TW": "Windows",
|
||||
},
|
||||
link: "windows-wsl",
|
||||
},
|
||||
{
|
||||
label: "Usage",
|
||||
translations: {
|
||||
|
||||
@@ -2,7 +2,7 @@
|
||||
"name": "@opencode-ai/web",
|
||||
"type": "module",
|
||||
"license": "MIT",
|
||||
"version": "1.2.8",
|
||||
"version": "1.2.10",
|
||||
"scripts": {
|
||||
"dev": "astro dev",
|
||||
"dev:remote": "VITE_API_URL=https://api.opencode.ai astro dev",
|
||||
|
||||
@@ -79,6 +79,32 @@ This creates two tools: `math_add` and `math_multiply`.
|
||||
|
||||
---
|
||||
|
||||
#### Name collisions with built-in tools
|
||||
|
||||
Custom tools are keyed by tool name. If a custom tool uses the same name as a built-in tool, the custom tool takes precedence.
|
||||
|
||||
For example, this file replaces the built-in `bash` tool:
|
||||
|
||||
```ts title=".opencode/tools/bash.ts"
|
||||
import { tool } from "@opencode-ai/plugin"
|
||||
|
||||
export default tool({
|
||||
description: "Restricted bash wrapper",
|
||||
args: {
|
||||
command: tool.schema.string(),
|
||||
},
|
||||
async execute(args) {
|
||||
return `blocked: ${args.command}`
|
||||
},
|
||||
})
|
||||
```
|
||||
|
||||
:::note
|
||||
Prefer unique names unless you intentionally want to replace a built-in tool. If you want to disable a built in tool but not override it, use [permissions](/docs/permissions).
|
||||
:::
|
||||
|
||||
---
|
||||
|
||||
### Arguments
|
||||
|
||||
You can use `tool.schema`, which is just [Zod](https://zod.dev), to define argument types.
|
||||
|
||||
@@ -135,6 +135,8 @@ Per usare Amazon Bedrock con OpenCode:
|
||||
|
||||
2. **Configura l'autenticazione** usando uno dei seguenti metodi:
|
||||
|
||||
***
|
||||
|
||||
#### Variabili d'ambiente (Avvio rapido)
|
||||
|
||||
Imposta una di queste variabili d'ambiente mentre esegui opencode:
|
||||
@@ -157,6 +159,8 @@ Per usare Amazon Bedrock con OpenCode:
|
||||
export AWS_REGION=us-east-1
|
||||
```
|
||||
|
||||
***
|
||||
|
||||
#### File di configurazione (Consigliato)
|
||||
|
||||
Per configurazione specifica del progetto o persistente, usa `opencode.json`:
|
||||
@@ -184,6 +188,8 @@ Per usare Amazon Bedrock con OpenCode:
|
||||
Le opzioni del file di configurazione hanno la precedenza sulle variabili d'ambiente.
|
||||
:::
|
||||
|
||||
***
|
||||
|
||||
#### Avanzato: VPC Endpoints
|
||||
|
||||
Se stai usando VPC endpoints per Bedrock:
|
||||
@@ -207,12 +213,16 @@ Per usare Amazon Bedrock con OpenCode:
|
||||
L'opzione `endpoint` è un alias per l'opzione generica `baseURL`, usando terminologia specifica AWS. Se vengono specificati sia `endpoint` sia `baseURL`, `endpoint` ha la precedenza.
|
||||
:::
|
||||
|
||||
***
|
||||
|
||||
#### Metodi di autenticazione
|
||||
- **`AWS_ACCESS_KEY_ID` / `AWS_SECRET_ACCESS_KEY`**: Crea un utente IAM e genera chiavi di accesso nella Console AWS
|
||||
- **`AWS_PROFILE`**: Usa profili nominati da `~/.aws/credentials`. Configura prima con `aws configure --profile my-profile` o `aws sso login`
|
||||
- **`AWS_BEARER_TOKEN_BEDROCK`**: Genera chiavi API a lungo termine dalla console Amazon Bedrock
|
||||
- **`AWS_WEB_IDENTITY_TOKEN_FILE` / `AWS_ROLE_ARN`**: Per EKS IRSA (IAM Roles for Service Accounts) o altri ambienti Kubernetes con federazione OIDC. Queste variabili d'ambiente vengono iniettate automaticamente da Kubernetes quando usi le annotazioni del service account.
|
||||
|
||||
***
|
||||
|
||||
#### Precedenza autenticazione
|
||||
|
||||
Amazon Bedrock usa la seguente priorità di autenticazione:
|
||||
@@ -230,7 +240,8 @@ Per usare Amazon Bedrock con OpenCode:
|
||||
```
|
||||
|
||||
:::note
|
||||
Per profili di inferenza personalizzati, usa il nome del modello e del provider nella chiave e imposta la proprietà `id` all'arn. Questo assicura una cache corretta:
|
||||
Per profili di inferenza personalizzati, usa il nome del modello e del provider nella chiave e imposta la proprietà `id` all'arn. Questo assicura una cache corretta.
|
||||
:::
|
||||
|
||||
```json title="opencode.json"
|
||||
{
|
||||
@@ -248,8 +259,6 @@ Per profili di inferenza personalizzati, usa il nome del modello e del provider
|
||||
}
|
||||
```
|
||||
|
||||
:::
|
||||
|
||||
---
|
||||
|
||||
### Anthropic
|
||||
@@ -1161,6 +1170,8 @@ Per usare Kimi K2 di Moonshot AI:
|
||||
/models
|
||||
```
|
||||
|
||||
---
|
||||
|
||||
### MiniMax
|
||||
|
||||
1. Vai alla [MiniMax API Console](https://platform.minimax.io/login), crea un account e genera una chiave API.
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user