rm messages

shell configs like .zshrc don't get loaded without it

.github/workflows/publish.yml

@@ -41,6 +41,13 @@ jobs:
 
       - uses: ./.github/actions/setup-bun
 
+      - name: Setup git committer
+        id: committer
+        uses: ./.github/actions/setup-git-committer
+        with:
+          opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
+          opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
+
       - name: Install OpenCode
         if: inputs.bump || inputs.version
         run: bun i -g opencode-ai
@@ -49,14 +56,16 @@ jobs:
         run: |
           ./script/version.ts
         env:
-          GH_TOKEN: ${{ github.token }}
+          GH_TOKEN: ${{ steps.committer.outputs.token }}
           OPENCODE_BUMP: ${{ inputs.bump }}
           OPENCODE_VERSION: ${{ inputs.version }}
           OPENCODE_API_KEY: ${{ secrets.OPENCODE_API_KEY }}
+          GH_REPO: ${{ (github.ref_name == 'beta' && 'anomalyco/opencode-beta') || github.repository }}
     outputs:
       version: ${{ steps.version.outputs.version }}
       release: ${{ steps.version.outputs.release }}
       tag: ${{ steps.version.outputs.tag }}
+      repo: ${{ steps.version.outputs.repo }}
 
   build-cli:
     needs: version
@@ -69,6 +78,13 @@ jobs:
 
       - uses: ./.github/actions/setup-bun
 
+      - name: Setup git committer
+        id: committer
+        uses: ./.github/actions/setup-git-committer
+        with:
+          opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
+          opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
+
       - name: Build
         id: build
         run: |
@@ -76,7 +92,8 @@ jobs:
         env:
           OPENCODE_VERSION: ${{ needs.version.outputs.version }}
           OPENCODE_RELEASE: ${{ needs.version.outputs.release }}
-          GH_TOKEN: ${{ github.token }}
+          GH_REPO: ${{ needs.version.outputs.repo }}
+          GH_TOKEN: ${{ steps.committer.outputs.token }}
 
       - uses: actions/upload-artifact@v4
         with:
@@ -189,6 +206,13 @@ jobs:
         if: contains(matrix.settings.host, 'ubuntu')
         run: cargo tauri --version
 
+      - name: Setup git committer
+        id: committer
+        uses: ./.github/actions/setup-git-committer
+        with:
+          opencode-app-id: ${{ vars.OPENCODE_APP_ID }}
+          opencode-app-secret: ${{ secrets.OPENCODE_APP_SECRET }}
+
       - name: Build and upload artifacts
         uses: tauri-apps/tauri-action@390cbe447412ced1303d35abe75287949e43437a
         timeout-minutes: 60
@@ -196,14 +220,16 @@ jobs:
           projectPath: packages/desktop
           uploadWorkflowArtifacts: true
           tauriScript: ${{ (contains(matrix.settings.host, 'ubuntu') && 'cargo tauri') || '' }}
-          args: --target ${{ matrix.settings.target }} --config ./src-tauri/tauri.prod.conf.json --verbose
+          args: --target ${{ matrix.settings.target }} --config ${{ (github.ref_name == 'beta' && './src-tauri/tauri.beta.conf.json') || './src-tauri/tauri.prod.conf.json' }} --verbose
           updaterJsonPreferNsis: true
           releaseId: ${{ needs.version.outputs.release }}
           tagName: ${{ needs.version.outputs.tag }}
           releaseDraft: true
           releaseAssetNamePattern: opencode-desktop-[platform]-[arch][ext]
+          repo: ${{ (github.ref_name == 'beta' && 'opencode-beta') || '' }}
+          releaseCommitish: ${{ github.sha }}
         env:
-          GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+          GITHUB_TOKEN: ${{ steps.committer.outputs.token }}
           TAURI_BUNDLER_NEW_APPIMAGE_FORMAT: true
           TAURI_SIGNING_PRIVATE_KEY: ${{ secrets.TAURI_SIGNING_PRIVATE_KEY }}
           TAURI_SIGNING_PRIVATE_KEY_PASSWORD: ${{ secrets.TAURI_SIGNING_PRIVATE_KEY_PASSWORD }}
@@ -280,4 +306,5 @@ jobs:
           OPENCODE_RELEASE: ${{ needs.version.outputs.release }}
           AUR_KEY: ${{ secrets.AUR_KEY }}
           GITHUB_TOKEN: ${{ steps.committer.outputs.token }}
+          GH_REPO: ${{ needs.version.outputs.repo }}
           NPM_CONFIG_PROVENANCE: false

.gitignore

@@ -27,3 +27,4 @@ target
 opencode-dev
 logs/
 *.bun-build
+tsconfig.tsbuildinfo

.opencode/agent/translator.md

@@ -1,7 +1,7 @@
 ---
 description: Translate content for a specified locale while preserving technical terms
 mode: subagent
-model: opencode/gemini-3-pro
+model: opencode/gemini-3.1-pro
 ---
 
 You are a professional translator and localization specialist.

.opencode/tool/github-triage.ts

@@ -5,8 +5,16 @@ import DESCRIPTION from "./github-triage.txt"
 const TEAM = {
   desktop: ["adamdotdevin", "iamdavidhill", "Brendonovich", "nexxeln"],
   zen: ["fwang", "MrMushrooooom"],
-  tui: ["thdxr", "kommander", "rekram1-node"],
-  core: ["thdxr", "rekram1-node", "jlongster"],
+  tui: [
+    "thdxr",
+    "kommander",
+    // "rekram1-node" (on vacation)
+  ],
+  core: [
+    "thdxr",
+    // "rekram1-node", (on vacation)
+    "jlongster",
+  ],
   docs: ["R44VC0RP"],
   windows: ["Hona"],
 } as const
@@ -42,10 +50,7 @@ async function githubFetch(endpoint: string, options: RequestInit = {}) {
 export default tool({
   description: DESCRIPTION,
   args: {
-    assignee: tool.schema
-      .enum(ASSIGNEES as [string, ...string[]])
-      .describe("The username of the assignee")
-      .default("rekram1-node"),
+    assignee: tool.schema.enum(ASSIGNEES as [string, ...string[]]).describe("The username of the assignee"),
     labels: tool.schema
       .array(tool.schema.enum(["nix", "opentui", "perf", "web", "desktop", "zen", "docs", "windows", "core"]))
       .describe("The labels(s) to add to the issue")
@@ -68,7 +73,8 @@ export default tool({
       results.push("Dropped label: nix (issue does not mention nix)")
     }
 
-    const assignee = nix ? "rekram1-node" : web ? pick(TEAM.desktop) : args.assignee
+    // const assignee = nix ? "rekram1-node" : web ? pick(TEAM.desktop) : args.assignee
+    const assignee = web ? pick(TEAM.desktop) : args.assignee
 
     if (labels.includes("zen") && !zen) {
       throw new Error("Only add the zen label when issue title/body contains 'zen'")

.opencode/tool/github-triage.txt

@@ -4,3 +4,5 @@ Choose labels and assignee using the current triage policy and ownership rules.
 Pick the most fitting labels for the issue and assign one owner.
 
 If unsure, choose the team/section with the most overlap with the issue and assign a member from that team at random.
+
+(Note: rekram1-node is on vacation, do not assign issues to him.)

bun.lock

@@ -25,7 +25,7 @@
     },
     "packages/app": {
       "name": "@opencode-ai/app",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@kobalte/core": "catalog:",
         "@opencode-ai/sdk": "workspace:*",
@@ -75,7 +75,7 @@
     },
     "packages/console/app": {
       "name": "@opencode-ai/console-app",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@cloudflare/vite-plugin": "1.15.2",
         "@ibm/plex": "6.4.1",
@@ -109,7 +109,7 @@
     },
     "packages/console/core": {
       "name": "@opencode-ai/console-core",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@aws-sdk/client-sts": "3.782.0",
         "@jsx-email/render": "1.1.1",
@@ -136,7 +136,7 @@
     },
     "packages/console/function": {
       "name": "@opencode-ai/console-function",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@ai-sdk/anthropic": "2.0.0",
         "@ai-sdk/openai": "2.0.2",
@@ -160,7 +160,7 @@
     },
     "packages/console/mail": {
       "name": "@opencode-ai/console-mail",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@jsx-email/all": "2.2.3",
         "@jsx-email/cli": "1.4.3",
@@ -184,7 +184,7 @@
     },
     "packages/desktop": {
       "name": "@opencode-ai/desktop",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@opencode-ai/app": "workspace:*",
         "@opencode-ai/ui": "workspace:*",
@@ -217,7 +217,7 @@
     },
     "packages/enterprise": {
       "name": "@opencode-ai/enterprise",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@opencode-ai/ui": "workspace:*",
         "@opencode-ai/util": "workspace:*",
@@ -246,7 +246,7 @@
     },
     "packages/function": {
       "name": "@opencode-ai/function",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@octokit/auth-app": "8.0.1",
         "@octokit/rest": "catalog:",
@@ -262,7 +262,7 @@
     },
     "packages/opencode": {
       "name": "opencode",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "bin": {
         "opencode": "./bin/opencode",
       },
@@ -315,6 +315,7 @@
         "ai": "catalog:",
         "ai-gateway-provider": "2.3.1",
         "bonjour-service": "1.3.0",
+        "bun-pty": "0.4.8",
         "chokidar": "4.0.3",
         "clipboardy": "4.0.0",
         "decimal.js": "10.5.0",
@@ -330,7 +331,6 @@
         "jsonc-parser": "3.3.1",
         "mime-types": "3.0.2",
         "minimatch": "10.0.3",
-        "node-pty": "1.2.0-beta.11",
         "open": "10.1.2",
         "opentui-spinner": "0.0.6",
         "partial-json": "0.1.7",
@@ -376,7 +376,7 @@
     },
     "packages/plugin": {
       "name": "@opencode-ai/plugin",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@opencode-ai/sdk": "workspace:*",
         "zod": "catalog:",
@@ -396,7 +396,7 @@
     },
     "packages/sdk/js": {
       "name": "@opencode-ai/sdk",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "devDependencies": {
         "@hey-api/openapi-ts": "0.90.10",
         "@tsconfig/node22": "catalog:",
@@ -407,7 +407,7 @@
     },
     "packages/slack": {
       "name": "@opencode-ai/slack",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@opencode-ai/sdk": "workspace:*",
         "@slack/bolt": "^3.17.1",
@@ -420,7 +420,7 @@
     },
     "packages/ui": {
       "name": "@opencode-ai/ui",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@kobalte/core": "catalog:",
         "@opencode-ai/sdk": "workspace:*",
@@ -462,7 +462,7 @@
     },
     "packages/util": {
       "name": "@opencode-ai/util",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "zod": "catalog:",
       },
@@ -473,7 +473,7 @@
     },
     "packages/web": {
       "name": "@opencode-ai/web",
-      "version": "1.2.7",
+      "version": "1.2.10",
       "dependencies": {
         "@astrojs/cloudflare": "12.6.3",
         "@astrojs/markdown-remark": "6.3.1",
@@ -2222,6 +2222,8 @@
 
     "bun-ffi-structs": ["bun-ffi-structs@0.1.2", "", { "peerDependencies": { "typescript": "^5" } }, "sha512-Lh1oQAYHDcnesJauieA4UNkWGXY9hYck7OA5IaRwE3Bp6K2F2pJSNYqq+hIy7P3uOvo3km3oxS8304g5gDMl/w=="],
 
+    "bun-pty": ["bun-pty@0.4.8", "", {}, "sha512-rO70Mrbr13+jxHHHu2YBkk2pNqrJE5cJn29WE++PUr+GFA0hq/VgtQPZANJ8dJo6d7XImvBk37Innt8GM7O28w=="],
+
     "bun-types": ["bun-types@1.3.9", "", { "dependencies": { "@types/node": "*" } }, "sha512-+UBWWOakIP4Tswh0Bt0QD0alpTY8cb5hvgiYeWCMet9YukHbzuruIEeXC2D7nMJPB12kbh8C7XJykSexEqGKJg=="],
 
     "bun-webgpu": ["bun-webgpu@0.1.4", "", { "dependencies": { "@webgpu/types": "^0.1.60" }, "optionalDependencies": { "bun-webgpu-darwin-arm64": "^0.1.4", "bun-webgpu-darwin-x64": "^0.1.4", "bun-webgpu-linux-x64": "^0.1.4", "bun-webgpu-win32-x64": "^0.1.4" } }, "sha512-Kw+HoXl1PMWJTh9wvh63SSRofTA8vYBFCw0XEP1V1fFdQEDhI8Sgf73sdndE/oDpN/7CMx0Yv/q8FCvO39ROMQ=="],
@@ -3296,8 +3298,6 @@
 
     "node-mock-http": ["node-mock-http@1.0.4", "", {}, "sha512-8DY+kFsDkNXy1sJglUfuODx1/opAGJGyrTuFqEoN90oRc2Vk0ZbD4K2qmKXBBEhZQzdKHIVfEJpDU8Ak2NJEvQ=="],
 
-    "node-pty": ["node-pty@1.2.0-beta.11", "", { "dependencies": { "node-addon-api": "^7.1.0" } }, "sha512-THcUyu1WwdgoIyUvgXOZ70EOMXzheGa0q3tbEb5kUIfKgcpBJ+AJ9Q1kq0bKtYmQzr77usXiTORZTLmAUQlnoQ=="],
-
     "node-releases": ["node-releases@2.0.27", "", {}, "sha512-nmh3lCkYZ3grZvqcCH+fjmQ7X+H0OeZgP40OierEaAptX4XofMh5kwNbWh7lBduUzCcV/8kZ+NDLCwm2iorIlA=="],
 
     "nopt": ["nopt@7.2.1", "", { "dependencies": { "abbrev": "^2.0.0" }, "bin": { "nopt": "bin/nopt.js" } }, "sha512-taM24ViiimT/XntxbPyJQzCG+p4EKOpgD3mxFwW38mGjVUrfERQOeY4EDHjdnptttfHuHQXFx+lTP08Q+mLa/w=="],

github/action.yml

@@ -30,6 +30,10 @@ inputs:
     description: "Comma-separated list of trigger phrases (case-insensitive). Defaults to '/opencode,/oc'"
     required: false
 
+  variant:
+    description: "Model variant for provider-specific reasoning effort (e.g., high, max, minimal)"
+    required: false
+
   oidc_base_url:
     description: "Base URL for OIDC token exchange API. Only required when running a custom GitHub App install. Defaults to https://api.opencode.ai"
     required: false
@@ -71,4 +75,5 @@ runs:
         PROMPT: ${{ inputs.prompt }}
         USE_GITHUB_TOKEN: ${{ inputs.use_github_token }}
         MENTIONS: ${{ inputs.mentions }}
+        VARIANT: ${{ inputs.variant }}
         OIDC_BASE_URL: ${{ inputs.oidc_base_url }}

package.json

@@ -11,7 +11,8 @@
     "dev:web": "bun --cwd packages/app dev",
     "typecheck": "bun turbo typecheck",
     "prepare": "husky",
-    "postinstall": "bun packages/opencode/script/node-pty-helper.ts",
+    "random": "echo 'Random script'",
+    "hello": "echo 'Hello World!'",
     "test": "echo 'do not run tests from root' && exit 1"
   },
   "workspaces": {

packages/app/e2e/actions.ts

@@ -225,7 +225,7 @@ export async function hoverSessionItem(page: Page, sessionID: string) {
 export async function openSessionMoreMenu(page: Page, sessionID: string) {
   await expect(page).toHaveURL(new RegExp(`/session/${sessionID}(?:[/?#]|$)`))
 
-  const scroller = page.locator(".session-scroller").first()
+  const scroller = page.locator(".scroll-view__viewport").first()
   await expect(scroller).toBeVisible()
   await expect(scroller.getByRole("heading", { level: 1 }).first()).toBeVisible({ timeout: 30_000 })
 

packages/app/e2e/session/session.spec.ts

@@ -44,7 +44,7 @@ test("session can be renamed via header menu", async ({ page, sdk, gotoSession }
     const menu = await openSessionMoreMenu(page, session.id)
     await clickMenuItem(menu, /rename/i)
 
-    const input = page.locator(".session-scroller").locator(inlineInputSelector).first()
+    const input = page.locator(".scroll-view__viewport").locator(inlineInputSelector).first()
     await expect(input).toBeVisible()
     await expect(input).toBeFocused()
     await input.fill(renamedTitle)

packages/app/e2e/terminal/terminal-init.spec.ts

@@ -6,6 +6,7 @@ test("smoke terminal mounts and can create a second tab", async ({ page, gotoSes
   await gotoSession()
 
   const terminals = page.locator(terminalSelector)
+  const tabs = page.locator('#terminal-panel [data-slot="tabs-trigger"]')
   const opened = await terminals.first().isVisible()
 
   if (!opened) {
@@ -21,6 +22,7 @@ test("smoke terminal mounts and can create a second tab", async ({ page, gotoSes
   await page.locator(promptSelector).click()
   await page.keyboard.press("Control+Alt+T")
 
-  await expect(terminals).toHaveCount(2)
-  await expect(terminals.nth(1).locator("textarea")).toHaveCount(1)
+  await expect(tabs).toHaveCount(2)
+  await expect(terminals).toHaveCount(1)
+  await expect(terminals.first().locator("textarea")).toHaveCount(1)
 })

packages/app/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/app",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "description": "",
   "type": "module",
   "exports": {

packages/app/src/components/prompt-input.tsx

@@ -89,6 +89,8 @@ const EXAMPLES = [
   "prompt.example.25",
 ] as const
 
+const NON_EMPTY_TEXT = /[^\s\u200B]/
+
 export const PromptInput: Component<PromptInputProps> = (props) => {
   const sdk = useSDK()
   const sync = useSync()
@@ -636,7 +638,9 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
     let buffer = ""
 
     const flushText = () => {
-      const content = buffer.replace(/\r\n?/g, "\n").replace(/\u200B/g, "")
+      let content = buffer
+      if (content.includes("\r")) content = content.replace(/\r\n?/g, "\n")
+      if (content.includes("\u200B")) content = content.replace(/\u200B/g, "")
       buffer = ""
       if (!content) return
       parts.push({ type: "text", content, start: position, end: position + content.length })
@@ -714,10 +718,12 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
     const rawParts = parseFromDOM()
     const images = imageAttachments()
     const cursorPosition = getCursorPosition(editorRef)
-    const rawText = rawParts.map((p) => ("content" in p ? p.content : "")).join("")
-    const trimmed = rawText.replace(/\u200B/g, "").trim()
+    const rawText =
+      rawParts.length === 1 && rawParts[0]?.type === "text"
+        ? rawParts[0].content
+        : rawParts.map((p) => ("content" in p ? p.content : "")).join("")
     const hasNonText = rawParts.some((part) => part.type !== "text")
-    const shouldReset = trimmed.length === 0 && !hasNonText && images.length === 0
+    const shouldReset = !NON_EMPTY_TEXT.test(rawText) && !hasNonText && images.length === 0
 
     if (shouldReset) {
       closePopover()
@@ -757,19 +763,31 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
   }
 
   const addPart = (part: ContentPart) => {
-    const selection = window.getSelection()
-    if (!selection || selection.rangeCount === 0) return
+    if (part.type === "image") return false
 
-    const cursorPosition = getCursorPosition(editorRef)
-    const currentPrompt = prompt.current()
-    const rawText = currentPrompt.map((p) => ("content" in p ? p.content : "")).join("")
-    const textBeforeCursor = rawText.substring(0, cursorPosition)
-    const atMatch = textBeforeCursor.match(/@(\S*)$/)
+    const selection = window.getSelection()
+    if (!selection) return false
+
+    if (selection.rangeCount === 0 || !editorRef.contains(selection.anchorNode)) {
+      editorRef.focus()
+      const cursor = prompt.cursor() ?? promptLength(prompt.current())
+      setCursorPosition(editorRef, cursor)
+    }
+
+    if (selection.rangeCount === 0) return false
+    const range = selection.getRangeAt(0)
+    if (!editorRef.contains(range.startContainer)) return false
 
     if (part.type === "file" || part.type === "agent") {
+      const cursorPosition = getCursorPosition(editorRef)
+      const rawText = prompt
+        .current()
+        .map((p) => ("content" in p ? p.content : ""))
+        .join("")
+      const textBeforeCursor = rawText.substring(0, cursorPosition)
+      const atMatch = textBeforeCursor.match(/@(\S*)$/)
       const pill = createPill(part)
       const gap = document.createTextNode(" ")
-      const range = selection.getRangeAt(0)
 
       if (atMatch) {
         const start = atMatch.index ?? cursorPosition - atMatch[0].length
@@ -784,8 +802,9 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
       range.collapse(true)
       selection.removeAllRanges()
       selection.addRange(range)
-    } else if (part.type === "text") {
-      const range = selection.getRangeAt(0)
+    }
+
+    if (part.type === "text") {
       const fragment = createTextFragment(part.content)
       const last = fragment.lastChild
       range.deleteContents()
@@ -821,6 +840,7 @@ export const PromptInput: Component<PromptInputProps> = (props) => {
 
     handleInput()
     closePopover()
+    return true
   }
 
   const addToHistory = (prompt: Prompt, mode: "normal" | "shell") => {

packages/app/src/components/prompt-input/attachments.ts

@@ -7,6 +7,19 @@ import { getCursorPosition } from "./editor-dom"
 
 export const ACCEPTED_IMAGE_TYPES = ["image/png", "image/jpeg", "image/gif", "image/webp"]
 export const ACCEPTED_FILE_TYPES = [...ACCEPTED_IMAGE_TYPES, "application/pdf"]
+const LARGE_PASTE_CHARS = 8000
+const LARGE_PASTE_BREAKS = 120
+
+function largePaste(text: string) {
+  if (text.length >= LARGE_PASTE_CHARS) return true
+  let breaks = 0
+  for (const char of text) {
+    if (char !== "\n") continue
+    breaks += 1
+    if (breaks >= LARGE_PASTE_BREAKS) return true
+  }
+  return false
+}
 
 type PromptAttachmentsInput = {
   editor: () => HTMLDivElement | undefined
@@ -14,7 +27,7 @@ type PromptAttachmentsInput = {
   isDialogActive: () => boolean
   setDraggingType: (type: "image" | "@mention" | null) => void
   focusEditor: () => void
-  addPart: (part: ContentPart) => void
+  addPart: (part: ContentPart) => boolean
   readClipboardImage?: () => Promise<File | null>
 }
 
@@ -89,6 +102,13 @@ export function createPromptAttachments(input: PromptAttachmentsInput) {
     }
 
     if (!plainText) return
+
+    if (largePaste(plainText)) {
+      if (input.addPart({ type: "text", content: plainText, start: 0, end: 0 })) return
+      input.focusEditor()
+      if (input.addPart({ type: "text", content: plainText, start: 0, end: 0 })) return
+    }
+
     const inserted = typeof document.execCommand === "function" && document.execCommand("insertText", false, plainText)
     if (inserted) return
 

packages/app/src/components/prompt-input/editor-dom.test.ts

@@ -24,6 +24,28 @@ describe("prompt-input editor dom", () => {
     expect((container.childNodes[1] as HTMLElement).tagName).toBe("BR")
   })
 
+  test("createTextFragment avoids break-node explosion for large multiline content", () => {
+    const content = Array.from({ length: 220 }, () => "line").join("\n")
+    const fragment = createTextFragment(content)
+    const container = document.createElement("div")
+    container.appendChild(fragment)
+
+    expect(container.childNodes.length).toBe(1)
+    expect(container.childNodes[0]?.nodeType).toBe(Node.TEXT_NODE)
+    expect(container.textContent).toBe(content)
+  })
+
+  test("createTextFragment keeps terminal break in large multiline fallback", () => {
+    const content = `${Array.from({ length: 220 }, () => "line").join("\n")}\n`
+    const fragment = createTextFragment(content)
+    const container = document.createElement("div")
+    container.appendChild(fragment)
+
+    expect(container.childNodes.length).toBe(2)
+    expect(container.childNodes[0]?.textContent).toBe(content.slice(0, -1))
+    expect((container.childNodes[1] as HTMLElement).tagName).toBe("BR")
+  })
+
   test("length helpers treat breaks as one char and ignore zero-width chars", () => {
     const container = document.createElement("div")
     container.appendChild(document.createTextNode("ab\u200B"))

packages/app/src/components/prompt-input/editor-dom.ts

@@ -1,5 +1,20 @@
+const MAX_BREAKS = 200
+
 export function createTextFragment(content: string): DocumentFragment {
   const fragment = document.createDocumentFragment()
+  let breaks = 0
+  for (const char of content) {
+    if (char !== "\n") continue
+    breaks += 1
+    if (breaks > MAX_BREAKS) {
+      const tail = content.endsWith("\n")
+      const text = tail ? content.slice(0, -1) : content
+      if (text) fragment.appendChild(document.createTextNode(text))
+      if (tail) fragment.appendChild(document.createElement("br"))
+      return fragment
+    }
+  }
+
   const segments = content.split("\n")
   segments.forEach((segment, index) => {
     if (segment) {

packages/app/src/components/session/session-context-tab.tsx

@@ -11,6 +11,7 @@ import { Accordion } from "@opencode-ai/ui/accordion"
 import { StickyAccordionHeader } from "@opencode-ai/ui/sticky-accordion-header"
 import { Code } from "@opencode-ai/ui/code"
 import { Markdown } from "@opencode-ai/ui/markdown"
+import { ScrollView } from "@opencode-ai/ui/scroll-view"
 import type { Message, Part, UserMessage } from "@opencode-ai/sdk/v2/client"
 import { useLanguage } from "@/context/language"
 import { getSessionContextMetrics } from "./session-context-metrics"
@@ -268,9 +269,9 @@ export function SessionContextTab() {
   })
 
   return (
-    <div
-      class="@container h-full overflow-y-auto no-scrollbar pb-10"
-      ref={(el) => {
+    <ScrollView
+      class="@container h-full pb-10"
+      viewportRef={(el) => {
         scroll = el
         restoreScroll()
       }}
@@ -336,6 +337,6 @@ export function SessionContextTab() {
           </Accordion>
         </div>
       </div>
-    </div>
+    </ScrollView>
   )
 }

packages/app/src/components/settings-general.tsx

@@ -250,6 +250,18 @@ export const SettingsGeneral: Component = () => {
             )}
           </Select>
         </SettingsRow>
+
+        <SettingsRow
+          title={language.t("settings.general.row.reasoningSummaries.title")}
+          description={language.t("settings.general.row.reasoningSummaries.description")}
+        >
+          <div data-action="settings-reasoning-summaries">
+            <Switch
+              checked={settings.general.showReasoningSummaries()}
+              onChange={(checked) => settings.general.setShowReasoningSummaries(checked)}
+            />
+          </div>
+        </SettingsRow>
       </div>
     </div>
   )
@@ -418,7 +430,7 @@ export const SettingsGeneral: Component = () => {
 
   return (
     <div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
-      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
+      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
         <div class="flex flex-col gap-1 pt-6 pb-8">
           <h2 class="text-16-medium text-text-strong">{language.t("settings.tab.general")}</h2>
         </div>

packages/app/src/components/settings-keybinds.tsx

@@ -370,7 +370,7 @@ export const SettingsKeybinds: Component = () => {
 
   return (
     <div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
-      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
+      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
         <div class="flex flex-col gap-4 pt-6 pb-6 max-w-[720px]">
           <div class="flex items-center justify-between gap-4">
             <h2 class="text-16-medium text-text-strong">{language.t("settings.shortcuts.title")}</h2>

packages/app/src/components/settings-models.tsx

@@ -59,7 +59,7 @@ export const SettingsModels: Component = () => {
 
   return (
     <div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
-      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
+      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
         <div class="flex flex-col gap-4 pt-6 pb-6 max-w-[720px]">
           <h2 class="text-16-medium text-text-strong">{language.t("settings.models.title")}</h2>
           <div class="flex items-center gap-2 px-3 h-9 rounded-lg bg-surface-base">

packages/app/src/components/settings-permissions.tsx

@@ -177,7 +177,7 @@ export const SettingsPermissions: Component = () => {
 
   return (
     <div class="flex flex-col h-full overflow-y-auto no-scrollbar">
-      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
+      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
         <div class="flex flex-col gap-1 px-4 py-8 sm:p-8 max-w-[720px]">
           <h2 class="text-16-medium text-text-strong">{language.t("settings.permissions.title")}</h2>
           <p class="text-14-regular text-text-weak">{language.t("settings.permissions.description")}</p>

packages/app/src/components/settings-providers.tsx

@@ -132,7 +132,7 @@ export const SettingsProviders: Component = () => {
 
   return (
     <div class="flex flex-col h-full overflow-y-auto no-scrollbar px-4 pb-10 sm:px-10 sm:pb-10">
-      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-raised-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
+      <div class="sticky top-0 z-10 bg-[linear-gradient(to_bottom,var(--surface-stronger-non-alpha)_calc(100%_-_24px),transparent)]">
         <div class="flex flex-col gap-1 pt-6 pb-8 max-w-[720px]">
           <h2 class="text-16-medium text-text-strong">{language.t("settings.providers.title")}</h2>
         </div>

packages/app/src/components/terminal.tsx

@@ -15,40 +15,6 @@ import { terminalWriter } from "@/utils/terminal-writer"
 
 const TOGGLE_TERMINAL_ID = "terminal.toggle"
 const DEFAULT_TOGGLE_TERMINAL_KEYBIND = "ctrl+`"
-const FRAME_META = 0
-const FRAME_OUTPUT = 1
-const FRAME_INPUT = 2
-const encoder = new TextEncoder()
-
-const connection = () => {
-  if (typeof crypto !== "undefined" && typeof crypto.randomUUID === "function") {
-    return crypto.randomUUID()
-  }
-  return `${Date.now().toString(36)}-${Math.random().toString(36).slice(2, 10)}`
-}
-
-const frameInput = (id: string, data: string) => {
-  const channel = encoder.encode(id)
-  const body = encoder.encode(data)
-  const out = new Uint8Array(2 + channel.length + body.length)
-  out[0] = FRAME_INPUT
-  out[1] = channel.length
-  out.set(channel, 2)
-  out.set(body, 2 + channel.length)
-  return out
-}
-
-const frameOutput = (bytes: Uint8Array, decoder: TextDecoder) => {
-  if (bytes[0] !== FRAME_OUTPUT) return
-  const size = bytes[1]
-  if (!Number.isSafeInteger(size) || size < 0) return
-  if (bytes.length < 2 + size) return
-  return {
-    connection: decoder.decode(bytes.subarray(2, 2 + size)),
-    data: decoder.decode(bytes.subarray(2 + size)),
-  }
-}
-
 export interface TerminalProps extends ComponentProps<"div"> {
   pty: LocalPTY
   onSubmit?: () => void
@@ -430,10 +396,8 @@ export const Terminal = (props: TerminalProps) => {
         scheduleSize(size.cols, size.rows)
       })
       cleanups.push(() => disposeIfDisposable(onResize))
-      const connectionID = connection()
       const onData = t.onData((data) => {
-        if (ws?.readyState !== WebSocket.OPEN) return
-        ws.send(frameInput(connectionID, data))
+        if (ws?.readyState === WebSocket.OPEN) ws.send(data)
       })
       cleanups.push(() => disposeIfDisposable(onData))
       const onKey = t.onKey((key) => {
@@ -486,7 +450,6 @@ export const Terminal = (props: TerminalProps) => {
       const url = new URL(sdk.url + `/pty/${local.pty.id}/connect`)
       url.searchParams.set("directory", sdk.directory)
       url.searchParams.set("cursor", String(start !== undefined ? start : local.pty.buffer ? -1 : 0))
-      url.searchParams.set("connection", connectionID)
       url.protocol = url.protocol === "https:" ? "wss:" : "ws:"
       url.username = server.current?.http.username ?? ""
       url.password = server.current?.http.password ?? ""
@@ -508,33 +471,24 @@ export const Terminal = (props: TerminalProps) => {
         if (closing) return
         if (event.data instanceof ArrayBuffer) {
           const bytes = new Uint8Array(event.data)
-          if (bytes[0] === FRAME_META) {
-            const json = decoder.decode(bytes.subarray(1))
-            try {
-              const meta = JSON.parse(json) as { cursor?: unknown; connection?: unknown }
-              if (typeof meta?.connection === "string" && meta.connection !== connectionID) return
-              const next = meta?.cursor
-              if (typeof next === "number" && Number.isSafeInteger(next) && next >= 0) {
-                cursor = next
-              }
-            } catch (err) {
-              debugTerminal("invalid websocket control frame", err)
+          if (bytes[0] !== 0) return
+          const json = decoder.decode(bytes.subarray(1))
+          try {
+            const meta = JSON.parse(json) as { cursor?: unknown }
+            const next = meta?.cursor
+            if (typeof next === "number" && Number.isSafeInteger(next) && next >= 0) {
+              cursor = next
             }
-            return
+          } catch (err) {
+            debugTerminal("invalid websocket control frame", err)
           }
-
-          const frame = frameOutput(bytes, decoder)
-          if (!frame) return
-          if (frame.connection !== connectionID) return
-          if (!frame.data) return
-          output?.push(frame.data)
-          cursor += frame.data.length
           return
         }
 
-        if (typeof event.data === "string") {
-          debugTerminal("ignoring unframed websocket output")
-        }
+        const data = typeof event.data === "string" ? event.data : ""
+        if (!data) return
+        output?.push(data)
+        cursor += data.length
       }
       socket.addEventListener("message", handleMessage)
 
@@ -586,7 +540,7 @@ export const Terminal = (props: TerminalProps) => {
     disposed = true
     if (fitFrame !== undefined) cancelAnimationFrame(fitFrame)
     if (sizeTimer !== undefined) clearTimeout(sizeTimer)
-    if (ws && ws.readyState !== WebSocket.CLOSED && ws.readyState !== WebSocket.CLOSING) ws.close()
+    if (ws && ws.readyState !== WebSocket.CLOSED && ws.readyState !== WebSocket.CLOSING) ws.close(1000)
 
     const finalize = () => {
       persistTerminal({ term, addon: serializeAddon, cursor, pty: local.pty, onCleanup: props.onCleanup })

packages/app/src/context/settings.tsx

@@ -22,6 +22,7 @@ export interface Settings {
   general: {
     autoSave: boolean
     releaseNotes: boolean
+    showReasoningSummaries: boolean
   }
   updates: {
     startup: boolean
@@ -42,6 +43,7 @@ const defaultSettings: Settings = {
   general: {
     autoSave: true,
     releaseNotes: true,
+    showReasoningSummaries: false,
   },
   updates: {
     startup: true,
@@ -120,6 +122,13 @@ export const { use: useSettings, provider: SettingsProvider } = createSimpleCont
         setReleaseNotes(value: boolean) {
           setStore("general", "releaseNotes", value)
         },
+        showReasoningSummaries: withFallback(
+          () => store.general?.showReasoningSummaries,
+          defaultSettings.general.showReasoningSummaries,
+        ),
+        setShowReasoningSummaries(value: boolean) {
+          setStore("general", "showReasoningSummaries", value)
+        },
       },
       updates: {
         startup: withFallback(() => store.updates?.startup, defaultSettings.updates.startup),

packages/app/src/i18n/en.ts

@@ -610,6 +610,8 @@ export const dict = {
   "settings.general.row.theme.description": "Customise how OpenCode is themed.",
   "settings.general.row.font.title": "Font",
   "settings.general.row.font.description": "Customise the mono font used in code blocks",
+  "settings.general.row.reasoningSummaries.title": "Show reasoning summaries",
+  "settings.general.row.reasoningSummaries.description": "Display model reasoning summaries in the timeline",
 
   "settings.general.row.wayland.title": "Use native Wayland",
   "settings.general.row.wayland.description": "Disable X11 fallback on Wayland. Requires restart.",

packages/app/src/pages/session.tsx

@@ -943,15 +943,12 @@ export default function Page() {
       if (next === dockHeight) return
 
       const el = scroller
-      const stick = el ? el.scrollHeight - el.clientHeight - el.scrollTop < 10 : false
+      const delta = next - dockHeight
+      const stick = el ? el.scrollHeight - el.clientHeight - el.scrollTop < 10 + Math.max(0, delta) : false
 
       dockHeight = next
 
-      if (stick && el) {
-        requestAnimationFrame(() => {
-          el.scrollTo({ top: el.scrollHeight, behavior: "auto" })
-        })
-      }
+      if (stick) autoScroll.forceScrollToBottom()
 
       if (el) scheduleScrollState(el)
       scrollSpy.markDirty()

packages/app/src/pages/session/composer/session-question-dock.tsx

@@ -62,7 +62,7 @@ export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit
   const measure = () => {
     if (!root) return
 
-    const scroller = document.querySelector(".session-scroller")
+    const scroller = document.querySelector(".scroll-view__viewport")
     const head = scroller instanceof HTMLElement ? scroller.firstElementChild : undefined
     const top =
       head instanceof HTMLElement && head.classList.contains("sticky") ? head.getBoundingClientRect().bottom : 0
@@ -95,7 +95,7 @@ export const SessionQuestionDock: Component<{ request: QuestionRequest; onSubmit
     window.addEventListener("resize", update)
 
     const dock = root?.closest('[data-component="session-prompt-dock"]')
-    const scroller = document.querySelector(".session-scroller")
+    const scroller = document.querySelector(".scroll-view__viewport")
     const observer = new ResizeObserver(update)
     if (dock instanceof HTMLElement) observer.observe(dock)
     if (scroller instanceof HTMLElement) observer.observe(scroller)

packages/app/src/pages/session/file-tabs.tsx

@@ -9,6 +9,7 @@ import { showToast } from "@opencode-ai/ui/toast"
 import { LineComment as LineCommentView, LineCommentEditor } from "@opencode-ai/ui/line-comment"
 import { Mark } from "@opencode-ai/ui/logo"
 import { Tabs } from "@opencode-ai/ui/tabs"
+import { ScrollView } from "@opencode-ai/ui/scroll-view"
 import { useLayout } from "@/context/layout"
 import { selectionFromLines, useFile, type FileSelection, type SelectedLineRange } from "@/context/file"
 import { useComments } from "@/context/comments"
@@ -509,51 +510,52 @@ export function FileTabContent(props: { tab: string }) {
   )
 
   return (
-    <Tabs.Content
-      value={props.tab}
-      class="mt-3 relative"
-      ref={(el: HTMLDivElement) => {
-        scroll = el
-        restoreScroll()
-      }}
-      onScroll={handleScroll}
-    >
-      <Switch>
-        <Match when={state()?.loaded && isImage()}>
-          <div class="px-6 py-4 pb-40">
-            <img
-              src={imageDataUrl()}
-              alt={path()}
-              class="max-w-full"
-              onLoad={() => requestAnimationFrame(restoreScroll)}
-            />
-          </div>
-        </Match>
-        <Match when={state()?.loaded && isSvg()}>
-          <div class="flex flex-col gap-4 px-6 py-4">
-            {renderCode(svgContent() ?? "", "")}
-            <Show when={svgPreviewUrl()}>
-              <div class="flex justify-center pb-40">
-                <img src={svgPreviewUrl()} alt={path()} class="max-w-full max-h-96" />
-              </div>
-            </Show>
-          </div>
-        </Match>
-        <Match when={state()?.loaded && isBinary()}>
-          <div class="h-full px-6 pb-42 flex flex-col items-center justify-center text-center gap-6">
-            <Mark class="w-14 opacity-10" />
-            <div class="flex flex-col gap-2 max-w-md">
-              <div class="text-14-semibold text-text-strong truncate">{path()?.split("/").pop()}</div>
-              <div class="text-14-regular text-text-weak">{language.t("session.files.binaryContent")}</div>
+    <Tabs.Content value={props.tab} class="mt-3 relative h-full">
+      <ScrollView
+        class="h-full"
+        viewportRef={(el: HTMLDivElement) => {
+          scroll = el
+          restoreScroll()
+        }}
+        onScroll={handleScroll as any}
+      >
+        <Switch>
+          <Match when={state()?.loaded && isImage()}>
+            <div class="px-6 py-4 pb-40">
+              <img
+                src={imageDataUrl()}
+                alt={path()}
+                class="max-w-full"
+                onLoad={() => requestAnimationFrame(restoreScroll)}
+              />
             </div>
-          </div>
-        </Match>
-        <Match when={state()?.loaded}>{renderCode(contents(), "pb-40")}</Match>
-        <Match when={state()?.loading}>
-          <div class="px-6 py-4 text-text-weak">{language.t("common.loading")}...</div>
-        </Match>
-        <Match when={state()?.error}>{(err) => <div class="px-6 py-4 text-text-weak">{err()}</div>}</Match>
-      </Switch>
+          </Match>
+          <Match when={state()?.loaded && isSvg()}>
+            <div class="flex flex-col gap-4 px-6 py-4">
+              {renderCode(svgContent() ?? "", "")}
+              <Show when={svgPreviewUrl()}>
+                <div class="flex justify-center pb-40">
+                  <img src={svgPreviewUrl()} alt={path()} class="max-w-full max-h-96" />
+                </div>
+              </Show>
+            </div>
+          </Match>
+          <Match when={state()?.loaded && isBinary()}>
+            <div class="h-full px-6 pb-42 flex flex-col items-center justify-center text-center gap-6">
+              <Mark class="w-14 opacity-10" />
+              <div class="flex flex-col gap-2 max-w-md">
+                <div class="text-14-semibold text-text-strong truncate">{path()?.split("/").pop()}</div>
+                <div class="text-14-regular text-text-weak">{language.t("session.files.binaryContent")}</div>
+              </div>
+            </div>
+          </Match>
+          <Match when={state()?.loaded}>{renderCode(contents(), "pb-40")}</Match>
+          <Match when={state()?.loading}>
+            <div class="px-6 py-4 text-text-weak">{language.t("common.loading")}...</div>
+          </Match>
+          <Match when={state()?.error}>{(err) => <div class="px-6 py-4 text-text-weak">{err()}</div>}</Match>
+        </Switch>
+      </ScrollView>
     </Tabs.Content>
   )
 }

packages/app/src/pages/session/message-timeline.tsx

@@ -8,12 +8,14 @@ import { DropdownMenu } from "@opencode-ai/ui/dropdown-menu"
 import { Dialog } from "@opencode-ai/ui/dialog"
 import { InlineInput } from "@opencode-ai/ui/inline-input"
 import { SessionTurn } from "@opencode-ai/ui/session-turn"
+import { ScrollView } from "@opencode-ai/ui/scroll-view"
 import type { UserMessage } from "@opencode-ai/sdk/v2"
 import { showToast } from "@opencode-ai/ui/toast"
 import { shouldMarkBoundaryGesture, normalizeWheelDelta } from "@/pages/session/message-gesture"
 import { SessionContextUsage } from "@/components/session-context-usage"
 import { useDialog } from "@opencode-ai/ui/context/dialog"
 import { useLanguage } from "@/context/language"
+import { useSettings } from "@/context/settings"
 import { useSDK } from "@/context/sdk"
 import { useSync } from "@/context/sync"
 
@@ -80,6 +82,7 @@ export function MessageTimeline(props: {
   const navigate = useNavigate()
   const sdk = useSDK()
   const sync = useSync()
+  const settings = useSettings()
   const dialog = useDialog()
   const language = useLanguage()
 
@@ -320,8 +323,8 @@ export function MessageTimeline(props: {
             <Icon name="arrow-down-to-line" />
           </button>
         </div>
-        <div
-          ref={props.setScrollRef}
+        <ScrollView
+          viewportRef={props.setScrollRef}
           onWheel={(e) => {
             const root = e.currentTarget
             const delta = normalizeWheelDelta({
@@ -365,7 +368,7 @@ export function MessageTimeline(props: {
             if (props.isDesktop) props.onScrollSpyScroll()
           }}
           onClick={props.onAutoScrollInteraction}
-          class="relative min-w-0 w-full h-full overflow-y-auto session-scroller"
+          class="relative min-w-0 w-full h-full"
           style={{
             "--session-title-height": showHeader() ? "40px" : "0px",
             "--sticky-accordion-top": showHeader() ? "48px" : "0px",
@@ -535,6 +538,7 @@ export function MessageTimeline(props: {
                     sessionID={sessionID() ?? ""}
                     messageID={message.id}
                     lastUserMessageID={props.lastUserMessageID}
+                    showReasoningSummaries={settings.general.showReasoningSummaries()}
                     classes={{
                       root: "min-w-0 w-full relative",
                       content: "flex flex-col justify-between !overflow-visible",
@@ -545,7 +549,7 @@ export function MessageTimeline(props: {
               )}
             </For>
           </div>
-        </div>
+        </ScrollView>
       </div>
     </Show>
   )

packages/app/src/pages/session/review-tab.tsx

@@ -143,9 +143,9 @@ export function SessionReviewTab(props: SessionReviewTabProps) {
       open={props.view().review.open()}
       onOpenChange={props.view().review.setOpen}
       classes={{
-        root: props.classes?.root ?? "pb-6",
+        root: props.classes?.root ?? "pb-6 pr-3",
         header: props.classes?.header ?? "px-3",
-        container: props.classes?.container ?? "px-3",
+        container: props.classes?.container ?? "pl-3",
       }}
       diffs={props.diffs()}
       diffStyle={props.diffStyle}

packages/app/src/pages/session/terminal-panel.tsx

@@ -67,11 +67,11 @@ export function TerminalPanel() {
     on(
       () => terminal.active(),
       (activeId) => {
-        if (!activeId || !opened()) return
+        if (!activeId || !open()) return
         if (document.activeElement instanceof HTMLElement) {
           document.activeElement.blur()
         }
-        focusTerminalById(activeId)
+        setTimeout(() => focusTerminalById(activeId), 0)
       },
     ),
   )
@@ -209,21 +209,17 @@ export function TerminalPanel() {
                 </Tabs.List>
               </Tabs>
               <div class="flex-1 min-h-0 relative">
-                <For each={all()}>
-                  {(pty) => (
-                    <div
-                      id={`terminal-wrapper-${pty.id}`}
-                      class="absolute inset-0"
-                      style={{
-                        display: terminal.active() === pty.id ? "block" : "none",
-                      }}
-                    >
-                      <Show when={pty.id} keyed>
-                        <Terminal pty={pty} onCleanup={terminal.update} onConnectError={() => terminal.clone(pty.id)} />
-                      </Show>
-                    </div>
+                <Show when={terminal.active()} keyed>
+                  {(id) => (
+                    <Show when={byId().get(id)}>
+                      {(pty) => (
+                        <div id={`terminal-wrapper-${id}`} class="absolute inset-0">
+                          <Terminal pty={pty()} onCleanup={terminal.update} onConnectError={() => terminal.clone(id)} />
+                        </div>
+                      )}
+                    </Show>
                   )}
-                </For>
+                </Show>
               </div>
             </div>
             <DragOverlay>

packages/console/app/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/console-app",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "type": "module",
   "license": "MIT",
   "scripts": {

packages/console/app/src/routes/download/[channel]/[platform].ts

@@ -1,5 +1,5 @@
-import { APIEvent } from "@solidjs/start"
-import { DownloadPlatform } from "./types"
+import type { APIEvent } from "@solidjs/start"
+import type { DownloadPlatform } from "../types"
 
 const assetNames: Record<string, string> = {
   "darwin-aarch64-dmg": "opencode-desktop-darwin-aarch64.dmg",
@@ -17,17 +17,20 @@ const downloadNames: Record<string, string> = {
   "windows-x64-nsis": "OpenCode Desktop Installer.exe",
 } satisfies { [K in DownloadPlatform]?: string }
 
-export async function GET({ params: { platform } }: APIEvent) {
+export async function GET({ params: { platform, channel } }: APIEvent) {
   const assetName = assetNames[platform]
   if (!assetName) return new Response("Not Found", { status: 404 })
 
-  const resp = await fetch(`https://github.com/anomalyco/opencode/releases/latest/download/${assetName}`, {
-    cf: {
-      // in case gh releases has rate limits
-      cacheTtl: 60 * 5,
-      cacheEverything: true,
-    },
-  } as any)
+  const resp = await fetch(
+    `https://github.com/anomalyco/${channel === "stable" ? "opencode" : "opencode-beta"}/releases/latest/download/${assetName}`,
+    {
+      cf: {
+        // in case gh releases has rate limits
+        cacheTtl: 60 * 5,
+        cacheEverything: true,
+      },
+    } as any,
+  )
 
   const downloadName = downloadNames[platform]
 

packages/console/app/src/routes/download/index.tsx

@@ -1,18 +1,18 @@
 import "./index.css"
-import { Title, Meta } from "@solidjs/meta"
-import { A, createAsync, query } from "@solidjs/router"
-import { Header } from "~/component/header"
-import { Footer } from "~/component/footer"
-import { IconCopy, IconCheck } from "~/component/icon"
+import { Meta, Title } from "@solidjs/meta"
+import { A } from "@solidjs/router"
+import { createSignal, type JSX, onMount, Show } from "solid-js"
 import { Faq } from "~/component/faq"
-import desktopAppIcon from "../../asset/lander/opencode-desktop-icon.png"
+import { Footer } from "~/component/footer"
+import { Header } from "~/component/header"
+import { IconCheck, IconCopy } from "~/component/icon"
 import { Legal } from "~/component/legal"
+import { LocaleLinks } from "~/component/locale-links"
 import { config } from "~/config"
-import { createSignal, onMount, Show, JSX } from "solid-js"
-import { DownloadPlatform } from "./types"
 import { useI18n } from "~/context/i18n"
 import { useLanguage } from "~/context/language"
-import { LocaleLinks } from "~/component/locale-links"
+import desktopAppIcon from "../../asset/lander/opencode-desktop-icon.png"
+import type { DownloadPlatform } from "./types"
 
 type OS = "macOS" | "Windows" | "Linux" | null
 
@@ -40,8 +40,8 @@ function getDownloadPlatform(os: OS): DownloadPlatform {
   }
 }
 
-function getDownloadHref(platform: DownloadPlatform) {
-  return `/download/${platform}`
+function getDownloadHref(platform: DownloadPlatform, channel: "stable" | "beta" = "stable") {
+  return `/download/${channel}/${platform}`
 }
 
 function IconDownload(props: JSX.SvgSVGAttributes<SVGSVGElement>) {

packages/console/app/src/routes/zen/util/handler.ts

@@ -107,11 +107,14 @@ export async function handler(
       const startTimestamp = Date.now()
       const reqUrl = providerInfo.modifyUrl(providerInfo.api, isStream)
       const reqBody = JSON.stringify(
-        providerInfo.modifyBody({
-          ...createBodyConverter(opts.format, providerInfo.format)(body),
-          model: providerInfo.model,
-          ...(providerInfo.payloadModifier ?? {}),
-        }),
+        providerInfo.modifyBody(
+          {
+            ...createBodyConverter(opts.format, providerInfo.format)(body),
+            model: providerInfo.model,
+            ...(providerInfo.payloadModifier ?? {}),
+          },
+          authInfo?.workspaceID,
+        ),
       )
       logger.debug("REQUEST URL: " + reqUrl)
       logger.debug("REQUEST: " + reqBody.substring(0, 300) + "...")

packages/console/app/src/routes/zen/util/provider/openai.ts

@@ -18,9 +18,10 @@ export const openaiHelper: ProviderHelper = () => ({
   modifyHeaders: (headers: Headers, body: Record<string, any>, apiKey: string) => {
     headers.set("authorization", `Bearer ${apiKey}`)
   },
-  modifyBody: (body: Record<string, any>) => {
-    return body
-  },
+  modifyBody: (body: Record<string, any>, workspaceID?: string) => ({
+    ...body,
+    ...(workspaceID ? { safety_identifier: workspaceID } : {}),
+  }),
   createBinaryStreamDecoder: () => undefined,
   streamSeparator: "\n\n",
   createUsageParser: () => {

packages/console/app/src/routes/zen/util/provider/provider.ts

@@ -37,7 +37,7 @@ export type ProviderHelper = (input: { reqModel: string; providerModel: string }
   format: ZenData.Format
   modifyUrl: (providerApi: string, isStream?: boolean) => string
   modifyHeaders: (headers: Headers, body: Record<string, any>, apiKey: string) => void
-  modifyBody: (body: Record<string, any>) => Record<string, any>
+  modifyBody: (body: Record<string, any>, workspaceID?: string) => Record<string, any>
   createBinaryStreamDecoder: () => ((chunk: Uint8Array) => Uint8Array | undefined) | undefined
   streamSeparator: string
   createUsageParser: () => {

packages/console/core/package.json

@@ -1,7 +1,7 @@
 {
   "$schema": "https://json.schemastore.org/package.json",
   "name": "@opencode-ai/console-core",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "private": true,
   "type": "module",
   "license": "MIT",

packages/console/function/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/console-function",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "$schema": "https://json.schemastore.org/package.json",
   "private": true,
   "type": "module",

packages/console/mail/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/console-mail",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "dependencies": {
     "@jsx-email/all": "2.2.3",
     "@jsx-email/cli": "1.4.3",

packages/desktop/package.json

@@ -1,7 +1,7 @@
 {
   "name": "@opencode-ai/desktop",
   "private": true,
-  "version": "1.2.7",
+  "version": "1.2.10",
   "type": "module",
   "license": "MIT",
   "scripts": {

packages/desktop/src-tauri/src/cli.rs

@@ -320,7 +320,7 @@ pub fn spawn_command(
         };
 
         let mut cmd = Command::new(shell);
-        cmd.args(["-l", "-c", &line]);
+        cmd.args(["-il", "-c", &line]);
 
         for (key, value) in envs {
             cmd.env(key, value);

packages/desktop/src-tauri/src/lib.rs

@@ -40,7 +40,9 @@ use crate::windows::{LoadingWindow, MainWindow};
 #[derive(Clone, serde::Serialize, specta::Type, Debug)]
 struct ServerReadyData {
     url: String,
+    username: Option<String>,
     password: Option<String>,
+    is_sidecar: bool
 }
 
 #[derive(Clone, Copy, serde::Serialize, specta::Type, Debug)]
@@ -605,6 +607,7 @@ async fn initialize(app: AppHandle) {
                     child,
                     health_check,
                     url,
+                    username,
                     password,
                 } => {
                     let app = app.clone();
@@ -631,7 +634,7 @@ async fn initialize(app: AppHandle) {
 
                             app.state::<ServerState>().set_child(Some(child));
 
-                            Ok(ServerReadyData { url, password })
+                            Ok(ServerReadyData { url, username,password, is_sidecar: true })
                         }
                         .map(move |res| {
                             let _ = server_ready_tx.send(res);
@@ -641,7 +644,9 @@ async fn initialize(app: AppHandle) {
                 ServerConnection::Existing { url } => {
                     let _ = server_ready_tx.send(Ok(ServerReadyData {
                         url: url.to_string(),
+                        username: None,
                         password: None,
+                        is_sidecar: false,
                     }));
                     None
                 }
@@ -719,6 +724,7 @@ enum ServerConnection {
     },
     CLI {
         url: String,
+        username: Option<String>,
         password: Option<String>,
         child: CommandChild,
         health_check: server::HealthCheck,
@@ -730,11 +736,15 @@ async fn setup_server_connection(app: AppHandle) -> ServerConnection {
 
     tracing::info!(?custom_url, "Attempting server connection");
 
-    if let Some(url) = custom_url
-        && server::check_health_or_ask_retry(&app, &url).await
+    if let Some(url) = &custom_url
+        && server::check_health_or_ask_retry(&app, url).await
     {
         tracing::info!(%url, "Connected to custom server");
-        return ServerConnection::Existing { url: url.clone() };
+        // If the default server is already local, no need to also spawn a sidecar
+        if server::is_localhost_url(url) {
+            return ServerConnection::Existing { url: url.clone() };
+        }
+        // Remote default server: fall through and also spawn a local sidecar
     }
 
     let local_port = get_sidecar_port();
@@ -755,6 +765,7 @@ async fn setup_server_connection(app: AppHandle) -> ServerConnection {
 
     ServerConnection::CLI {
         url: local_url,
+        username: Some("opencode".to_string()),
         password: Some(password),
         child,
         health_check,

packages/desktop/src-tauri/src/server.rs

@@ -150,7 +150,7 @@ pub async fn check_health(url: &str, password: Option<&str>) -> bool {
         return false;
     };
 
-    let mut builder = reqwest::Client::builder().timeout(Duration::from_secs(3));
+    let mut builder = reqwest::Client::builder().timeout(Duration::from_secs(7));
 
     if url_is_localhost(&url) {
         // Some environments set proxy variables (HTTP_PROXY/HTTPS_PROXY/ALL_PROXY) without
@@ -178,6 +178,10 @@ pub async fn check_health(url: &str, password: Option<&str>) -> bool {
         .unwrap_or(false)
 }
 
+pub fn is_localhost_url(url: &str) -> bool {
+    reqwest::Url::parse(url).is_ok_and(|u| url_is_localhost(&u))
+}
+
 fn url_is_localhost(url: &reqwest::Url) -> bool {
     url.host_str().is_some_and(|host| {
         host.eq_ignore_ascii_case("localhost")

packages/desktop/src-tauri/tauri.beta.conf.json

@@ -0,0 +1,21 @@
+{
+  "$schema": "https://schema.tauri.app/config/2",
+  "productName": "OpenCode Beta",
+  "identifier": "ai.opencode.desktop.beta",
+  "bundle": {
+    "createUpdaterArtifacts": true,
+    "linux": {
+      "rpm": {
+        "compression": {
+          "type": "none"
+        }
+      }
+    }
+  },
+  "plugins": {
+    "updater": {
+      "pubkey": "dW50cnVzdGVkIGNvbW1lbnQ6IG1pbmlzaWduIHB1YmxpYyBrZXk6IEYwMDM5Nzg5OUMzOUExMDQKUldRRW9UbWNpWmNEOENYT01CV0lhOXR1UFhpaXJsK1Z3aU9lZnNtNzE0TDROWVMwVW9XQnFOelkK",
+      "endpoints": ["https://github.com/anomalyco/opencode-beta/releases/latest/download/latest.json"]
+    }
+  }
+}

packages/desktop/src/bindings.ts

@@ -35,7 +35,9 @@ export type LoadingWindowComplete = null;
 
 export type ServerReadyData = {
 		url: string,
+		username: string | null,
 		password: string | null,
+		is_sidecar: boolean,
 	};
 
 export type SqliteMigrationProgress = { type: "InProgress"; value: number } | { type: "Done" };

packages/desktop/src/index.tsx

@@ -23,7 +23,7 @@ import { relaunch } from "@tauri-apps/plugin-process"
 import { open as shellOpen } from "@tauri-apps/plugin-shell"
 import { Store } from "@tauri-apps/plugin-store"
 import { check, type Update } from "@tauri-apps/plugin-updater"
-import { type Accessor, createResource, type JSX, onCleanup, onMount, Show } from "solid-js"
+import { createResource, type JSX, onCleanup, onMount, Show } from "solid-js"
 import { render } from "solid-js/web"
 import pkg from "../package.json"
 import { initI18n, t } from "./i18n"
@@ -31,7 +31,7 @@ import { UPDATER_ENABLED } from "./updater"
 import { webviewZoom } from "./webview-zoom"
 import "./styles.css"
 import { Channel } from "@tauri-apps/api/core"
-import { commands, type InitStep } from "./bindings"
+import { commands, ServerReadyData, type InitStep } from "./bindings"
 import { createMenu } from "./menu"
 
 const root = document.getElementById("root")
@@ -452,16 +452,19 @@ render(() => {
       <AppBaseProviders>
         <ServerGate>
           {(data) => {
-            const server: ServerConnection.Sidecar = {
-              displayName: "Local Server",
-              type: "sidecar",
-              variant: "base",
-              http: {
-                url: data().url,
-                username: "opencode",
-                password: data().password ?? undefined,
-              },
+            const http = {
+              url: data.url,
+              username: data.username ?? undefined,
+              password: data.password ?? undefined,
             }
+            const server: ServerConnection.Any = data.is_sidecar
+              ? {
+                  displayName: "Local Server",
+                  type: "sidecar",
+                  variant: "base",
+                  http,
+                }
+              : { type: "http", http }
 
             function Inner() {
               const cmd = useCommand()
@@ -485,39 +488,22 @@ render(() => {
   )
 }, root!)
 
-type ServerReadyData = { url: string; password: string | null }
-
 // Gate component that waits for the server to be ready
-function ServerGate(props: { children: (data: Accessor<ServerReadyData>) => JSX.Element }) {
+function ServerGate(props: { children: (data: ServerReadyData) => JSX.Element }) {
   const [serverData] = createResource(() => commands.awaitInitialization(new Channel<InitStep>() as any))
+  if (serverData.state === "errored") throw serverData.error
 
   return (
     <Show
-      when={serverData.state !== "errored"}
+      when={serverData.state !== "pending" && serverData()}
       fallback={
-        <div class="h-screen w-screen flex flex-col items-center justify-center bg-background-base gap-4">
-          <Splash class="w-16 h-20 opacity-50" />
-          <div class="max-w-md px-4 text-center">
-            <p class="text-sm font-medium text-red-400">Failed to start server</p>
-            <p class="mt-2 text-xs text-zinc-400 break-words whitespace-pre-wrap">
-              {String(serverData.error ?? "Unknown error")}
-            </p>
-          </div>
+        <div class="h-screen w-screen flex flex-col items-center justify-center bg-background-base">
+          <Splash class="w-16 h-20 opacity-50 animate-pulse" />
           <div data-tauri-decorum-tb class="flex flex-row absolute top-0 right-0 z-10 h-10" />
         </div>
       }
     >
-      <Show
-        when={serverData.state !== "pending" && serverData()}
-        fallback={
-          <div class="h-screen w-screen flex flex-col items-center justify-center bg-background-base">
-            <Splash class="w-16 h-20 opacity-50 animate-pulse" />
-            <div data-tauri-decorum-tb class="flex flex-row absolute top-0 right-0 z-10 h-10" />
-          </div>
-        }
-      >
-        {(data) => props.children(data)}
-      </Show>
+      {(data) => props.children(data())}
     </Show>
   )
 }

packages/enterprise/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/enterprise",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "private": true,
   "type": "module",
   "license": "MIT",

packages/extensions/zed/extension.toml

@@ -1,7 +1,7 @@
 id = "opencode"
 name = "OpenCode"
 description = "The open source coding agent."
-version = "1.2.7"
+version = "1.2.10"
 schema_version = 1
 authors = ["Anomaly"]
 repository = "https://github.com/anomalyco/opencode"
@@ -11,26 +11,26 @@ name = "OpenCode"
 icon = "./icons/opencode.svg"
 
 [agent_servers.opencode.targets.darwin-aarch64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.7/opencode-darwin-arm64.zip"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-darwin-arm64.zip"
 cmd = "./opencode"
 args = ["acp"]
 
 [agent_servers.opencode.targets.darwin-x86_64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.7/opencode-darwin-x64.zip"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-darwin-x64.zip"
 cmd = "./opencode"
 args = ["acp"]
 
 [agent_servers.opencode.targets.linux-aarch64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.7/opencode-linux-arm64.tar.gz"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-linux-arm64.tar.gz"
 cmd = "./opencode"
 args = ["acp"]
 
 [agent_servers.opencode.targets.linux-x86_64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.7/opencode-linux-x64.tar.gz"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-linux-x64.tar.gz"
 cmd = "./opencode"
 args = ["acp"]
 
 [agent_servers.opencode.targets.windows-x86_64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.7/opencode-windows-x64.zip"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.10/opencode-windows-x64.zip"
 cmd = "./opencode.exe"
 args = ["acp"]

packages/function/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/function",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "$schema": "https://json.schemastore.org/package.json",
   "private": true,
   "type": "module",

packages/opencode/bin/opencode

@@ -25,6 +25,12 @@ if (envPath) {
 const scriptPath = fs.realpathSync(__filename)
 const scriptDir = path.dirname(scriptPath)
 
+//
+const cached = path.join(scriptDir, ".opencode")
+if (fs.existsSync(cached)) {
+  run(cached)
+}
+
 const platformMap = {
   darwin: "darwin",
   linux: "linux",

packages/opencode/package.json

@@ -1,6 +1,6 @@
 {
   "$schema": "https://json.schemastore.org/package.json",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "name": "opencode",
   "type": "module",
   "license": "MIT",
@@ -100,7 +100,7 @@
     "ai": "catalog:",
     "ai-gateway-provider": "2.3.1",
     "bonjour-service": "1.3.0",
-    "node-pty": "1.2.0-beta.11",
+    "bun-pty": "0.4.8",
     "chokidar": "4.0.3",
     "clipboardy": "4.0.0",
     "decimal.js": "10.5.0",

packages/opencode/script/build.ts

@@ -1,10 +1,10 @@
 #!/usr/bin/env bun
 
-import solidPlugin from "../node_modules/@opentui/solid/scripts/solid-plugin"
-import path from "path"
-import fs from "fs"
 import { $ } from "bun"
+import fs from "fs"
+import path from "path"
 import { fileURLToPath } from "url"
+import solidPlugin from "../node_modules/@opentui/solid/scripts/solid-plugin"
 
 const __filename = fileURLToPath(import.meta.url)
 const __dirname = path.dirname(__filename)
@@ -12,8 +12,9 @@ const dir = path.resolve(__dirname, "..")
 
 process.chdir(dir)
 
-import pkg from "../package.json"
 import { Script } from "@opencode-ai/script"
+import pkg from "../package.json"
+
 const modelsUrl = process.env.OPENCODE_MODELS_URL || "https://models.dev"
 // Fetch and generate models.dev snapshot
 const modelsData = process.env.MODELS_DEV_API_JSON
@@ -26,7 +27,11 @@ await Bun.write(
 console.log("Generated models-snapshot.ts")
 
 // Load migrations from migration directories
-const migrationDirs = (await fs.promises.readdir(path.join(dir, "migration"), { withFileTypes: true }))
+const migrationDirs = (
+  await fs.promises.readdir(path.join(dir, "migration"), {
+    withFileTypes: true,
+  })
+)
   .filter((entry) => entry.isDirectory() && /^\d{4}\d{2}\d{2}\d{2}\d{2}\d{2}/.test(entry.name))
   .map((entry) => entry.name)
   .sort()
@@ -142,8 +147,6 @@ if (!skipInstall) {
   await $`bun install --os="*" --cpu="*" @opentui/core@${pkg.dependencies["@opentui/core"]}`
   await $`bun install --os="*" --cpu="*" @parcel/watcher@${pkg.dependencies["@parcel/watcher"]}`
 }
-await $`bun script/node-pty-helper.ts`
-
 for (const item of targets) {
   const name = [
     pkg.name,
@@ -173,7 +176,6 @@ for (const item of targets) {
     compile: {
       autoloadBunfig: false,
       autoloadDotenv: false,
-      //@ts-ignore (bun types aren't up to date)
       autoloadTsconfig: true,
       autoloadPackageJson: true,
       target: name.replace(pkg.name, "bun") as any,
@@ -216,7 +218,7 @@ if (Script.release) {
       await $`zip -r ../../${key}.zip *`.cwd(`dist/${key}/bin`)
     }
   }
-  await $`gh release upload v${Script.version} ./dist/*.zip ./dist/*.tar.gz --clobber`
+  await $`gh release upload v${Script.version} ./dist/*.zip ./dist/*.tar.gz --clobber --repo ${process.env.GH_REPO}`
 }
 
 export { binaries }

packages/opencode/script/node-pty-helper.ts

@@ -1,45 +0,0 @@
-#!/usr/bin/env bun
-
-import fs from "node:fs"
-import path from "node:path"
-import { createRequire } from "node:module"
-
-const req = createRequire(import.meta.url)
-
-const resolve = () => {
-  try {
-    return path.dirname(req.resolve("node-pty/package.json"))
-  } catch {
-    return
-  }
-}
-
-export const fixNodePtyHelper = () => {
-  const root = resolve()
-  if (!root) return []
-
-  const files = [
-    path.join(root, "prebuilds", "darwin-arm64", "spawn-helper"),
-    path.join(root, "prebuilds", "darwin-x64", "spawn-helper"),
-    path.join(root, "build", "Release", "spawn-helper"),
-    path.join(root, "build", "Debug", "spawn-helper"),
-  ]
-
-  return files.flatMap((file) => {
-    if (!fs.existsSync(file)) return []
-    const mode = fs.statSync(file).mode
-    const next = mode | 0o111
-    if (mode === next) return []
-    fs.chmodSync(file, next)
-    return [file]
-  })
-}
-
-if (import.meta.main) {
-  const changed = fixNodePtyHelper()
-  if (!changed.length) process.exit(0)
-  console.log(`updated node-pty spawn-helper permissions (${changed.length})`)
-  for (const file of changed) {
-    console.log(`- ${file}`)
-  }
-}

packages/opencode/script/postinstall.mjs

@@ -109,8 +109,14 @@ async function main() {
     // On non-Windows platforms, just verify the binary package exists
     // Don't replace the wrapper script - it handles binary execution
     const { binaryPath } = findBinary()
-    console.log(`Platform binary verified at: ${binaryPath}`)
-    console.log("Wrapper script will handle binary execution")
+    const target = path.join(__dirname, "bin", ".opencode")
+    if (fs.existsSync(target)) fs.unlinkSync(target)
+    try {
+      fs.linkSync(binaryPath, target)
+    } catch {
+      fs.copyFileSync(binaryPath, target)
+    }
+    fs.chmodSync(target, 0o755)
   } catch (error) {
     console.error("Failed to setup opencode binary:", error.message)
     process.exit(1)

packages/opencode/src/cli/cmd/github.ts

@@ -450,6 +450,7 @@ export const GithubRunCommand = cmd({
       const isWorkflowDispatchEvent = context.eventName === "workflow_dispatch"
 
       const { providerID, modelID } = normalizeModel()
+      const variant = process.env["VARIANT"] || undefined
       const runId = normalizeRunId()
       const share = normalizeShare()
       const oidcBaseUrl = normalizeOidcBaseUrl()
@@ -912,6 +913,7 @@ export const GithubRunCommand = cmd({
         const result = await SessionPrompt.prompt({
           sessionID: session.id,
           messageID: Identifier.ascending("message"),
+          variant,
           model: {
             providerID,
             modelID,
@@ -965,6 +967,7 @@ export const GithubRunCommand = cmd({
         const summary = await SessionPrompt.prompt({
           sessionID: session.id,
           messageID: Identifier.ascending("message"),
+          variant,
           model: {
             providerID,
             modelID,

packages/opencode/src/cli/cmd/tui/component/prompt/history.tsx

@@ -2,8 +2,7 @@ import path from "path"
 import { Global } from "@/global"
 import { Filesystem } from "@/util/filesystem"
 import { onMount } from "solid-js"
-import { createStore, produce } from "solid-js/store"
-import { clone } from "remeda"
+import { createStore, produce, unwrap } from "solid-js/store"
 import { createSimpleContext } from "../../context/helper"
 import { appendFile, writeFile } from "fs/promises"
 import type { AgentPart, FilePart, TextPart } from "@opencode-ai/sdk/v2"
@@ -83,7 +82,7 @@ export const { use: usePromptHistory, provider: PromptHistoryProvider } = create
         return store.history.at(store.index)
       },
       append(item: PromptInfo) {
-        const entry = clone(item)
+        const entry = structuredClone(unwrap(item))
         let trimmed = false
         setStore(
           produce((draft) => {

packages/opencode/src/cli/cmd/tui/component/prompt/stash.tsx

@@ -2,8 +2,7 @@ import path from "path"
 import { Global } from "@/global"
 import { Filesystem } from "@/util/filesystem"
 import { onMount } from "solid-js"
-import { createStore, produce } from "solid-js/store"
-import { clone } from "remeda"
+import { createStore, produce, unwrap } from "solid-js/store"
 import { createSimpleContext } from "../../context/helper"
 import { appendFile, writeFile } from "fs/promises"
 import type { PromptInfo } from "./history"
@@ -53,7 +52,7 @@ export const { use: usePromptStash, provider: PromptStashProvider } = createSimp
         return store.entries
       },
       push(entry: Omit<StashEntry, "timestamp">) {
-        const stash = clone({ ...entry, timestamp: Date.now() })
+        const stash = structuredClone(unwrap({ ...entry, timestamp: Date.now() }))
         let trimmed = false
         setStore(
           produce((draft) => {

packages/opencode/src/config/config.ts

@@ -292,7 +292,9 @@ export namespace Config {
         ...(proxied() ? ["--no-cache"] : []),
       ],
       { cwd: dir },
-    ).catch(() => {})
+    ).catch((err) => {
+      log.warn("failed to install dependencies", { dir, error: err })
+    })
   }
 
   async function isWritable(dir: string) {

packages/opencode/src/plugin/index.ts

@@ -41,8 +41,10 @@ export namespace Plugin {
 
     for (const plugin of INTERNAL_PLUGINS) {
       log.info("loading internal plugin", { name: plugin.name })
-      const init = await plugin(input)
-      hooks.push(init)
+      const init = await plugin(input).catch((err) => {
+        log.error("failed to load internal plugin", { name: plugin.name, error: err })
+      })
+      if (init) hooks.push(init)
     }
 
     let plugins = config.plugin ?? []
@@ -59,37 +61,40 @@ export namespace Plugin {
         const lastAtIndex = plugin.lastIndexOf("@")
         const pkg = lastAtIndex > 0 ? plugin.substring(0, lastAtIndex) : plugin
         const version = lastAtIndex > 0 ? plugin.substring(lastAtIndex + 1) : "latest"
-        const builtin = BUILTIN.some((x) => x.startsWith(pkg + "@"))
         plugin = await BunProc.install(pkg, version).catch((err) => {
-          if (!builtin) throw err
-
-          const message = err instanceof Error ? err.message : String(err)
-          log.error("failed to install builtin plugin", {
-            pkg,
-            version,
-            error: message,
-          })
+          const cause = err instanceof Error ? err.cause : err
+          const detail = cause instanceof Error ? cause.message : String(cause ?? err)
+          log.error("failed to install plugin", { pkg, version, error: detail })
           Bus.publish(Session.Event.Error, {
             error: new NamedError.Unknown({
-              message: `Failed to install built-in plugin ${pkg}@${version}: ${message}`,
+              message: `Failed to install plugin ${pkg}@${version}: ${detail}`,
             }).toObject(),
           })
-
           return ""
         })
         if (!plugin) continue
       }
-      const mod = await import(plugin)
       // Prevent duplicate initialization when plugins export the same function
       // as both a named export and default export (e.g., `export const X` and `export default X`).
       // Object.entries(mod) would return both entries pointing to the same function reference.
-      const seen = new Set<PluginInstance>()
-      for (const [_name, fn] of Object.entries<PluginInstance>(mod)) {
-        if (seen.has(fn)) continue
-        seen.add(fn)
-        const init = await fn(input)
-        hooks.push(init)
-      }
+      await import(plugin)
+        .then(async (mod) => {
+          const seen = new Set<PluginInstance>()
+          for (const [_name, fn] of Object.entries<PluginInstance>(mod)) {
+            if (seen.has(fn)) continue
+            seen.add(fn)
+            hooks.push(await fn(input))
+          }
+        })
+        .catch((err) => {
+          const message = err instanceof Error ? err.message : String(err)
+          log.error("failed to load plugin", { path: plugin, error: message })
+          Bus.publish(Session.Event.Error, {
+            error: new NamedError.Unknown({
+              message: `Failed to load plugin ${plugin}: ${message}`,
+            }).toObject(),
+          })
+        })
     }
 
     return {

packages/opencode/src/provider/models.ts

@@ -65,7 +65,13 @@ export namespace ModelsDev {
     status: z.enum(["alpha", "beta", "deprecated"]).optional(),
     options: z.record(z.string(), z.any()),
     headers: z.record(z.string(), z.string()).optional(),
-    provider: z.object({ npm: z.string().optional(), api: z.string().optional() }).optional(),
+    provider: z
+      .object({
+        npm: z.string().optional(),
+        api: z.string().optional(),
+        shape: z.enum(["responses", "completions"]).optional(),
+      })
+      .optional(),
     variants: z.record(z.string(), z.record(z.string(), z.any())).optional(),
   })
   export type Model = z.infer<typeof Model>

packages/opencode/src/provider/provider.ts

@@ -109,7 +109,7 @@ export namespace Provider {
     "@ai-sdk/github-copilot": createGitHubCopilotOpenAICompatible,
   }
 
-  type CustomModelLoader = (sdk: any, modelID: string, options?: Record<string, any>) => Promise<any>
+  type CustomModelLoader = (sdk: any, model: Model, options?: Record<string, any>) => Promise<any>
   type CustomLoader = (provider: Info) => Promise<{
     autoload: boolean
     getModel?: CustomModelLoader
@@ -153,8 +153,9 @@ export namespace Provider {
     openai: async () => {
       return {
         autoload: false,
-        async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
-          return sdk.responses(modelID)
+        async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
+          if (model.api.shape === "completions") return sdk.chat(model.api.id)
+          return sdk.responses(model.api.id)
         },
         options: {},
       }
@@ -162,9 +163,12 @@ export namespace Provider {
     "github-copilot": async () => {
       return {
         autoload: false,
-        async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
-          if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(modelID)
-          return shouldUseCopilotResponsesApi(modelID) ? sdk.responses(modelID) : sdk.chat(modelID)
+        async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
+          const shape = model.api.shape
+          if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(model.api.id)
+          if (shape === "responses") return sdk.responses(model.api.id)
+          if (shape === "completions") return sdk.chat(model.api.id)
+          return shouldUseCopilotResponsesApi(model.api.id) ? sdk.responses(model.api.id) : sdk.chat(model.api.id)
         },
         options: {},
       }
@@ -172,9 +176,12 @@ export namespace Provider {
     "github-copilot-enterprise": async () => {
       return {
         autoload: false,
-        async getModel(sdk: any, modelID: string, _options?: Record<string, any>) {
-          if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(modelID)
-          return shouldUseCopilotResponsesApi(modelID) ? sdk.responses(modelID) : sdk.chat(modelID)
+        async getModel(sdk: any, model: Model, _options?: Record<string, any>) {
+          const shape = model.api.shape
+          if (sdk.responses === undefined && sdk.chat === undefined) return sdk.languageModel(model.api.id)
+          if (shape === "responses") return sdk.responses(model.api.id)
+          if (shape === "completions") return sdk.chat(model.api.id)
+          return shouldUseCopilotResponsesApi(model.api.id) ? sdk.responses(model.api.id) : sdk.chat(model.api.id)
         },
         options: {},
       }
@@ -182,12 +189,12 @@ export namespace Provider {
     azure: async () => {
       return {
         autoload: false,
-        async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
-          if (options?.["useCompletionUrls"]) {
-            return sdk.chat(modelID)
-          } else {
-            return sdk.responses(modelID)
-          }
+        async getModel(sdk: any, model: Model, options?: Record<string, any>) {
+          if (sdk.responses === undefined || sdk.chat === undefined) return sdk.languageModel(model.api.id)
+          if (model.api.shape === "completions") return sdk.chat(model.api.id)
+          if (model.api.shape === "responses") return sdk.responses(model.api.id)
+          if (options?.["useCompletionUrls"]) return sdk.chat(model.api.id)
+          return sdk.responses(model.api.id)
         },
         options: {},
       }
@@ -196,12 +203,12 @@ export namespace Provider {
       const resourceName = Env.get("AZURE_COGNITIVE_SERVICES_RESOURCE_NAME")
       return {
         autoload: false,
-        async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
-          if (options?.["useCompletionUrls"]) {
-            return sdk.chat(modelID)
-          } else {
-            return sdk.responses(modelID)
-          }
+        async getModel(sdk: any, model: Model, options?: Record<string, any>) {
+          if (sdk.responses === undefined || sdk.chat === undefined) return sdk.languageModel(model.api.id)
+          if (model.api.shape === "completions") return sdk.chat(model.api.id)
+          if (model.api.shape === "responses") return sdk.responses(model.api.id)
+          if (options?.["useCompletionUrls"]) return sdk.chat(model.api.id)
+          return sdk.responses(model.api.id)
         },
         options: {
           baseURL: resourceName ? `https://${resourceName}.cognitiveservices.azure.com/openai` : undefined,
@@ -269,7 +276,8 @@ export namespace Provider {
       return {
         autoload: true,
         options: providerOptions,
-        async getModel(sdk: any, modelID: string, options?: Record<string, any>) {
+        async getModel(sdk: any, model: Model, options?: Record<string, any>) {
+          let modelID = model.api.id
           // Skip region prefixing if model already has a cross-region inference profile prefix
           // Models from models.dev may already include prefixes like us., eu., global., etc.
           const crossRegionPrefixes = ["global.", "us.", "eu.", "jp.", "apac.", "au."]
@@ -406,8 +414,8 @@ export namespace Provider {
             return fetch(input, { ...init, headers })
           },
         },
-        async getModel(sdk: any, modelID: string) {
-          const id = String(modelID).trim()
+        async getModel(sdk: any, model: Model) {
+          const id = String(model.api.id).trim()
           return sdk.languageModel(id)
         },
       }
@@ -423,8 +431,8 @@ export namespace Provider {
           project,
           location,
         },
-        async getModel(sdk: any, modelID) {
-          const id = String(modelID).trim()
+        async getModel(sdk: any, model: Model) {
+          const id = String(model.api.id).trim()
           return sdk.languageModel(id)
         },
       }
@@ -448,8 +456,8 @@ export namespace Provider {
       return {
         autoload: !!envServiceKey,
         options: envServiceKey ? { deploymentId, resourceGroup } : {},
-        async getModel(sdk: any, modelID: string) {
-          return sdk(modelID)
+        async getModel(sdk: any, model: Model) {
+          return sdk(model.api.id)
         },
       }
     },
@@ -494,8 +502,8 @@ export namespace Provider {
             ...(providerConfig?.options?.featureFlags || {}),
           },
         },
-        async getModel(sdk: ReturnType<typeof createGitLab>, modelID: string) {
-          return sdk.agenticChat(modelID, {
+        async getModel(sdk: ReturnType<typeof createGitLab>, model: Model) {
+          return sdk.agenticChat(model.api.id, {
             aiGatewayHeaders,
             featureFlags: {
               duo_agent_platform_agentic_chat: true,
@@ -524,8 +532,8 @@ export namespace Provider {
           apiKey,
           baseURL: `https://api.cloudflare.com/client/v4/accounts/${accountId}/ai/v1`,
         },
-        async getModel(sdk: any, modelID: string) {
-          return sdk.languageModel(modelID)
+        async getModel(sdk: any, model: Model) {
+          return sdk.languageModel(model.api.id)
         },
       }
     },
@@ -560,9 +568,9 @@ export namespace Provider {
 
       return {
         autoload: true,
-        async getModel(_sdk: any, modelID: string, _options?: Record<string, any>) {
+        async getModel(_sdk: any, model: Model, _options?: Record<string, any>) {
           // Model IDs use Unified API format: provider/model (e.g., "anthropic/claude-sonnet-4-5")
-          return aigateway(unified(modelID))
+          return aigateway(unified(model.api.id))
         },
         options: {},
       }
@@ -598,6 +606,7 @@ export namespace Provider {
         id: z.string(),
         url: z.string(),
         npm: z.string(),
+        shape: z.enum(["responses", "completions"]).optional(),
       }),
       name: z.string(),
       family: z.string().optional(),
@@ -686,6 +695,7 @@ export namespace Provider {
         id: model.id,
         url: model.provider?.api ?? provider.api!,
         npm: model.provider?.npm ?? provider.npm ?? "@ai-sdk/openai-compatible",
+        shape: model.provider?.shape,
       },
       status: model.status ?? "active",
       headers: model.headers ?? {},
@@ -836,6 +846,7 @@ export namespace Provider {
               existingModel?.api.npm ??
               modelsDev[providerID]?.npm ??
               "@ai-sdk/openai-compatible",
+            shape: model.provider?.shape ?? existingModel?.api.shape,
             url: model.provider?.api ?? provider?.api ?? existingModel?.api.url ?? modelsDev[providerID]?.api,
           },
           status: model.status ?? existingModel?.status ?? "active",
@@ -1177,7 +1188,7 @@ export namespace Provider {
 
     try {
       const language = s.modelLoaders[model.providerID]
-        ? await s.modelLoaders[model.providerID](sdk, model.api.id, provider.options)
+        ? await s.modelLoaders[model.providerID](sdk, model, provider.options)
         : sdk.languageModel(model.api.id)
       s.models.set(key, language)
       return language

packages/opencode/src/pty/index.ts

@@ -1,10 +1,11 @@
 import { BusEvent } from "@/bus/bus-event"
 import { Bus } from "@/bus"
-import { type IPty } from "node-pty"
+import { type IPty } from "bun-pty"
 import z from "zod"
 import { Identifier } from "../id/id"
 import { Log } from "../util/log"
 import { Instance } from "../project/instance"
+import { lazy } from "@opencode-ai/util/lazy"
 import { Shell } from "@/shell/shell"
 import { Plugin } from "@/plugin"
 
@@ -14,27 +15,22 @@ export namespace Pty {
   const BUFFER_LIMIT = 1024 * 1024 * 2
   const BUFFER_CHUNK = 64 * 1024
   const encoder = new TextEncoder()
-  const decoder = new TextDecoder()
-  const FRAME_META = 0
-  const FRAME_OUTPUT = 1
-  const FRAME_INPUT = 2
-  const MAX_CONNECTION = 200
 
   type Socket = {
     readyState: number
+    data?: unknown
     send: (data: string | Uint8Array | ArrayBuffer) => void
     close: (code?: number, reason?: string) => void
   }
 
   type Subscriber = {
     id: number
-    connection: string
+    token: unknown
   }
 
   const sockets = new WeakMap<object, number>()
   const owners = new WeakMap<object, string>()
   let socketCounter = 0
-  let connectionCounter = 0
 
   const tagSocket = (ws: Socket) => {
     if (!ws || typeof ws !== "object") return
@@ -43,74 +39,58 @@ export namespace Pty {
     return next
   }
 
-  const connection = () => {
-    connectionCounter = (connectionCounter + 1) % Number.MAX_SAFE_INTEGER
-    return `${Date.now().toString(36)}-${connectionCounter.toString(36)}`
-  }
+  const token = (ws: Socket) => {
+    const data = ws.data
+    if (data === undefined) return
+    if (data === null) return
+    if (typeof data !== "object") return data
 
-  const normalizeConnection = (value?: string) => {
-    const next = typeof value === "string" ? value.trim() : ""
-    if (!next) return connection()
-    if (next.length > MAX_CONNECTION) return connection()
-    if (encoder.encode(next).length > 255) return connection()
-    return next
-  }
+    const id = (data as { connId?: unknown }).connId
+    if (typeof id === "number" || typeof id === "string") return id
 
-  const output = (connection: string, data: string) => {
-    const channel = encoder.encode(connection)
-    const chunk = encoder.encode(data)
-    const out = new Uint8Array(2 + channel.length + chunk.length)
-    out[0] = FRAME_OUTPUT
-    out[1] = channel.length
-    out.set(channel, 2)
-    out.set(chunk, 2 + channel.length)
-    return out
-  }
+    const href = (data as { href?: unknown }).href
+    if (typeof href === "string") return href
 
-  const input = (message: string | Uint8Array | ArrayBuffer) => {
-    if (typeof message === "string") {
-      return { data: message }
+    const url = (data as { url?: unknown }).url
+    if (typeof url === "string") return url
+    if (url && typeof url === "object") {
+      const href = (url as { href?: unknown }).href
+      if (typeof href === "string") return href
+      return url
     }
 
-    const bytes = message instanceof Uint8Array ? message : new Uint8Array(message)
-    if (bytes[0] !== FRAME_INPUT) return
-    const size = bytes[1]
-    if (!Number.isSafeInteger(size) || size < 0) return
-    if (bytes.length < 2 + size) return
-    return {
-      connection: decoder.decode(bytes.subarray(2, 2 + size)),
-      data: decoder.decode(bytes.subarray(2 + size)),
+    const events = (data as { events?: unknown }).events
+    if (typeof events === "number" || typeof events === "string") return events
+    if (events && typeof events === "object") {
+      const id = (events as { connId?: unknown }).connId
+      if (typeof id === "number" || typeof id === "string") return id
+
+      const id2 = (events as { connection?: unknown }).connection
+      if (typeof id2 === "number" || typeof id2 === "string") return id2
+
+      const id3 = (events as { id?: unknown }).id
+      if (typeof id3 === "number" || typeof id3 === "string") return id3
+
+      return events
     }
+
+    return data
   }
 
-  // WebSocket control frame: 0x00 + UTF-8 JSON ({ cursor, connection }).
-  const meta = (cursor: number, connection: string) => {
-    const json = JSON.stringify({ cursor, connection })
+  // WebSocket control frame: 0x00 + UTF-8 JSON.
+  const meta = (cursor: number) => {
+    const json = JSON.stringify({ cursor })
     const bytes = encoder.encode(json)
     const out = new Uint8Array(bytes.length + 1)
-    out[0] = FRAME_META
+    out[0] = 0
     out.set(bytes, 1)
     return out
   }
 
-  type Spawn = (file: string, args: string | string[], options: unknown) => IPty
-  let override: Spawn | undefined
-  let spawn: Spawn | undefined
-
-  const pty = async (): Promise<Spawn> => {
-    if (override) return override
-    if (spawn) return spawn
-    const mod = await import("node-pty")
-    const next = mod.spawn as Spawn
-    spawn = next
-    return next
-  }
-
-  export function setSpawn(input?: Spawn) {
-    override = input
-    if (input) return
-    spawn = undefined
-  }
+  const pty = lazy(async () => {
+    const { spawn } = await import("bun-pty")
+    return spawn
+  })
 
   export const Info = z
     .object({
@@ -255,8 +235,13 @@ export namespace Pty {
           continue
         }
 
+        if (token(ws) !== sub.token) {
+          session.subscribers.delete(ws)
+          continue
+        }
+
         try {
-          ws.send(output(sub.connection, chunk))
+          ws.send(chunk)
         } catch {
           session.subscribers.delete(ws)
         }
@@ -332,7 +317,7 @@ export namespace Pty {
     }
   }
 
-  export function connect(id: string, ws: Socket, cursor?: number, connectionID?: string) {
+  export function connect(id: string, ws: Socket, cursor?: number) {
     const session = state().get(id)
     if (!session) {
       ws.close()
@@ -352,11 +337,7 @@ export namespace Pty {
     }
 
     owners.set(ws, id)
-    const sub = {
-      id: socketId,
-      connection: normalizeConnection(connectionID),
-    }
-    session.subscribers.set(ws, sub)
+    session.subscribers.set(ws, { id: socketId, token: token(ws) })
 
     const cleanup = () => {
       session.subscribers.delete(ws)
@@ -380,7 +361,7 @@ export namespace Pty {
     if (data) {
       try {
         for (let i = 0; i < data.length; i += BUFFER_CHUNK) {
-          ws.send(output(sub.connection, data.slice(i, i + BUFFER_CHUNK)))
+          ws.send(data.slice(i, i + BUFFER_CHUNK))
         }
       } catch {
         cleanup()
@@ -390,18 +371,15 @@ export namespace Pty {
     }
 
     try {
-      ws.send(meta(end, sub.connection))
+      ws.send(meta(end))
     } catch {
       cleanup()
       ws.close()
       return
     }
     return {
-      onMessage: (message: string | Uint8Array | ArrayBuffer) => {
-        const next = input(message)
-        if (!next?.data) return
-        if (next.connection && next.connection !== sub.connection) return
-        session.process.write(next.data)
+      onMessage: (message: string | ArrayBuffer) => {
+        session.process.write(String(message))
       },
       onClose: () => {
         log.info("client disconnected from session", { id })

packages/opencode/src/server/routes/experimental.ts

@@ -6,6 +6,7 @@ import { Worktree } from "../../worktree"
 import { Instance } from "../../project/instance"
 import { Project } from "../../project/project"
 import { MCP } from "../../mcp"
+import { Session } from "../../session"
 import { zodToJsonSchema } from "zod-to-json-schema"
 import { errors } from "../error"
 import { lazy } from "../../util/lazy"
@@ -184,6 +185,65 @@ export const ExperimentalRoutes = lazy(() =>
         return c.json(true)
       },
     )
+    .get(
+      "/session",
+      describeRoute({
+        summary: "List sessions",
+        description:
+          "Get a list of all OpenCode sessions across projects, sorted by most recently updated. Archived sessions are excluded by default.",
+        operationId: "experimental.session.list",
+        responses: {
+          200: {
+            description: "List of sessions",
+            content: {
+              "application/json": {
+                schema: resolver(Session.GlobalInfo.array()),
+              },
+            },
+          },
+        },
+      }),
+      validator(
+        "query",
+        z.object({
+          directory: z.string().optional().meta({ description: "Filter sessions by project directory" }),
+          roots: z.coerce.boolean().optional().meta({ description: "Only return root sessions (no parentID)" }),
+          start: z.coerce
+            .number()
+            .optional()
+            .meta({ description: "Filter sessions updated on or after this timestamp (milliseconds since epoch)" }),
+          cursor: z.coerce
+            .number()
+            .optional()
+            .meta({ description: "Return sessions updated before this timestamp (milliseconds since epoch)" }),
+          search: z.string().optional().meta({ description: "Filter sessions by title (case-insensitive)" }),
+          limit: z.coerce.number().optional().meta({ description: "Maximum number of sessions to return" }),
+          archived: z.coerce.boolean().optional().meta({ description: "Include archived sessions (default false)" }),
+        }),
+      ),
+      async (c) => {
+        const query = c.req.valid("query")
+        const limit = query.limit ?? 100
+        const sessions: Session.GlobalInfo[] = []
+        for await (const session of Session.listGlobal({
+          directory: query.directory,
+          roots: query.roots,
+          start: query.start,
+          cursor: query.cursor,
+          search: query.search,
+          limit: limit + 1,
+          archived: query.archived,
+        })) {
+          sessions.push(session)
+        }
+        const hasMore = sessions.length > limit
+        const list = hasMore ? sessions.slice(0, limit) : sessions
+        if (hasMore && list.length > 0) {
+          c.header("x-next-cursor", String(list[list.length - 1].time.updated))
+        }
+        return c.json(list)
+      },
+    )
     .get(
       "/resource",
       describeRoute({

packages/opencode/src/server/routes/pty.ts

@@ -1,11 +1,11 @@
 import { Hono } from "hono"
 import { describeRoute, validator, resolver } from "hono-openapi"
+import { upgradeWebSocket } from "hono/bun"
 import z from "zod"
 import { Pty } from "@/pty"
 import { NotFoundError } from "../../storage/db"
 import { errors } from "../error"
 import { lazy } from "../../util/lazy"
-import { upgradeWebSocket } from "../websocket"
 
 export const PtyRoutes = lazy(() =>
   new Hono()
@@ -158,12 +158,6 @@ export const PtyRoutes = lazy(() =>
           if (!Number.isSafeInteger(parsed) || parsed < -1) return
           return parsed
         })()
-        const connection = (() => {
-          const value = c.req.query("connection")
-          if (!value) return
-          if (value.length > 200) return
-          return value
-        })()
         let handler: ReturnType<typeof Pty.connect>
         if (!Pty.get(id)) throw new Error("Session not found")
 
@@ -183,20 +177,15 @@ export const PtyRoutes = lazy(() =>
 
         return {
           onOpen(_event, ws) {
-            if (!isSocket(ws)) {
+            const socket = ws.raw
+            if (!isSocket(socket)) {
               ws.close()
               return
             }
-            handler = Pty.connect(id, ws, cursor, connection)
+            handler = Pty.connect(id, socket, cursor)
           },
           onMessage(event) {
-            if (
-              typeof event.data !== "string" &&
-              !(event.data instanceof ArrayBuffer) &&
-              !(event.data instanceof Uint8Array)
-            ) {
-              return
-            }
+            if (typeof event.data !== "string") return
             handler?.onMessage(event.data)
           },
           onClose() {

packages/opencode/src/server/server.ts

@@ -33,7 +33,7 @@ import { lazy } from "../util/lazy"
 import { InstanceBootstrap } from "../project/bootstrap"
 import { NotFoundError } from "../storage/db"
 import type { ContentfulStatusCode } from "hono/utils/http-status"
-import { websocket } from "./websocket"
+import { websocket } from "hono/bun"
 import { HTTPException } from "hono/http-exception"
 import { errors } from "./error"
 import { QuestionRoutes } from "./routes/question"

packages/opencode/src/server/websocket.ts

@@ -1 +0,0 @@
-export { createBunWebSocket, upgradeWebSocket, websocket } from "hono/bun"

packages/opencode/src/session/index.ts

@@ -10,8 +10,10 @@ import { Flag } from "../flag/flag"
 import { Identifier } from "../id/id"
 import { Installation } from "../installation"
 
-import { Database, NotFoundError, eq, and, or, gte, isNull, desc, like } from "../storage/db"
+import { Database, NotFoundError, eq, and, or, gte, isNull, desc, like, inArray, lt } from "../storage/db"
+import type { SQL } from "../storage/db"
 import { SessionTable, MessageTable, PartTable } from "./session.sql"
+import { ProjectTable } from "../project/project.sql"
 import { Storage } from "@/storage/storage"
 import { Log } from "../util/log"
 import { MessageV2 } from "./message-v2"
@@ -154,6 +156,24 @@ export namespace Session {
     })
   export type Info = z.output<typeof Info>
 
+  export const ProjectInfo = z
+    .object({
+      id: z.string(),
+      name: z.string().optional(),
+      worktree: z.string(),
+    })
+    .meta({
+      ref: "ProjectSummary",
+    })
+  export type ProjectInfo = z.output<typeof ProjectInfo>
+
+  export const GlobalInfo = Info.extend({
+    project: ProjectInfo.nullable(),
+  }).meta({
+    ref: "GlobalSession",
+  })
+  export type GlobalInfo = z.output<typeof GlobalInfo>
+
   export const Event = {
     Created: BusEvent.define(
       "session.created",
@@ -544,6 +564,75 @@ export namespace Session {
     }
   }
 
+  export function* listGlobal(input?: {
+    directory?: string
+    roots?: boolean
+    start?: number
+    cursor?: number
+    search?: string
+    limit?: number
+    archived?: boolean
+  }) {
+    const conditions: SQL[] = []
+
+    if (input?.directory) {
+      conditions.push(eq(SessionTable.directory, input.directory))
+    }
+    if (input?.roots) {
+      conditions.push(isNull(SessionTable.parent_id))
+    }
+    if (input?.start) {
+      conditions.push(gte(SessionTable.time_updated, input.start))
+    }
+    if (input?.cursor) {
+      conditions.push(lt(SessionTable.time_updated, input.cursor))
+    }
+    if (input?.search) {
+      conditions.push(like(SessionTable.title, `%${input.search}%`))
+    }
+    if (!input?.archived) {
+      conditions.push(isNull(SessionTable.time_archived))
+    }
+
+    const limit = input?.limit ?? 100
+
+    const rows = Database.use((db) => {
+      const query =
+        conditions.length > 0
+          ? db
+              .select()
+              .from(SessionTable)
+              .where(and(...conditions))
+          : db.select().from(SessionTable)
+      return query.orderBy(desc(SessionTable.time_updated), desc(SessionTable.id)).limit(limit).all()
+    })
+
+    const ids = [...new Set(rows.map((row) => row.project_id))]
+    const projects = new Map<string, ProjectInfo>()
+
+    if (ids.length > 0) {
+      const items = Database.use((db) =>
+        db
+          .select({ id: ProjectTable.id, name: ProjectTable.name, worktree: ProjectTable.worktree })
+          .from(ProjectTable)
+          .where(inArray(ProjectTable.id, ids))
+          .all(),
+      )
+      for (const item of items) {
+        projects.set(item.id, {
+          id: item.id,
+          name: item.name ?? undefined,
+          worktree: item.worktree,
+        })
+      }
+    }
+
+    for (const row of rows) {
+      const project = projects.get(row.project_id) ?? null
+      yield { ...fromRow(row), project }
+    }
+  }
+
   export const children = fn(Identifier.schema("session"), async (parentID) => {
     const project = Instance.project
     const rows = Database.use((db) =>

packages/opencode/src/session/llm.ts

@@ -11,7 +11,7 @@ import {
   tool,
   jsonSchema,
 } from "ai"
-import { clone, mergeDeep, pipe } from "remeda"
+import { mergeDeep, pipe } from "remeda"
 import { ProviderTransform } from "@/provider/transform"
 import { Config } from "@/config/config"
 import { Instance } from "@/project/instance"
@@ -80,15 +80,11 @@ export namespace LLM {
     )
 
     const header = system[0]
-    const original = clone(system)
     await Plugin.trigger(
       "experimental.chat.system.transform",
       { sessionID: input.sessionID, model: input.model },
       { system },
     )
-    if (system.length === 0) {
-      system.push(...original)
-    }
     // rejoin to maintain 2-part structure for caching if header unchanged
     if (system.length > 2 && system[0] === header) {
       const rest = system.slice(1)

packages/opencode/src/session/prompt.ts

@@ -22,7 +22,6 @@ import PROMPT_PLAN from "../session/prompt/plan.txt"
 import BUILD_SWITCH from "../session/prompt/build-switch.txt"
 import MAX_STEPS from "../session/prompt/max-steps.txt"
 import { defer } from "../util/defer"
-import { clone } from "remeda"
 import { ToolRegistry } from "../tool/registry"
 import { MCP } from "../mcp"
 import { LSP } from "../lsp"
@@ -627,11 +626,9 @@ export namespace SessionPrompt {
         })
       }
 
-      const sessionMessages = clone(msgs)
-
       // Ephemerally wrap queued user messages with a reminder to stay on track
       if (step > 1 && lastFinished) {
-        for (const msg of sessionMessages) {
+        for (const msg of msgs) {
           if (msg.info.role !== "user" || msg.info.id <= lastFinished.id) continue
           for (const part of msg.parts) {
             if (part.type !== "text" || part.ignored || part.synthetic) continue
@@ -648,7 +645,7 @@ export namespace SessionPrompt {
         }
       }
 
-      await Plugin.trigger("experimental.chat.messages.transform", {}, { messages: sessionMessages })
+      await Plugin.trigger("experimental.chat.messages.transform", {}, { messages: msgs })
 
       // Build system prompt, adding structured output instruction if needed
       const system = [...(await SystemPrompt.environment(model)), ...(await InstructionPrompt.system())]
@@ -664,7 +661,7 @@ export namespace SessionPrompt {
         sessionID,
         system,
         messages: [
-          ...MessageV2.toModelMessages(sessionMessages, model),
+          ...MessageV2.toModelMessages(msgs, model),
           ...(isLastStep
             ? [
                 {
@@ -909,7 +906,12 @@ export namespace SessionPrompt {
           title: "",
           metadata,
           output: truncated.content,
-          attachments,
+          attachments: attachments.map((attachment) => ({
+            ...attachment,
+            id: Identifier.ascending("part"),
+            sessionID: ctx.sessionID,
+            messageID: input.processor.message.id,
+          })),
           content: result.content, // directly return content to preserve ordering when outputting to model
         }
       }

packages/opencode/src/snapshot/index.ts

@@ -66,7 +66,7 @@ export namespace Snapshot {
       await $`git --git-dir ${git} config core.autocrlf false`.quiet().nothrow()
       log.info("initialized")
     }
-    await $`git --git-dir ${git} --work-tree ${Instance.worktree} add .`.quiet().cwd(Instance.directory).nothrow()
+    await add(git)
     const hash = await $`git --git-dir ${git} --work-tree ${Instance.worktree} write-tree`
       .quiet()
       .cwd(Instance.directory)
@@ -84,7 +84,7 @@ export namespace Snapshot {
 
   export async function patch(hash: string): Promise<Patch> {
     const git = gitdir()
-    await $`git --git-dir ${git} --work-tree ${Instance.worktree} add .`.quiet().cwd(Instance.directory).nothrow()
+    await add(git)
     const result =
       await $`git -c core.autocrlf=false -c core.quotepath=false --git-dir ${git} --work-tree ${Instance.worktree} diff --no-ext-diff --name-only ${hash} -- .`
         .quiet()
@@ -162,7 +162,7 @@ export namespace Snapshot {
 
   export async function diff(hash: string) {
     const git = gitdir()
-    await $`git --git-dir ${git} --work-tree ${Instance.worktree} add .`.quiet().cwd(Instance.directory).nothrow()
+    await add(git)
     const result =
       await $`git -c core.autocrlf=false -c core.quotepath=false --git-dir ${git} --work-tree ${Instance.worktree} diff --no-ext-diff ${hash} -- .`
         .quiet()
@@ -253,4 +253,38 @@ export namespace Snapshot {
     const project = Instance.project
     return path.join(Global.Path.data, "snapshot", project.id)
   }
+
+  async function add(git: string) {
+    await syncExclude(git)
+    await $`git --git-dir ${git} --work-tree ${Instance.worktree} add .`.quiet().cwd(Instance.directory).nothrow()
+  }
+
+  async function syncExclude(git: string) {
+    const file = await excludes()
+    const target = path.join(git, "info", "exclude")
+    await fs.mkdir(path.join(git, "info"), { recursive: true })
+    if (!file) {
+      await Bun.write(target, "")
+      return
+    }
+    const text = await Bun.file(file)
+      .text()
+      .catch(() => "")
+    await Bun.write(target, text)
+  }
+
+  async function excludes() {
+    const file = await $`git rev-parse --path-format=absolute --git-path info/exclude`
+      .quiet()
+      .cwd(Instance.worktree)
+      .nothrow()
+      .text()
+    if (!file.trim()) return
+    const exists = await fs
+      .stat(file.trim())
+      .then(() => true)
+      .catch(() => false)
+    if (!exists) return
+    return file.trim()
+  }
 }

packages/opencode/test/pty/pty-output-isolation.test.ts

@@ -1,73 +1,9 @@
-import { afterEach, beforeEach, describe, expect, test } from "bun:test"
+import { describe, expect, test } from "bun:test"
 import { Instance } from "../../src/project/instance"
 import { Pty } from "../../src/pty"
 import { tmpdir } from "../fixture/fixture"
 
-const encoder = new TextEncoder()
-const decoder = new TextDecoder()
-
-const input = (connection: string, data: string) => {
-  const channel = encoder.encode(connection)
-  const body = encoder.encode(data)
-  const out = new Uint8Array(2 + channel.length + body.length)
-  out[0] = 2
-  out[1] = channel.length
-  out.set(channel, 2)
-  out.set(body, 2 + channel.length)
-  return out
-}
-
-const output = (connection: string, data: unknown) => {
-  if (typeof data === "string") return data
-  if (!(data instanceof Uint8Array) && !(data instanceof ArrayBuffer)) return ""
-  const bytes = data instanceof Uint8Array ? data : new Uint8Array(data)
-  if (bytes[0] !== 1) return ""
-  const size = bytes[1]
-  if (!Number.isSafeInteger(size) || size < 0) return ""
-  if (bytes.length < 2 + size) return ""
-  const id = decoder.decode(bytes.subarray(2, 2 + size))
-  if (id !== connection) return ""
-  return decoder.decode(bytes.subarray(2 + size))
-}
-
-const spawn = () => {
-  let pid = 1000
-  return () => {
-    const data = new Set<(chunk: string) => void>()
-    const exit = new Set<(event: { exitCode: number }) => void>()
-    let closed = false
-
-    return {
-      pid: ++pid,
-      onData: (cb: (chunk: string) => void) => {
-        data.add(cb)
-      },
-      onExit: (cb: (event: { exitCode: number }) => void) => {
-        exit.add(cb)
-      },
-      resize: () => {},
-      write: (chunk: string) => {
-        if (closed) return
-        for (const cb of data) cb(chunk)
-      },
-      kill: () => {
-        if (closed) return
-        closed = true
-        for (const cb of exit) cb({ exitCode: 0 })
-      },
-    }
-  }
-}
-
 describe("pty", () => {
-  beforeEach(() => {
-    Pty.setSpawn(spawn() as unknown as Parameters<typeof Pty.setSpawn>[0])
-  })
-
-  afterEach(() => {
-    Pty.setSpawn()
-  })
-
   test("does not leak output when websocket objects are reused", async () => {
     await using dir = await tmpdir({ git: true })
 
@@ -82,9 +18,9 @@ describe("pty", () => {
 
           const ws = {
             readyState: 1,
+            data: { events: { connection: "a" } },
             send: (data: unknown) => {
-              const text = output("conn-a", data)
-              if (text) outA.push(text)
+              outA.push(typeof data === "string" ? data : Buffer.from(data as Uint8Array).toString("utf8"))
             },
             close: () => {
               // no-op (simulate abrupt drop)
@@ -92,14 +28,14 @@ describe("pty", () => {
           }
 
           // Connect "a" first with ws.
-          Pty.connect(a.id, ws as any, undefined, "conn-a")
+          Pty.connect(a.id, ws as any)
 
           // Now "reuse" the same ws object for another connection.
+          ws.data = { events: { connection: "b" } }
           ws.send = (data: unknown) => {
-            const text = output("conn-b", data)
-            if (text) outB.push(text)
+            outB.push(typeof data === "string" ? data : Buffer.from(data as Uint8Array).toString("utf8"))
           }
-          Pty.connect(b.id, ws as any, undefined, "conn-b")
+          Pty.connect(b.id, ws as any)
 
           // Clear connect metadata writes.
           outA.length = 0
@@ -118,7 +54,7 @@ describe("pty", () => {
     })
   })
 
-  test("does not leak output when websocket objects are recycled before re-connect", async () => {
+  test("does not leak output when Bun recycles websocket objects before re-connect", async () => {
     await using dir = await tmpdir({ git: true })
 
     await Instance.provide({
@@ -131,9 +67,9 @@ describe("pty", () => {
 
           const ws = {
             readyState: 1,
+            data: { events: { connection: "a" } },
             send: (data: unknown) => {
-              const text = output("conn-a", data)
-              if (text) outA.push(text)
+              outA.push(typeof data === "string" ? data : Buffer.from(data as Uint8Array).toString("utf8"))
             },
             close: () => {
               // no-op (simulate abrupt drop)
@@ -141,14 +77,14 @@ describe("pty", () => {
           }
 
           // Connect "a" first.
-          Pty.connect(a.id, ws as any, undefined, "conn-a")
+          Pty.connect(a.id, ws as any)
           outA.length = 0
 
-          // Simulate websocket object reuse for another connection before
-          // the next onOpen calls Pty.connect.
+          // Simulate Bun reusing the same websocket object for another
+          // connection before the next onOpen calls Pty.connect.
+          ws.data = { events: { connection: "b" } }
           ws.send = (data: unknown) => {
-            const text = output("conn-b", data)
-            if (text) outB.push(text)
+            outB.push(typeof data === "string" ? data : Buffer.from(data as Uint8Array).toString("utf8"))
           }
 
           Pty.write(a.id, "AAA\n")
@@ -162,7 +98,7 @@ describe("pty", () => {
     })
   })
 
-  test("drops input frames that carry a different connection id", async () => {
+  test("does not leak output when socket data mutates in-place", async () => {
     await using dir = await tmpdir({ git: true })
 
     await Instance.provide({
@@ -170,29 +106,35 @@ describe("pty", () => {
       fn: async () => {
         const a = await Pty.create({ command: "cat", title: "a" })
         try {
-          const out: string[] = []
+          const outA: string[] = []
+          const outB: string[] = []
 
+          const ctx = { connId: 1 }
           const ws = {
             readyState: 1,
+            data: ctx,
             send: (data: unknown) => {
-              const text = output("conn-a", data)
-              if (text) out.push(text)
+              outA.push(typeof data === "string" ? data : Buffer.from(data as Uint8Array).toString("utf8"))
             },
             close: () => {
               // no-op
             },
           }
 
-          const handler = Pty.connect(a.id, ws as any, undefined, "conn-a")
-          out.length = 0
+          Pty.connect(a.id, ws as any)
+          outA.length = 0
 
-          handler?.onMessage(input("conn-b", "BBB\n"))
-          await Bun.sleep(100)
-          expect(out.join("")).not.toContain("BBB")
+          // Simulate the runtime mutating per-connection data without
+          // swapping the reference (ws.data stays the same object).
+          ctx.connId = 2
+          ws.send = (data: unknown) => {
+            outB.push(typeof data === "string" ? data : Buffer.from(data as Uint8Array).toString("utf8"))
+          }
 
-          handler?.onMessage(input("conn-a", "AAA\n"))
+          Pty.write(a.id, "AAA\n")
           await Bun.sleep(100)
-          expect(out.join("")).toContain("AAA")
+
+          expect(outB.join("")).not.toContain("AAA")
         } finally {
           await Pty.remove(a.id)
         }

packages/opencode/test/server/global-session-list.test.ts

@@ -0,0 +1,89 @@
+import { describe, expect, test } from "bun:test"
+import { Instance } from "../../src/project/instance"
+import { Project } from "../../src/project/project"
+import { Session } from "../../src/session"
+import { Log } from "../../src/util/log"
+import { tmpdir } from "../fixture/fixture"
+
+Log.init({ print: false })
+
+describe("Session.listGlobal", () => {
+  test("lists sessions across projects with project metadata", async () => {
+    await using first = await tmpdir({ git: true })
+    await using second = await tmpdir({ git: true })
+
+    const firstSession = await Instance.provide({
+      directory: first.path,
+      fn: async () => Session.create({ title: "first-session" }),
+    })
+    const secondSession = await Instance.provide({
+      directory: second.path,
+      fn: async () => Session.create({ title: "second-session" }),
+    })
+
+    const sessions = [...Session.listGlobal({ limit: 200 })]
+    const ids = sessions.map((session) => session.id)
+
+    expect(ids).toContain(firstSession.id)
+    expect(ids).toContain(secondSession.id)
+
+    const firstProject = Project.get(firstSession.projectID)
+    const secondProject = Project.get(secondSession.projectID)
+
+    const firstItem = sessions.find((session) => session.id === firstSession.id)
+    const secondItem = sessions.find((session) => session.id === secondSession.id)
+
+    expect(firstItem?.project?.id).toBe(firstProject?.id)
+    expect(firstItem?.project?.worktree).toBe(firstProject?.worktree)
+    expect(secondItem?.project?.id).toBe(secondProject?.id)
+    expect(secondItem?.project?.worktree).toBe(secondProject?.worktree)
+  })
+
+  test("excludes archived sessions by default", async () => {
+    await using tmp = await tmpdir({ git: true })
+
+    const archived = await Instance.provide({
+      directory: tmp.path,
+      fn: async () => Session.create({ title: "archived-session" }),
+    })
+
+    await Instance.provide({
+      directory: tmp.path,
+      fn: async () => Session.setArchived({ sessionID: archived.id, time: Date.now() }),
+    })
+
+    const sessions = [...Session.listGlobal({ limit: 200 })]
+    const ids = sessions.map((session) => session.id)
+
+    expect(ids).not.toContain(archived.id)
+
+    const allSessions = [...Session.listGlobal({ limit: 200, archived: true })]
+    const allIds = allSessions.map((session) => session.id)
+
+    expect(allIds).toContain(archived.id)
+  })
+
+  test("supports cursor pagination", async () => {
+    await using tmp = await tmpdir({ git: true })
+
+    const first = await Instance.provide({
+      directory: tmp.path,
+      fn: async () => Session.create({ title: "page-one" }),
+    })
+    await new Promise((resolve) => setTimeout(resolve, 5))
+    const second = await Instance.provide({
+      directory: tmp.path,
+      fn: async () => Session.create({ title: "page-two" }),
+    })
+
+    const page = [...Session.listGlobal({ directory: tmp.path, limit: 1 })]
+    expect(page.length).toBe(1)
+    expect(page[0].id).toBe(second.id)
+
+    const next = [...Session.listGlobal({ directory: tmp.path, limit: 10, cursor: page[0].time.updated })]
+    const ids = next.map((session) => session.id)
+
+    expect(ids).toContain(first.id)
+    expect(ids).not.toContain(second.id)
+  })
+})

packages/opencode/test/session/llm.test.ts

@@ -307,7 +307,6 @@ describe("session.llm.stream", () => {
         expect(url.pathname.startsWith("/v1/")).toBe(true)
         expect(url.pathname.endsWith("/chat/completions")).toBe(true)
         expect(headers.get("Authorization")).toBe("Bearer test-key")
-        expect(headers.get("User-Agent") ?? "").toMatch(/^opencode\//)
 
         expect(body.model).toBe(resolved.api.id)
         expect(body.temperature).toBe(0.4)

packages/opencode/test/session/prompt-missing-file.test.ts

@@ -1,104 +0,0 @@
-import path from "path"
-import { describe, expect, test } from "bun:test"
-import { Instance } from "../../src/project/instance"
-import { Session } from "../../src/session"
-import { MessageV2 } from "../../src/session/message-v2"
-import { SessionPrompt } from "../../src/session/prompt"
-import { tmpdir } from "../fixture/fixture"
-
-describe("session.prompt missing file", () => {
-  test("does not fail the prompt when a file part is missing", async () => {
-    await using tmp = await tmpdir({
-      git: true,
-      config: {
-        agent: {
-          build: {
-            model: "openai/gpt-5.2",
-          },
-        },
-      },
-    })
-
-    await Instance.provide({
-      directory: tmp.path,
-      fn: async () => {
-        const session = await Session.create({})
-
-        const missing = path.join(tmp.path, "does-not-exist.ts")
-        const msg = await SessionPrompt.prompt({
-          sessionID: session.id,
-          agent: "build",
-          noReply: true,
-          parts: [
-            { type: "text", text: "please review @does-not-exist.ts" },
-            {
-              type: "file",
-              mime: "text/plain",
-              url: `file://${missing}`,
-              filename: "does-not-exist.ts",
-            },
-          ],
-        })
-
-        if (msg.info.role !== "user") throw new Error("expected user message")
-
-        const hasFailure = msg.parts.some(
-          (part) => part.type === "text" && part.synthetic && part.text.includes("Read tool failed to read"),
-        )
-        expect(hasFailure).toBe(true)
-
-        await Session.remove(session.id)
-      },
-    })
-  })
-
-  test("keeps stored part order stable when file resolution is async", async () => {
-    await using tmp = await tmpdir({
-      git: true,
-      config: {
-        agent: {
-          build: {
-            model: "openai/gpt-5.2",
-          },
-        },
-      },
-    })
-
-    await Instance.provide({
-      directory: tmp.path,
-      fn: async () => {
-        const session = await Session.create({})
-
-        const missing = path.join(tmp.path, "still-missing.ts")
-        const msg = await SessionPrompt.prompt({
-          sessionID: session.id,
-          agent: "build",
-          noReply: true,
-          parts: [
-            {
-              type: "file",
-              mime: "text/plain",
-              url: `file://${missing}`,
-              filename: "still-missing.ts",
-            },
-            { type: "text", text: "after-file" },
-          ],
-        })
-
-        if (msg.info.role !== "user") throw new Error("expected user message")
-
-        const stored = await MessageV2.get({
-          sessionID: session.id,
-          messageID: msg.info.id,
-        })
-        const text = stored.parts.filter((part) => part.type === "text").map((part) => part.text)
-
-        expect(text[0]?.startsWith("Called the Read tool with the following input:")).toBe(true)
-        expect(text[1]?.includes("Read tool failed to read")).toBe(true)
-        expect(text[2]).toBe("after-file")
-
-        await Session.remove(session.id)
-      },
-    })
-  })
-})

packages/opencode/test/session/prompt-special-chars.test.ts

@@ -1,56 +0,0 @@
-import path from "path"
-import { describe, expect, test } from "bun:test"
-import { fileURLToPath } from "url"
-import { Instance } from "../../src/project/instance"
-import { Log } from "../../src/util/log"
-import { Session } from "../../src/session"
-import { SessionPrompt } from "../../src/session/prompt"
-import { MessageV2 } from "../../src/session/message-v2"
-import { tmpdir } from "../fixture/fixture"
-
-Log.init({ print: false })
-
-describe("session.prompt special characters", () => {
-  test("handles filenames with # character", async () => {
-    await using tmp = await tmpdir({
-      git: true,
-      init: async (dir) => {
-        await Bun.write(path.join(dir, "file#name.txt"), "special content\n")
-      },
-    })
-
-    await Instance.provide({
-      directory: tmp.path,
-      fn: async () => {
-        const session = await Session.create({})
-        const template = "Read @file#name.txt"
-        const parts = await SessionPrompt.resolvePromptParts(template)
-        const fileParts = parts.filter((part) => part.type === "file")
-
-        expect(fileParts.length).toBe(1)
-        expect(fileParts[0].filename).toBe("file#name.txt")
-
-        // Verify the URL is properly encoded (# should be %23)
-        expect(fileParts[0].url).toContain("%23")
-
-        // Verify the URL can be correctly converted back to a file path
-        const decodedPath = fileURLToPath(fileParts[0].url)
-        expect(decodedPath).toBe(path.join(tmp.path, "file#name.txt"))
-
-        const message = await SessionPrompt.prompt({
-          sessionID: session.id,
-          parts,
-          noReply: true,
-        })
-        const stored = await MessageV2.get({ sessionID: session.id, messageID: message.info.id })
-
-        // Verify the file content was read correctly
-        const textParts = stored.parts.filter((part) => part.type === "text")
-        const hasContent = textParts.some((part) => part.text.includes("special content"))
-        expect(hasContent).toBe(true)
-
-        await Session.remove(session.id)
-      },
-    })
-  })
-})

packages/opencode/test/session/prompt-variant.test.ts

@@ -1,68 +0,0 @@
-import { describe, expect, test } from "bun:test"
-import { Instance } from "../../src/project/instance"
-import { Session } from "../../src/session"
-import { SessionPrompt } from "../../src/session/prompt"
-import { tmpdir } from "../fixture/fixture"
-
-describe("session.prompt agent variant", () => {
-  test("applies agent variant only when using agent model", async () => {
-    const prev = process.env.OPENAI_API_KEY
-    process.env.OPENAI_API_KEY = "test-openai-key"
-
-    try {
-      await using tmp = await tmpdir({
-        git: true,
-        config: {
-          agent: {
-            build: {
-              model: "openai/gpt-5.2",
-              variant: "xhigh",
-            },
-          },
-        },
-      })
-
-      await Instance.provide({
-        directory: tmp.path,
-        fn: async () => {
-          const session = await Session.create({})
-
-          const other = await SessionPrompt.prompt({
-            sessionID: session.id,
-            agent: "build",
-            model: { providerID: "opencode", modelID: "kimi-k2.5-free" },
-            noReply: true,
-            parts: [{ type: "text", text: "hello" }],
-          })
-          if (other.info.role !== "user") throw new Error("expected user message")
-          expect(other.info.variant).toBeUndefined()
-
-          const match = await SessionPrompt.prompt({
-            sessionID: session.id,
-            agent: "build",
-            noReply: true,
-            parts: [{ type: "text", text: "hello again" }],
-          })
-          if (match.info.role !== "user") throw new Error("expected user message")
-          expect(match.info.model).toEqual({ providerID: "openai", modelID: "gpt-5.2" })
-          expect(match.info.variant).toBe("xhigh")
-
-          const override = await SessionPrompt.prompt({
-            sessionID: session.id,
-            agent: "build",
-            noReply: true,
-            variant: "high",
-            parts: [{ type: "text", text: "hello third" }],
-          })
-          if (override.info.role !== "user") throw new Error("expected user message")
-          expect(override.info.variant).toBe("high")
-
-          await Session.remove(session.id)
-        },
-      })
-    } finally {
-      if (prev === undefined) delete process.env.OPENAI_API_KEY
-      else process.env.OPENAI_API_KEY = prev
-    }
-  })
-})

packages/opencode/test/session/prompt.test.ts

@@ -0,0 +1,211 @@
+import path from "path"
+import { describe, expect, test } from "bun:test"
+import { fileURLToPath } from "url"
+import { Instance } from "../../src/project/instance"
+import { Session } from "../../src/session"
+import { MessageV2 } from "../../src/session/message-v2"
+import { SessionPrompt } from "../../src/session/prompt"
+import { Log } from "../../src/util/log"
+import { tmpdir } from "../fixture/fixture"
+
+Log.init({ print: false })
+
+describe("session.prompt missing file", () => {
+  test("does not fail the prompt when a file part is missing", async () => {
+    await using tmp = await tmpdir({
+      git: true,
+      config: {
+        agent: {
+          build: {
+            model: "openai/gpt-5.2",
+          },
+        },
+      },
+    })
+
+    await Instance.provide({
+      directory: tmp.path,
+      fn: async () => {
+        const session = await Session.create({})
+
+        const missing = path.join(tmp.path, "does-not-exist.ts")
+        const msg = await SessionPrompt.prompt({
+          sessionID: session.id,
+          agent: "build",
+          noReply: true,
+          parts: [
+            { type: "text", text: "please review @does-not-exist.ts" },
+            {
+              type: "file",
+              mime: "text/plain",
+              url: `file://${missing}`,
+              filename: "does-not-exist.ts",
+            },
+          ],
+        })
+
+        if (msg.info.role !== "user") throw new Error("expected user message")
+
+        const hasFailure = msg.parts.some(
+          (part) => part.type === "text" && part.synthetic && part.text.includes("Read tool failed to read"),
+        )
+        expect(hasFailure).toBe(true)
+
+        await Session.remove(session.id)
+      },
+    })
+  })
+
+  test("keeps stored part order stable when file resolution is async", async () => {
+    await using tmp = await tmpdir({
+      git: true,
+      config: {
+        agent: {
+          build: {
+            model: "openai/gpt-5.2",
+          },
+        },
+      },
+    })
+
+    await Instance.provide({
+      directory: tmp.path,
+      fn: async () => {
+        const session = await Session.create({})
+
+        const missing = path.join(tmp.path, "still-missing.ts")
+        const msg = await SessionPrompt.prompt({
+          sessionID: session.id,
+          agent: "build",
+          noReply: true,
+          parts: [
+            {
+              type: "file",
+              mime: "text/plain",
+              url: `file://${missing}`,
+              filename: "still-missing.ts",
+            },
+            { type: "text", text: "after-file" },
+          ],
+        })
+
+        if (msg.info.role !== "user") throw new Error("expected user message")
+
+        const stored = await MessageV2.get({
+          sessionID: session.id,
+          messageID: msg.info.id,
+        })
+        const text = stored.parts.filter((part) => part.type === "text").map((part) => part.text)
+
+        expect(text[0]?.startsWith("Called the Read tool with the following input:")).toBe(true)
+        expect(text[1]?.includes("Read tool failed to read")).toBe(true)
+        expect(text[2]).toBe("after-file")
+
+        await Session.remove(session.id)
+      },
+    })
+  })
+})
+
+describe("session.prompt special characters", () => {
+  test("handles filenames with # character", async () => {
+    await using tmp = await tmpdir({
+      git: true,
+      init: async (dir) => {
+        await Bun.write(path.join(dir, "file#name.txt"), "special content\n")
+      },
+    })
+
+    await Instance.provide({
+      directory: tmp.path,
+      fn: async () => {
+        const session = await Session.create({})
+        const template = "Read @file#name.txt"
+        const parts = await SessionPrompt.resolvePromptParts(template)
+        const fileParts = parts.filter((part) => part.type === "file")
+
+        expect(fileParts.length).toBe(1)
+        expect(fileParts[0].filename).toBe("file#name.txt")
+        expect(fileParts[0].url).toContain("%23")
+
+        const decodedPath = fileURLToPath(fileParts[0].url)
+        expect(decodedPath).toBe(path.join(tmp.path, "file#name.txt"))
+
+        const message = await SessionPrompt.prompt({
+          sessionID: session.id,
+          parts,
+          noReply: true,
+        })
+        const stored = await MessageV2.get({ sessionID: session.id, messageID: message.info.id })
+        const textParts = stored.parts.filter((part) => part.type === "text")
+        const hasContent = textParts.some((part) => part.text.includes("special content"))
+        expect(hasContent).toBe(true)
+
+        await Session.remove(session.id)
+      },
+    })
+  })
+})
+
+describe("session.prompt agent variant", () => {
+  test("applies agent variant only when using agent model", async () => {
+    const prev = process.env.OPENAI_API_KEY
+    process.env.OPENAI_API_KEY = "test-openai-key"
+
+    try {
+      await using tmp = await tmpdir({
+        git: true,
+        config: {
+          agent: {
+            build: {
+              model: "openai/gpt-5.2",
+              variant: "xhigh",
+            },
+          },
+        },
+      })
+
+      await Instance.provide({
+        directory: tmp.path,
+        fn: async () => {
+          const session = await Session.create({})
+
+          const other = await SessionPrompt.prompt({
+            sessionID: session.id,
+            agent: "build",
+            model: { providerID: "opencode", modelID: "kimi-k2.5-free" },
+            noReply: true,
+            parts: [{ type: "text", text: "hello" }],
+          })
+          if (other.info.role !== "user") throw new Error("expected user message")
+          expect(other.info.variant).toBeUndefined()
+
+          const match = await SessionPrompt.prompt({
+            sessionID: session.id,
+            agent: "build",
+            noReply: true,
+            parts: [{ type: "text", text: "hello again" }],
+          })
+          if (match.info.role !== "user") throw new Error("expected user message")
+          expect(match.info.model).toEqual({ providerID: "openai", modelID: "gpt-5.2" })
+          expect(match.info.variant).toBe("xhigh")
+
+          const override = await SessionPrompt.prompt({
+            sessionID: session.id,
+            agent: "build",
+            noReply: true,
+            variant: "high",
+            parts: [{ type: "text", text: "hello third" }],
+          })
+          if (override.info.role !== "user") throw new Error("expected user message")
+          expect(override.info.variant).toBe("high")
+
+          await Session.remove(session.id)
+        },
+      })
+    } finally {
+      if (prev === undefined) delete process.env.OPENAI_API_KEY
+      else process.env.OPENAI_API_KEY = prev
+    }
+  })
+})

packages/opencode/test/snapshot/snapshot.test.ts

@@ -508,6 +508,68 @@ test("gitignore changes", async () => {
   })
 })
 
+test("git info exclude changes", async () => {
+  await using tmp = await bootstrap()
+  await Instance.provide({
+    directory: tmp.path,
+    fn: async () => {
+      const before = await Snapshot.track()
+      expect(before).toBeTruthy()
+
+      const file = `${tmp.path}/.git/info/exclude`
+      const text = await Bun.file(file).text()
+      await Bun.write(file, `${text.trimEnd()}\nignored.txt\n`)
+      await Bun.write(`${tmp.path}/ignored.txt`, "ignored content")
+      await Bun.write(`${tmp.path}/normal.txt`, "normal content")
+
+      const patch = await Snapshot.patch(before!)
+      expect(patch.files).toContain(`${tmp.path}/normal.txt`)
+      expect(patch.files).not.toContain(`${tmp.path}/ignored.txt`)
+
+      const after = await Snapshot.track()
+      const diffs = await Snapshot.diffFull(before!, after!)
+      expect(diffs.some((x) => x.file === "normal.txt")).toBe(true)
+      expect(diffs.some((x) => x.file === "ignored.txt")).toBe(false)
+    },
+  })
+})
+
+test("git info exclude keeps global excludes", async () => {
+  await using tmp = await bootstrap()
+  await Instance.provide({
+    directory: tmp.path,
+    fn: async () => {
+      const global = `${tmp.path}/global.ignore`
+      const config = `${tmp.path}/global.gitconfig`
+      await Bun.write(global, "global.tmp\n")
+      await Bun.write(config, `[core]\n\texcludesFile = ${global}\n`)
+
+      const prev = process.env.GIT_CONFIG_GLOBAL
+      process.env.GIT_CONFIG_GLOBAL = config
+      try {
+        const before = await Snapshot.track()
+        expect(before).toBeTruthy()
+
+        const file = `${tmp.path}/.git/info/exclude`
+        const text = await Bun.file(file).text()
+        await Bun.write(file, `${text.trimEnd()}\ninfo.tmp\n`)
+
+        await Bun.write(`${tmp.path}/global.tmp`, "global content")
+        await Bun.write(`${tmp.path}/info.tmp`, "info content")
+        await Bun.write(`${tmp.path}/normal.txt`, "normal content")
+
+        const patch = await Snapshot.patch(before!)
+        expect(patch.files).toContain(`${tmp.path}/normal.txt`)
+        expect(patch.files).not.toContain(`${tmp.path}/global.tmp`)
+        expect(patch.files).not.toContain(`${tmp.path}/info.tmp`)
+      } finally {
+        if (prev) process.env.GIT_CONFIG_GLOBAL = prev
+        else delete process.env.GIT_CONFIG_GLOBAL
+      }
+    },
+  })
+})
+
 test("concurrent file operations during patch", async () => {
   await using tmp = await bootstrap()
   await Instance.provide({

packages/plugin/package.json

@@ -1,7 +1,7 @@
 {
   "$schema": "https://json.schemastore.org/package.json",
   "name": "@opencode-ai/plugin",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "type": "module",
   "license": "MIT",
   "scripts": {

packages/sdk/js/package.json

@@ -1,7 +1,7 @@
 {
   "$schema": "https://json.schemastore.org/package.json",
   "name": "@opencode-ai/sdk",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "type": "module",
   "license": "MIT",
   "scripts": {
@@ -13,15 +13,15 @@
     "./client": "./src/client.ts",
     "./server": "./src/server.ts",
     "./v2": {
-      "types": "./dist/src/v2/index.d.ts",
+      "types": "./dist/v2/index.d.ts",
       "default": "./src/v2/index.ts"
     },
     "./v2/client": {
-      "types": "./dist/src/v2/client.d.ts",
+      "types": "./dist/v2/client.d.ts",
       "default": "./src/v2/client.ts"
     },
     "./v2/gen/client": {
-      "types": "./dist/src/v2/gen/client/index.d.ts",
+      "types": "./dist/v2/gen/client/index.d.ts",
       "default": "./src/v2/gen/client/index.ts"
     },
     "./v2/server": "./src/v2/server.ts"

packages/sdk/js/src/v2/gen/sdk.gen.ts

@@ -25,6 +25,7 @@ import type {
   EventTuiSessionSelect,
   EventTuiToastShow,
   ExperimentalResourceListResponses,
+  ExperimentalSessionListResponses,
   FileListResponses,
   FilePartInput,
   FilePartSource,
@@ -898,6 +899,48 @@ export class Worktree extends HeyApiClient {
   }
 }
 
+export class Session extends HeyApiClient {
+  /**
+   * List sessions
+   *
+   * Get a list of all OpenCode sessions across projects, sorted by most recently updated. Archived sessions are excluded by default.
+   */
+  public list<ThrowOnError extends boolean = false>(
+    parameters?: {
+      directory?: string
+      roots?: boolean
+      start?: number
+      cursor?: number
+      search?: string
+      limit?: number
+      archived?: boolean
+    },
+    options?: Options<never, ThrowOnError>,
+  ) {
+    const params = buildClientParams(
+      [parameters],
+      [
+        {
+          args: [
+            { in: "query", key: "directory" },
+            { in: "query", key: "roots" },
+            { in: "query", key: "start" },
+            { in: "query", key: "cursor" },
+            { in: "query", key: "search" },
+            { in: "query", key: "limit" },
+            { in: "query", key: "archived" },
+          ],
+        },
+      ],
+    )
+    return (options?.client ?? this.client).get<ExperimentalSessionListResponses, unknown, ThrowOnError>({
+      url: "/experimental/session",
+      ...options,
+      ...params,
+    })
+  }
+}
+
 export class Resource extends HeyApiClient {
   /**
    * Get MCP resources
@@ -920,13 +963,18 @@ export class Resource extends HeyApiClient {
 }
 
 export class Experimental extends HeyApiClient {
+  private _session?: Session
+  get session(): Session {
+    return (this._session ??= new Session({ client: this.client }))
+  }
+
   private _resource?: Resource
   get resource(): Resource {
     return (this._resource ??= new Resource({ client: this.client }))
   }
 }
 
-export class Session extends HeyApiClient {
+export class Session2 extends HeyApiClient {
   /**
    * List sessions
    *
@@ -3231,9 +3279,9 @@ export class OpencodeClient extends HeyApiClient {
     return (this._experimental ??= new Experimental({ client: this.client }))
   }
 
-  private _session?: Session
-  get session(): Session {
-    return (this._session ??= new Session({ client: this.client }))
+  private _session?: Session2
+  get session(): Session2 {
+    return (this._session ??= new Session2({ client: this.client }))
   }
 
   private _part?: Part

packages/sdk/js/src/v2/gen/types.gen.ts

@@ -2044,6 +2044,45 @@ export type WorktreeResetInput = {
   directory: string
 }
 
+export type ProjectSummary = {
+  id: string
+  name?: string
+  worktree: string
+}
+
+export type GlobalSession = {
+  id: string
+  slug: string
+  projectID: string
+  directory: string
+  parentID?: string
+  summary?: {
+    additions: number
+    deletions: number
+    files: number
+    diffs?: Array<FileDiff>
+  }
+  share?: {
+    url: string
+  }
+  title: string
+  version: string
+  time: {
+    created: number
+    updated: number
+    compacting?: number
+    archived?: number
+  }
+  permission?: PermissionRuleset
+  revert?: {
+    messageID: string
+    partID?: string
+    snapshot?: string
+    diff?: string
+  }
+  project: ProjectSummary | null
+}
+
 export type McpResource = {
   name: string
   uri: string
@@ -2870,6 +2909,51 @@ export type WorktreeResetResponses = {
 
 export type WorktreeResetResponse = WorktreeResetResponses[keyof WorktreeResetResponses]
 
+export type ExperimentalSessionListData = {
+  body?: never
+  path?: never
+  query?: {
+    /**
+     * Filter sessions by project directory
+     */
+    directory?: string
+    /**
+     * Only return root sessions (no parentID)
+     */
+    roots?: boolean
+    /**
+     * Filter sessions updated on or after this timestamp (milliseconds since epoch)
+     */
+    start?: number
+    /**
+     * Return sessions updated before this timestamp (milliseconds since epoch)
+     */
+    cursor?: number
+    /**
+     * Filter sessions by title (case-insensitive)
+     */
+    search?: string
+    /**
+     * Maximum number of sessions to return
+     */
+    limit?: number
+    /**
+     * Include archived sessions (default false)
+     */
+    archived?: boolean
+  }
+  url: "/experimental/session"
+}
+
+export type ExperimentalSessionListResponses = {
+  /**
+   * List of sessions
+   */
+  200: Array<GlobalSession>
+}
+
+export type ExperimentalSessionListResponse = ExperimentalSessionListResponses[keyof ExperimentalSessionListResponses]
+
 export type ExperimentalResourceListData = {
   body?: never
   path?: never

packages/sdk/js/tsconfig.json

@@ -7,7 +7,8 @@
     "declaration": true,
     "moduleResolution": "nodenext",
     "lib": ["es2022", "dom", "dom.iterable"],
-    "composite": true
+    "composite": true,
+    "rootDir": "src"
   },
   "include": ["src"]
 }

packages/sdk/openapi.json

@@ -1202,6 +1202,92 @@
         ]
       }
     },
+    "/experimental/session": {
+      "get": {
+        "operationId": "experimental.session.list",
+        "parameters": [
+          {
+            "in": "query",
+            "name": "directory",
+            "schema": {
+              "type": "string"
+            },
+            "description": "Filter sessions by project directory"
+          },
+          {
+            "in": "query",
+            "name": "roots",
+            "schema": {
+              "type": "boolean"
+            },
+            "description": "Only return root sessions (no parentID)"
+          },
+          {
+            "in": "query",
+            "name": "start",
+            "schema": {
+              "type": "number"
+            },
+            "description": "Filter sessions updated on or after this timestamp (milliseconds since epoch)"
+          },
+          {
+            "in": "query",
+            "name": "cursor",
+            "schema": {
+              "type": "number"
+            },
+            "description": "Return sessions updated before this timestamp (milliseconds since epoch)"
+          },
+          {
+            "in": "query",
+            "name": "search",
+            "schema": {
+              "type": "string"
+            },
+            "description": "Filter sessions by title (case-insensitive)"
+          },
+          {
+            "in": "query",
+            "name": "limit",
+            "schema": {
+              "type": "number"
+            },
+            "description": "Maximum number of sessions to return"
+          },
+          {
+            "in": "query",
+            "name": "archived",
+            "schema": {
+              "type": "boolean"
+            },
+            "description": "Include archived sessions (default false)"
+          }
+        ],
+        "summary": "List sessions",
+        "description": "Get a list of all OpenCode sessions across projects, sorted by most recently updated. Archived sessions are excluded by default.",
+        "responses": {
+          "200": {
+            "description": "List of sessions",
+            "content": {
+              "application/json": {
+                "schema": {
+                  "type": "array",
+                  "items": {
+                    "$ref": "#/components/schemas/GlobalSession"
+                  }
+                }
+              }
+            }
+          }
+        },
+        "x-codeSamples": [
+          {
+            "lang": "js",
+            "source": "import { createOpencodeClient } from \"@opencode-ai/sdk\n\nconst client = createOpencodeClient()\nawait client.experimental.session.list({\n  ...\n})"
+          }
+        ]
+      }
+    },
     "/experimental/resource": {
       "get": {
         "operationId": "experimental.resource.list",
@@ -10499,6 +10585,129 @@
         },
         "required": ["directory"]
       },
+      "ProjectSummary": {
+        "type": "object",
+        "properties": {
+          "id": {
+            "type": "string"
+          },
+          "name": {
+            "type": "string"
+          },
+          "worktree": {
+            "type": "string"
+          }
+        },
+        "required": ["id", "worktree"]
+      },
+      "GlobalSession": {
+        "type": "object",
+        "properties": {
+          "id": {
+            "type": "string",
+            "pattern": "^ses.*"
+          },
+          "slug": {
+            "type": "string"
+          },
+          "projectID": {
+            "type": "string"
+          },
+          "directory": {
+            "type": "string"
+          },
+          "parentID": {
+            "type": "string",
+            "pattern": "^ses.*"
+          },
+          "summary": {
+            "type": "object",
+            "properties": {
+              "additions": {
+                "type": "number"
+              },
+              "deletions": {
+                "type": "number"
+              },
+              "files": {
+                "type": "number"
+              },
+              "diffs": {
+                "type": "array",
+                "items": {
+                  "$ref": "#/components/schemas/FileDiff"
+                }
+              }
+            },
+            "required": ["additions", "deletions", "files"]
+          },
+          "share": {
+            "type": "object",
+            "properties": {
+              "url": {
+                "type": "string"
+              }
+            },
+            "required": ["url"]
+          },
+          "title": {
+            "type": "string"
+          },
+          "version": {
+            "type": "string"
+          },
+          "time": {
+            "type": "object",
+            "properties": {
+              "created": {
+                "type": "number"
+              },
+              "updated": {
+                "type": "number"
+              },
+              "compacting": {
+                "type": "number"
+              },
+              "archived": {
+                "type": "number"
+              }
+            },
+            "required": ["created", "updated"]
+          },
+          "permission": {
+            "$ref": "#/components/schemas/PermissionRuleset"
+          },
+          "revert": {
+            "type": "object",
+            "properties": {
+              "messageID": {
+                "type": "string"
+              },
+              "partID": {
+                "type": "string"
+              },
+              "snapshot": {
+                "type": "string"
+              },
+              "diff": {
+                "type": "string"
+              }
+            },
+            "required": ["messageID"]
+          },
+          "project": {
+            "anyOf": [
+              {
+                "$ref": "#/components/schemas/ProjectSummary"
+              },
+              {
+                "type": "null"
+              }
+            ]
+          }
+        },
+        "required": ["id", "slug", "projectID", "directory", "title", "version", "time", "project"]
+      },
       "McpResource": {
         "type": "object",
         "properties": {

packages/slack/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/slack",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "type": "module",
   "license": "MIT",
   "scripts": {

packages/ui/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/ui",
-  "version": "1.2.7",
+  "version": "1.2.10",
   "type": "module",
   "license": "MIT",
   "exports": {

packages/ui/src/components/collapsible.css

@@ -26,13 +26,16 @@
     [data-slot="collapsible-arrow"] {
       opacity: 0;
       transition: opacity 0.15s ease;
+      will-change: opacity;
+      transform: translateZ(0);
     }
 
     [data-slot="collapsible-arrow-icon"] {
       display: inline-flex;
       color: var(--icon-weaker);
-      transform: rotate(-90deg);
+      transform: translateZ(0) rotate(-90deg);
       transition: transform 0.15s ease;
+      will-change: transform;
     }
 
     &:hover [data-slot="collapsible-arrow"] {
@@ -74,7 +77,7 @@
     }
 
     [data-slot="collapsible-arrow-icon"] {
-      transform: rotate(0deg);
+      transform: translateZ(0) rotate(0deg);
     }
   }
 

packages/ui/src/components/message-part.css

@@ -179,6 +179,7 @@
 
 [data-component="text-part"] {
   width: 100%;
+  margin-top: 24px;
 
   [data-slot="text-part-body"] {
     margin-top: 0;
@@ -227,13 +228,18 @@
 [data-component="reasoning-part"] {
   width: 100%;
   color: var(--text-base);
-  font-size: var(--font-size-small);
-  line-height: var(--line-height-large);
+  line-height: var(--line-height-normal);
 
   [data-component="markdown"] {
     margin-top: 24px;
     font-style: normal;
     font-size: inherit;
+    color: var(--text-weak);
+
+    strong,
+    b {
+      color: var(--text-weak);
+    }
 
     p:has(strong) {
       margin-top: 24px;

packages/ui/src/components/message-part.tsx

@@ -96,6 +96,7 @@ export interface MessageProps {
   parts: PartType[]
   showAssistantCopyPartID?: string | null
   interrupted?: boolean
+  showReasoningSummaries?: boolean
 }
 
 export interface MessagePartProps {
@@ -104,6 +105,7 @@ export interface MessagePartProps {
   hideDetails?: boolean
   defaultOpen?: boolean
   showAssistantCopyPartID?: string | null
+  turnDurationMs?: number
 }
 
 export type PartComponent = Component<MessagePartProps>
@@ -149,6 +151,8 @@ function createThrottledValue(getValue: () => string) {
 function relativizeProjectPaths(text: string, directory?: string) {
   if (!text) return ""
   if (!directory) return text
+  if (directory === "/") return text
+  if (directory === "\\") return text
   return text.split(directory).join("")
 }
 
@@ -261,21 +265,23 @@ function list<T>(value: T[] | undefined | null, fallback: T[]) {
   return fallback
 }
 
-function renderable(part: PartType) {
+function renderable(part: PartType, showReasoningSummaries = true) {
   if (part.type === "tool") {
     if (HIDDEN_TOOLS.has(part.tool)) return false
     if (part.tool === "question") return part.state.status !== "pending" && part.state.status !== "running"
     return true
   }
   if (part.type === "text") return !!part.text?.trim()
-  if (part.type === "reasoning") return !!part.text?.trim()
+  if (part.type === "reasoning") return showReasoningSummaries && !!part.text?.trim()
   return !!PART_MAPPING[part.type]
 }
 
 export function AssistantParts(props: {
   messages: AssistantMessage[]
   showAssistantCopyPartID?: string | null
+  turnDurationMs?: number
   working?: boolean
+  showReasoningSummaries?: boolean
 }) {
   const data = useData()
   const emptyParts: PartType[] = []
@@ -296,7 +302,7 @@ export function AssistantParts(props: {
 
     const parts = props.messages.flatMap((message) =>
       list(data.store.part?.[message.id], emptyParts)
-        .filter(renderable)
+        .filter((part) => renderable(part, props.showReasoningSummaries ?? true))
         .map((part) => ({ message, part })),
     )
 
@@ -365,6 +371,7 @@ export function AssistantParts(props: {
                   part={entry().part}
                   message={entry().message}
                   showAssistantCopyPartID={props.showAssistantCopyPartID}
+                  turnDurationMs={props.turnDurationMs}
                 />
               )}
             </Show>
@@ -475,6 +482,7 @@ export function Message(props: MessageProps) {
             message={assistantMessage() as AssistantMessage}
             parts={props.parts}
             showAssistantCopyPartID={props.showAssistantCopyPartID}
+            showReasoningSummaries={props.showReasoningSummaries}
           />
         )}
       </Match>
@@ -486,6 +494,7 @@ export function AssistantMessageDisplay(props: {
   message: AssistantMessage
   parts: PartType[]
   showAssistantCopyPartID?: string | null
+  showReasoningSummaries?: boolean
 }) {
   const grouped = createMemo(() => {
     const keys: string[] = []
@@ -514,7 +523,7 @@ export function AssistantMessageDisplay(props: {
     }
 
     parts.forEach((part, index) => {
-      if (!renderable(part)) return
+      if (!renderable(part, props.showReasoningSummaries ?? true)) return
 
       if (isContextGroupTool(part)) {
         if (start < 0) start = index
@@ -849,6 +858,7 @@ export function Part(props: MessagePartProps) {
         hideDetails={props.hideDetails}
         defaultOpen={props.defaultOpen}
         showAssistantCopyPartID={props.showAssistantCopyPartID}
+        turnDurationMs={props.turnDurationMs}
       />
     </Show>
   )
@@ -1060,8 +1070,12 @@ PART_MAPPING["text"] = function TextPartDisplay(props) {
     if (props.message.role !== "assistant") return ""
     const message = props.message as AssistantMessage
     const completed = message.time.completed
-    if (typeof completed !== "number") return ""
-    const ms = completed - message.time.created
+    const ms =
+      typeof props.turnDurationMs === "number"
+        ? props.turnDurationMs
+        : typeof completed === "number"
+          ? completed - message.time.created
+          : -1
     if (!(ms >= 0)) return ""
     const total = Math.round(ms / 1000)
     if (total < 60) return `${total}s`
@@ -1593,6 +1607,12 @@ ToolRegistry.register({
     const i18n = useI18n()
     const diffComponent = useDiffComponent()
     const files = createMemo(() => (props.metadata.files ?? []) as ApplyPatchFile[])
+    const pending = createMemo(() => props.status === "pending" || props.status === "running")
+    const single = createMemo(() => {
+      const list = files()
+      if (list.length !== 1) return
+      return list[0]
+    })
     const [expanded, setExpanded] = createSignal<string[]>([])
     let seeded = false
 
@@ -1611,100 +1631,147 @@ ToolRegistry.register({
     })
 
     return (
-      <div data-component="apply-patch-tool">
-        <BasicTool
-          {...props}
-          icon="code-lines"
-          defer
-          trigger={{
-            title: i18n.t("ui.tool.patch"),
-            subtitle: subtitle(),
-          }}
-        >
-          <Show when={files().length > 0}>
-            <Accordion
-              multiple
-              data-scope="apply-patch"
-              style={{ "--sticky-accordion-offset": "40px" }}
-              value={expanded()}
-              onChange={(value) => setExpanded(Array.isArray(value) ? value : value ? [value] : [])}
+      <Show
+        when={single()}
+        fallback={
+          <div data-component="apply-patch-tool">
+            <BasicTool
+              {...props}
+              icon="code-lines"
+              defer
+              trigger={{
+                title: i18n.t("ui.tool.patch"),
+                subtitle: subtitle(),
+              }}
             >
-              <For each={files()}>
-                {(file) => {
-                  const active = createMemo(() => expanded().includes(file.filePath))
-                  const [visible, setVisible] = createSignal(false)
+              <Show when={files().length > 0}>
+                <Accordion
+                  multiple
+                  data-scope="apply-patch"
+                  style={{ "--sticky-accordion-offset": "40px" }}
+                  value={expanded()}
+                  onChange={(value) => setExpanded(Array.isArray(value) ? value : value ? [value] : [])}
+                >
+                  <For each={files()}>
+                    {(file) => {
+                      const active = createMemo(() => expanded().includes(file.filePath))
+                      const [visible, setVisible] = createSignal(false)
 
-                  createEffect(() => {
-                    if (!active()) {
-                      setVisible(false)
-                      return
-                    }
+                      createEffect(() => {
+                        if (!active()) {
+                          setVisible(false)
+                          return
+                        }
 
-                    requestAnimationFrame(() => {
-                      if (!active()) return
-                      setVisible(true)
-                    })
-                  })
+                        requestAnimationFrame(() => {
+                          if (!active()) return
+                          setVisible(true)
+                        })
+                      })
 
-                  return (
-                    <Accordion.Item value={file.filePath} data-type={file.type}>
-                      <StickyAccordionHeader>
-                        <Accordion.Trigger>
-                          <div data-slot="apply-patch-trigger-content">
-                            <div data-slot="apply-patch-file-info">
-                              <FileIcon node={{ path: file.relativePath, type: "file" }} />
-                              <div data-slot="apply-patch-file-name-container">
-                                <Show when={file.relativePath.includes("/")}>
-                                  <span data-slot="apply-patch-directory">{`\u202A${getDirectory(file.relativePath)}\u202C`}</span>
-                                </Show>
-                                <span data-slot="apply-patch-filename">{getFilename(file.relativePath)}</span>
+                      return (
+                        <Accordion.Item value={file.filePath} data-type={file.type}>
+                          <StickyAccordionHeader>
+                            <Accordion.Trigger>
+                              <div data-slot="apply-patch-trigger-content">
+                                <div data-slot="apply-patch-file-info">
+                                  <FileIcon node={{ path: file.relativePath, type: "file" }} />
+                                  <div data-slot="apply-patch-file-name-container">
+                                    <Show when={file.relativePath.includes("/")}>
+                                      <span data-slot="apply-patch-directory">{`\u202A${getDirectory(file.relativePath)}\u202C`}</span>
+                                    </Show>
+                                    <span data-slot="apply-patch-filename">{getFilename(file.relativePath)}</span>
+                                  </div>
+                                </div>
+                                <div data-slot="apply-patch-trigger-actions">
+                                  <Switch>
+                                    <Match when={file.type === "add"}>
+                                      <span data-slot="apply-patch-change" data-type="added">
+                                        {i18n.t("ui.patch.action.created")}
+                                      </span>
+                                    </Match>
+                                    <Match when={file.type === "delete"}>
+                                      <span data-slot="apply-patch-change" data-type="removed">
+                                        {i18n.t("ui.patch.action.deleted")}
+                                      </span>
+                                    </Match>
+                                    <Match when={file.type === "move"}>
+                                      <span data-slot="apply-patch-change" data-type="modified">
+                                        {i18n.t("ui.patch.action.moved")}
+                                      </span>
+                                    </Match>
+                                    <Match when={true}>
+                                      <DiffChanges changes={{ additions: file.additions, deletions: file.deletions }} />
+                                    </Match>
+                                  </Switch>
+                                  <Icon name="chevron-grabber-vertical" size="small" />
+                                </div>
                               </div>
-                            </div>
-                            <div data-slot="apply-patch-trigger-actions">
-                              <Switch>
-                                <Match when={file.type === "add"}>
-                                  <span data-slot="apply-patch-change" data-type="added">
-                                    {i18n.t("ui.patch.action.created")}
-                                  </span>
-                                </Match>
-                                <Match when={file.type === "delete"}>
-                                  <span data-slot="apply-patch-change" data-type="removed">
-                                    {i18n.t("ui.patch.action.deleted")}
-                                  </span>
-                                </Match>
-                                <Match when={file.type === "move"}>
-                                  <span data-slot="apply-patch-change" data-type="modified">
-                                    {i18n.t("ui.patch.action.moved")}
-                                  </span>
-                                </Match>
-                                <Match when={true}>
-                                  <DiffChanges changes={{ additions: file.additions, deletions: file.deletions }} />
-                                </Match>
-                              </Switch>
-                              <Icon name="chevron-grabber-vertical" size="small" />
-                            </div>
-                          </div>
-                        </Accordion.Trigger>
-                      </StickyAccordionHeader>
-                      <Accordion.Content>
-                        <Show when={visible()}>
-                          <div data-component="apply-patch-file-diff">
-                            <Dynamic
-                              component={diffComponent}
-                              before={{ name: file.filePath, contents: file.before }}
-                              after={{ name: file.movePath ?? file.filePath, contents: file.after }}
-                            />
-                          </div>
-                        </Show>
-                      </Accordion.Content>
-                    </Accordion.Item>
-                  )
-                }}
-              </For>
-            </Accordion>
-          </Show>
-        </BasicTool>
-      </div>
+                            </Accordion.Trigger>
+                          </StickyAccordionHeader>
+                          <Accordion.Content>
+                            <Show when={visible()}>
+                              <div data-component="apply-patch-file-diff">
+                                <Dynamic
+                                  component={diffComponent}
+                                  before={{ name: file.filePath, contents: file.before }}
+                                  after={{ name: file.movePath ?? file.filePath, contents: file.after }}
+                                />
+                              </div>
+                            </Show>
+                          </Accordion.Content>
+                        </Accordion.Item>
+                      )
+                    }}
+                  </For>
+                </Accordion>
+              </Show>
+            </BasicTool>
+          </div>
+        }
+      >
+        {(file) => (
+          <BasicTool
+            {...props}
+            icon="code-lines"
+            defer
+            trigger={
+              <div data-component="edit-trigger">
+                <div data-slot="message-part-title-area">
+                  <div data-slot="message-part-title">
+                    <span data-slot="message-part-title-text">
+                      <Show when={pending()} fallback={i18n.t("ui.tool.patch")}>
+                        <TextShimmer text={i18n.t("ui.tool.patch")} />
+                      </Show>
+                    </span>
+                    <Show when={!pending()}>
+                      <span data-slot="message-part-title-filename">{getFilename(file().relativePath)}</span>
+                    </Show>
+                  </div>
+                  <Show when={!pending() && file().relativePath.includes("/")}>
+                    <div data-slot="message-part-path">
+                      <span data-slot="message-part-directory">{getDirectory(file().relativePath)}</span>
+                    </div>
+                  </Show>
+                </div>
+                <div data-slot="message-part-actions">
+                  <Show when={!pending()}>
+                    <DiffChanges changes={{ additions: file().additions, deletions: file().deletions }} />
+                  </Show>
+                </div>
+              </div>
+            }
+          >
+            <div data-component="edit-content">
+              <Dynamic
+                component={diffComponent}
+                before={{ name: file().filePath, contents: file().before }}
+                after={{ name: file().movePath ?? file().filePath, contents: file().after }}
+              />
+            </div>
+          </BasicTool>
+        )}
+      </Show>
     )
   },
 })

packages/ui/src/components/scroll-view.css

@@ -0,0 +1,61 @@
+.scroll-view {
+  position: relative;
+  overflow: hidden;
+}
+
+.scroll-view__viewport {
+  height: 100%;
+  width: 100%;
+  overflow-y: auto;
+  scrollbar-width: none;
+  outline: none;
+}
+
+.scroll-view__viewport::-webkit-scrollbar {
+  display: none;
+}
+
+.scroll-view__thumb {
+  position: absolute;
+  right: 0;
+  top: 0;
+  width: 16px;
+  transition: opacity 200ms ease;
+  cursor: default;
+  user-select: none;
+  opacity: 0;
+}
+
+.scroll-view__thumb::after {
+  content: "";
+  position: absolute;
+  right: 4px;
+  top: 0;
+  bottom: 0;
+  width: 6px;
+  border-radius: 9999px;
+  background-color: var(--border-weak-base);
+  backdrop-filter: blur(4px);
+  transition: background-color 150ms ease;
+}
+
+.scroll-view__thumb:hover::after,
+.scroll-view__thumb[data-dragging="true"]::after {
+  background-color: var(--border-strong-base);
+}
+
+.dark .scroll-view__thumb::after,
+[data-theme="dark"] .scroll-view__thumb::after {
+  background-color: var(--border-weak-base);
+}
+
+.dark .scroll-view__thumb:hover::after,
+[data-theme="dark"] .scroll-view__thumb:hover::after,
+.dark .scroll-view__thumb[data-dragging="true"]::after,
+[data-theme="dark"] .scroll-view__thumb[data-dragging="true"]::after {
+  background-color: var(--border-strong-base);
+}
+
+.scroll-view__thumb[data-visible="true"] {
+  opacity: 1;
+}

packages/ui/src/components/scroll-view.tsx

@@ -0,0 +1,217 @@
+import { createSignal, onCleanup, onMount, splitProps, type ComponentProps, Show, mergeProps } from "solid-js"
+
+export interface ScrollViewProps extends ComponentProps<"div"> {
+  viewportRef?: (el: HTMLDivElement) => void
+  orientation?: "vertical" | "horizontal" // currently only vertical is fully implemented for thumb
+}
+
+export function ScrollView(props: ScrollViewProps) {
+  const merged = mergeProps({ orientation: "vertical" }, props)
+  const [local, events, rest] = splitProps(
+    merged,
+    ["class", "children", "viewportRef", "orientation", "style"],
+    [
+      "onScroll",
+      "onWheel",
+      "onTouchStart",
+      "onTouchMove",
+      "onTouchEnd",
+      "onTouchCancel",
+      "onPointerDown",
+      "onClick",
+      "onKeyDown",
+    ],
+  )
+
+  let rootRef!: HTMLDivElement
+  let viewportRef!: HTMLDivElement
+  let thumbRef!: HTMLDivElement
+
+  const [isHovered, setIsHovered] = createSignal(false)
+  const [isDragging, setIsDragging] = createSignal(false)
+
+  const [thumbHeight, setThumbHeight] = createSignal(0)
+  const [thumbTop, setThumbTop] = createSignal(0)
+  const [showThumb, setShowThumb] = createSignal(false)
+
+  const updateThumb = () => {
+    if (!viewportRef) return
+    const { scrollTop, scrollHeight, clientHeight } = viewportRef
+
+    if (scrollHeight <= clientHeight || scrollHeight === 0) {
+      setShowThumb(false)
+      return
+    }
+
+    setShowThumb(true)
+    const trackPadding = 8
+    const trackHeight = clientHeight - trackPadding * 2
+
+    const minThumbHeight = 32
+    // Calculate raw thumb height based on ratio
+    let height = (clientHeight / scrollHeight) * trackHeight
+    height = Math.max(height, minThumbHeight)
+
+    const maxScrollTop = scrollHeight - clientHeight
+    const maxThumbTop = trackHeight - height
+
+    const top = maxScrollTop > 0 ? (scrollTop / maxScrollTop) * maxThumbTop : 0
+
+    // Ensure thumb stays within bounds (shouldn't be necessary due to math above, but good for safety)
+    const boundedTop = trackPadding + Math.max(0, Math.min(top, maxThumbTop))
+
+    setThumbHeight(height)
+    setThumbTop(boundedTop)
+  }
+
+  onMount(() => {
+    if (local.viewportRef) {
+      local.viewportRef(viewportRef)
+    }
+
+    const observer = new ResizeObserver(() => {
+      updateThumb()
+    })
+
+    observer.observe(viewportRef)
+    // Also observe the first child if possible to catch content changes
+    if (viewportRef.firstElementChild) {
+      observer.observe(viewportRef.firstElementChild)
+    }
+
+    onCleanup(() => {
+      observer.disconnect()
+    })
+
+    updateThumb()
+  })
+
+  let startY = 0
+  let startScrollTop = 0
+
+  const onThumbPointerDown = (e: PointerEvent) => {
+    e.preventDefault()
+    e.stopPropagation()
+    setIsDragging(true)
+    startY = e.clientY
+    startScrollTop = viewportRef.scrollTop
+
+    thumbRef.setPointerCapture(e.pointerId)
+
+    const onPointerMove = (e: PointerEvent) => {
+      const deltaY = e.clientY - startY
+      const { scrollHeight, clientHeight } = viewportRef
+      const maxScrollTop = scrollHeight - clientHeight
+      const maxThumbTop = clientHeight - thumbHeight()
+
+      if (maxThumbTop > 0) {
+        const scrollDelta = deltaY * (maxScrollTop / maxThumbTop)
+        viewportRef.scrollTop = startScrollTop + scrollDelta
+      }
+    }
+
+    const onPointerUp = (e: PointerEvent) => {
+      setIsDragging(false)
+      thumbRef.releasePointerCapture(e.pointerId)
+      thumbRef.removeEventListener("pointermove", onPointerMove)
+      thumbRef.removeEventListener("pointerup", onPointerUp)
+    }
+
+    thumbRef.addEventListener("pointermove", onPointerMove)
+    thumbRef.addEventListener("pointerup", onPointerUp)
+  }
+
+  // Keybinds implementation
+  // We ensure the viewport has a tabindex so it can receive focus
+  // We can also explicitly catch PageUp/Down if we want smooth scroll or specific behavior,
+  // but native usually handles this perfectly. Let's explicitly ensure it behaves well.
+  const onKeyDown = (e: KeyboardEvent) => {
+    // If user is focused on an input inside the scroll view, don't hijack keys
+    if (document.activeElement && ["INPUT", "TEXTAREA", "SELECT"].includes(document.activeElement.tagName)) {
+      return
+    }
+
+    const scrollAmount = viewportRef.clientHeight * 0.8
+    const lineAmount = 40
+
+    switch (e.key) {
+      case "PageDown":
+        e.preventDefault()
+        viewportRef.scrollBy({ top: scrollAmount, behavior: "smooth" })
+        break
+      case "PageUp":
+        e.preventDefault()
+        viewportRef.scrollBy({ top: -scrollAmount, behavior: "smooth" })
+        break
+      case "Home":
+        e.preventDefault()
+        viewportRef.scrollTo({ top: 0, behavior: "smooth" })
+        break
+      case "End":
+        e.preventDefault()
+        viewportRef.scrollTo({ top: viewportRef.scrollHeight, behavior: "smooth" })
+        break
+      case "ArrowUp":
+        e.preventDefault()
+        viewportRef.scrollBy({ top: -lineAmount, behavior: "smooth" })
+        break
+      case "ArrowDown":
+        e.preventDefault()
+        viewportRef.scrollBy({ top: lineAmount, behavior: "smooth" })
+        break
+    }
+  }
+
+  return (
+    <div
+      ref={rootRef}
+      class={`scroll-view ${local.class || ""}`}
+      style={local.style}
+      onPointerEnter={() => setIsHovered(true)}
+      onPointerLeave={() => setIsHovered(false)}
+      {...rest}
+    >
+      {/* Viewport */}
+      <div
+        ref={viewportRef}
+        class="scroll-view__viewport"
+        onScroll={(e) => {
+          updateThumb()
+          if (typeof events.onScroll === "function") events.onScroll(e as any)
+        }}
+        onWheel={events.onWheel as any}
+        onTouchStart={events.onTouchStart as any}
+        onTouchMove={events.onTouchMove as any}
+        onTouchEnd={events.onTouchEnd as any}
+        onTouchCancel={events.onTouchCancel as any}
+        onPointerDown={events.onPointerDown as any}
+        onClick={events.onClick as any}
+        tabIndex={0}
+        role="region"
+        aria-label="scrollable content"
+        onKeyDown={(e) => {
+          onKeyDown(e)
+          if (typeof events.onKeyDown === "function") events.onKeyDown(e as any)
+        }}
+      >
+        {local.children}
+      </div>
+
+      {/* Thumb Overlay */}
+      <Show when={showThumb()}>
+        <div
+          ref={thumbRef}
+          onPointerDown={onThumbPointerDown}
+          class="scroll-view__thumb"
+          data-visible={isHovered() || isDragging()}
+          data-dragging={isDragging()}
+          style={{
+            height: `${thumbHeight()}px`,
+            transform: `translateY(${thumbTop()}px)`,
+            "z-index": 100, // ensure it displays over content
+          }}
+        />
+      </Show>
+    </div>
+  )
+}

packages/ui/src/components/session-review.css

@@ -12,6 +12,7 @@
 
   [data-slot="session-review-container"] {
     flex: 1 1 auto;
+    padding-right: 4px;
   }
 
   [data-slot="session-review-header"] {
@@ -40,7 +41,6 @@
     display: flex;
     align-items: center;
     column-gap: 12px;
-    padding-right: 1px;
   }
 
   [data-slot="session-review-actions"] [data-component="radio-group"] {

packages/ui/src/components/session-review.tsx

@@ -7,6 +7,7 @@ import { Icon } from "./icon"
 import { LineComment, LineCommentEditor } from "./line-comment"
 import { StickyAccordionHeader } from "./sticky-accordion-header"
 import { Tooltip } from "./tooltip"
+import { ScrollView } from "./scroll-view"
 import { useDiffComponent } from "../context/diff"
 import { useI18n } from "../context/i18n"
 import { getDirectory, getFilename } from "@opencode-ai/util/path"
@@ -188,8 +189,10 @@ export const SessionReview = (props: SessionReviewProps) => {
   const [opened, setOpened] = createSignal<SessionReviewFocus | null>(null)
 
   const open = () => props.open ?? store.open
+  const files = createMemo(() => props.diffs.map((d) => d.file))
+  const diffs = createMemo(() => new Map(props.diffs.map((d) => [d.file, d] as const)))
   const diffStyle = () => props.diffStyle ?? (props.split ? "split" : "unified")
-  const hasDiffs = () => props.diffs.length > 0
+  const hasDiffs = () => files().length > 0
 
   const handleChange = (open: string[]) => {
     props.onOpenChange?.(open)
@@ -198,7 +201,7 @@ export const SessionReview = (props: SessionReviewProps) => {
   }
 
   const handleExpandOrCollapseAll = () => {
-    const next = open().length > 0 ? [] : props.diffs.map((d) => d.file)
+    const next = open().length > 0 ? [] : files()
     handleChange(next)
   }
 
@@ -274,13 +277,13 @@ export const SessionReview = (props: SessionReviewProps) => {
   })
 
   return (
-    <div
+    <ScrollView
       data-component="session-review"
-      ref={(el) => {
+      viewportRef={(el) => {
         scroll = el
         props.scrollRef?.(el)
       }}
-      onScroll={props.onScroll}
+      onScroll={props.onScroll as any}
       classList={{
         ...(props.classList ?? {}),
         [props.classes?.root ?? ""]: !!props.classes?.root,
@@ -321,51 +324,54 @@ export const SessionReview = (props: SessionReviewProps) => {
       <div data-slot="session-review-container" class={props.classes?.container}>
         <Show when={hasDiffs()} fallback={props.empty}>
           <Accordion multiple value={open()} onChange={handleChange}>
-            <For each={props.diffs}>
-              {(diff) => {
+            <For each={files()}>
+              {(file) => {
                 let wrapper: HTMLDivElement | undefined
 
-                const expanded = createMemo(() => open().includes(diff.file))
+                const diff = createMemo(() => diffs().get(file))
+                const item = () => diff()!
+
+                const expanded = createMemo(() => open().includes(file))
                 const [force, setForce] = createSignal(false)
 
-                const comments = createMemo(() => (props.comments ?? []).filter((c) => c.file === diff.file))
+                const comments = createMemo(() => (props.comments ?? []).filter((c) => c.file === file))
                 const commentedLines = createMemo(() => comments().map((c) => c.selection))
 
-                const beforeText = () => (typeof diff.before === "string" ? diff.before : "")
-                const afterText = () => (typeof diff.after === "string" ? diff.after : "")
-                const changedLines = () => diff.additions + diff.deletions
+                const beforeText = () => (typeof item().before === "string" ? item().before : "")
+                const afterText = () => (typeof item().after === "string" ? item().after : "")
+                const changedLines = () => item().additions + item().deletions
 
                 const tooLarge = createMemo(() => {
                   if (!expanded()) return false
                   if (force()) return false
-                  if (isImageFile(diff.file)) return false
+                  if (isImageFile(file)) return false
                   return changedLines() > MAX_DIFF_CHANGED_LINES
                 })
 
-                const isAdded = () => diff.status === "added" || (beforeText().length === 0 && afterText().length > 0)
+                const isAdded = () => item().status === "added" || (beforeText().length === 0 && afterText().length > 0)
                 const isDeleted = () =>
-                  diff.status === "deleted" || (afterText().length === 0 && beforeText().length > 0)
-                const isImage = () => isImageFile(diff.file)
-                const isAudio = () => isAudioFile(diff.file)
+                  item().status === "deleted" || (afterText().length === 0 && beforeText().length > 0)
+                const isImage = () => isImageFile(file)
+                const isAudio = () => isAudioFile(file)
 
-                const diffImageSrc = dataUrlFromValue(diff.after) ?? dataUrlFromValue(diff.before)
-                const [imageSrc, setImageSrc] = createSignal<string | undefined>(diffImageSrc)
+                const diffImageSrc = createMemo(() => dataUrlFromValue(item().after) ?? dataUrlFromValue(item().before))
+                const [imageSrc, setImageSrc] = createSignal<string | undefined>(diffImageSrc())
                 const [imageStatus, setImageStatus] = createSignal<"idle" | "loading" | "error">("idle")
 
-                const diffAudioSrc = dataUrlFromValue(diff.after) ?? dataUrlFromValue(diff.before)
-                const [audioSrc, setAudioSrc] = createSignal<string | undefined>(diffAudioSrc)
+                const diffAudioSrc = createMemo(() => dataUrlFromValue(item().after) ?? dataUrlFromValue(item().before))
+                const [audioSrc, setAudioSrc] = createSignal<string | undefined>(diffAudioSrc())
                 const [audioStatus, setAudioStatus] = createSignal<"idle" | "loading" | "error">("idle")
                 const [audioMime, setAudioMime] = createSignal<string | undefined>(undefined)
 
                 const selectedLines = createMemo(() => {
                   const current = selection()
-                  if (!current || current.file !== diff.file) return null
+                  if (!current || current.file !== file) return null
                   return current.range
                 })
 
                 const draftRange = createMemo(() => {
                   const current = commenting()
-                  if (!current || current.file !== diff.file) return null
+                  if (!current || current.file !== file) return null
                   return current.range
                 })
 
@@ -416,6 +422,21 @@ export const SessionReview = (props: SessionReviewProps) => {
                   requestAnimationFrame(updateAnchors)
                 }
 
+                createEffect(() => {
+                  if (!isImage()) return
+                  const src = diffImageSrc()
+                  setImageSrc(src)
+                  setImageStatus("idle")
+                })
+
+                createEffect(() => {
+                  if (!isAudio()) return
+                  const src = diffAudioSrc()
+                  setAudioSrc(src)
+                  setAudioStatus("idle")
+                  setAudioMime(undefined)
+                })
+
                 createEffect(() => {
                   comments()
                   scheduleAnchors()
@@ -429,7 +450,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                 })
 
                 createEffect(() => {
-                  if (!open().includes(diff.file)) return
+                  if (!open().includes(file)) return
                   if (!isImage()) return
                   if (imageSrc()) return
                   if (imageStatus() !== "idle") return
@@ -439,7 +460,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                   if (!reader) return
 
                   setImageStatus("loading")
-                  reader(diff.file)
+                  reader(file)
                     .then((result) => {
                       const src = dataUrl(result)
                       if (!src) {
@@ -455,7 +476,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                 })
 
                 createEffect(() => {
-                  if (!open().includes(diff.file)) return
+                  if (!open().includes(file)) return
                   if (!isAudio()) return
                   if (audioSrc()) return
                   if (audioStatus() !== "idle") return
@@ -464,7 +485,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                   if (!reader) return
 
                   setAudioStatus("loading")
-                  reader(diff.file)
+                  reader(file)
                     .then((result) => {
                       const src = dataUrl(result)
                       if (!src) {
@@ -488,7 +509,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                     return
                   }
 
-                  setSelection({ file: diff.file, range })
+                  setSelection({ file, range })
                 }
 
                 const handleLineSelectionEnd = (range: SelectedLineRange | null) => {
@@ -499,8 +520,8 @@ export const SessionReview = (props: SessionReviewProps) => {
                     return
                   }
 
-                  setSelection({ file: diff.file, range })
-                  setCommenting({ file: diff.file, range })
+                  setSelection({ file, range })
+                  setCommenting({ file, range })
                 }
 
                 const openComment = (comment: SessionReviewComment) => {
@@ -516,22 +537,22 @@ export const SessionReview = (props: SessionReviewProps) => {
 
                 return (
                   <Accordion.Item
-                    value={diff.file}
-                    id={diffId(diff.file)}
-                    data-file={diff.file}
+                    value={file}
+                    id={diffId(file)}
+                    data-file={file}
                     data-slot="session-review-accordion-item"
-                    data-selected={props.focusedFile === diff.file ? "" : undefined}
+                    data-selected={props.focusedFile === file ? "" : undefined}
                   >
                     <StickyAccordionHeader>
                       <Accordion.Trigger>
                         <div data-slot="session-review-trigger-content">
                           <div data-slot="session-review-file-info">
-                            <FileIcon node={{ path: diff.file, type: "file" }} />
+                            <FileIcon node={{ path: file, type: "file" }} />
                             <div data-slot="session-review-file-name-container">
-                              <Show when={diff.file.includes("/")}>
-                                <span data-slot="session-review-directory">{`\u202A${getDirectory(diff.file)}\u202C`}</span>
+                              <Show when={file.includes("/")}>
+                                <span data-slot="session-review-directory">{`\u202A${getDirectory(file)}\u202C`}</span>
                               </Show>
-                              <span data-slot="session-review-filename">{getFilename(diff.file)}</span>
+                              <span data-slot="session-review-filename">{getFilename(file)}</span>
                               <Show when={props.onViewFile}>
                                 <Tooltip value="Open file" placement="top" gutter={4}>
                                   <button
@@ -540,7 +561,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                                     aria-label="Open file"
                                     onClick={(e) => {
                                       e.stopPropagation()
-                                      props.onViewFile?.(diff.file)
+                                      props.onViewFile?.(file)
                                     }}
                                   >
                                     <Icon name="open-file" size="small" />
@@ -556,7 +577,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                                   <span data-slot="session-review-change" data-type="added">
                                     {i18n.t("ui.sessionReview.change.added")}
                                   </span>
-                                  <DiffChanges changes={diff} />
+                                  <DiffChanges changes={item()} />
                                 </div>
                               </Match>
                               <Match when={isDeleted()}>
@@ -570,7 +591,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                                 </span>
                               </Match>
                               <Match when={true}>
-                                <DiffChanges changes={diff} />
+                                <DiffChanges changes={item()} />
                               </Match>
                             </Switch>
                             <span data-slot="session-review-diff-chevron">
@@ -585,7 +606,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                         data-slot="session-review-diff-wrapper"
                         ref={(el) => {
                           wrapper = el
-                          anchors.set(diff.file, el)
+                          anchors.set(file, el)
                           scheduleAnchors()
                         }}
                       >
@@ -593,7 +614,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                           <Switch>
                             <Match when={isImage() && imageSrc()}>
                               <div data-slot="session-review-image-container">
-                                <img data-slot="session-review-image" src={imageSrc()} alt={diff.file} />
+                                <img data-slot="session-review-image" src={imageSrc()} alt={file} />
                               </div>
                             </Match>
                             <Match when={isImage() && isDeleted()}>
@@ -633,7 +654,7 @@ export const SessionReview = (props: SessionReviewProps) => {
                             <Match when={!isImage()}>
                               <Dynamic
                                 component={diffComponent}
-                                preloadedDiff={diff.preloaded}
+                                preloadedDiff={item().preloaded}
                                 diffStyle={diffStyle()}
                                 onRendered={() => {
                                   props.onDiffRendered?.()
@@ -645,12 +666,12 @@ export const SessionReview = (props: SessionReviewProps) => {
                                 selectedLines={selectedLines()}
                                 commentedLines={commentedLines()}
                                 before={{
-                                  name: diff.file!,
-                                  contents: typeof diff.before === "string" ? diff.before : "",
+                                  name: file,
+                                  contents: typeof item().before === "string" ? item().before : "",
                                 }}
                                 after={{
-                                  name: diff.file!,
-                                  contents: typeof diff.after === "string" ? diff.after : "",
+                                  name: file,
+                                  contents: typeof item().after === "string" ? item().after : "",
                                 }}
                               />
                             </Match>
@@ -688,10 +709,10 @@ export const SessionReview = (props: SessionReviewProps) => {
                                   onCancel={() => setCommenting(null)}
                                   onSubmit={(comment) => {
                                     props.onLineComment?.({
-                                      file: diff.file,
+                                      file,
                                       selection: range(),
                                       comment,
-                                      preview: selectionPreview(diff, range()),
+                                      preview: selectionPreview(item(), range()),
                                     })
                                     setCommenting(null)
                                   }}
@@ -709,6 +730,6 @@ export const SessionReview = (props: SessionReviewProps) => {
           </Accordion>
         </Show>
       </div>
-    </div>
+    </ScrollView>
   )
 }

packages/ui/src/components/session-turn.css

@@ -41,6 +41,8 @@
     display: flex;
     align-items: center;
     gap: 8px;
+    width: 100%;
+    min-width: 0;
     color: var(--text-weak);
     font-family: var(--font-family-sans);
     font-size: var(--font-size-base);
@@ -52,6 +54,16 @@
       width: 16px;
       height: 16px;
     }
+
+    [data-slot="session-turn-thinking-heading"] {
+      flex: 1 1 auto;
+      min-width: 0;
+      overflow: hidden;
+      text-overflow: ellipsis;
+      white-space: nowrap;
+      color: var(--text-weaker);
+      font-weight: var(--font-weight-regular);
+    }
   }
 
   .error-card {
@@ -129,6 +141,11 @@
     gap: 8px;
     flex-shrink: 0;
 
+    [data-slot="collapsible-arrow"] {
+      margin-left: -6px;
+      transform: translateY(2px);
+    }
+
     [data-component="diff-changes"][data-variant="bars"] {
       transform: translateY(1px);
     }

packages/ui/src/components/session-turn.tsx

@@ -6,7 +6,7 @@ import { Binary } from "@opencode-ai/util/binary"
 import { getDirectory, getFilename } from "@opencode-ai/util/path"
 import { createEffect, createMemo, createSignal, For, on, ParentProps, Show } from "solid-js"
 import { Dynamic } from "solid-js/web"
-import { AssistantParts, Message } from "./message-part"
+import { AssistantParts, Message, PART_MAPPING } from "./message-part"
 import { Card } from "./card"
 import { Accordion } from "./accordion"
 import { StickyAccordionHeader } from "./sticky-accordion-header"
@@ -83,15 +83,55 @@ function list<T>(value: T[] | undefined | null, fallback: T[]) {
 
 const hidden = new Set(["todowrite", "todoread"])
 
-function visible(part: PartType) {
+function partState(part: PartType, showReasoningSummaries: boolean) {
   if (part.type === "tool") {
-    if (hidden.has(part.tool)) return false
-    if (part.tool === "question") return part.state.status !== "pending" && part.state.status !== "running"
-    return true
+    if (hidden.has(part.tool)) return
+    if (part.tool === "question" && (part.state.status === "pending" || part.state.status === "running")) return
+    return "visible" as const
+  }
+  if (part.type === "text") return part.text?.trim() ? ("visible" as const) : undefined
+  if (part.type === "reasoning") {
+    if (showReasoningSummaries) return "visible" as const
+    return
+  }
+  if (PART_MAPPING[part.type]) return "visible" as const
+  return
+}
+
+function clean(value: string) {
+  return value
+    .replace(/`([^`]+)`/g, "$1")
+    .replace(/\[([^\]]+)\]\([^\)]+\)/g, "$1")
+    .replace(/[*_~]+/g, "")
+    .trim()
+}
+
+function heading(text: string) {
+  const markdown = text.replace(/\r\n?/g, "\n")
+
+  const html = markdown.match(/<h[1-6][^>]*>([\s\S]*?)<\/h[1-6]>/i)
+  if (html?.[1]) {
+    const value = clean(html[1].replace(/<[^>]+>/g, " "))
+    if (value) return value
+  }
+
+  const atx = markdown.match(/^\s{0,3}#{1,6}[ \t]+(.+?)(?:[ \t]+#+[ \t]*)?$/m)
+  if (atx?.[1]) {
+    const value = clean(atx[1])
+    if (value) return value
+  }
+
+  const setext = markdown.match(/^([^\n]+)\n(?:=+|-+)\s*$/m)
+  if (setext?.[1]) {
+    const value = clean(setext[1])
+    if (value) return value
+  }
+
+  const strong = markdown.match(/^\s*(?:\*\*|__)(.+?)(?:\*\*|__)\s*$/m)
+  if (strong?.[1]) {
+    const value = clean(strong[1])
+    if (value) return value
   }
-  if (part.type === "text") return !!part.text?.trim()
-  if (part.type === "reasoning") return !!part.text?.trim()
-  return false
 }
 
 export function SessionTurn(
@@ -99,6 +139,7 @@ export function SessionTurn(
     sessionID: string
     messageID: string
     lastUserMessageID?: string
+    showReasoningSummaries?: boolean
     onUserInteracted?: () => void
     classes?: {
       root?: string
@@ -242,17 +283,57 @@ export function SessionTurn(
 
   const status = createMemo(() => data.store.session_status[props.sessionID] ?? idle)
   const working = createMemo(() => status().type !== "idle" && isLastUserMessage())
+  const showReasoningSummaries = createMemo(() => props.showReasoningSummaries ?? true)
 
   const assistantCopyPartID = createMemo(() => {
     if (working()) return null
     return showAssistantCopyPartID() ?? null
   })
+  const turnDurationMs = createMemo(() => {
+    const start = message()?.time.created
+    if (typeof start !== "number") return undefined
+
+    const end = assistantMessages().reduce<number | undefined>((max, item) => {
+      const completed = item.time.completed
+      if (typeof completed !== "number") return max
+      if (max === undefined) return completed
+      return Math.max(max, completed)
+    }, undefined)
+
+    if (typeof end !== "number") return undefined
+    if (end < start) return undefined
+    return end - start
+  })
   const assistantVisible = createMemo(() =>
     assistantMessages().reduce((count, message) => {
       const parts = list(data.store.part?.[message.id], emptyParts)
-      return count + parts.filter(visible).length
+      return count + parts.filter((part) => partState(part, showReasoningSummaries()) === "visible").length
     }, 0),
   )
+  const assistantTailVisible = createMemo(() =>
+    assistantMessages()
+      .flatMap((message) => list(data.store.part?.[message.id], emptyParts))
+      .flatMap((part) => {
+        if (partState(part, showReasoningSummaries()) !== "visible") return []
+        if (part.type === "text") return ["text" as const]
+        return ["other" as const]
+      })
+      .at(-1),
+  )
+  const reasoningHeading = createMemo(() =>
+    assistantMessages()
+      .flatMap((message) => list(data.store.part?.[message.id], emptyParts))
+      .filter((part): part is PartType & { type: "reasoning"; text: string } => part.type === "reasoning")
+      .map((part) => heading(part.text))
+      .filter((text): text is string => !!text)
+      .at(-1),
+  )
+  const showThinking = createMemo(() => {
+    if (!working() || !!error()) return false
+    if (showReasoningSummaries()) return assistantVisible() === 0
+    if (assistantTailVisible() === "text") return false
+    return true
+  })
 
   const autoScroll = createAutoScroll({
     working,
@@ -280,20 +361,25 @@ export function SessionTurn(
                 <div data-slot="session-turn-message-content" aria-live="off">
                   <Message message={msg()} parts={parts()} interrupted={interrupted()} />
                 </div>
-                <Show when={working() && assistantVisible() === 0 && !error()}>
-                  <div data-slot="session-turn-thinking">
-                    <TextShimmer text={i18n.t("ui.sessionTurn.status.thinking")} />
-                  </div>
-                </Show>
                 <Show when={assistantMessages().length > 0}>
                   <div data-slot="session-turn-assistant-content" aria-hidden={working()}>
                     <AssistantParts
                       messages={assistantMessages()}
                       showAssistantCopyPartID={assistantCopyPartID()}
+                      turnDurationMs={turnDurationMs()}
                       working={working()}
+                      showReasoningSummaries={showReasoningSummaries()}
                     />
                   </div>
                 </Show>
+                <Show when={showThinking()}>
+                  <div data-slot="session-turn-thinking">
+                    <TextShimmer text={i18n.t("ui.sessionTurn.status.thinking")} />
+                    <Show when={!showReasoningSummaries() && reasoningHeading()}>
+                      {(text) => <span data-slot="session-turn-thinking-heading">{text()}</span>}
+                    </Show>
+                  </div>
+                </Show>
                 <Show when={edited() > 0 && !working()}>
                   <div data-slot="session-turn-diffs">
                     <Collapsible open={open()} onOpenChange={setOpen} variant="ghost">

packages/ui/src/pierre/virtualizer.ts

@@ -37,10 +37,11 @@ function target(container: HTMLElement): Target | undefined {
 
   const review = container.closest("[data-component='session-review']")
   if (review instanceof HTMLElement) {
+    const root = scrollRoot(container) ?? review
     const content = review.querySelector("[data-slot='session-review-container']")
     return {
       key: review,
-      root: review,
+      root,
       content: content instanceof HTMLElement ? content : undefined,
     }
   }

packages/ui/src/styles/index.css

@@ -44,6 +44,7 @@
 @import "../components/select.css" layer(components);
 @import "../components/spinner.css" layer(components);
 @import "../components/switch.css" layer(components);
+@import "../components/scroll-view.css" layer(components);
 @import "../components/session-review.css" layer(components);
 @import "../components/session-turn.css" layer(components);
 @import "../components/sticky-accordion-header.css" layer(components);

packages/ui/src/styles/tailwind/utilities.css

@@ -8,34 +8,6 @@
   }
 }
 
-@utility session-scroller {
-  &::-webkit-scrollbar {
-    width: 10px;
-    height: 10px;
-  }
-
-  &::-webkit-scrollbar-track {
-    background: transparent;
-    border-radius: 5px;
-  }
-
-  &::-webkit-scrollbar-thumb {
-    background: var(--border-weak-base);
-    border-radius: 5px;
-    border: 3px solid transparent;
-    background-clip: padding-box;
-  }
-
-  &::-webkit-scrollbar-thumb:hover {
-    background: var(--border-weak-base);
-  }
-
-  & {
-    scrollbar-width: thin;
-    scrollbar-color: var(--border-weak-base) transparent;
-  }
-}
-
 @utility badge-mask {
   -webkit-mask-image: radial-gradient(circle 5px at calc(100% - 4px) 4px, transparent 5px, black 5.5px);
   mask-image: radial-gradient(circle 5px at calc(100% - 4px) 4px, transparent 5px, black 5.5px);

packages/ui/src/styles/theme.css

@@ -117,6 +117,7 @@
   --surface-weak: var(--smoke-light-alpha-3);
   --surface-weaker: var(--smoke-light-alpha-4);
   --surface-strong: #ffffff;
+  --surface-stronger-non-alpha: var(--surface-raised-stronger-non-alpha);
   --surface-raised-stronger-non-alpha: var(--white);
   --surface-brand-base: var(--yuzu-light-9);
   --surface-brand-hover: var(--yuzu-light-10);
@@ -375,6 +376,7 @@
     --surface-weak: var(--smoke-dark-alpha-4);
     --surface-weaker: var(--smoke-dark-alpha-5);
     --surface-strong: var(--smoke-dark-alpha-7);
+    --surface-stronger-non-alpha: var(--surface-raised-stronger-non-alpha);
     --surface-raised-stronger-non-alpha: var(--smoke-dark-3);
     --surface-brand-base: var(--yuzu-light-9);
     --surface-brand-hover: var(--yuzu-light-10);