Merge remote-tracking branch 'upstream/dev' into cli-auth-cloud

# ------------------------ >8 ------------------------
# Do not modify or remove the line above.
# Everything below it will be ignored.
#
# Conflicts:
#	bun.lock

.github/workflows/storybook.yml

@@ -0,0 +1,38 @@
+name: storybook
+
+on:
+  push:
+    branches: [dev]
+    paths:
+      - ".github/workflows/storybook.yml"
+      - "package.json"
+      - "bun.lock"
+      - "packages/storybook/**"
+      - "packages/ui/**"
+  pull_request:
+    branches: [dev]
+    paths:
+      - ".github/workflows/storybook.yml"
+      - "package.json"
+      - "bun.lock"
+      - "packages/storybook/**"
+      - "packages/ui/**"
+  workflow_dispatch:
+
+concurrency:
+  group: ${{ github.workflow }}-${{ github.ref }}
+  cancel-in-progress: true
+
+jobs:
+  build:
+    name: storybook build
+    runs-on: blacksmith-4vcpu-ubuntu-2404
+    steps:
+      - name: Checkout repository
+        uses: actions/checkout@v4
+
+      - name: Setup Bun
+        uses: ./.github/actions/setup-bun
+
+      - name: Build Storybook
+        run: bun --cwd packages/storybook build

.opencode/opencode.jsonc

@@ -5,6 +5,11 @@
       "options": {},
     },
   },
+  "permission": {
+    "edit": {
+      "packages/opencode/migration/*": "deny",
+    },
+  },
   "mcp": {},
   "tools": {
     "github-triage": false,

AGENTS.md

@@ -122,3 +122,7 @@ const table = sqliteTable("session", {
 - Avoid mocks as much as possible
 - Test actual implementation, do not duplicate logic into tests
 - Tests cannot run from repo root (guard: `do-not-run-tests-from-root`); run from package dirs like `packages/opencode`.
+
+## Type Checking
+
+- Always run `bun typecheck` from package directories (e.g., `packages/opencode`), never `tsc` directly.

nix/hashes.json

@@ -1,8 +1,8 @@
 {
   "nodeModules": {
-    "x86_64-linux": "sha256-4kjoJ06VNvHltPHfzQRBG0bC6R39jao10ffGzrNZ230=",
-    "aarch64-linux": "sha256-6Uio+S2rcyBWbBEeOZb9N1CCKgkbKi68lOIKi3Ws/pQ=",
-    "aarch64-darwin": "sha256-8ngN5KVN4vhdsk0QJ11BGgSVBrcaEbwSj23c77HBpgs=",
-    "x86_64-darwin": "sha256-v/ueYGb9a0Nymzy+mkO4uQr78DAuJnES1qOT0onFgnQ="
+    "x86_64-linux": "sha256-+SMpaj0jeIHjlddAu6QIwojmWFVIiA8/G32hiQMjcOk=",
+    "aarch64-linux": "sha256-uo63IF6OCMab+O3ngn1sVxqIGJMm04HXuDgIRmXNTNk=",
+    "aarch64-darwin": "sha256-yB2tWm6AsX6UifnDqe7VldhN5zTQkDoqZ87AGQYjxT4=",
+    "x86_64-darwin": "sha256-nNhtqMSG4/y+uxjj14Jc5QQ7X6hQli9ni4v56XAvaAU="
   }
 }

package.json

@@ -43,6 +43,7 @@
       "dompurify": "3.3.1",
       "drizzle-kit": "1.0.0-beta.16-ea816b6",
       "drizzle-orm": "1.0.0-beta.16-ea816b6",
+      "effect": "4.0.0-beta.29",
       "ai": "5.0.124",
       "hono": "4.10.7",
       "hono-openapi": "1.1.2",

packages/app/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/app",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "description": "",
   "type": "module",
   "exports": {

packages/app/src/components/debug-bar.tsx

@@ -0,0 +1,432 @@
+import { useIsRouting, useLocation } from "@solidjs/router"
+import { batch, createEffect, onCleanup, onMount } from "solid-js"
+import { createStore } from "solid-js/store"
+import { Tooltip } from "@opencode-ai/ui/tooltip"
+
+type Mem = Performance & {
+  memory?: {
+    usedJSHeapSize: number
+    jsHeapSizeLimit: number
+  }
+}
+
+type Evt = PerformanceEntry & {
+  interactionId?: number
+  processingStart?: number
+}
+
+type Shift = PerformanceEntry & {
+  hadRecentInput: boolean
+  value: number
+}
+
+type Obs = PerformanceObserverInit & {
+  durationThreshold?: number
+}
+
+const span = 5000
+
+const ms = (n?: number, d = 0) => {
+  if (n === undefined || Number.isNaN(n)) return "n/a"
+  return `${n.toFixed(d)}ms`
+}
+
+const time = (n?: number) => {
+  if (n === undefined || Number.isNaN(n)) return "n/a"
+  return `${Math.round(n)}`
+}
+
+const mb = (n?: number) => {
+  if (n === undefined || Number.isNaN(n)) return "n/a"
+  const v = n / 1024 / 1024
+  return `${v >= 1024 ? v.toFixed(0) : v.toFixed(1)}MB`
+}
+
+const bad = (n: number | undefined, limit: number, low = false) => {
+  if (n === undefined || Number.isNaN(n)) return false
+  return low ? n < limit : n > limit
+}
+
+const session = (path: string) => path.includes("/session")
+
+function Cell(props: { bad?: boolean; dim?: boolean; label: string; tip: string; value: string }) {
+  return (
+    <Tooltip value={props.tip} placement="left">
+      <div class="flex w-full flex-col items-center px-0.5 py-1 text-center">
+        <div class="text-[7px] font-black uppercase tracking-[0.04em] opacity-70 leading-none">{props.label}</div>
+        <div
+          classList={{
+            "text-[9px] font-semibold leading-none tabular-nums": true,
+            "text-text-on-critical-base": !!props.bad,
+            "opacity-70": !!props.dim,
+          }}
+        >
+          {props.value}
+        </div>
+      </div>
+    </Tooltip>
+  )
+}
+
+export function DebugBar() {
+  const location = useLocation()
+  const routing = useIsRouting()
+  const [state, setState] = createStore({
+    cls: undefined as number | undefined,
+    delay: undefined as number | undefined,
+    fps: undefined as number | undefined,
+    gap: undefined as number | undefined,
+    heap: {
+      limit: undefined as number | undefined,
+      used: undefined as number | undefined,
+    },
+    inp: undefined as number | undefined,
+    jank: undefined as number | undefined,
+    long: {
+      block: undefined as number | undefined,
+      count: undefined as number | undefined,
+      max: undefined as number | undefined,
+    },
+    nav: {
+      dur: undefined as number | undefined,
+      pending: false,
+    },
+  })
+
+  const heap = () => (state.heap.limit ? (state.heap.used ?? 0) / state.heap.limit : undefined)
+  const heapv = () => {
+    const value = heap()
+    if (value === undefined) return "n/a"
+    return `${Math.round(value * 100)}%`
+  }
+  const longv = () => (state.long.count === undefined ? "n/a" : `${time(state.long.block)}/${state.long.count}`)
+  const navv = () => (state.nav.pending ? "..." : time(state.nav.dur))
+
+  let prev = ""
+  let start = 0
+  let init = false
+  let one = 0
+  let two = 0
+
+  createEffect(() => {
+    const busy = routing()
+    const next = `${location.pathname}${location.search}`
+
+    if (!init) {
+      init = true
+      prev = next
+      return
+    }
+
+    if (busy) {
+      if (one !== 0) cancelAnimationFrame(one)
+      if (two !== 0) cancelAnimationFrame(two)
+      one = 0
+      two = 0
+      if (start !== 0) return
+      start = performance.now()
+      if (session(prev)) setState("nav", { dur: undefined, pending: true })
+      return
+    }
+
+    if (start === 0) {
+      prev = next
+      return
+    }
+
+    const at = start
+    const from = prev
+    start = 0
+    prev = next
+
+    if (!(session(from) || session(next))) return
+
+    if (one !== 0) cancelAnimationFrame(one)
+    if (two !== 0) cancelAnimationFrame(two)
+    one = requestAnimationFrame(() => {
+      one = 0
+      two = requestAnimationFrame(() => {
+        two = 0
+        setState("nav", { dur: performance.now() - at, pending: false })
+      })
+    })
+  })
+
+  onMount(() => {
+    const obs: PerformanceObserver[] = []
+    const fps: Array<{ at: number; dur: number }> = []
+    const long: Array<{ at: number; dur: number }> = []
+    const seen = new Map<number | string, { at: number; delay: number; dur: number }>()
+    let hasLong = false
+    let poll: number | undefined
+    let raf = 0
+    let last = 0
+    let snap = 0
+
+    const trim = (list: Array<{ at: number; dur: number }>, span: number, at: number) => {
+      while (list[0] && at - list[0].at > span) list.shift()
+    }
+
+    const syncFrame = (at: number) => {
+      trim(fps, span, at)
+      const total = fps.reduce((sum, entry) => sum + entry.dur, 0)
+      const gap = fps.reduce((max, entry) => Math.max(max, entry.dur), 0)
+      const jank = fps.filter((entry) => entry.dur > 32).length
+      batch(() => {
+        setState("fps", total > 0 ? (fps.length * 1000) / total : undefined)
+        setState("gap", gap > 0 ? gap : undefined)
+        setState("jank", jank)
+      })
+    }
+
+    const syncLong = (at = performance.now()) => {
+      if (!hasLong) return
+      trim(long, span, at)
+      const block = long.reduce((sum, entry) => sum + Math.max(0, entry.dur - 50), 0)
+      const max = long.reduce((hi, entry) => Math.max(hi, entry.dur), 0)
+      setState("long", { block, count: long.length, max })
+    }
+
+    const syncInp = (at = performance.now()) => {
+      for (const [key, entry] of seen) {
+        if (at - entry.at > span) seen.delete(key)
+      }
+      let delay = 0
+      let inp = 0
+      for (const entry of seen.values()) {
+        delay = Math.max(delay, entry.delay)
+        inp = Math.max(inp, entry.dur)
+      }
+      batch(() => {
+        setState("delay", delay > 0 ? delay : undefined)
+        setState("inp", inp > 0 ? inp : undefined)
+      })
+    }
+
+    const syncHeap = () => {
+      const mem = (performance as Mem).memory
+      if (!mem) return
+      setState("heap", { limit: mem.jsHeapSizeLimit, used: mem.usedJSHeapSize })
+    }
+
+    const reset = () => {
+      fps.length = 0
+      long.length = 0
+      seen.clear()
+      last = 0
+      snap = 0
+      batch(() => {
+        setState("fps", undefined)
+        setState("gap", undefined)
+        setState("jank", undefined)
+        setState("delay", undefined)
+        setState("inp", undefined)
+        if (hasLong) setState("long", { block: 0, count: 0, max: 0 })
+      })
+    }
+
+    const watch = (type: string, init: Obs, fn: (entries: PerformanceEntry[]) => void) => {
+      if (typeof PerformanceObserver === "undefined") return false
+      if (!(PerformanceObserver.supportedEntryTypes ?? []).includes(type)) return false
+      const ob = new PerformanceObserver((list) => fn(list.getEntries()))
+      try {
+        ob.observe(init)
+        obs.push(ob)
+        return true
+      } catch {
+        ob.disconnect()
+        return false
+      }
+    }
+
+    if (
+      watch("layout-shift", { buffered: true, type: "layout-shift" }, (entries) => {
+        const add = entries.reduce((sum, entry) => {
+          const item = entry as Shift
+          if (item.hadRecentInput) return sum
+          return sum + item.value
+        }, 0)
+        if (add === 0) return
+        setState("cls", (value) => (value ?? 0) + add)
+      })
+    ) {
+      setState("cls", 0)
+    }
+
+    if (
+      watch("longtask", { buffered: true, type: "longtask" }, (entries) => {
+        const at = performance.now()
+        long.push(...entries.map((entry) => ({ at: entry.startTime, dur: entry.duration })))
+        syncLong(at)
+      })
+    ) {
+      hasLong = true
+      setState("long", { block: 0, count: 0, max: 0 })
+    }
+
+    watch("event", { buffered: true, durationThreshold: 16, type: "event" }, (entries) => {
+      for (const raw of entries) {
+        const entry = raw as Evt
+        if (entry.duration < 16) continue
+        const key =
+          entry.interactionId && entry.interactionId > 0
+            ? entry.interactionId
+            : `${entry.name}:${Math.round(entry.startTime)}`
+        const prev = seen.get(key)
+        const delay = Math.max(0, (entry.processingStart ?? entry.startTime) - entry.startTime)
+        seen.set(key, {
+          at: entry.startTime,
+          delay: Math.max(prev?.delay ?? 0, delay),
+          dur: Math.max(prev?.dur ?? 0, entry.duration),
+        })
+        if (seen.size <= 200) continue
+        const first = seen.keys().next().value
+        if (first !== undefined) seen.delete(first)
+      }
+      syncInp()
+    })
+
+    const loop = (at: number) => {
+      if (document.visibilityState !== "visible") {
+        raf = 0
+        return
+      }
+
+      if (last === 0) {
+        last = at
+        raf = requestAnimationFrame(loop)
+        return
+      }
+
+      fps.push({ at, dur: at - last })
+      last = at
+
+      if (at - snap >= 250) {
+        snap = at
+        syncFrame(at)
+      }
+
+      raf = requestAnimationFrame(loop)
+    }
+
+    const stop = () => {
+      if (raf !== 0) cancelAnimationFrame(raf)
+      raf = 0
+      if (poll === undefined) return
+      clearInterval(poll)
+      poll = undefined
+    }
+
+    const start = () => {
+      if (document.visibilityState !== "visible") return
+      if (poll === undefined) {
+        poll = window.setInterval(() => {
+          syncLong()
+          syncInp()
+          syncHeap()
+        }, 1000)
+      }
+      if (raf !== 0) return
+      raf = requestAnimationFrame(loop)
+    }
+
+    const vis = () => {
+      if (document.visibilityState !== "visible") {
+        stop()
+        return
+      }
+      reset()
+      start()
+    }
+
+    syncHeap()
+    start()
+    document.addEventListener("visibilitychange", vis)
+
+    onCleanup(() => {
+      if (one !== 0) cancelAnimationFrame(one)
+      if (two !== 0) cancelAnimationFrame(two)
+      stop()
+      document.removeEventListener("visibilitychange", vis)
+      for (const ob of obs) ob.disconnect()
+    })
+  })
+
+  return (
+    <aside
+      aria-label="Development performance diagnostics"
+      class="pointer-events-auto h-full min-h-0 w-[36px] shrink-0 overflow-y-auto text-text-on-interactive-base no-scrollbar sm:w-[38px]"
+      style={{ "background-color": "color-mix(in srgb, var(--icon-interactive-base) 42%, black)" }}
+    >
+      <div class="flex min-h-full flex-col gap-0.5 py-2 font-mono">
+        <Cell
+          label="NAV"
+          tip="Last completed route transition touching a session page, measured from router start until the first paint after it settles."
+          value={navv()}
+          bad={bad(state.nav.dur, 400)}
+          dim={state.nav.dur === undefined && !state.nav.pending}
+        />
+        <Cell
+          label="FPS"
+          tip="Rolling frames per second over the last 5 seconds."
+          value={state.fps === undefined ? "n/a" : `${Math.round(state.fps)}`}
+          bad={bad(state.fps, 50, true)}
+          dim={state.fps === undefined}
+        />
+        <Cell
+          label="FRM"
+          tip="Worst frame time over the last 5 seconds."
+          value={time(state.gap)}
+          bad={bad(state.gap, 50)}
+          dim={state.gap === undefined}
+        />
+        <Cell
+          label="JNK"
+          tip="Frames over 32ms in the last 5 seconds."
+          value={state.jank === undefined ? "n/a" : `${state.jank}`}
+          bad={bad(state.jank, 8)}
+          dim={state.jank === undefined}
+        />
+        <Cell
+          label="LNG"
+          tip={`Blocked time and long-task count in the last 5 seconds. Max task: ${ms(state.long.max)}.`}
+          value={longv()}
+          bad={bad(state.long.block, 200)}
+          dim={state.long.count === undefined}
+        />
+        <Cell
+          label="DLY"
+          tip="Worst observed input delay in the last 5 seconds."
+          value={time(state.delay)}
+          bad={bad(state.delay, 100)}
+          dim={state.delay === undefined}
+        />
+        <Cell
+          label="INP"
+          tip="Approximate interaction duration over the last 5 seconds. This is INP-like, not the official Web Vitals INP."
+          value={time(state.inp)}
+          bad={bad(state.inp, 200)}
+          dim={state.inp === undefined}
+        />
+        <Cell
+          label="CLS"
+          tip="Cumulative layout shift for the current app lifetime."
+          value={state.cls === undefined ? "n/a" : state.cls.toFixed(2)}
+          bad={bad(state.cls, 0.1)}
+          dim={state.cls === undefined}
+        />
+        <Cell
+          label="MEM"
+          tip={
+            state.heap.used === undefined
+              ? "Used JS heap vs heap limit. Chromium only."
+              : `Used JS heap vs heap limit. ${mb(state.heap.used)} of ${mb(state.heap.limit)}.`
+          }
+          value={heapv()}
+          bad={bad(heap(), 0.8)}
+          dim={state.heap.used === undefined}
+        />
+      </div>
+    </aside>
+  )
+}

packages/app/src/context/terminal.test.ts

@@ -2,6 +2,7 @@ import { beforeAll, describe, expect, mock, test } from "bun:test"
 
 let getWorkspaceTerminalCacheKey: (dir: string) => string
 let getLegacyTerminalStorageKeys: (dir: string, legacySessionID?: string) => string[]
+let migrateTerminalState: (value: unknown) => unknown
 
 beforeAll(async () => {
   mock.module("@solidjs/router", () => ({
@@ -17,6 +18,7 @@ beforeAll(async () => {
   const mod = await import("./terminal")
   getWorkspaceTerminalCacheKey = mod.getWorkspaceTerminalCacheKey
   getLegacyTerminalStorageKeys = mod.getLegacyTerminalStorageKeys
+  migrateTerminalState = mod.migrateTerminalState
 })
 
 describe("getWorkspaceTerminalCacheKey", () => {
@@ -37,3 +39,44 @@ describe("getLegacyTerminalStorageKeys", () => {
     ])
   })
 })
+
+describe("migrateTerminalState", () => {
+  test("drops invalid terminals and restores a valid active terminal", () => {
+    expect(
+      migrateTerminalState({
+        active: "missing",
+        all: [
+          null,
+          { id: "one", title: "Terminal 2" },
+          { id: "one", title: "duplicate", titleNumber: 9 },
+          { id: "two", title: "logs", titleNumber: 4, rows: 24, cols: 80 },
+          { title: "no-id" },
+        ],
+      }),
+    ).toEqual({
+      active: "one",
+      all: [
+        { id: "one", title: "Terminal 2", titleNumber: 2 },
+        { id: "two", title: "logs", titleNumber: 4, rows: 24, cols: 80 },
+      ],
+    })
+  })
+
+  test("keeps a valid active id", () => {
+    expect(
+      migrateTerminalState({
+        active: "two",
+        all: [
+          { id: "one", title: "Terminal 1" },
+          { id: "two", title: "shell", titleNumber: 7 },
+        ],
+      }),
+    ).toEqual({
+      active: "two",
+      all: [
+        { id: "one", title: "Terminal 1", titleNumber: 1 },
+        { id: "two", title: "shell", titleNumber: 7 },
+      ],
+    })
+  })
+})

packages/app/src/context/terminal.tsx

@@ -20,6 +20,71 @@ export type LocalPTY = {
 const WORKSPACE_KEY = "__workspace__"
 const MAX_TERMINAL_SESSIONS = 20
 
+function record(value: unknown): value is Record<string, unknown> {
+  return typeof value === "object" && value !== null && !Array.isArray(value)
+}
+
+function text(value: unknown) {
+  return typeof value === "string" ? value : undefined
+}
+
+function num(value: unknown) {
+  return typeof value === "number" && Number.isFinite(value) ? value : undefined
+}
+
+function numberFromTitle(title: string) {
+  const match = title.match(/^Terminal (\d+)$/)
+  if (!match) return
+  const value = Number(match[1])
+  if (!Number.isFinite(value) || value <= 0) return
+  return value
+}
+
+function pty(value: unknown): LocalPTY | undefined {
+  if (!record(value)) return
+
+  const id = text(value.id)
+  if (!id) return
+
+  const title = text(value.title) ?? ""
+  const number = num(value.titleNumber)
+  const rows = num(value.rows)
+  const cols = num(value.cols)
+  const buffer = text(value.buffer)
+  const scrollY = num(value.scrollY)
+  const cursor = num(value.cursor)
+
+  return {
+    id,
+    title,
+    titleNumber: number && number > 0 ? number : (numberFromTitle(title) ?? 0),
+    ...(rows !== undefined ? { rows } : {}),
+    ...(cols !== undefined ? { cols } : {}),
+    ...(buffer !== undefined ? { buffer } : {}),
+    ...(scrollY !== undefined ? { scrollY } : {}),
+    ...(cursor !== undefined ? { cursor } : {}),
+  }
+}
+
+export function migrateTerminalState(value: unknown) {
+  if (!record(value)) return value
+
+  const seen = new Set<string>()
+  const all = (Array.isArray(value.all) ? value.all : []).flatMap((item) => {
+    const next = pty(item)
+    if (!next || seen.has(next.id)) return []
+    seen.add(next.id)
+    return [next]
+  })
+
+  const active = text(value.active)
+
+  return {
+    active: active && seen.has(active) ? active : all[0]?.id,
+    all,
+  }
+}
+
 export function getWorkspaceTerminalCacheKey(dir: string) {
   return `${dir}:${WORKSPACE_KEY}`
 }
@@ -71,16 +136,11 @@ export function clearWorkspaceTerminals(dir: string, sessionIDs?: string[], plat
 function createWorkspaceTerminalSession(sdk: ReturnType<typeof useSDK>, dir: string, legacySessionID?: string) {
   const legacy = getLegacyTerminalStorageKeys(dir, legacySessionID)
 
-  const numberFromTitle = (title: string) => {
-    const match = title.match(/^Terminal (\d+)$/)
-    if (!match) return
-    const value = Number(match[1])
-    if (!Number.isFinite(value) || value <= 0) return
-    return value
-  }
-
   const [store, setStore, _, ready] = persisted(
-    Persist.workspace(dir, "terminal", legacy),
+    {
+      ...Persist.workspace(dir, "terminal", legacy),
+      migrate: migrateTerminalState,
+    },
     createStore<{
       active?: string
       all: LocalPTY[]
@@ -128,26 +188,6 @@ function createWorkspaceTerminalSession(sdk: ReturnType<typeof useSDK>, dir: str
   })
   onCleanup(unsub)
 
-  const meta = { migrated: false }
-
-  createEffect(() => {
-    if (!ready()) return
-    if (meta.migrated) return
-    meta.migrated = true
-
-    setStore("all", (all) => {
-      const next = all.map((pty) => {
-        const direct = Number.isFinite(pty.titleNumber) && pty.titleNumber > 0 ? pty.titleNumber : undefined
-        if (direct !== undefined) return pty
-        const parsed = numberFromTitle(pty.title)
-        if (parsed === undefined) return pty
-        return { ...pty, titleNumber: parsed }
-      })
-      if (next.every((pty, index) => pty === all[index])) return all
-      return next
-    })
-  })
-
   return {
     ready,
     all: createMemo(() => store.all),

packages/app/src/pages/layout.tsx

@@ -54,6 +54,7 @@ import { useCommand, type CommandOption } from "@/context/command"
 import { ConstrainDragXAxis } from "@/utils/solid-dnd"
 import { DialogSelectDirectory } from "@/components/dialog-select-directory"
 import { DialogEditProject } from "@/components/dialog-edit-project"
+import { DebugBar } from "@/components/debug-bar"
 import { Titlebar } from "@/components/titlebar"
 import { useServer } from "@/context/server"
 import { useLanguage, type Locale } from "@/context/language"
@@ -424,6 +425,17 @@ export default function Layout(props: ParentProps) {
           return
         }
 
+        if (
+          e.details?.type === "question.replied" ||
+          e.details?.type === "question.rejected" ||
+          e.details?.type === "permission.replied"
+        ) {
+          const props = e.details.properties as { sessionID: string }
+          const sessionKey = `${e.name}:${props.sessionID}`
+          dismissSessionAlert(sessionKey)
+          return
+        }
+
         if (e.details?.type !== "permission.asked" && e.details?.type !== "question.asked") return
         const title =
           e.details.type === "permission.asked"
@@ -2124,193 +2136,204 @@ export default function Layout(props: ParentProps) {
   }
 
   return (
-    <div class="relative bg-background-base flex-1 min-h-0 flex flex-col select-none [&_input]:select-text [&_textarea]:select-text [&_[contenteditable]]:select-text">
+    <div class="relative bg-background-base flex-1 min-h-0 min-w-0 flex flex-col select-none [&_input]:select-text [&_textarea]:select-text [&_[contenteditable]]:select-text">
       <Titlebar />
-      <div class="flex-1 min-h-0 relative overflow-x-hidden">
-        <nav
-          aria-label={language.t("sidebar.nav.projectsAndSessions")}
-          data-component="sidebar-nav-desktop"
-          classList={{
-            "hidden xl:block": true,
-            "absolute inset-y-0 left-0": true,
-            "z-10": true,
-          }}
-          style={{ width: `${Math.max(layout.sidebar.width(), 244)}px` }}
-          ref={(el) => {
-            setState("nav", el)
-          }}
-          onMouseEnter={() => {
-            disarm()
-          }}
-          onMouseLeave={() => {
-            aim.reset()
-            if (!sidebarHovering()) return
+      <div class="flex-1 min-h-0 min-w-0 flex">
+        <div class="flex-1 min-h-0 relative">
+          <div class="size-full relative overflow-x-hidden">
+            <nav
+              aria-label={language.t("sidebar.nav.projectsAndSessions")}
+              data-component="sidebar-nav-desktop"
+              classList={{
+                "hidden xl:block": true,
+                "absolute inset-y-0 left-0": true,
+                "z-10": true,
+              }}
+              style={{ width: `${Math.max(layout.sidebar.width(), 244)}px` }}
+              ref={(el) => {
+                setState("nav", el)
+              }}
+              onMouseEnter={() => {
+                disarm()
+              }}
+              onMouseLeave={() => {
+                aim.reset()
+                if (!sidebarHovering()) return
 
-            arm()
-          }}
-        >
-          <div class="@container w-full h-full contain-strict">
-            <SidebarContent
-              opened={() => layout.sidebar.opened()}
-              aimMove={aim.move}
-              projects={() => layout.projects.list()}
-              renderProject={(project) => (
-                <SortableProject ctx={projectSidebarCtx} project={project} sortNow={sortNow} />
-              )}
-              handleDragStart={handleDragStart}
-              handleDragEnd={handleDragEnd}
-              handleDragOver={handleDragOver}
-              openProjectLabel={language.t("command.project.open")}
-              openProjectKeybind={() => command.keybind("project.open")}
-              onOpenProject={chooseProject}
-              renderProjectOverlay={() => (
-                <ProjectDragOverlay projects={() => layout.projects.list()} activeProject={() => store.activeProject} />
-              )}
-              settingsLabel={() => language.t("sidebar.settings")}
-              settingsKeybind={() => command.keybind("settings.open")}
-              onOpenSettings={openSettings}
-              helpLabel={() => language.t("sidebar.help")}
-              onOpenHelp={() => platform.openLink("https://opencode.ai/desktop-feedback")}
-              renderPanel={() => (
-                <Show when={currentProject()} keyed>
-                  {(project) => <SidebarPanel project={project} merged />}
-                </Show>
-              )}
+                arm()
+              }}
+            >
+              <div class="@container w-full h-full contain-strict">
+                <SidebarContent
+                  opened={() => layout.sidebar.opened()}
+                  aimMove={aim.move}
+                  projects={() => layout.projects.list()}
+                  renderProject={(project) => (
+                    <SortableProject ctx={projectSidebarCtx} project={project} sortNow={sortNow} />
+                  )}
+                  handleDragStart={handleDragStart}
+                  handleDragEnd={handleDragEnd}
+                  handleDragOver={handleDragOver}
+                  openProjectLabel={language.t("command.project.open")}
+                  openProjectKeybind={() => command.keybind("project.open")}
+                  onOpenProject={chooseProject}
+                  renderProjectOverlay={() => (
+                    <ProjectDragOverlay
+                      projects={() => layout.projects.list()}
+                      activeProject={() => store.activeProject}
+                    />
+                  )}
+                  settingsLabel={() => language.t("sidebar.settings")}
+                  settingsKeybind={() => command.keybind("settings.open")}
+                  onOpenSettings={openSettings}
+                  helpLabel={() => language.t("sidebar.help")}
+                  onOpenHelp={() => platform.openLink("https://opencode.ai/desktop-feedback")}
+                  renderPanel={() => (
+                    <Show when={currentProject()} keyed>
+                      {(project) => <SidebarPanel project={project} merged />}
+                    </Show>
+                  )}
+                />
+              </div>
+              <Show when={layout.sidebar.opened()}>
+                <div onPointerDown={() => setSizing(true)}>
+                  <ResizeHandle
+                    direction="horizontal"
+                    size={layout.sidebar.width()}
+                    min={244}
+                    max={typeof window === "undefined" ? 1000 : window.innerWidth * 0.3 + 64}
+                    collapseThreshold={244}
+                    onResize={(w) => {
+                      setSizing(true)
+                      if (sizet !== undefined) clearTimeout(sizet)
+                      sizet = window.setTimeout(() => setSizing(false), 120)
+                      layout.sidebar.resize(w)
+                    }}
+                    onCollapse={layout.sidebar.close}
+                  />
+                </div>
+              </Show>
+            </nav>
+
+            <div
+              class="hidden xl:block pointer-events-none absolute top-0 right-0 z-0 border-t border-border-weaker-base"
+              style={{ left: "calc(4rem + 12px)" }}
             />
-          </div>
-          <Show when={layout.sidebar.opened()}>
-            <div onPointerDown={() => setSizing(true)}>
-              <ResizeHandle
-                direction="horizontal"
-                size={layout.sidebar.width()}
-                min={244}
-                max={typeof window === "undefined" ? 1000 : window.innerWidth * 0.3 + 64}
-                collapseThreshold={244}
-                onResize={(w) => {
-                  setSizing(true)
-                  if (sizet !== undefined) clearTimeout(sizet)
-                  sizet = window.setTimeout(() => setSizing(false), 120)
-                  layout.sidebar.resize(w)
+
+            <div class="xl:hidden">
+              <div
+                classList={{
+                  "fixed inset-x-0 top-10 bottom-0 z-40 transition-opacity duration-200": true,
+                  "opacity-100 pointer-events-auto": layout.mobileSidebar.opened(),
+                  "opacity-0 pointer-events-none": !layout.mobileSidebar.opened(),
+                }}
+                onClick={(e) => {
+                  if (e.target === e.currentTarget) layout.mobileSidebar.hide()
                 }}
-                onCollapse={layout.sidebar.close}
               />
+              <nav
+                aria-label={language.t("sidebar.nav.projectsAndSessions")}
+                data-component="sidebar-nav-mobile"
+                classList={{
+                  "@container fixed top-10 bottom-0 left-0 z-50 w-full max-w-[400px] overflow-hidden border-r border-border-weaker-base bg-background-base transition-transform duration-200 ease-out": true,
+                  "translate-x-0": layout.mobileSidebar.opened(),
+                  "-translate-x-full": !layout.mobileSidebar.opened(),
+                }}
+                onClick={(e) => e.stopPropagation()}
+              >
+                <SidebarContent
+                  mobile
+                  opened={() => layout.sidebar.opened()}
+                  aimMove={aim.move}
+                  projects={() => layout.projects.list()}
+                  renderProject={(project) => (
+                    <SortableProject ctx={projectSidebarCtx} project={project} sortNow={sortNow} mobile />
+                  )}
+                  handleDragStart={handleDragStart}
+                  handleDragEnd={handleDragEnd}
+                  handleDragOver={handleDragOver}
+                  openProjectLabel={language.t("command.project.open")}
+                  openProjectKeybind={() => command.keybind("project.open")}
+                  onOpenProject={chooseProject}
+                  renderProjectOverlay={() => (
+                    <ProjectDragOverlay
+                      projects={() => layout.projects.list()}
+                      activeProject={() => store.activeProject}
+                    />
+                  )}
+                  settingsLabel={() => language.t("sidebar.settings")}
+                  settingsKeybind={() => command.keybind("settings.open")}
+                  onOpenSettings={openSettings}
+                  helpLabel={() => language.t("sidebar.help")}
+                  onOpenHelp={() => platform.openLink("https://opencode.ai/desktop-feedback")}
+                  renderPanel={() => <SidebarPanel project={currentProject()} mobile />}
+                />
+              </nav>
             </div>
-          </Show>
-        </nav>
 
-        <div
-          class="hidden xl:block pointer-events-none absolute top-0 right-0 z-0 border-t border-border-weaker-base"
-          style={{ left: "calc(4rem + 12px)" }}
-        />
+            <div
+              classList={{
+                "absolute inset-0": true,
+                "xl:inset-y-0 xl:right-0 xl:left-[var(--main-left)]": true,
+                "z-20": true,
+                "transition-[left] duration-200 ease-[cubic-bezier(0.22,1,0.36,1)] will-change-[left] motion-reduce:transition-none":
+                  !sizing(),
+              }}
+              style={{
+                "--main-left": layout.sidebar.opened() ? `${Math.max(layout.sidebar.width(), 244)}px` : "4rem",
+              }}
+            >
+              <main
+                classList={{
+                  "size-full overflow-x-hidden flex flex-col items-start contain-strict border-t border-border-weak-base bg-background-base xl:border-l xl:rounded-tl-[12px]": true,
+                }}
+              >
+                <Show when={!autoselecting()} fallback={<div class="size-full" />}>
+                  {props.children}
+                </Show>
+              </main>
+            </div>
 
-        <div class="xl:hidden">
-          <div
-            classList={{
-              "fixed inset-x-0 top-10 bottom-0 z-40 transition-opacity duration-200": true,
-              "opacity-100 pointer-events-auto": layout.mobileSidebar.opened(),
-              "opacity-0 pointer-events-none": !layout.mobileSidebar.opened(),
-            }}
-            onClick={(e) => {
-              if (e.target === e.currentTarget) layout.mobileSidebar.hide()
-            }}
-          />
-          <nav
-            aria-label={language.t("sidebar.nav.projectsAndSessions")}
-            data-component="sidebar-nav-mobile"
-            classList={{
-              "@container fixed top-10 bottom-0 left-0 z-50 w-full max-w-[400px] overflow-hidden border-r border-border-weaker-base bg-background-base transition-transform duration-200 ease-out": true,
-              "translate-x-0": layout.mobileSidebar.opened(),
-              "-translate-x-full": !layout.mobileSidebar.opened(),
-            }}
-            onClick={(e) => e.stopPropagation()}
-          >
-            <SidebarContent
-              mobile
-              opened={() => layout.sidebar.opened()}
-              aimMove={aim.move}
-              projects={() => layout.projects.list()}
-              renderProject={(project) => (
-                <SortableProject ctx={projectSidebarCtx} project={project} sortNow={sortNow} mobile />
-              )}
-              handleDragStart={handleDragStart}
-              handleDragEnd={handleDragEnd}
-              handleDragOver={handleDragOver}
-              openProjectLabel={language.t("command.project.open")}
-              openProjectKeybind={() => command.keybind("project.open")}
-              onOpenProject={chooseProject}
-              renderProjectOverlay={() => (
-                <ProjectDragOverlay projects={() => layout.projects.list()} activeProject={() => store.activeProject} />
-              )}
-              settingsLabel={() => language.t("sidebar.settings")}
-              settingsKeybind={() => command.keybind("settings.open")}
-              onOpenSettings={openSettings}
-              helpLabel={() => language.t("sidebar.help")}
-              onOpenHelp={() => platform.openLink("https://opencode.ai/desktop-feedback")}
-              renderPanel={() => <SidebarPanel project={currentProject()} mobile />}
-            />
-          </nav>
-        </div>
-
-        <div
-          classList={{
-            "absolute inset-0": true,
-            "xl:inset-y-0 xl:right-0 xl:left-[var(--main-left)]": true,
-            "z-20": true,
-            "transition-[left] duration-200 ease-[cubic-bezier(0.22,1,0.36,1)] will-change-[left] motion-reduce:transition-none":
-              !sizing(),
-          }}
-          style={{
-            "--main-left": layout.sidebar.opened() ? `${Math.max(layout.sidebar.width(), 244)}px` : "4rem",
-          }}
-        >
-          <main
-            classList={{
-              "size-full overflow-x-hidden flex flex-col items-start contain-strict border-t border-border-weak-base bg-background-base xl:border-l xl:rounded-tl-[12px]": true,
-            }}
-          >
-            <Show when={!autoselecting()} fallback={<div class="size-full" />}>
-              {props.children}
-            </Show>
-          </main>
-        </div>
-
-        <div
-          classList={{
-            "hidden xl:flex absolute inset-y-0 left-16 z-30": true,
-            "opacity-100 translate-x-0 pointer-events-auto": peeked() && !layout.sidebar.opened(),
-            "opacity-0 -translate-x-2 pointer-events-none": !peeked() || layout.sidebar.opened(),
-            "transition-[opacity,transform] motion-reduce:transition-none": true,
-            "duration-180 ease-out": peeked() && !layout.sidebar.opened(),
-            "duration-120 ease-in": !peeked() || layout.sidebar.opened(),
-          }}
-          onMouseMove={disarm}
-          onMouseEnter={() => {
-            disarm()
-            aim.reset()
-          }}
-          onPointerDown={disarm}
-          onMouseLeave={() => {
-            arm()
-          }}
-        >
-          <Show when={peek()} keyed>
-            {(project) => <SidebarPanel project={project} merged={false} />}
-          </Show>
-        </div>
-
-        <div
-          classList={{
-            "hidden xl:block pointer-events-none absolute inset-y-0 right-0 z-25 overflow-hidden": true,
-            "opacity-100 translate-x-0": peeked() && !layout.sidebar.opened(),
-            "opacity-0 -translate-x-2": !peeked() || layout.sidebar.opened(),
-            "transition-[opacity,transform] motion-reduce:transition-none": true,
-            "duration-180 ease-out": peeked() && !layout.sidebar.opened(),
-            "duration-120 ease-in": !peeked() || layout.sidebar.opened(),
-          }}
-          style={{ left: `calc(4rem + ${Math.max(Math.max(layout.sidebar.width(), 244) - 64, 0)}px)` }}
-        >
-          <div class="h-full w-px" style={{ "box-shadow": "var(--shadow-sidebar-overlay)" }} />
+            <div
+              classList={{
+                "hidden xl:flex absolute inset-y-0 left-16 z-30": true,
+                "opacity-100 translate-x-0 pointer-events-auto": peeked() && !layout.sidebar.opened(),
+                "opacity-0 -translate-x-2 pointer-events-none": !peeked() || layout.sidebar.opened(),
+                "transition-[opacity,transform] motion-reduce:transition-none": true,
+                "duration-180 ease-out": peeked() && !layout.sidebar.opened(),
+                "duration-120 ease-in": !peeked() || layout.sidebar.opened(),
+              }}
+              onMouseMove={disarm}
+              onMouseEnter={() => {
+                disarm()
+                aim.reset()
+              }}
+              onPointerDown={disarm}
+              onMouseLeave={() => {
+                arm()
+              }}
+            >
+              <Show when={peek()} keyed>
+                {(project) => <SidebarPanel project={project} merged={false} />}
+              </Show>
+            </div>
+
+            <div
+              classList={{
+                "hidden xl:block pointer-events-none absolute inset-y-0 right-0 z-25 overflow-hidden": true,
+                "opacity-100 translate-x-0": peeked() && !layout.sidebar.opened(),
+                "opacity-0 -translate-x-2": !peeked() || layout.sidebar.opened(),
+                "transition-[opacity,transform] motion-reduce:transition-none": true,
+                "duration-180 ease-out": peeked() && !layout.sidebar.opened(),
+                "duration-120 ease-in": !peeked() || layout.sidebar.opened(),
+              }}
+              style={{ left: `calc(4rem + ${Math.max(Math.max(layout.sidebar.width(), 244) - 64, 0)}px)` }}
+            >
+              <div class="h-full w-px" style={{ "box-shadow": "var(--shadow-sidebar-overlay)" }} />
+            </div>
+          </div>
         </div>
+        {import.meta.env.DEV && <DebugBar />}
       </div>
       <Toast.Region />
     </div>

packages/app/src/pages/session.tsx

@@ -37,7 +37,6 @@ import { createOpenReviewFile, createSizing } from "@/pages/session/helpers"
 import { MessageTimeline } from "@/pages/session/message-timeline"
 import { type DiffStyle, SessionReviewTab, type SessionReviewTabProps } from "@/pages/session/review-tab"
 import { resetSessionModel, syncSessionModel } from "@/pages/session/session-model-helpers"
-import { createScrollSpy } from "@/pages/session/scroll-spy"
 import { SessionMobileTabs } from "@/pages/session/session-mobile-tabs"
 import { SessionSidePanel } from "@/pages/session/session-side-panel"
 import { TerminalPanel } from "@/pages/session/terminal-panel"
@@ -486,20 +485,49 @@ export default function Page() {
     return "main"
   })
 
-  const activeMessage = createMemo(() => {
-    if (!store.messageId) return lastUserMessage()
-    const found = visibleUserMessages()?.find((m) => m.id === store.messageId)
-    return found ?? lastUserMessage()
-  })
   const setActiveMessage = (message: UserMessage | undefined) => {
+    messageMark = scrollMark
     setStore("messageId", message?.id)
   }
 
+  const anchor = (id: string) => `message-${id}`
+
+  const cursor = () => {
+    const root = scroller
+    if (!root) return store.messageId
+
+    const box = root.getBoundingClientRect()
+    const line = box.top + 100
+    const list = [...root.querySelectorAll<HTMLElement>("[data-message-id]")]
+      .map((el) => {
+        const id = el.dataset.messageId
+        if (!id) return
+
+        const rect = el.getBoundingClientRect()
+        return { id, top: rect.top, bottom: rect.bottom }
+      })
+      .filter((item): item is { id: string; top: number; bottom: number } => !!item)
+
+    const shown = list.filter((item) => item.bottom > box.top && item.top < box.bottom)
+    const hit = shown.find((item) => item.top <= line && item.bottom >= line)
+    if (hit) return hit.id
+
+    const near = [...shown].sort((a, b) => {
+      const da = Math.abs(a.top - line)
+      const db = Math.abs(b.top - line)
+      if (da !== db) return da - db
+      return a.top - b.top
+    })[0]
+    if (near) return near.id
+
+    return list.filter((item) => item.top <= line).at(-1)?.id ?? list[0]?.id ?? store.messageId
+  }
+
   function navigateMessageByOffset(offset: number) {
     const msgs = visibleUserMessages()
     if (msgs.length === 0) return
 
-    const current = store.messageId
+    const current = store.messageId && messageMark === scrollMark ? store.messageId : cursor()
     const base = current ? msgs.findIndex((m) => m.id === current) : msgs.length
     const currentIndex = base === -1 ? msgs.length : base
     const targetIndex = currentIndex + offset
@@ -572,6 +600,8 @@ export default function Page() {
   let dockHeight = 0
   let scroller: HTMLDivElement | undefined
   let content: HTMLDivElement | undefined
+  let scrollMark = 0
+  let messageMark = 0
 
   const scrollGestureWindowMs = 250
 
@@ -616,6 +646,7 @@ export default function Page() {
       () => {
         setStore("messageId", undefined)
         setStore("changes", "session")
+        setUi("pendingMessage", undefined)
       },
       { defer: true },
     ),
@@ -1110,12 +1141,6 @@ export default function Page() {
 
   let scrollStateFrame: number | undefined
   let scrollStateTarget: HTMLDivElement | undefined
-  const scrollSpy = createScrollSpy({
-    onActive: (id) => {
-      if (id === store.messageId) return
-      setStore("messageId", id)
-    },
-  })
 
   const updateScrollState = (el: HTMLDivElement) => {
     const max = el.scrollHeight - el.clientHeight
@@ -1163,31 +1188,21 @@ export default function Page() {
     ),
   )
 
-  createEffect(
-    on(
-      sessionKey,
-      () => {
-        scrollSpy.clear()
-      },
-      { defer: true },
-    ),
-  )
-
-  const anchor = (id: string) => `message-${id}`
-
   const setScrollRef = (el: HTMLDivElement | undefined) => {
     scroller = el
     autoScroll.scrollRef(el)
-    scrollSpy.setContainer(el)
     if (el) scheduleScrollState(el)
   }
 
+  const markUserScroll = () => {
+    scrollMark += 1
+  }
+
   createResizeObserver(
     () => content,
     () => {
       const el = scroller
       if (el) scheduleScrollState(el)
-      scrollSpy.markDirty()
     },
   )
 
@@ -1220,7 +1235,6 @@ export default function Page() {
       if (stick) autoScroll.forceScrollToBottom()
 
       if (el) scheduleScrollState(el)
-      scrollSpy.markDirty()
     },
   )
 
@@ -1248,7 +1262,6 @@ export default function Page() {
 
   onCleanup(() => {
     document.removeEventListener("keydown", handleKeyDown)
-    scrollSpy.destroy()
     if (reviewFrame !== undefined) cancelAnimationFrame(reviewFrame)
     if (scrollStateFrame !== undefined) cancelAnimationFrame(scrollStateFrame)
   })
@@ -1280,7 +1293,7 @@ export default function Page() {
           <div class="flex-1 min-h-0 overflow-hidden">
             <Switch>
               <Match when={params.id}>
-                <Show when={activeMessage()}>
+                <Show when={lastUserMessage()}>
                   <MessageTimeline
                     mobileChanges={mobileChanges()}
                     mobileFallback={reviewContent({
@@ -1300,8 +1313,7 @@ export default function Page() {
                     onAutoScrollHandleScroll={autoScroll.handleScroll}
                     onMarkScrollGesture={markScrollGesture}
                     hasScrollGesture={hasScrollGesture}
-                    isDesktop={isDesktop()}
-                    onScrollSpyScroll={scrollSpy.onScroll}
+                    onUserScroll={markUserScroll}
                     onTurnBackfillScroll={historyWindow.onScrollerScroll}
                     onAutoScrollInteraction={autoScroll.handleInteraction}
                     centered={centered()}
@@ -1320,8 +1332,6 @@ export default function Page() {
                     }}
                     renderedUserMessages={historyWindow.renderedUserMessages()}
                     anchor={anchor}
-                    onRegisterMessage={scrollSpy.register}
-                    onUnregisterMessage={scrollSpy.unregister}
                   />
                 </Show>
               </Match>

packages/app/src/pages/session/message-timeline.tsx

@@ -8,6 +8,7 @@ import { IconButton } from "@opencode-ai/ui/icon-button"
 import { DropdownMenu } from "@opencode-ai/ui/dropdown-menu"
 import { Dialog } from "@opencode-ai/ui/dialog"
 import { InlineInput } from "@opencode-ai/ui/inline-input"
+import { Spinner } from "@opencode-ai/ui/spinner"
 import { SessionTurn } from "@opencode-ai/ui/session-turn"
 import { ScrollView } from "@opencode-ai/ui/scroll-view"
 import type { AssistantMessage, Message as MessageType, Part, TextPart, UserMessage } from "@opencode-ai/sdk/v2"
@@ -192,8 +193,7 @@ export function MessageTimeline(props: {
   onAutoScrollHandleScroll: () => void
   onMarkScrollGesture: (target?: EventTarget | null) => void
   hasScrollGesture: () => boolean
-  isDesktop: boolean
-  onScrollSpyScroll: () => void
+  onUserScroll: () => void
   onTurnBackfillScroll: () => void
   onAutoScrollInteraction: (event: MouseEvent) => void
   centered: boolean
@@ -204,8 +204,6 @@ export function MessageTimeline(props: {
   onLoadEarlier: () => void
   renderedUserMessages: UserMessage[]
   anchor: (id: string) => string
-  onRegisterMessage: (el: HTMLDivElement, id: string) => void
-  onUnregisterMessage: (id: string) => void
 }) {
   let touchGesture: number | undefined
 
@@ -235,6 +233,40 @@ export function MessageTimeline(props: {
     if (!id) return idle
     return sync.data.session_status[id] ?? idle
   })
+  const working = createMemo(() => !!pending() || sessionStatus().type !== "idle")
+
+  const [slot, setSlot] = createStore({
+    open: false,
+    show: false,
+    fade: false,
+  })
+
+  let f: number | undefined
+  const clear = () => {
+    if (f !== undefined) window.clearTimeout(f)
+    f = undefined
+  }
+
+  onCleanup(clear)
+  createEffect(
+    on(
+      working,
+      (on, prev) => {
+        clear()
+        if (on) {
+          setSlot({ open: true, show: true, fade: false })
+          return
+        }
+        if (prev) {
+          setSlot({ open: false, show: true, fade: true })
+          f = window.setTimeout(() => setSlot({ show: false, fade: false }), 260)
+          return
+        }
+        setSlot({ open: false, show: false, fade: false })
+      },
+      { defer: true },
+    ),
+  )
   const activeMessageID = createMemo(() => {
     const parentID = pending()?.parentID
     if (parentID) {
@@ -539,9 +571,9 @@ export function MessageTimeline(props: {
             props.onScheduleScrollState(e.currentTarget)
             props.onTurnBackfillScroll()
             if (!props.hasScrollGesture()) return
+            props.onUserScroll()
             props.onAutoScrollHandleScroll()
             props.onMarkScrollGesture(e.currentTarget)
-            if (props.isDesktop) props.onScrollSpyScroll()
           }}
           onClick={props.onAutoScrollInteraction}
           class="relative min-w-0 w-full h-full"
@@ -573,43 +605,64 @@ export function MessageTimeline(props: {
                         aria-label={language.t("common.goBack")}
                       />
                     </Show>
-                    <Show when={titleValue() || title.editing}>
-                      <Show
-                        when={title.editing}
-                        fallback={
-                          <h1
-                            class="text-14-medium text-text-strong truncate grow-1 min-w-0 pl-2"
-                            onDblClick={openTitleEditor}
-                          >
-                            {titleValue()}
-                          </h1>
-                        }
+                    <div class="flex items-center min-w-0 grow-1">
+                      <div
+                        class="shrink-0 flex items-center justify-center overflow-hidden transition-[width,margin] duration-300 ease-[cubic-bezier(0.22,1,0.36,1)]"
+                        style={{
+                          width: slot.open ? "16px" : "0px",
+                          "margin-right": slot.open ? "8px" : "0px",
+                        }}
+                        aria-hidden="true"
                       >
-                        <InlineInput
-                          ref={(el) => {
-                            titleRef = el
-                          }}
-                          value={title.draft}
-                          disabled={title.saving}
-                          class="text-14-medium text-text-strong grow-1 min-w-0 pl-2 rounded-[6px]"
-                          style={{ "--inline-input-shadow": "var(--shadow-xs-border-select)" }}
-                          onInput={(event) => setTitle("draft", event.currentTarget.value)}
-                          onKeyDown={(event) => {
-                            event.stopPropagation()
-                            if (event.key === "Enter") {
-                              event.preventDefault()
-                              void saveTitleEditor()
-                              return
-                            }
-                            if (event.key === "Escape") {
-                              event.preventDefault()
-                              closeTitleEditor()
-                            }
-                          }}
-                          onBlur={closeTitleEditor}
-                        />
+                        <Show when={slot.show}>
+                          <div
+                            class="transition-opacity duration-200 ease-out"
+                            classList={{
+                              "opacity-0": slot.fade,
+                            }}
+                          >
+                            <Spinner class="size-4" style={{ color: "var(--icon-interactive-base)" }} />
+                          </div>
+                        </Show>
+                      </div>
+                      <Show when={titleValue() || title.editing}>
+                        <Show
+                          when={title.editing}
+                          fallback={
+                            <h1
+                              class="text-14-medium text-text-strong truncate grow-1 min-w-0"
+                              onDblClick={openTitleEditor}
+                            >
+                              {titleValue()}
+                            </h1>
+                          }
+                        >
+                          <InlineInput
+                            ref={(el) => {
+                              titleRef = el
+                            }}
+                            value={title.draft}
+                            disabled={title.saving}
+                            class="text-14-medium text-text-strong grow-1 min-w-0 rounded-[6px]"
+                            style={{ "--inline-input-shadow": "var(--shadow-xs-border-select)" }}
+                            onInput={(event) => setTitle("draft", event.currentTarget.value)}
+                            onKeyDown={(event) => {
+                              event.stopPropagation()
+                              if (event.key === "Enter") {
+                                event.preventDefault()
+                                void saveTitleEditor()
+                                return
+                              }
+                              if (event.key === "Escape") {
+                                event.preventDefault()
+                                closeTitleEditor()
+                              }
+                            }}
+                            onBlur={closeTitleEditor}
+                          />
+                        </Show>
                       </Show>
-                    </Show>
+                    </div>
                   </div>
                   <Show when={sessionID()}>
                     {(id) => (
@@ -707,10 +760,6 @@ export function MessageTimeline(props: {
                     <div
                       id={props.anchor(messageID)}
                       data-message-id={messageID}
-                      ref={(el) => {
-                        props.onRegisterMessage(el, messageID)
-                        onCleanup(() => props.onUnregisterMessage(messageID))
-                      }}
                       classList={{
                         "min-w-0 w-full max-w-full": true,
                         "md:max-w-200 2xl:max-w-[1000px]": props.centered,

packages/app/src/pages/session/scroll-spy.test.ts

@@ -1,127 +0,0 @@
-import { describe, expect, test } from "bun:test"
-import { createScrollSpy, pickOffsetId, pickVisibleId } from "./scroll-spy"
-
-const rect = (top: number, height = 80): DOMRect =>
-  ({
-    x: 0,
-    y: top,
-    top,
-    left: 0,
-    right: 800,
-    bottom: top + height,
-    width: 800,
-    height,
-    toJSON: () => ({}),
-  }) as DOMRect
-
-const setRect = (el: Element, top: number, height = 80) => {
-  Object.defineProperty(el, "getBoundingClientRect", {
-    configurable: true,
-    value: () => rect(top, height),
-  })
-}
-
-describe("pickVisibleId", () => {
-  test("prefers higher intersection ratio", () => {
-    const id = pickVisibleId(
-      [
-        { id: "a", ratio: 0.2, top: 100 },
-        { id: "b", ratio: 0.8, top: 300 },
-      ],
-      120,
-    )
-
-    expect(id).toBe("b")
-  })
-
-  test("breaks ratio ties by nearest line", () => {
-    const id = pickVisibleId(
-      [
-        { id: "a", ratio: 0.5, top: 90 },
-        { id: "b", ratio: 0.5, top: 140 },
-      ],
-      130,
-    )
-
-    expect(id).toBe("b")
-  })
-})
-
-describe("pickOffsetId", () => {
-  test("uses binary search cutoff", () => {
-    const id = pickOffsetId(
-      [
-        { id: "a", top: 0 },
-        { id: "b", top: 200 },
-        { id: "c", top: 400 },
-      ],
-      350,
-    )
-
-    expect(id).toBe("b")
-  })
-})
-
-describe("createScrollSpy fallback", () => {
-  test("tracks active id from offsets and dirty refresh", () => {
-    const active: string[] = []
-    const root = document.createElement("div") as HTMLDivElement
-    const one = document.createElement("div")
-    const two = document.createElement("div")
-    const three = document.createElement("div")
-
-    root.append(one, two, three)
-    document.body.append(root)
-
-    Object.defineProperty(root, "scrollTop", { configurable: true, writable: true, value: 250 })
-    setRect(root, 0, 800)
-    setRect(one, -250)
-    setRect(two, -50)
-    setRect(three, 150)
-
-    const queue: FrameRequestCallback[] = []
-    const flush = () => {
-      const run = [...queue]
-      queue.length = 0
-      for (const cb of run) cb(0)
-    }
-
-    const spy = createScrollSpy({
-      onActive: (id) => active.push(id),
-      raf: (cb) => (queue.push(cb), queue.length),
-      caf: () => {},
-      IntersectionObserver: undefined,
-      ResizeObserver: undefined,
-      MutationObserver: undefined,
-    })
-
-    spy.setContainer(root)
-    spy.register(one, "a")
-    spy.register(two, "b")
-    spy.register(three, "c")
-    spy.onScroll()
-    flush()
-
-    expect(spy.getActiveId()).toBe("b")
-    expect(active.at(-1)).toBe("b")
-
-    root.scrollTop = 450
-    setRect(one, -450)
-    setRect(two, -250)
-    setRect(three, -50)
-    spy.onScroll()
-    flush()
-    expect(spy.getActiveId()).toBe("c")
-
-    root.scrollTop = 250
-    setRect(one, -250)
-    setRect(two, 250)
-    setRect(three, 150)
-    spy.markDirty()
-    spy.onScroll()
-    flush()
-    expect(spy.getActiveId()).toBe("a")
-
-    spy.destroy()
-  })
-})

packages/app/src/pages/session/scroll-spy.ts

@@ -1,275 +0,0 @@
-type Visible = {
-  id: string
-  ratio: number
-  top: number
-}
-
-type Offset = {
-  id: string
-  top: number
-}
-
-type Input = {
-  onActive: (id: string) => void
-  raf?: (cb: FrameRequestCallback) => number
-  caf?: (id: number) => void
-  IntersectionObserver?: typeof globalThis.IntersectionObserver
-  ResizeObserver?: typeof globalThis.ResizeObserver
-  MutationObserver?: typeof globalThis.MutationObserver
-}
-
-export const pickVisibleId = (list: Visible[], line: number) => {
-  if (list.length === 0) return
-
-  const sorted = [...list].sort((a, b) => {
-    if (b.ratio !== a.ratio) return b.ratio - a.ratio
-
-    const da = Math.abs(a.top - line)
-    const db = Math.abs(b.top - line)
-    if (da !== db) return da - db
-
-    return a.top - b.top
-  })
-
-  return sorted[0]?.id
-}
-
-export const pickOffsetId = (list: Offset[], cutoff: number) => {
-  if (list.length === 0) return
-
-  let lo = 0
-  let hi = list.length - 1
-  let out = 0
-
-  while (lo <= hi) {
-    const mid = (lo + hi) >> 1
-    const top = list[mid]?.top
-    if (top === undefined) break
-
-    if (top <= cutoff) {
-      out = mid
-      lo = mid + 1
-      continue
-    }
-
-    hi = mid - 1
-  }
-
-  return list[out]?.id
-}
-
-export const createScrollSpy = (input: Input) => {
-  const raf = input.raf ?? requestAnimationFrame
-  const caf = input.caf ?? cancelAnimationFrame
-  const CtorIO = input.IntersectionObserver ?? globalThis.IntersectionObserver
-  const CtorRO = input.ResizeObserver ?? globalThis.ResizeObserver
-  const CtorMO = input.MutationObserver ?? globalThis.MutationObserver
-
-  let root: HTMLDivElement | undefined
-  let io: IntersectionObserver | undefined
-  let ro: ResizeObserver | undefined
-  let mo: MutationObserver | undefined
-  let frame: number | undefined
-  let active: string | undefined
-  let dirty = true
-
-  const node = new Map<string, HTMLElement>()
-  const id = new WeakMap<HTMLElement, string>()
-  const visible = new Map<string, { ratio: number; top: number }>()
-  let offset: Offset[] = []
-
-  const schedule = () => {
-    if (frame !== undefined) return
-    frame = raf(() => {
-      frame = undefined
-      update()
-    })
-  }
-
-  const refreshOffset = () => {
-    const el = root
-    if (!el) {
-      offset = []
-      dirty = false
-      return
-    }
-
-    const base = el.getBoundingClientRect().top
-    offset = [...node].map(([next, item]) => ({
-      id: next,
-      top: item.getBoundingClientRect().top - base + el.scrollTop,
-    }))
-    offset.sort((a, b) => a.top - b.top)
-    dirty = false
-  }
-
-  const update = () => {
-    const el = root
-    if (!el) return
-
-    const line = el.getBoundingClientRect().top + 100
-    const next =
-      pickVisibleId(
-        [...visible].map(([k, v]) => ({
-          id: k,
-          ratio: v.ratio,
-          top: v.top,
-        })),
-        line,
-      ) ??
-      (() => {
-        if (dirty) refreshOffset()
-        return pickOffsetId(offset, el.scrollTop + 100)
-      })()
-
-    if (!next || next === active) return
-    active = next
-    input.onActive(next)
-  }
-
-  const observe = () => {
-    const el = root
-    if (!el) return
-
-    io?.disconnect()
-    io = undefined
-    if (CtorIO) {
-      try {
-        io = new CtorIO(
-          (entries) => {
-            for (const entry of entries) {
-              const item = entry.target
-              if (!(item instanceof HTMLElement)) continue
-              const key = id.get(item)
-              if (!key) continue
-
-              if (!entry.isIntersecting || entry.intersectionRatio <= 0) {
-                visible.delete(key)
-                continue
-              }
-
-              visible.set(key, {
-                ratio: entry.intersectionRatio,
-                top: entry.boundingClientRect.top,
-              })
-            }
-
-            schedule()
-          },
-          {
-            root: el,
-            threshold: [0, 0.25, 0.5, 0.75, 1],
-          },
-        )
-      } catch {
-        io = undefined
-      }
-    }
-
-    if (io) {
-      for (const item of node.values()) io.observe(item)
-    }
-
-    ro?.disconnect()
-    ro = undefined
-    if (CtorRO) {
-      ro = new CtorRO(() => {
-        dirty = true
-        schedule()
-      })
-      ro.observe(el)
-      for (const item of node.values()) ro.observe(item)
-    }
-
-    mo?.disconnect()
-    mo = undefined
-    if (CtorMO) {
-      mo = new CtorMO(() => {
-        dirty = true
-        schedule()
-      })
-      mo.observe(el, { subtree: true, childList: true, characterData: true })
-    }
-
-    dirty = true
-    schedule()
-  }
-
-  const setContainer = (el?: HTMLDivElement) => {
-    if (root === el) return
-
-    root = el
-    visible.clear()
-    active = undefined
-    observe()
-  }
-
-  const register = (el: HTMLElement, key: string) => {
-    const prev = node.get(key)
-    if (prev && prev !== el) {
-      io?.unobserve(prev)
-      ro?.unobserve(prev)
-    }
-
-    node.set(key, el)
-    id.set(el, key)
-    if (io) io.observe(el)
-    if (ro) ro.observe(el)
-    dirty = true
-    schedule()
-  }
-
-  const unregister = (key: string) => {
-    const item = node.get(key)
-    if (!item) return
-
-    io?.unobserve(item)
-    ro?.unobserve(item)
-    node.delete(key)
-    visible.delete(key)
-    dirty = true
-    schedule()
-  }
-
-  const markDirty = () => {
-    dirty = true
-    schedule()
-  }
-
-  const clear = () => {
-    for (const item of node.values()) {
-      io?.unobserve(item)
-      ro?.unobserve(item)
-    }
-
-    node.clear()
-    visible.clear()
-    offset = []
-    active = undefined
-    dirty = true
-  }
-
-  const destroy = () => {
-    if (frame !== undefined) caf(frame)
-    frame = undefined
-    clear()
-    io?.disconnect()
-    ro?.disconnect()
-    mo?.disconnect()
-    io = undefined
-    ro = undefined
-    mo = undefined
-    root = undefined
-  }
-
-  return {
-    setContainer,
-    register,
-    unregister,
-    onScroll: schedule,
-    markDirty,
-    clear,
-    destroy,
-    getActiveId: () => active,
-  }
-}

packages/app/src/pages/session/use-session-hash-scroll.ts

@@ -1,6 +1,6 @@
 import type { UserMessage } from "@opencode-ai/sdk/v2"
 import { useLocation, useNavigate } from "@solidjs/router"
-import { createEffect, createMemo, onMount } from "solid-js"
+import { createEffect, createMemo, onCleanup, onMount } from "solid-js"
 import { messageIdFromHash } from "./message-id-from-hash"
 
 export { messageIdFromHash } from "./message-id-from-hash"
@@ -26,17 +26,38 @@ export const useSessionHashScroll = (input: {
   const messageById = createMemo(() => new Map(visibleUserMessages().map((m) => [m.id, m])))
   const messageIndex = createMemo(() => new Map(visibleUserMessages().map((m, i) => [m.id, i])))
   let pendingKey = ""
+  let clearing = false
 
   const location = useLocation()
   const navigate = useNavigate()
 
+  const frames = new Set<number>()
+  const queue = (fn: () => void) => {
+    const id = requestAnimationFrame(() => {
+      frames.delete(id)
+      fn()
+    })
+    frames.add(id)
+  }
+  const cancel = () => {
+    for (const id of frames) cancelAnimationFrame(id)
+    frames.clear()
+  }
+
   const clearMessageHash = () => {
+    cancel()
+    input.consumePendingMessage(input.sessionKey())
+    if (input.pendingMessage()) input.setPendingMessage(undefined)
     if (!location.hash) return
+    clearing = true
     navigate(location.pathname + location.search, { replace: true })
   }
 
   const updateHash = (id: string) => {
-    navigate(location.pathname + location.search + `#${input.anchor(id)}`, {
+    const hash = `#${input.anchor(id)}`
+    if (location.hash === hash) return
+    clearing = false
+    navigate(location.pathname + location.search + hash, {
       replace: true,
     })
   }
@@ -54,51 +75,37 @@ export const useSessionHashScroll = (input: {
     return true
   }
 
+  const seek = (id: string, behavior: ScrollBehavior, left = 4): boolean => {
+    const el = document.getElementById(input.anchor(id))
+    if (el) return scrollToElement(el, behavior)
+    if (left <= 0) return false
+    queue(() => {
+      seek(id, behavior, left - 1)
+    })
+    return false
+  }
+
   const scrollToMessage = (message: UserMessage, behavior: ScrollBehavior = "smooth") => {
-    console.log({ message, behavior })
+    cancel()
     if (input.currentMessageId() !== message.id) input.setActiveMessage(message)
 
     const index = messageIndex().get(message.id) ?? -1
     if (index !== -1 && index < input.turnStart()) {
       input.setTurnStart(index)
 
-      requestAnimationFrame(() => {
-        const el = document.getElementById(input.anchor(message.id))
-        if (!el) {
-          requestAnimationFrame(() => {
-            const next = document.getElementById(input.anchor(message.id))
-            if (!next) return
-            scrollToElement(next, behavior)
-          })
-          return
-        }
-        scrollToElement(el, behavior)
+      queue(() => {
+        seek(message.id, behavior)
       })
 
       updateHash(message.id)
       return
     }
 
-    const el = document.getElementById(input.anchor(message.id))
-    if (!el) {
-      updateHash(message.id)
-      requestAnimationFrame(() => {
-        const next = document.getElementById(input.anchor(message.id))
-        if (!next) return
-        if (!scrollToElement(next, behavior)) return
-      })
-      return
-    }
-    if (scrollToElement(el, behavior)) {
+    if (seek(message.id, behavior)) {
       updateHash(message.id)
       return
     }
 
-    requestAnimationFrame(() => {
-      const next = document.getElementById(input.anchor(message.id))
-      if (!next) return
-      if (!scrollToElement(next, behavior)) return
-    })
     updateHash(message.id)
   }
 
@@ -135,9 +142,11 @@ export const useSessionHashScroll = (input: {
   }
 
   createEffect(() => {
-    location.hash
+    const hash = location.hash
+    if (!hash) clearing = false
     if (!input.sessionID() || !input.messagesReady()) return
-    requestAnimationFrame(() => applyHash("auto"))
+    cancel()
+    queue(() => applyHash("auto"))
   })
 
   createEffect(() => {
@@ -159,16 +168,19 @@ export const useSessionHashScroll = (input: {
       }
     }
 
-    if (!targetId) targetId = messageIdFromHash(location.hash)
+    if (!targetId && !clearing) targetId = messageIdFromHash(location.hash)
     if (!targetId) return
-    if (input.currentMessageId() === targetId) return
 
+    const pending = input.pendingMessage() === targetId
     const msg = messageById().get(targetId)
     if (!msg) return
 
-    if (input.pendingMessage() === targetId) input.setPendingMessage(undefined)
+    if (pending) input.setPendingMessage(undefined)
+    if (input.currentMessageId() === targetId && !pending) return
+
     input.autoScroll.pause()
-    requestAnimationFrame(() => scrollToMessage(msg, "auto"))
+    cancel()
+    queue(() => scrollToMessage(msg, "auto"))
   })
 
   onMount(() => {
@@ -177,6 +189,8 @@ export const useSessionHashScroll = (input: {
     }
   })
 
+  onCleanup(cancel)
+
   return {
     clearMessageHash,
     scrollToMessage,

packages/console/app/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/console-app",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "type": "module",
   "license": "MIT",
   "scripts": {

packages/console/core/package.json

@@ -1,7 +1,7 @@
 {
   "$schema": "https://json.schemastore.org/package.json",
   "name": "@opencode-ai/console-core",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "private": true,
   "type": "module",
   "license": "MIT",

packages/console/function/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/console-function",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "$schema": "https://json.schemastore.org/package.json",
   "private": true,
   "type": "module",

packages/console/mail/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/console-mail",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "dependencies": {
     "@jsx-email/all": "2.2.3",
     "@jsx-email/cli": "1.4.3",

packages/desktop-electron/package.json

@@ -1,7 +1,7 @@
 {
   "name": "@opencode-ai/desktop-electron",
   "private": true,
-  "version": "1.2.23",
+  "version": "1.2.24",
   "type": "module",
   "license": "MIT",
   "homepage": "https://opencode.ai",

packages/desktop/package.json

@@ -1,7 +1,7 @@
 {
   "name": "@opencode-ai/desktop",
   "private": true,
-  "version": "1.2.23",
+  "version": "1.2.24",
   "type": "module",
   "license": "MIT",
   "scripts": {

packages/enterprise/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/enterprise",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "private": true,
   "type": "module",
   "license": "MIT",

packages/extensions/zed/extension.toml

@@ -1,7 +1,7 @@
 id = "opencode"
 name = "OpenCode"
 description = "The open source coding agent."
-version = "1.2.23"
+version = "1.2.24"
 schema_version = 1
 authors = ["Anomaly"]
 repository = "https://github.com/anomalyco/opencode"
@@ -11,26 +11,26 @@ name = "OpenCode"
 icon = "./icons/opencode.svg"
 
 [agent_servers.opencode.targets.darwin-aarch64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.23/opencode-darwin-arm64.zip"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.24/opencode-darwin-arm64.zip"
 cmd = "./opencode"
 args = ["acp"]
 
 [agent_servers.opencode.targets.darwin-x86_64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.23/opencode-darwin-x64.zip"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.24/opencode-darwin-x64.zip"
 cmd = "./opencode"
 args = ["acp"]
 
 [agent_servers.opencode.targets.linux-aarch64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.23/opencode-linux-arm64.tar.gz"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.24/opencode-linux-arm64.tar.gz"
 cmd = "./opencode"
 args = ["acp"]
 
 [agent_servers.opencode.targets.linux-x86_64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.23/opencode-linux-x64.tar.gz"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.24/opencode-linux-x64.tar.gz"
 cmd = "./opencode"
 args = ["acp"]
 
 [agent_servers.opencode.targets.windows-x86_64]
-archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.23/opencode-windows-x64.zip"
+archive = "https://github.com/anomalyco/opencode/releases/download/v1.2.24/opencode-windows-x64.zip"
 cmd = "./opencode.exe"
 args = ["acp"]

packages/function/package.json

@@ -1,6 +1,6 @@
 {
   "name": "@opencode-ai/function",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "$schema": "https://json.schemastore.org/package.json",
   "private": true,
   "type": "module",

packages/opencode/migration/20260228203230_blue_harpoon/migration.sql

@@ -0,0 +1,17 @@
+CREATE TABLE `account` (
+	`id` text PRIMARY KEY,
+	`email` text NOT NULL,
+	`url` text NOT NULL,
+	`access_token` text NOT NULL,
+	`refresh_token` text NOT NULL,
+	`token_expiry` integer,
+	`selected_org_id` text,
+	`time_created` integer NOT NULL,
+	`time_updated` integer NOT NULL
+);
+--> statement-breakpoint
+CREATE TABLE `account_state` (
+	`id` integer PRIMARY KEY NOT NULL,
+	`active_account_id` text,
+	FOREIGN KEY (`active_account_id`) REFERENCES `account`(`id`) ON UPDATE no action ON DELETE set null
+);

packages/opencode/migration/20260309230000_move_org_to_state/migration.sql

@@ -0,0 +1,3 @@
+ALTER TABLE `account_state` ADD `active_org_id` text;--> statement-breakpoint
+UPDATE `account_state` SET `active_org_id` = (SELECT `selected_org_id` FROM `account` WHERE `account`.`id` = `account_state`.`active_account_id`);--> statement-breakpoint
+ALTER TABLE `account` DROP COLUMN `selected_org_id`;

packages/opencode/package.json

@@ -1,6 +1,6 @@
 {
   "$schema": "https://json.schemastore.org/package.json",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "name": "opencode",
   "type": "module",
   "license": "MIT",
@@ -27,6 +27,7 @@
   },
   "devDependencies": {
     "@babel/core": "7.28.4",
+    "@effect/language-service": "0.79.0",
     "@octokit/webhooks-types": "7.6.1",
     "@opencode-ai/script": "workspace:*",
     "@parcel/watcher-darwin-arm64": "2.5.1",
@@ -41,6 +42,7 @@
     "@types/babel__core": "7.20.5",
     "@types/bun": "catalog:",
     "@types/mime-types": "3.0.1",
+    "@types/semver": "^7.5.8",
     "@types/turndown": "5.0.5",
     "@types/yargs": "17.0.33",
     "@types/which": "3.0.4",
@@ -107,6 +109,7 @@
     "decimal.js": "10.5.0",
     "diff": "catalog:",
     "drizzle-orm": "1.0.0-beta.16-ea816b6",
+    "effect": "catalog:",
     "fuzzysort": "3.1.0",
     "glob": "13.0.5",
     "google-auth-library": "10.5.0",
@@ -121,6 +124,7 @@
     "opentui-spinner": "0.0.6",
     "partial-json": "0.1.7",
     "remeda": "catalog:",
+    "semver": "^7.6.3",
     "solid-js": "catalog:",
     "strip-ansi": "7.1.2",
     "tree-sitter-bash": "0.25.0",

packages/opencode/src/account/account.sql.ts

@@ -1,7 +1,23 @@
-import { sqliteTable, text, integer, primaryKey, uniqueIndex } from "drizzle-orm/sqlite-core"
-import { eq } from "drizzle-orm"
+import { sqliteTable, text, integer, primaryKey } from "drizzle-orm/sqlite-core"
 import { Timestamps } from "@/storage/schema.sql"
 
+export const AccountTable = sqliteTable("account", {
+  id: text().primaryKey(),
+  email: text().notNull(),
+  url: text().notNull(),
+  access_token: text().notNull(),
+  refresh_token: text().notNull(),
+  token_expiry: integer(),
+  ...Timestamps,
+})
+
+export const AccountStateTable = sqliteTable("account_state", {
+  id: integer().primaryKey(),
+  active_account_id: text().references(() => AccountTable.id, { onDelete: "set null" }),
+  active_org_id: text(),
+})
+
+// LEGACY
 export const ControlAccountTable = sqliteTable(
   "control_account",
   {

packages/opencode/src/account/index.ts

@@ -0,0 +1,43 @@
+import { Effect, Option, ServiceMap } from "effect"
+
+import {
+  Account as AccountSchema,
+  type AccountError,
+  type AccessToken,
+  AccountID,
+  AccountService,
+  OrgID,
+} from "./service"
+
+export { AccessToken, AccountID, OrgID } from "./service"
+
+import { runtime } from "@/effect/runtime"
+
+type AccountServiceShape = ServiceMap.Service.Shape<typeof AccountService>
+
+function runSync<A>(f: (service: AccountServiceShape) => Effect.Effect<A, AccountError>) {
+  return runtime.runSync(AccountService.use(f))
+}
+
+function runPromise<A>(f: (service: AccountServiceShape) => Effect.Effect<A, AccountError>) {
+  return runtime.runPromise(AccountService.use(f))
+}
+
+export namespace Account {
+  export const Account = AccountSchema
+  export type Account = AccountSchema
+
+  export function active(): Account | undefined {
+    return Option.getOrUndefined(runSync((service) => service.active()))
+  }
+
+  export async function config(accountID: AccountID, orgID: OrgID): Promise<Record<string, unknown> | undefined> {
+    const config = await runPromise((service) => service.config(accountID, orgID))
+    return Option.getOrUndefined(config)
+  }
+
+  export async function token(accountID: AccountID): Promise<AccessToken | undefined> {
+    const token = await runPromise((service) => service.token(accountID))
+    return Option.getOrUndefined(token)
+  }
+}

packages/opencode/src/account/repo.ts

@@ -0,0 +1,138 @@
+import { eq } from "drizzle-orm"
+import { Effect, Layer, Option, Schema, ServiceMap } from "effect"
+
+import { Database } from "@/storage/db"
+import { AccountStateTable, AccountTable } from "./account.sql"
+import { Account, AccountID, AccountRepoError, OrgID } from "./schema"
+
+export type AccountRow = (typeof AccountTable)["$inferSelect"]
+
+const decodeAccount = Schema.decodeUnknownSync(Account)
+
+type DbClient = Parameters<typeof Database.use>[0] extends (db: infer T) => unknown ? T : never
+
+const ACCOUNT_STATE_ID = 1
+
+const db = <A>(run: (db: DbClient) => A) =>
+  Effect.try({
+    try: () => Database.use(run),
+    catch: (cause) => new AccountRepoError({ message: "Database operation failed", cause }),
+  })
+
+const current = (db: DbClient) => {
+  const state = db.select().from(AccountStateTable).where(eq(AccountStateTable.id, ACCOUNT_STATE_ID)).get()
+  if (!state?.active_account_id) return
+  const account = db.select().from(AccountTable).where(eq(AccountTable.id, state.active_account_id)).get()
+  if (!account) return
+  return { ...account, active_org_id: state.active_org_id ?? null }
+}
+
+const setState = (db: DbClient, accountID: AccountID, orgID: string | null) =>
+  db
+    .insert(AccountStateTable)
+    .values({ id: ACCOUNT_STATE_ID, active_account_id: accountID, active_org_id: orgID })
+    .onConflictDoUpdate({
+      target: AccountStateTable.id,
+      set: { active_account_id: accountID, active_org_id: orgID },
+    })
+    .run()
+
+export class AccountRepo extends ServiceMap.Service<
+  AccountRepo,
+  {
+    readonly active: () => Effect.Effect<Option.Option<Account>, AccountRepoError>
+    readonly list: () => Effect.Effect<Account[], AccountRepoError>
+    readonly remove: (accountID: AccountID) => Effect.Effect<void, AccountRepoError>
+    readonly use: (accountID: AccountID, orgID: Option.Option<OrgID>) => Effect.Effect<void, AccountRepoError>
+    readonly getRow: (accountID: AccountID) => Effect.Effect<Option.Option<AccountRow>, AccountRepoError>
+    readonly persistToken: (input: {
+      accountID: AccountID
+      accessToken: string
+      refreshToken: string
+      expiry: Option.Option<number>
+    }) => Effect.Effect<void, AccountRepoError>
+    readonly persistAccount: (input: {
+      id: AccountID
+      email: string
+      url: string
+      accessToken: string
+      refreshToken: string
+      expiry: number
+      orgID: Option.Option<OrgID>
+    }) => Effect.Effect<void, AccountRepoError>
+  }
+>()("@opencode/AccountRepo") {
+  static readonly layer: Layer.Layer<AccountRepo> = Layer.succeed(
+    AccountRepo,
+    AccountRepo.of({
+      active: Effect.fn("AccountRepo.active")(() =>
+        db((db) => current(db)).pipe(Effect.map((row) => (row ? Option.some(decodeAccount(row)) : Option.none()))),
+      ),
+
+      list: Effect.fn("AccountRepo.list")(() => db((db) => db.select().from(AccountTable).all().map((row) => decodeAccount({ ...row, active_org_id: null })))),
+
+      remove: Effect.fn("AccountRepo.remove")((accountID: AccountID) =>
+        db((db) =>
+          Database.transaction((tx) => {
+            tx.update(AccountStateTable)
+              .set({ active_account_id: null, active_org_id: null })
+              .where(eq(AccountStateTable.active_account_id, accountID))
+              .run()
+            tx.delete(AccountTable).where(eq(AccountTable.id, accountID)).run()
+          }),
+        ).pipe(Effect.asVoid),
+      ),
+
+      use: Effect.fn("AccountRepo.use")((accountID: AccountID, orgID: Option.Option<OrgID>) =>
+        db((db) => setState(db, accountID, Option.getOrNull(orgID))).pipe(Effect.asVoid),
+      ),
+
+      getRow: Effect.fn("AccountRepo.getRow")((accountID: AccountID) =>
+        db((db) => db.select().from(AccountTable).where(eq(AccountTable.id, accountID)).get()).pipe(
+          Effect.map(Option.fromNullishOr),
+        ),
+      ),
+
+      persistToken: Effect.fn("AccountRepo.persistToken")((input) =>
+        db((db) =>
+          db
+            .update(AccountTable)
+            .set({
+              access_token: input.accessToken,
+              refresh_token: input.refreshToken,
+              token_expiry: Option.getOrNull(input.expiry),
+            })
+            .where(eq(AccountTable.id, input.accountID))
+            .run(),
+        ).pipe(Effect.asVoid),
+      ),
+
+      persistAccount: Effect.fn("AccountRepo.persistAccount")((input) => {
+        const orgID = Option.getOrNull(input.orgID)
+        return db((db) =>
+          Database.transaction((tx) => {
+            tx.insert(AccountTable)
+              .values({
+                id: input.id,
+                email: input.email,
+                url: input.url,
+                access_token: input.accessToken,
+                refresh_token: input.refreshToken,
+                token_expiry: input.expiry,
+              })
+              .onConflictDoUpdate({
+                target: AccountTable.id,
+                set: {
+                  access_token: input.accessToken,
+                  refresh_token: input.refreshToken,
+                  token_expiry: input.expiry,
+                },
+              })
+              .run()
+            setState(tx, input.id, orgID)
+          }),
+        ).pipe(Effect.asVoid)
+      }),
+    }),
+  )
+}

packages/opencode/src/account/schema.ts

@@ -0,0 +1,73 @@
+import { Schema } from "effect"
+
+import { withStatics } from "@/util/schema"
+
+export const AccountID = Schema.String.pipe(
+  Schema.brand("AccountId"),
+  withStatics((s) => ({ make: (id: string) => s.makeUnsafe(id) })),
+)
+export type AccountID = Schema.Schema.Type<typeof AccountID>
+
+export const OrgID = Schema.String.pipe(
+  Schema.brand("OrgId"),
+  withStatics((s) => ({ make: (id: string) => s.makeUnsafe(id) })),
+)
+export type OrgID = Schema.Schema.Type<typeof OrgID>
+
+export const AccessToken = Schema.String.pipe(
+  Schema.brand("AccessToken"),
+  withStatics((s) => ({ make: (token: string) => s.makeUnsafe(token) })),
+)
+export type AccessToken = Schema.Schema.Type<typeof AccessToken>
+
+export class Account extends Schema.Class<Account>("Account")({
+  id: AccountID,
+  email: Schema.String,
+  url: Schema.String,
+  active_org_id: Schema.NullOr(OrgID),
+}) {}
+
+export class Org extends Schema.Class<Org>("Org")({
+  id: OrgID,
+  name: Schema.String,
+}) {}
+
+export class AccountRepoError extends Schema.TaggedErrorClass<AccountRepoError>()("AccountRepoError", {
+  message: Schema.String,
+  cause: Schema.optional(Schema.Defect),
+}) {}
+
+export class AccountServiceError extends Schema.TaggedErrorClass<AccountServiceError>()("AccountServiceError", {
+  message: Schema.String,
+  cause: Schema.optional(Schema.Defect),
+}) {}
+
+export type AccountError = AccountRepoError | AccountServiceError
+
+export class Login extends Schema.Class<Login>("Login")({
+  code: Schema.String,
+  user: Schema.String,
+  url: Schema.String,
+  server: Schema.String,
+  expiry: Schema.Number,
+  interval: Schema.Number,
+}) {}
+
+export class PollSuccess extends Schema.TaggedClass<PollSuccess>()("PollSuccess", {
+  email: Schema.String,
+}) {}
+
+export class PollPending extends Schema.TaggedClass<PollPending>()("PollPending", {}) {}
+
+export class PollSlow extends Schema.TaggedClass<PollSlow>()("PollSlow", {}) {}
+
+export class PollExpired extends Schema.TaggedClass<PollExpired>()("PollExpired", {}) {}
+
+export class PollDenied extends Schema.TaggedClass<PollDenied>()("PollDenied", {}) {}
+
+export class PollError extends Schema.TaggedClass<PollError>()("PollError", {
+  cause: Schema.Defect,
+}) {}
+
+export const PollResult = Schema.Union([PollSuccess, PollPending, PollSlow, PollExpired, PollDenied, PollError])
+export type PollResult = Schema.Schema.Type<typeof PollResult>

packages/opencode/src/account/service.ts

@@ -0,0 +1,385 @@
+import { Clock, Effect, Layer, Option, Schema, ServiceMap } from "effect"
+import {
+  FetchHttpClient,
+  HttpClient,
+  HttpClientError,
+  HttpClientRequest,
+  HttpClientResponse,
+} from "effect/unstable/http"
+
+import { withTransientReadRetry } from "@/util/effect-http-client"
+import { AccountRepo, type AccountRow } from "./repo"
+import {
+  type AccountError,
+  AccessToken,
+  Account,
+  AccountID,
+  AccountRepoError,
+  AccountServiceError,
+  Login,
+  Org,
+  OrgID,
+  PollDenied,
+  PollError,
+  PollExpired,
+  PollPending,
+  type PollResult,
+  PollSlow,
+  PollSuccess,
+} from "./schema"
+
+export * from "./schema"
+
+export type AccountOrgs = {
+  account: Account
+  orgs: Org[]
+}
+
+const RemoteOrg = Schema.Struct({
+  id: Schema.optional(OrgID),
+  name: Schema.optional(Schema.String),
+})
+
+const RemoteOrgs = Schema.Array(RemoteOrg)
+
+const RemoteConfig = Schema.Struct({
+  config: Schema.Record(Schema.String, Schema.Json),
+})
+
+const TokenRefresh = Schema.Struct({
+  access_token: Schema.String,
+  refresh_token: Schema.optional(Schema.String),
+  expires_in: Schema.optional(Schema.Number),
+})
+
+const DeviceCode = Schema.Struct({
+  device_code: Schema.String,
+  user_code: Schema.String,
+  verification_uri_complete: Schema.String,
+  expires_in: Schema.Number,
+  interval: Schema.Number,
+})
+
+const DeviceToken = Schema.Struct({
+  access_token: Schema.optional(Schema.String),
+  refresh_token: Schema.optional(Schema.String),
+  expires_in: Schema.optional(Schema.Number),
+  error: Schema.optional(Schema.String),
+  error_description: Schema.optional(Schema.String),
+})
+
+const User = Schema.Struct({
+  id: Schema.optional(AccountID),
+  email: Schema.optional(Schema.String),
+})
+
+const ClientId = Schema.Struct({ client_id: Schema.String })
+
+const DeviceTokenRequest = Schema.Struct({
+  grant_type: Schema.String,
+  device_code: Schema.String,
+  client_id: Schema.String,
+})
+
+const serverDefault = "https://web-14275-d60e67f5-pyqs0590.onporter.run"
+const clientId = "opencode-cli"
+
+const toAccountServiceError = (message: string, cause?: unknown) => new AccountServiceError({ message, cause })
+
+const mapAccountServiceError =
+  (operation: string, message = "Account service operation failed") =>
+  <A, E, R>(effect: Effect.Effect<A, E, R>): Effect.Effect<A, AccountServiceError, R> =>
+    effect.pipe(
+      Effect.mapError((error) =>
+        error instanceof AccountServiceError ? error : toAccountServiceError(`${message} (${operation})`, error),
+      ),
+    )
+
+export class AccountService extends ServiceMap.Service<
+  AccountService,
+  {
+    readonly active: () => Effect.Effect<Option.Option<Account>, AccountError>
+    readonly list: () => Effect.Effect<Account[], AccountError>
+    readonly orgsByAccount: () => Effect.Effect<AccountOrgs[], AccountError>
+    readonly remove: (accountID: AccountID) => Effect.Effect<void, AccountError>
+    readonly use: (accountID: AccountID, orgID: Option.Option<OrgID>) => Effect.Effect<void, AccountError>
+    readonly orgs: (accountID: AccountID) => Effect.Effect<Org[], AccountError>
+    readonly config: (
+      accountID: AccountID,
+      orgID: OrgID,
+    ) => Effect.Effect<Option.Option<Record<string, unknown>>, AccountError>
+    readonly token: (accountID: AccountID) => Effect.Effect<Option.Option<AccessToken>, AccountError>
+    readonly login: (url?: string) => Effect.Effect<Login, AccountError>
+    readonly poll: (input: Login) => Effect.Effect<PollResult, AccountError>
+  }
+>()("@opencode/Account") {
+  static readonly layer: Layer.Layer<AccountService, never, AccountRepo | HttpClient.HttpClient> = Layer.effect(
+    AccountService,
+    Effect.gen(function* () {
+      const repo = yield* AccountRepo
+      const http = yield* HttpClient.HttpClient
+      const httpRead = withTransientReadRetry(http)
+
+      const execute = (operation: string, request: HttpClientRequest.HttpClientRequest) =>
+        http.execute(request).pipe(mapAccountServiceError(operation, "HTTP request failed"))
+
+      const executeRead = (operation: string, request: HttpClientRequest.HttpClientRequest) =>
+        httpRead.execute(request).pipe(mapAccountServiceError(operation, "HTTP request failed"))
+
+      const executeEffect = <E>(operation: string, request: Effect.Effect<HttpClientRequest.HttpClientRequest, E>) =>
+        request.pipe(
+          Effect.flatMap((req) => http.execute(req)),
+          mapAccountServiceError(operation, "HTTP request failed"),
+        )
+
+      const okOrNone = (operation: string, response: HttpClientResponse.HttpClientResponse) =>
+        HttpClientResponse.filterStatusOk(response).pipe(
+          Effect.map(Option.some),
+          Effect.catch((error) =>
+            HttpClientError.isHttpClientError(error) && error.reason._tag === "StatusCodeError"
+              ? Effect.succeed(Option.none<HttpClientResponse.HttpClientResponse>())
+              : Effect.fail(error),
+          ),
+          mapAccountServiceError(operation),
+        )
+
+      const tokenForRow = Effect.fn("AccountService.tokenForRow")(function* (found: AccountRow) {
+        const now = yield* Clock.currentTimeMillis
+        if (found.token_expiry && found.token_expiry > now) return Option.some(AccessToken.make(found.access_token))
+
+        const response = yield* execute(
+          "token.refresh",
+          HttpClientRequest.post(`${found.url}/oauth/token`).pipe(
+            HttpClientRequest.acceptJson,
+            HttpClientRequest.bodyUrlParams({
+              grant_type: "refresh_token",
+              refresh_token: found.refresh_token,
+            }),
+          ),
+        )
+
+        const ok = yield* okOrNone("token.refresh", response)
+        if (Option.isNone(ok)) return Option.none()
+
+        const parsed = yield* HttpClientResponse.schemaBodyJson(TokenRefresh)(ok.value).pipe(
+          mapAccountServiceError("token.refresh", "Failed to decode response"),
+        )
+
+        const expiry = Option.fromNullishOr(parsed.expires_in).pipe(Option.map((e) => now + e * 1000))
+
+        yield* repo.persistToken({
+          accountID: AccountID.make(found.id),
+          accessToken: parsed.access_token,
+          refreshToken: parsed.refresh_token ?? found.refresh_token,
+          expiry,
+        })
+
+        return Option.some(AccessToken.make(parsed.access_token))
+      })
+
+      const resolveAccess = Effect.fn("AccountService.resolveAccess")(function* (accountID: AccountID) {
+        const maybeAccount = yield* repo.getRow(accountID)
+        if (Option.isNone(maybeAccount)) return Option.none<{ account: AccountRow; accessToken: AccessToken }>()
+
+        const account = maybeAccount.value
+        const accessToken = yield* tokenForRow(account)
+        if (Option.isNone(accessToken)) return Option.none<{ account: AccountRow; accessToken: AccessToken }>()
+
+        return Option.some({ account, accessToken: accessToken.value })
+      })
+
+      const token = Effect.fn("AccountService.token")((accountID: AccountID) =>
+        resolveAccess(accountID).pipe(Effect.map(Option.map((r) => r.accessToken))),
+      )
+
+      const orgsByAccount = Effect.fn("AccountService.orgsByAccount")(function* () {
+        const accounts = yield* repo.list()
+        return yield* Effect.forEach(
+          accounts,
+          (account) => orgs(account.id).pipe(Effect.map((orgs) => ({ account, orgs }))),
+          { concurrency: 3 },
+        )
+      })
+
+      const orgs = Effect.fn("AccountService.orgs")(function* (accountID: AccountID) {
+        const resolved = yield* resolveAccess(accountID)
+        if (Option.isNone(resolved)) return []
+
+        const { account, accessToken } = resolved.value
+
+        const response = yield* executeRead(
+          "orgs",
+          HttpClientRequest.get(`${account.url}/api/orgs`).pipe(
+            HttpClientRequest.acceptJson,
+            HttpClientRequest.bearerToken(accessToken),
+          ),
+        )
+
+        const ok = yield* okOrNone("orgs", response)
+        if (Option.isNone(ok)) return []
+
+        const orgs = yield* HttpClientResponse.schemaBodyJson(RemoteOrgs)(ok.value).pipe(
+          mapAccountServiceError("orgs", "Failed to decode response"),
+        )
+        return orgs
+          .filter((org) => org.id !== undefined && org.name !== undefined)
+          .map((org) => new Org({ id: org.id!, name: org.name! }))
+      })
+
+      const config = Effect.fn("AccountService.config")(function* (accountID: AccountID, orgID: OrgID) {
+        const resolved = yield* resolveAccess(accountID)
+        if (Option.isNone(resolved)) return Option.none()
+
+        const { account, accessToken } = resolved.value
+
+        const response = yield* executeRead(
+          "config",
+          HttpClientRequest.get(`${account.url}/api/config`).pipe(
+            HttpClientRequest.acceptJson,
+            HttpClientRequest.bearerToken(accessToken),
+            HttpClientRequest.setHeaders({ "x-org-id": orgID }),
+          ),
+        )
+
+        const ok = yield* okOrNone("config", response)
+        if (Option.isNone(ok)) return Option.none()
+
+        const parsed = yield* HttpClientResponse.schemaBodyJson(RemoteConfig)(ok.value).pipe(
+          mapAccountServiceError("config", "Failed to decode response"),
+        )
+        return Option.some(parsed.config)
+      })
+
+      const login = Effect.fn("AccountService.login")(function* (url?: string) {
+        const server = url ?? serverDefault
+
+        const response = yield* executeEffect(
+          "login",
+          HttpClientRequest.post(`${server}/auth/device/code`).pipe(
+            HttpClientRequest.acceptJson,
+            HttpClientRequest.schemaBodyJson(ClientId)({ client_id: clientId }),
+          ),
+        )
+
+        const ok = yield* okOrNone("login", response)
+        if (Option.isNone(ok)) {
+          const body = yield* response.text.pipe(Effect.orElseSucceed(() => ""))
+          return yield* toAccountServiceError(`Failed to initiate device flow: ${body || response.status}`)
+        }
+
+        const parsed = yield* HttpClientResponse.schemaBodyJson(DeviceCode)(ok.value).pipe(
+          mapAccountServiceError("login", "Failed to decode response"),
+        )
+        return new Login({
+          code: parsed.device_code,
+          user: parsed.user_code,
+          url: `${server}${parsed.verification_uri_complete}`,
+          server,
+          expiry: parsed.expires_in,
+          interval: parsed.interval,
+        })
+      })
+
+      const poll = Effect.fn("AccountService.poll")(function* (input: Login) {
+        const response = yield* executeEffect(
+          "poll",
+          HttpClientRequest.post(`${input.server}/auth/device/token`).pipe(
+            HttpClientRequest.acceptJson,
+            HttpClientRequest.schemaBodyJson(DeviceTokenRequest)({
+              grant_type: "urn:ietf:params:oauth:grant-type:device_code",
+              device_code: input.code,
+              client_id: clientId,
+            }),
+          ),
+        )
+
+        const parsed = yield* HttpClientResponse.schemaBodyJson(DeviceToken)(response).pipe(
+          mapAccountServiceError("poll", "Failed to decode response"),
+        )
+
+        if (!parsed.access_token) {
+          if (parsed.error === "authorization_pending") return new PollPending()
+          if (parsed.error === "slow_down") return new PollSlow()
+          if (parsed.error === "expired_token") return new PollExpired()
+          if (parsed.error === "access_denied") return new PollDenied()
+          return new PollError({ cause: parsed.error })
+        }
+
+        const access = parsed.access_token
+
+        const fetchUser = executeRead(
+          "poll.user",
+          HttpClientRequest.get(`${input.server}/api/user`).pipe(
+            HttpClientRequest.acceptJson,
+            HttpClientRequest.bearerToken(access),
+          ),
+        ).pipe(
+          Effect.flatMap((r) =>
+            HttpClientResponse.schemaBodyJson(User)(r).pipe(
+              mapAccountServiceError("poll.user", "Failed to decode response"),
+            ),
+          ),
+        )
+
+        const fetchOrgs = executeRead(
+          "poll.orgs",
+          HttpClientRequest.get(`${input.server}/api/orgs`).pipe(
+            HttpClientRequest.acceptJson,
+            HttpClientRequest.bearerToken(access),
+          ),
+        ).pipe(
+          Effect.flatMap((r) =>
+            HttpClientResponse.schemaBodyJson(RemoteOrgs)(r).pipe(
+              mapAccountServiceError("poll.orgs", "Failed to decode response"),
+            ),
+          ),
+        )
+
+        const [user, remoteOrgs] = yield* Effect.all([fetchUser, fetchOrgs], { concurrency: 2 })
+
+        const userId = user.id
+        const userEmail = user.email
+
+        if (!userId || !userEmail) {
+          return new PollError({ cause: "No id or email in response" })
+        }
+
+        const firstOrgID = remoteOrgs.length > 0 ? Option.fromNullishOr(remoteOrgs[0].id) : Option.none()
+
+        const now = yield* Clock.currentTimeMillis
+        const expiry = now + (parsed.expires_in ?? 0) * 1000
+        const refresh = parsed.refresh_token ?? ""
+
+        yield* repo.persistAccount({
+          id: userId,
+          email: userEmail,
+          url: input.server,
+          accessToken: access,
+          refreshToken: refresh,
+          expiry,
+          orgID: firstOrgID,
+        })
+
+        return new PollSuccess({ email: userEmail })
+      })
+
+      return AccountService.of({
+        active: repo.active,
+        list: repo.list,
+        orgsByAccount,
+        remove: repo.remove,
+        use: repo.use,
+        orgs,
+        config,
+        token,
+        login,
+        poll,
+      })
+    }),
+  )
+
+  static readonly defaultLayer = AccountService.layer.pipe(
+    Layer.provide(AccountRepo.layer),
+    Layer.provide(FetchHttpClient.layer),
+  )
+}

packages/opencode/src/acp/agent.ts

@@ -29,7 +29,7 @@ import {
 } from "@agentclientprotocol/sdk"
 
 import { Log } from "../util/log"
-import { pathToFileURL } from "bun"
+import { pathToFileURL } from "url"
 import { Filesystem } from "../util/filesystem"
 import { Hash } from "../util/hash"
 import { ACPSessionManager } from "./session"

packages/opencode/src/bun/registry.ts

@@ -1,4 +1,4 @@
-import { semver } from "bun"
+import semver from "semver"
 import { text } from "node:stream/consumers"
 import { Log } from "../util/log"
 import { Process } from "../util/process"
@@ -45,6 +45,6 @@ export namespace PackageRegistry {
     const isRange = /[\s^~*xX<>|=]/.test(cachedVersion)
     if (isRange) return !semver.satisfies(latestVersion, cachedVersion)
 
-    return semver.order(cachedVersion, latestVersion) === -1
+    return semver.lt(cachedVersion, latestVersion)
   }
 }

packages/opencode/src/cli/cmd/account.ts

@@ -0,0 +1,177 @@
+import { cmd } from "./cmd"
+import { Duration, Effect, Match, Option } from "effect"
+import { UI } from "../ui"
+import { runtime } from "@/effect/runtime"
+import { AccountID, AccountService, OrgID, PollExpired, type PollResult } from "@/account/service"
+import { type AccountError } from "@/account/schema"
+import * as Prompt from "../effect/prompt"
+import open from "open"
+
+const openBrowser = (url: string) => Effect.promise(() => open(url).catch(() => undefined))
+
+const println = (msg: string) => Effect.sync(() => UI.println(msg))
+
+const loginEffect = Effect.fn("login")(function* (url?: string) {
+  const service = yield* AccountService
+
+  yield* Prompt.intro("Log in")
+  const login = yield* service.login(url)
+
+  yield* Prompt.log.info("Go to: " + login.url)
+  yield* Prompt.log.info("Enter code: " + login.user)
+  yield* openBrowser(login.url)
+
+  const s = Prompt.spinner()
+  yield* s.start("Waiting for authorization...")
+
+  const poll = (wait: number): Effect.Effect<PollResult, AccountError> =>
+    Effect.gen(function* () {
+      yield* Effect.sleep(wait)
+      const result = yield* service.poll(login)
+      if (result._tag === "PollPending") return yield* poll(wait)
+      if (result._tag === "PollSlow") return yield* poll(wait + 5000)
+      return result
+    })
+
+  const result = yield* poll(login.interval * 1000).pipe(
+    Effect.timeout(Duration.seconds(login.expiry)),
+    Effect.catchTag("TimeoutError", () => Effect.succeed(new PollExpired())),
+  )
+
+  yield* Match.valueTags(result, {
+    PollSuccess: (r) =>
+      Effect.gen(function* () {
+        yield* s.stop("Logged in as " + r.email)
+        yield* Prompt.outro("Done")
+      }),
+    PollExpired: () => s.stop("Device code expired", 1),
+    PollDenied: () => s.stop("Authorization denied", 1),
+    PollError: (r) => s.stop("Error: " + String(r.cause), 1),
+    PollPending: () => s.stop("Unexpected state", 1),
+    PollSlow: () => s.stop("Unexpected state", 1),
+  })
+})
+
+const logoutEffect = Effect.fn("logout")(function* (email?: string) {
+  const service = yield* AccountService
+
+  if (email) {
+    const accounts = yield* service.list()
+    const match = accounts.find((a) => a.email === email)
+    if (!match) return yield* println("Account not found: " + email)
+    yield* service.remove(match.id)
+    yield* println("Logged out from " + email)
+    return
+  }
+
+  const active = yield* service.active()
+  if (Option.isNone(active)) return yield* println("Not logged in")
+  yield* service.remove(active.value.id)
+  yield* println("Logged out from " + active.value.email)
+})
+
+interface OrgChoice {
+  orgID: OrgID
+  accountID: AccountID
+  label: string
+}
+
+const switchEffect = Effect.fn("switch")(function* () {
+  const service = yield* AccountService
+
+  const groups = yield* service.orgsByAccount()
+  if (groups.length === 0) return yield* println("Not logged in")
+
+  const active = yield* service.active()
+  const activeOrgID = Option.flatMap(active, (a) => Option.fromNullishOr(a.active_org_id))
+
+  const opts = groups.flatMap((group) =>
+    group.orgs.map((org) => {
+      const isActive = Option.isSome(activeOrgID) && activeOrgID.value === org.id
+      return {
+        value: { orgID: org.id, accountID: group.account.id, label: org.name },
+        label: isActive
+          ? `${org.name} (${group.account.email})` + UI.Style.TEXT_DIM + " (active)"
+          : `${org.name} (${group.account.email})`,
+      }
+    }),
+  )
+  if (opts.length === 0) return yield* println("No orgs found")
+
+  yield* Prompt.intro("Switch org")
+
+  const selected = yield* Prompt.select<OrgChoice>({ message: "Select org", options: opts })
+  if (Option.isNone(selected)) return
+
+  const choice = selected.value
+  yield* service.use(choice.accountID, Option.some(choice.orgID))
+  yield* Prompt.outro("Switched to " + choice.label)
+})
+
+const orgsEffect = Effect.fn("orgs")(function* () {
+  const service = yield* AccountService
+
+  const groups = yield* service.orgsByAccount()
+  if (groups.length === 0) return yield* println("No accounts found")
+  if (!groups.some((group) => group.orgs.length > 0)) return yield* println("No orgs found")
+
+  const active = yield* service.active()
+  const activeOrgID = Option.flatMap(active, (a) => Option.fromNullishOr(a.active_org_id))
+
+  for (const group of groups) {
+    for (const org of group.orgs) {
+      const isActive = Option.isSome(activeOrgID) && activeOrgID.value === org.id
+      const dot = isActive ? UI.Style.TEXT_SUCCESS + "●" + UI.Style.TEXT_NORMAL : " "
+      const name = isActive ? UI.Style.TEXT_HIGHLIGHT_BOLD + org.name + UI.Style.TEXT_NORMAL : org.name
+      const email = UI.Style.TEXT_DIM + group.account.email + UI.Style.TEXT_NORMAL
+      const id = UI.Style.TEXT_DIM + org.id + UI.Style.TEXT_NORMAL
+      yield* println(`  ${dot} ${name}  ${email}  ${id}`)
+    }
+  }
+})
+
+export const LoginCommand = cmd({
+  command: "login [url]",
+  describe: "log in to an opencode account",
+  builder: (yargs) =>
+    yargs.positional("url", {
+      describe: "server URL",
+      type: "string",
+    }),
+  async handler(args) {
+    UI.empty()
+    await runtime.runPromise(loginEffect(args.url))
+  },
+})
+
+export const LogoutCommand = cmd({
+  command: "logout [email]",
+  describe: "log out from an account",
+  builder: (yargs) =>
+    yargs.positional("email", {
+      describe: "account email to log out from",
+      type: "string",
+    }),
+  async handler(args) {
+    UI.empty()
+    await runtime.runPromise(logoutEffect(args.email))
+  },
+})
+
+export const SwitchCommand = cmd({
+  command: "switch",
+  describe: "switch active org",
+  async handler() {
+    UI.empty()
+    await runtime.runPromise(switchEffect())
+  },
+})
+
+export const OrgsCommand = cmd({
+  command: "orgs",
+  describe: "list all orgs",
+  async handler() {
+    UI.empty()
+    await runtime.runPromise(orgsEffect())
+  },
+})

packages/opencode/src/cli/cmd/github.ts

@@ -27,8 +27,9 @@ import { Provider } from "../../provider/provider"
 import { Bus } from "../../bus"
 import { MessageV2 } from "../../session/message-v2"
 import { SessionPrompt } from "@/session/prompt"
-import { $ } from "bun"
 import { setTimeout as sleep } from "node:timers/promises"
+import { Process } from "@/util/process"
+import { git } from "@/util/git"
 
 type GitHubAuthor = {
   login: string
@@ -255,7 +256,7 @@ export const GithubInstallCommand = cmd({
             }
 
             // Get repo info
-            const info = (await $`git remote get-url origin`.quiet().nothrow().text()).trim()
+            const info = (await git(["remote", "get-url", "origin"], { cwd: Instance.worktree })).text().trim()
             const parsed = parseGitHubRemote(info)
             if (!parsed) {
               prompts.log.error(`Could not find git repository. Please run this command from a git repository.`)
@@ -493,6 +494,26 @@ export const GithubRunCommand = cmd({
           ? "pr_review"
           : "issue"
         : undefined
+      const gitText = async (args: string[]) => {
+        const result = await git(args, { cwd: Instance.worktree })
+        if (result.exitCode !== 0) {
+          throw new Process.RunFailedError(["git", ...args], result.exitCode, result.stdout, result.stderr)
+        }
+        return result.text().trim()
+      }
+      const gitRun = async (args: string[]) => {
+        const result = await git(args, { cwd: Instance.worktree })
+        if (result.exitCode !== 0) {
+          throw new Process.RunFailedError(["git", ...args], result.exitCode, result.stdout, result.stderr)
+        }
+        return result
+      }
+      const gitStatus = (args: string[]) => git(args, { cwd: Instance.worktree })
+      const commitChanges = async (summary: string, actor?: string) => {
+        const args = ["commit", "-m", summary]
+        if (actor) args.push("-m", `Co-authored-by: ${actor} <${actor}@users.noreply.github.com>`)
+        await gitRun(args)
+      }
 
       try {
         if (useGithubToken) {
@@ -553,7 +574,7 @@ export const GithubRunCommand = cmd({
           }
           const branchPrefix = isWorkflowDispatchEvent ? "dispatch" : "schedule"
           const branch = await checkoutNewBranch(branchPrefix)
-          const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
+          const head = await gitText(["rev-parse", "HEAD"])
           const response = await chat(userPrompt, promptFiles)
           const { dirty, uncommittedChanges, switched } = await branchIsDirty(head, branch)
           if (switched) {
@@ -587,7 +608,7 @@ export const GithubRunCommand = cmd({
           // Local PR
           if (prData.headRepository.nameWithOwner === prData.baseRepository.nameWithOwner) {
             await checkoutLocalBranch(prData)
-            const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
+            const head = await gitText(["rev-parse", "HEAD"])
             const dataPrompt = buildPromptDataForPR(prData)
             const response = await chat(`${userPrompt}\n\n${dataPrompt}`, promptFiles)
             const { dirty, uncommittedChanges, switched } = await branchIsDirty(head, prData.headRefName)
@@ -605,7 +626,7 @@ export const GithubRunCommand = cmd({
           // Fork PR
           else {
             const forkBranch = await checkoutForkBranch(prData)
-            const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
+            const head = await gitText(["rev-parse", "HEAD"])
             const dataPrompt = buildPromptDataForPR(prData)
             const response = await chat(`${userPrompt}\n\n${dataPrompt}`, promptFiles)
             const { dirty, uncommittedChanges, switched } = await branchIsDirty(head, forkBranch)
@@ -624,7 +645,7 @@ export const GithubRunCommand = cmd({
         // Issue
         else {
           const branch = await checkoutNewBranch("issue")
-          const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
+          const head = await gitText(["rev-parse", "HEAD"])
           const issueData = await fetchIssue()
           const dataPrompt = buildPromptDataForIssue(issueData)
           const response = await chat(`${userPrompt}\n\n${dataPrompt}`, promptFiles)
@@ -658,7 +679,7 @@ export const GithubRunCommand = cmd({
         exitCode = 1
         console.error(e instanceof Error ? e.message : String(e))
         let msg = e
-        if (e instanceof $.ShellError) {
+        if (e instanceof Process.RunFailedError) {
           msg = e.stderr.toString()
         } else if (e instanceof Error) {
           msg = e.message
@@ -1049,29 +1070,29 @@ export const GithubRunCommand = cmd({
         const config = "http.https://github.com/.extraheader"
         // actions/checkout@v6 no longer stores credentials in .git/config,
         // so this may not exist - use nothrow() to handle gracefully
-        const ret = await $`git config --local --get ${config}`.nothrow()
+        const ret = await gitStatus(["config", "--local", "--get", config])
         if (ret.exitCode === 0) {
           gitConfig = ret.stdout.toString().trim()
-          await $`git config --local --unset-all ${config}`
+          await gitRun(["config", "--local", "--unset-all", config])
         }
 
         const newCredentials = Buffer.from(`x-access-token:${appToken}`, "utf8").toString("base64")
 
-        await $`git config --local ${config} "AUTHORIZATION: basic ${newCredentials}"`
-        await $`git config --global user.name "${AGENT_USERNAME}"`
-        await $`git config --global user.email "${AGENT_USERNAME}@users.noreply.github.com"`
+        await gitRun(["config", "--local", config, `AUTHORIZATION: basic ${newCredentials}`])
+        await gitRun(["config", "--global", "user.name", AGENT_USERNAME])
+        await gitRun(["config", "--global", "user.email", `${AGENT_USERNAME}@users.noreply.github.com`])
       }
 
       async function restoreGitConfig() {
         if (gitConfig === undefined) return
         const config = "http.https://github.com/.extraheader"
-        await $`git config --local ${config} "${gitConfig}"`
+        await gitRun(["config", "--local", config, gitConfig])
       }
 
       async function checkoutNewBranch(type: "issue" | "schedule" | "dispatch") {
         console.log("Checking out new branch...")
         const branch = generateBranchName(type)
-        await $`git checkout -b ${branch}`
+        await gitRun(["checkout", "-b", branch])
         return branch
       }
 
@@ -1081,8 +1102,8 @@ export const GithubRunCommand = cmd({
         const branch = pr.headRefName
         const depth = Math.max(pr.commits.totalCount, 20)
 
-        await $`git fetch origin --depth=${depth} ${branch}`
-        await $`git checkout ${branch}`
+        await gitRun(["fetch", "origin", `--depth=${depth}`, branch])
+        await gitRun(["checkout", branch])
       }
 
       async function checkoutForkBranch(pr: GitHubPullRequest) {
@@ -1092,9 +1113,9 @@ export const GithubRunCommand = cmd({
         const localBranch = generateBranchName("pr")
         const depth = Math.max(pr.commits.totalCount, 20)
 
-        await $`git remote add fork https://github.com/${pr.headRepository.nameWithOwner}.git`
-        await $`git fetch fork --depth=${depth} ${remoteBranch}`
-        await $`git checkout -b ${localBranch} fork/${remoteBranch}`
+        await gitRun(["remote", "add", "fork", `https://github.com/${pr.headRepository.nameWithOwner}.git`])
+        await gitRun(["fetch", "fork", `--depth=${depth}`, remoteBranch])
+        await gitRun(["checkout", "-b", localBranch, `fork/${remoteBranch}`])
         return localBranch
       }
 
@@ -1115,28 +1136,23 @@ export const GithubRunCommand = cmd({
       async function pushToNewBranch(summary: string, branch: string, commit: boolean, isSchedule: boolean) {
         console.log("Pushing to new branch...")
         if (commit) {
-          await $`git add .`
+          await gitRun(["add", "."])
           if (isSchedule) {
-            // No co-author for scheduled events - the schedule is operating as the repo
-            await $`git commit -m "${summary}"`
+            await commitChanges(summary)
           } else {
-            await $`git commit -m "${summary}
-
-Co-authored-by: ${actor} <${actor}@users.noreply.github.com>"`
+            await commitChanges(summary, actor)
           }
         }
-        await $`git push -u origin ${branch}`
+        await gitRun(["push", "-u", "origin", branch])
       }
 
       async function pushToLocalBranch(summary: string, commit: boolean) {
         console.log("Pushing to local branch...")
         if (commit) {
-          await $`git add .`
-          await $`git commit -m "${summary}
-
-Co-authored-by: ${actor} <${actor}@users.noreply.github.com>"`
+          await gitRun(["add", "."])
+          await commitChanges(summary, actor)
         }
-        await $`git push`
+        await gitRun(["push"])
       }
 
       async function pushToForkBranch(summary: string, pr: GitHubPullRequest, commit: boolean) {
@@ -1145,30 +1161,28 @@ Co-authored-by: ${actor} <${actor}@users.noreply.github.com>"`
         const remoteBranch = pr.headRefName
 
         if (commit) {
-          await $`git add .`
-          await $`git commit -m "${summary}
-
-Co-authored-by: ${actor} <${actor}@users.noreply.github.com>"`
+          await gitRun(["add", "."])
+          await commitChanges(summary, actor)
         }
-        await $`git push fork HEAD:${remoteBranch}`
+        await gitRun(["push", "fork", `HEAD:${remoteBranch}`])
       }
 
       async function branchIsDirty(originalHead: string, expectedBranch: string) {
         console.log("Checking if branch is dirty...")
         // Detect if the agent switched branches during chat (e.g. created
         // its own branch, committed, and possibly pushed/created a PR).
-        const current = (await $`git rev-parse --abbrev-ref HEAD`).stdout.toString().trim()
+        const current = await gitText(["rev-parse", "--abbrev-ref", "HEAD"])
         if (current !== expectedBranch) {
           console.log(`Branch changed during chat: expected ${expectedBranch}, now on ${current}`)
           return { dirty: true, uncommittedChanges: false, switched: true }
         }
 
-        const ret = await $`git status --porcelain`
+        const ret = await gitStatus(["status", "--porcelain"])
         const status = ret.stdout.toString().trim()
         if (status.length > 0) {
           return { dirty: true, uncommittedChanges: true, switched: false }
         }
-        const head = (await $`git rev-parse HEAD`).stdout.toString().trim()
+        const head = await gitText(["rev-parse", "HEAD"])
         return {
           dirty: head !== originalHead,
           uncommittedChanges: false,
@@ -1180,11 +1194,11 @@ Co-authored-by: ${actor} <${actor}@users.noreply.github.com>"`
       // Falls back to fetching from origin when local refs are missing
       // (common in shallow clones from actions/checkout).
       async function hasNewCommits(base: string, head: string) {
-        const result = await $`git rev-list --count ${base}..${head}`.nothrow()
+        const result = await gitStatus(["rev-list", "--count", `${base}..${head}`])
         if (result.exitCode !== 0) {
           console.log(`rev-list failed, fetching origin/${base}...`)
-          await $`git fetch origin ${base} --depth=1`.nothrow()
-          const retry = await $`git rev-list --count origin/${base}..${head}`.nothrow()
+          await gitStatus(["fetch", "origin", base, "--depth=1"])
+          const retry = await gitStatus(["rev-list", "--count", `origin/${base}..${head}`])
           if (retry.exitCode !== 0) return true // assume dirty if we can't tell
           return parseInt(retry.stdout.toString().trim()) > 0
         }

packages/opencode/src/cli/cmd/import.ts

@@ -10,7 +10,7 @@ import { ShareNext } from "../../share/share-next"
 import { EOL } from "os"
 import { Filesystem } from "../../util/filesystem"
 
-/** Discriminated union returned by the ShareNext API (GET /api/share/:id/data) */
+/** Discriminated union returned by the ShareNext API (GET /api/shares/:id/data) */
 export type ShareData =
   | { type: "session"; data: SDKSession }
   | { type: "message"; data: Message }
@@ -24,6 +24,14 @@ export function parseShareUrl(url: string): string | null {
   return match ? match[1] : null
 }
 
+export function shouldAttachShareAuthHeaders(shareUrl: string, controlBaseUrl: string): boolean {
+  try {
+    return new URL(shareUrl).origin === new URL(controlBaseUrl).origin
+  } catch {
+    return false
+  }
+}
+
 /**
  * Transform ShareNext API response (flat array) into the nested structure for local file storage.
  *
@@ -97,8 +105,21 @@ export const ImportCommand = cmd({
           return
         }
 
-        const baseUrl = await ShareNext.url()
-        const response = await fetch(`${baseUrl}/api/share/${slug}/data`)
+        const parsed = new URL(args.file)
+        const baseUrl = parsed.origin
+        const req = await ShareNext.request()
+        const headers = shouldAttachShareAuthHeaders(args.file, req.baseUrl) ? req.headers : {}
+
+        const dataPath = req.api.data(slug)
+        let response = await fetch(`${baseUrl}${dataPath}`, {
+          headers,
+        })
+
+        if (!response.ok && dataPath !== `/api/share/${slug}/data`) {
+          response = await fetch(`${baseUrl}/api/share/${slug}/data`, {
+            headers,
+          })
+        }
 
         if (!response.ok) {
           process.stdout.write(`Failed to fetch share data: ${response.statusText}`)

packages/opencode/src/cli/cmd/pr.ts

@@ -1,7 +1,8 @@
 import { UI } from "../ui"
 import { cmd } from "./cmd"
 import { Instance } from "@/project/instance"
-import { $ } from "bun"
+import { Process } from "@/util/process"
+import { git } from "@/util/git"
 
 export const PrCommand = cmd({
   command: "pr <number>",
@@ -27,21 +28,35 @@ export const PrCommand = cmd({
         UI.println(`Fetching and checking out PR #${prNumber}...`)
 
         // Use gh pr checkout with custom branch name
-        const result = await $`gh pr checkout ${prNumber} --branch ${localBranchName} --force`.nothrow()
+        const result = await Process.run(
+          ["gh", "pr", "checkout", `${prNumber}`, "--branch", localBranchName, "--force"],
+          {
+            nothrow: true,
+          },
+        )
 
-        if (result.exitCode !== 0) {
+        if (result.code !== 0) {
           UI.error(`Failed to checkout PR #${prNumber}. Make sure you have gh CLI installed and authenticated.`)
           process.exit(1)
         }
 
         // Fetch PR info for fork handling and session link detection
-        const prInfoResult =
-          await $`gh pr view ${prNumber} --json headRepository,headRepositoryOwner,isCrossRepository,headRefName,body`.nothrow()
+        const prInfoResult = await Process.text(
+          [
+            "gh",
+            "pr",
+            "view",
+            `${prNumber}`,
+            "--json",
+            "headRepository,headRepositoryOwner,isCrossRepository,headRefName,body",
+          ],
+          { nothrow: true },
+        )
 
         let sessionId: string | undefined
 
-        if (prInfoResult.exitCode === 0) {
-          const prInfoText = prInfoResult.text()
+        if (prInfoResult.code === 0) {
+          const prInfoText = prInfoResult.text
           if (prInfoText.trim()) {
             const prInfo = JSON.parse(prInfoText)
 
@@ -52,15 +67,19 @@ export const PrCommand = cmd({
               const remoteName = forkOwner
 
               // Check if remote already exists
-              const remotes = (await $`git remote`.nothrow().text()).trim()
+              const remotes = (await git(["remote"], { cwd: Instance.worktree })).text().trim()
               if (!remotes.split("\n").includes(remoteName)) {
-                await $`git remote add ${remoteName} https://github.com/${forkOwner}/${forkName}.git`.nothrow()
+                await git(["remote", "add", remoteName, `https://github.com/${forkOwner}/${forkName}.git`], {
+                  cwd: Instance.worktree,
+                })
                 UI.println(`Added fork remote: ${remoteName}`)
               }
 
               // Set upstream to the fork so pushes go there
               const headRefName = prInfo.headRefName
-              await $`git branch --set-upstream-to=${remoteName}/${headRefName} ${localBranchName}`.nothrow()
+              await git(["branch", `--set-upstream-to=${remoteName}/${headRefName}`, localBranchName], {
+                cwd: Instance.worktree,
+              })
             }
 
             // Check for opencode session link in PR body
@@ -71,9 +90,11 @@ export const PrCommand = cmd({
                 UI.println(`Found opencode session: ${sessionUrl}`)
                 UI.println(`Importing session...`)
 
-                const importResult = await $`opencode import ${sessionUrl}`.nothrow()
-                if (importResult.exitCode === 0) {
-                  const importOutput = importResult.text().trim()
+                const importResult = await Process.text(["opencode", "import", sessionUrl], {
+                  nothrow: true,
+                })
+                if (importResult.code === 0) {
+                  const importOutput = importResult.text.trim()
                   // Extract session ID from the output (format: "Imported session: <session-id>")
                   const sessionIdMatch = importOutput.match(/Imported session: ([a-zA-Z0-9_-]+)/)
                   if (sessionIdMatch) {

packages/opencode/src/cli/cmd/providers.ts

@@ -13,27 +13,13 @@ import { Instance } from "../../project/instance"
 import type { Hooks } from "@opencode-ai/plugin"
 import { Process } from "../../util/process"
 import { text } from "node:stream/consumers"
-import { setTimeout as sleep } from "node:timers/promises"
 
 type PluginAuth = NonNullable<Hooks["auth"]>
 
-/**
- * Handle plugin-based authentication flow.
- * Returns true if auth was handled, false if it should fall through to default handling.
- */
-async function handlePluginAuth(plugin: { auth: PluginAuth }, provider: string, methodName?: string): Promise<boolean> {
+async function handlePluginAuth(plugin: { auth: PluginAuth }, provider: string): Promise<boolean> {
   let index = 0
-  if (methodName) {
-    const match = plugin.auth.methods.findIndex((x) => x.label.toLowerCase() === methodName.toLowerCase())
-    if (match === -1) {
-      prompts.log.error(
-        `Unknown method "${methodName}" for ${provider}. Available: ${plugin.auth.methods.map((x) => x.label).join(", ")}`,
-      )
-      process.exit(1)
-    }
-    index = match
-  } else if (plugin.auth.methods.length > 1) {
-    const selected = await prompts.select({
+  if (plugin.auth.methods.length > 1) {
+    const method = await prompts.select({
       message: "Login method",
       options: [
         ...plugin.auth.methods.map((x, index) => ({
@@ -42,13 +28,12 @@ async function handlePluginAuth(plugin: { auth: PluginAuth }, provider: string,
         })),
       ],
     })
-    if (prompts.isCancel(selected)) throw new UI.CancelledError()
-    index = parseInt(selected)
+    if (prompts.isCancel(method)) throw new UI.CancelledError()
+    index = parseInt(method)
   }
   const method = plugin.auth.methods[index]
 
-  // Handle prompts for all auth types
-  await sleep(10)
+  await Bun.sleep(10)
   const inputs: Record<string, string> = {}
   if (method.prompts) {
     for (const prompt of method.prompts) {
@@ -171,11 +156,6 @@ async function handlePluginAuth(plugin: { auth: PluginAuth }, provider: string,
   return false
 }
 
-/**
- * Build a deduplicated list of plugin-registered auth providers that are not
- * already present in models.dev, respecting enabled/disabled provider lists.
- * Pure function with no side effects; safe to test without mocking.
- */
 export function resolvePluginProviders(input: {
   hooks: Hooks[]
   existingProviders: Record<string, unknown>
@@ -203,19 +183,20 @@ export function resolvePluginProviders(input: {
   return result
 }
 
-export const AuthCommand = cmd({
-  command: "auth",
-  describe: "manage credentials",
+export const ProvidersCommand = cmd({
+  command: "providers",
+  aliases: ["auth"],
+  describe: "manage AI providers and credentials",
   builder: (yargs) =>
-    yargs.command(AuthLoginCommand).command(AuthLogoutCommand).command(AuthListCommand).demandCommand(),
+    yargs.command(ProvidersListCommand).command(ProvidersLoginCommand).command(ProvidersLogoutCommand).demandCommand(),
   async handler() {},
 })
 
-export const AuthListCommand = cmd({
+export const ProvidersListCommand = cmd({
   command: "list",
   aliases: ["ls"],
-  describe: "list providers",
-  async handler() {
+  describe: "list providers and credentials",
+  async handler(_args) {
     UI.empty()
     const authPath = path.join(Global.Path.data, "auth.json")
     const homedir = os.homedir()
@@ -231,7 +212,6 @@ export const AuthListCommand = cmd({
 
     prompts.outro(`${results.length} credentials`)
 
-    // Environment variables section
     const activeEnvVars: Array<{ provider: string; envVar: string }> = []
 
     for (const [providerID, provider] of Object.entries(database)) {
@@ -258,25 +238,14 @@ export const AuthListCommand = cmd({
   },
 })
 
-export const AuthLoginCommand = cmd({
+export const ProvidersLoginCommand = cmd({
   command: "login [url]",
   describe: "log in to a provider",
   builder: (yargs) =>
-    yargs
-      .positional("url", {
-        describe: "opencode auth provider",
-        type: "string",
-      })
-      .option("provider", {
-        alias: ["p"],
-        describe: "provider id or name to log in to (skips provider selection)",
-        type: "string",
-      })
-      .option("method", {
-        alias: ["m"],
-        describe: "login method label (skips method selection)",
-        type: "string",
-      }),
+    yargs.positional("url", {
+      describe: "opencode auth provider",
+      type: "string",
+    }),
   async handler(args) {
     await Instance.provide({
       directory: process.cwd(),
@@ -284,8 +253,7 @@ export const AuthLoginCommand = cmd({
         UI.empty()
         prompts.intro("Add credential")
         if (args.url) {
-          const url = args.url.replace(/\/+$/, "")
-          const wellknown = await fetch(`${url}/.well-known/opencode`).then((x) => x.json() as any)
+          const wellknown = await fetch(`${args.url}/.well-known/opencode`).then((x) => x.json() as any)
           prompts.log.info(`Running \`${wellknown.auth.command.join(" ")}\``)
           const proc = Process.spawn(wellknown.auth.command, {
             stdout: "pipe",
@@ -301,12 +269,12 @@ export const AuthLoginCommand = cmd({
             prompts.outro("Done")
             return
           }
-          await Auth.set(url, {
+          await Auth.set(args.url, {
             type: "wellknown",
             key: wellknown.auth.env,
             token: token.trim(),
           })
-          prompts.log.success("Logged into " + url)
+          prompts.log.success("Logged into " + args.url)
           prompts.outro("Done")
           return
         }
@@ -343,76 +311,59 @@ export const AuthLoginCommand = cmd({
           enabled,
           providerNames: Object.fromEntries(Object.entries(config.provider ?? {}).map(([id, p]) => [id, p.name])),
         })
-        const options = [
-          ...pipe(
-            providers,
-            values(),
-            sortBy(
-              (x) => priority[x.id] ?? 99,
-              (x) => x.name ?? x.id,
+        let provider = await prompts.autocomplete({
+          message: "Select provider",
+          maxItems: 8,
+          options: [
+            ...pipe(
+              providers,
+              values(),
+              sortBy(
+                (x) => priority[x.id] ?? 99,
+                (x) => x.name ?? x.id,
+              ),
+              map((x) => ({
+                label: x.name,
+                value: x.id,
+                hint: {
+                  opencode: "recommended",
+                  anthropic: "Claude Max or API key",
+                  openai: "ChatGPT Plus/Pro or API key",
+                }[x.id],
+              })),
             ),
-            map((x) => ({
+            ...pluginProviders.map((x) => ({
               label: x.name,
               value: x.id,
-              hint: {
-                opencode: "recommended",
-                anthropic: "Claude Max or API key",
-                openai: "ChatGPT Plus/Pro or API key",
-              }[x.id],
+              hint: "plugin",
             })),
-          ),
-          ...pluginProviders.map((x) => ({
-            label: x.name,
-            value: x.id,
-            hint: "plugin",
-          })),
-        ]
+            {
+              value: "other",
+              label: "Other",
+            },
+          ],
+        })
 
-        let provider: string
-        if (args.provider) {
-          const input = args.provider
-          const byID = options.find((x) => x.value === input)
-          const byName = options.find((x) => x.label.toLowerCase() === input.toLowerCase())
-          const match = byID ?? byName
-          if (!match) {
-            prompts.log.error(`Unknown provider "${input}"`)
-            process.exit(1)
-          }
-          provider = match.value
-        } else {
-          const selected = await prompts.autocomplete({
-            message: "Select provider",
-            maxItems: 8,
-            options: [
-              ...options,
-              {
-                value: "other",
-                label: "Other",
-              },
-            ],
-          })
-          if (prompts.isCancel(selected)) throw new UI.CancelledError()
-          provider = selected as string
-        }
+        if (prompts.isCancel(provider)) throw new UI.CancelledError()
 
         const plugin = await Plugin.list().then((x) => x.findLast((x) => x.auth?.provider === provider))
         if (plugin && plugin.auth) {
-          const handled = await handlePluginAuth({ auth: plugin.auth }, provider, args.method)
+          const handled = await handlePluginAuth({ auth: plugin.auth }, provider)
           if (handled) return
         }
 
         if (provider === "other") {
-          const custom = await prompts.text({
+          provider = await prompts.text({
             message: "Enter provider id",
             validate: (x) => (x && x.match(/^[0-9a-z-]+$/) ? undefined : "a-z, 0-9 and hyphens only"),
           })
-          if (prompts.isCancel(custom)) throw new UI.CancelledError()
-          provider = custom.replace(/^@ai-sdk\//, "")
+          if (prompts.isCancel(provider)) throw new UI.CancelledError()
+          provider = provider.replace(/^@ai-sdk\//, "")
+          if (prompts.isCancel(provider)) throw new UI.CancelledError()
 
-          // Check if a plugin provides auth for this custom provider
           const customPlugin = await Plugin.list().then((x) => x.findLast((x) => x.auth?.provider === provider))
           if (customPlugin && customPlugin.auth) {
-            const handled = await handlePluginAuth({ auth: customPlugin.auth }, provider, args.method)
+            const handled = await handlePluginAuth({ auth: customPlugin.auth }, provider)
             if (handled) return
           }
 
@@ -461,10 +412,10 @@ export const AuthLoginCommand = cmd({
   },
 })
 
-export const AuthLogoutCommand = cmd({
+export const ProvidersLogoutCommand = cmd({
   command: "logout",
   describe: "log out from a configured provider",
-  async handler() {
+  async handler(_args) {
     UI.empty()
     const credentials = await Auth.all().then((x) => Object.entries(x))
     prompts.intro("Remove credential")

packages/opencode/src/cli/cmd/run.ts

@@ -1,6 +1,6 @@
 import type { Argv } from "yargs"
 import path from "path"
-import { pathToFileURL } from "bun"
+import { pathToFileURL } from "url"
 import { UI } from "../ui"
 import { cmd } from "./cmd"
 import { Flag } from "../../flag/flag"
@@ -667,7 +667,7 @@ export const RunCommand = cmd({
     await bootstrap(process.cwd(), async () => {
       const fetchFn = (async (input: RequestInfo | URL, init?: RequestInit) => {
         const request = new Request(input, init)
-        return Server.App().fetch(request)
+        return Server.Default().fetch(request)
       }) as typeof globalThis.fetch
       const sdk = createOpencodeClient({ baseUrl: "http://opencode.internal", fetch: fetchFn })
       await execute(sdk)

packages/opencode/src/cli/cmd/tui/app.tsx

@@ -20,6 +20,7 @@ import { DialogHelp } from "./ui/dialog-help"
 import { CommandProvider, useCommandDialog } from "@tui/component/dialog-command"
 import { DialogAgent } from "@tui/component/dialog-agent"
 import { DialogSessionList } from "@tui/component/dialog-session-list"
+import { DialogWorkspaceList } from "@tui/component/dialog-workspace-list"
 import { KeybindProvider } from "@tui/context/keybind"
 import { ThemeProvider, useTheme } from "@tui/context/theme"
 import { Home } from "@tui/routes/home"
@@ -371,6 +372,22 @@ function App() {
         dialog.replace(() => <DialogSessionList />)
       },
     },
+    ...(Flag.OPENCODE_EXPERIMENTAL_WORKSPACES
+      ? [
+          {
+            title: "Manage workspaces",
+            value: "workspace.list",
+            category: "Workspace",
+            suggested: true,
+            slash: {
+              name: "workspaces",
+            },
+            onSelect: () => {
+              dialog.replace(() => <DialogWorkspaceList />)
+            },
+          },
+        ]
+      : []),
     {
       title: "New session",
       suggested: route.data.type === "session",

packages/opencode/src/cli/cmd/tui/component/dialog-workspace-list.tsx

@@ -0,0 +1,326 @@
+import { useDialog } from "@tui/ui/dialog"
+import { DialogSelect } from "@tui/ui/dialog-select"
+import { useRoute } from "@tui/context/route"
+import { useSync } from "@tui/context/sync"
+import { createEffect, createMemo, createSignal, onMount } from "solid-js"
+import type { Session } from "@opencode-ai/sdk/v2"
+import { useSDK } from "../context/sdk"
+import { useToast } from "../ui/toast"
+import { useKeybind } from "../context/keybind"
+import { DialogSessionList } from "./workspace/dialog-session-list"
+import { createOpencodeClient } from "@opencode-ai/sdk/v2"
+
+async function openWorkspace(input: {
+  dialog: ReturnType<typeof useDialog>
+  route: ReturnType<typeof useRoute>
+  sdk: ReturnType<typeof useSDK>
+  sync: ReturnType<typeof useSync>
+  toast: ReturnType<typeof useToast>
+  workspaceID: string
+  forceCreate?: boolean
+}) {
+  const cacheSession = (session: Session) => {
+    input.sync.set(
+      "session",
+      [...input.sync.data.session.filter((item) => item.id !== session.id), session].toSorted((a, b) =>
+        a.id.localeCompare(b.id),
+      ),
+    )
+  }
+
+  const client = createOpencodeClient({
+    baseUrl: input.sdk.url,
+    fetch: input.sdk.fetch,
+    directory: input.sync.data.path.directory || input.sdk.directory,
+    experimental_workspaceID: input.workspaceID,
+  })
+  const listed = input.forceCreate ? undefined : await client.session.list({ roots: true, limit: 1 })
+  const session = listed?.data?.[0]
+  if (session?.id) {
+    cacheSession(session)
+    input.route.navigate({
+      type: "session",
+      sessionID: session.id,
+    })
+    input.dialog.clear()
+    return
+  }
+  let created: Session | undefined
+  while (!created) {
+    const result = await client.session.create({}).catch(() => undefined)
+    if (!result) {
+      input.toast.show({
+        message: "Failed to open workspace",
+        variant: "error",
+      })
+      return
+    }
+    if (result.response.status >= 500 && result.response.status < 600) {
+      await Bun.sleep(1000)
+      continue
+    }
+    if (!result.data) {
+      input.toast.show({
+        message: "Failed to open workspace",
+        variant: "error",
+      })
+      return
+    }
+    created = result.data
+  }
+  cacheSession(created)
+  input.route.navigate({
+    type: "session",
+    sessionID: created.id,
+  })
+  input.dialog.clear()
+}
+
+function DialogWorkspaceCreate(props: { onSelect: (workspaceID: string) => Promise<void> }) {
+  const dialog = useDialog()
+  const sync = useSync()
+  const sdk = useSDK()
+  const toast = useToast()
+  const [creating, setCreating] = createSignal<string>()
+
+  onMount(() => {
+    dialog.setSize("medium")
+  })
+
+  const options = createMemo(() => {
+    const type = creating()
+    if (type) {
+      return [
+        {
+          title: `Creating ${type} workspace...`,
+          value: "creating" as const,
+          description: "This can take a while for remote environments",
+        },
+      ]
+    }
+    return [
+      {
+        title: "Worktree",
+        value: "worktree" as const,
+        description: "Create a local git worktree",
+      },
+    ]
+  })
+
+  const createWorkspace = async (type: string) => {
+    if (creating()) return
+    setCreating(type)
+
+    const result = await sdk.client.experimental.workspace.create({ type, branch: null }).catch((err) => {
+      console.log(err)
+      return undefined
+    })
+    console.log(JSON.stringify(result, null, 2))
+    const workspace = result?.data
+    if (!workspace) {
+      setCreating(undefined)
+      toast.show({
+        message: "Failed to create workspace",
+        variant: "error",
+      })
+      return
+    }
+    await sync.workspace.sync()
+    await props.onSelect(workspace.id)
+    setCreating(undefined)
+  }
+
+  return (
+    <DialogSelect
+      title={creating() ? "Creating Workspace" : "New Workspace"}
+      skipFilter={true}
+      options={options()}
+      onSelect={(option) => {
+        if (option.value === "creating") return
+        void createWorkspace(option.value)
+      }}
+    />
+  )
+}
+
+export function DialogWorkspaceList() {
+  const dialog = useDialog()
+  const route = useRoute()
+  const sync = useSync()
+  const sdk = useSDK()
+  const toast = useToast()
+  const keybind = useKeybind()
+  const [toDelete, setToDelete] = createSignal<string>()
+  const [counts, setCounts] = createSignal<Record<string, number | null | undefined>>({})
+
+  const open = (workspaceID: string, forceCreate?: boolean) =>
+    openWorkspace({
+      dialog,
+      route,
+      sdk,
+      sync,
+      toast,
+      workspaceID,
+      forceCreate,
+    })
+
+  async function selectWorkspace(workspaceID: string) {
+    if (workspaceID === "__local__") {
+      if (localCount() > 0) {
+        dialog.replace(() => <DialogSessionList localOnly={true} />)
+        return
+      }
+      route.navigate({
+        type: "home",
+      })
+      dialog.clear()
+      return
+    }
+    const count = counts()[workspaceID]
+    if (count && count > 0) {
+      dialog.replace(() => <DialogSessionList workspaceID={workspaceID} />)
+      return
+    }
+
+    if (count === 0) {
+      await open(workspaceID)
+      return
+    }
+    const client = createOpencodeClient({
+      baseUrl: sdk.url,
+      fetch: sdk.fetch,
+      directory: sync.data.path.directory || sdk.directory,
+      experimental_workspaceID: workspaceID,
+    })
+    const listed = await client.session.list({ roots: true, limit: 1 }).catch(() => undefined)
+    if (listed?.data?.length) {
+      dialog.replace(() => <DialogSessionList workspaceID={workspaceID} />)
+      return
+    }
+    await open(workspaceID)
+  }
+
+  const currentWorkspaceID = createMemo(() => {
+    if (route.data.type === "session") {
+      return sync.session.get(route.data.sessionID)?.workspaceID ?? "__local__"
+    }
+    return "__local__"
+  })
+
+  const localCount = createMemo(
+    () => sync.data.session.filter((session) => !session.workspaceID && !session.parentID).length,
+  )
+
+  let run = 0
+  createEffect(() => {
+    const workspaces = sync.data.workspaceList
+    const next = ++run
+    if (!workspaces.length) {
+      setCounts({})
+      return
+    }
+    setCounts(Object.fromEntries(workspaces.map((workspace) => [workspace.id, undefined])))
+    void Promise.all(
+      workspaces.map(async (workspace) => {
+        const client = createOpencodeClient({
+          baseUrl: sdk.url,
+          fetch: sdk.fetch,
+          directory: sync.data.path.directory || sdk.directory,
+          experimental_workspaceID: workspace.id,
+        })
+        const result = await client.session.list({ roots: true }).catch(() => undefined)
+        return [workspace.id, result ? (result.data?.length ?? 0) : null] as const
+      }),
+    ).then((entries) => {
+      if (run !== next) return
+      setCounts(Object.fromEntries(entries))
+    })
+  })
+
+  const options = createMemo(() => [
+    {
+      title: "Local",
+      value: "__local__",
+      category: "Workspace",
+      description: "Use the local machine",
+      footer: `${localCount()} session${localCount() === 1 ? "" : "s"}`,
+    },
+    ...sync.data.workspaceList.map((workspace) => {
+      const count = counts()[workspace.id]
+      return {
+        title:
+          toDelete() === workspace.id
+            ? `Delete ${workspace.id}? Press ${keybind.print("session_delete")} again`
+            : workspace.id,
+        value: workspace.id,
+        category: workspace.type,
+        description: workspace.branch ? `Branch ${workspace.branch}` : undefined,
+        footer:
+          count === undefined
+            ? "Loading sessions..."
+            : count === null
+              ? "Sessions unavailable"
+              : `${count} session${count === 1 ? "" : "s"}`,
+      }
+    }),
+    {
+      title: "+ New workspace",
+      value: "__create__",
+      category: "Actions",
+      description: "Create a new workspace",
+    },
+  ])
+
+  onMount(() => {
+    dialog.setSize("large")
+    void sync.workspace.sync()
+  })
+
+  return (
+    <DialogSelect
+      title="Workspaces"
+      skipFilter={true}
+      options={options()}
+      current={currentWorkspaceID()}
+      onMove={() => {
+        setToDelete(undefined)
+      }}
+      onSelect={(option) => {
+        setToDelete(undefined)
+        if (option.value === "__create__") {
+          dialog.replace(() => <DialogWorkspaceCreate onSelect={(workspaceID) => open(workspaceID, true)} />)
+          return
+        }
+        void selectWorkspace(option.value)
+      }}
+      keybind={[
+        {
+          keybind: keybind.all.session_delete?.[0],
+          title: "delete",
+          onTrigger: async (option) => {
+            if (option.value === "__create__" || option.value === "__local__") return
+            if (toDelete() !== option.value) {
+              setToDelete(option.value)
+              return
+            }
+            const result = await sdk.client.experimental.workspace.remove({ id: option.value }).catch(() => undefined)
+            setToDelete(undefined)
+            if (result?.error) {
+              toast.show({
+                message: "Failed to delete workspace",
+                variant: "error",
+              })
+              return
+            }
+            if (currentWorkspaceID() === option.value) {
+              route.navigate({
+                type: "home",
+              })
+            }
+            await sync.workspace.sync()
+          },
+        },
+      ]}
+    />
+  )
+}

packages/opencode/src/cli/cmd/tui/component/prompt/index.tsx

@@ -539,12 +539,25 @@ export function Prompt(props: PromptProps) {
       promptModelWarning()
       return
     }
-    const sessionID = props.sessionID
-      ? props.sessionID
-      : await (async () => {
-          const sessionID = await sdk.client.session.create({}).then((x) => x.data!.id)
-          return sessionID
-        })()
+
+    let sessionID = props.sessionID
+    if (sessionID == null) {
+      const res = await sdk.client.session.create({})
+
+      if (res.error) {
+        console.log("Creating a session failed:", res.error)
+
+        toast.show({
+          message: "Creating a session failed. Open console for more details.",
+          variant: "error",
+        })
+
+        return
+      }
+
+      sessionID = res.data.id
+    }
+
     const messageID = Identifier.ascending("message")
     let inputText = store.prompt.input
 

packages/opencode/src/cli/cmd/tui/component/workspace/dialog-session-list.tsx

@@ -0,0 +1,151 @@
+import { useDialog } from "@tui/ui/dialog"
+import { DialogSelect } from "@tui/ui/dialog-select"
+import { useRoute } from "@tui/context/route"
+import { useSync } from "@tui/context/sync"
+import { createMemo, createSignal, createResource, onMount, Show } from "solid-js"
+import { Locale } from "@/util/locale"
+import { useKeybind } from "../../context/keybind"
+import { useTheme } from "../../context/theme"
+import { useSDK } from "../../context/sdk"
+import { DialogSessionRename } from "../dialog-session-rename"
+import { useKV } from "../../context/kv"
+import { createDebouncedSignal } from "../../util/signal"
+import { Spinner } from "../spinner"
+import { useToast } from "../../ui/toast"
+
+export function DialogSessionList(props: { workspaceID?: string; localOnly?: boolean } = {}) {
+  const dialog = useDialog()
+  const route = useRoute()
+  const sync = useSync()
+  const keybind = useKeybind()
+  const { theme } = useTheme()
+  const sdk = useSDK()
+  const kv = useKV()
+  const toast = useToast()
+  const [toDelete, setToDelete] = createSignal<string>()
+  const [search, setSearch] = createDebouncedSignal("", 150)
+
+  const [listed, listedActions] = createResource(
+    () => props.workspaceID,
+    async (workspaceID) => {
+      if (!workspaceID) return undefined
+      const result = await sdk.client.session.list({ roots: true })
+      return result.data ?? []
+    },
+  )
+
+  const [searchResults] = createResource(search, async (query) => {
+    if (!query || props.localOnly) return undefined
+    const result = await sdk.client.session.list({
+      search: query,
+      limit: 30,
+      ...(props.workspaceID ? { roots: true } : {}),
+    })
+    return result.data ?? []
+  })
+
+  const currentSessionID = createMemo(() => (route.data.type === "session" ? route.data.sessionID : undefined))
+
+  const sessions = createMemo(() => {
+    if (searchResults()) return searchResults()!
+    if (props.workspaceID) return listed() ?? []
+    if (props.localOnly) return sync.data.session.filter((session) => !session.workspaceID)
+    return sync.data.session
+  })
+
+  const options = createMemo(() => {
+    const today = new Date().toDateString()
+    return sessions()
+      .filter((x) => {
+        if (x.parentID !== undefined) return false
+        if (props.workspaceID && listed()) return true
+        if (props.workspaceID) return x.workspaceID === props.workspaceID
+        if (props.localOnly) return !x.workspaceID
+        return true
+      })
+      .toSorted((a, b) => b.time.updated - a.time.updated)
+      .map((x) => {
+        const date = new Date(x.time.updated)
+        let category = date.toDateString()
+        if (category === today) {
+          category = "Today"
+        }
+        const isDeleting = toDelete() === x.id
+        const status = sync.data.session_status?.[x.id]
+        const isWorking = status?.type === "busy"
+        return {
+          title: isDeleting ? `Press ${keybind.print("session_delete")} again to confirm` : x.title,
+          bg: isDeleting ? theme.error : undefined,
+          value: x.id,
+          category,
+          footer: Locale.time(x.time.updated),
+          gutter: isWorking ? <Spinner /> : undefined,
+        }
+      })
+  })
+
+  onMount(() => {
+    dialog.setSize("large")
+  })
+
+  return (
+    <DialogSelect
+      title={props.workspaceID ? `Workspace Sessions` : props.localOnly ? "Local Sessions" : "Sessions"}
+      options={options()}
+      skipFilter={!props.localOnly}
+      current={currentSessionID()}
+      onFilter={setSearch}
+      onMove={() => {
+        setToDelete(undefined)
+      }}
+      onSelect={(option) => {
+        route.navigate({
+          type: "session",
+          sessionID: option.value,
+        })
+        dialog.clear()
+      }}
+      keybind={[
+        {
+          keybind: keybind.all.session_delete?.[0],
+          title: "delete",
+          onTrigger: async (option) => {
+            if (toDelete() === option.value) {
+              const deleted = await sdk.client.session
+                .delete({
+                  sessionID: option.value,
+                })
+                .then(() => true)
+                .catch(() => false)
+              setToDelete(undefined)
+              if (!deleted) {
+                toast.show({
+                  message: "Failed to delete session",
+                  variant: "error",
+                })
+                return
+              }
+              if (props.workspaceID) {
+                listedActions.mutate((sessions) => sessions?.filter((session) => session.id !== option.value))
+                return
+              }
+              sync.set(
+                "session",
+                sync.data.session.filter((session) => session.id !== option.value),
+              )
+              return
+            }
+            setToDelete(option.value)
+          },
+        },
+        {
+          keybind: keybind.all.session_rename?.[0],
+          title: "rename",
+          onTrigger: async (option) => {
+            dialog.replace(() => <DialogSessionRename session={option.value} />)
+          },
+        },
+      ]}
+    />
+  )
+}

packages/opencode/src/cli/cmd/tui/context/sdk.tsx

@@ -5,6 +5,7 @@ import { batch, onCleanup, onMount } from "solid-js"
 
 export type EventSource = {
   on: (handler: (event: Event) => void) => () => void
+  setWorkspace?: (workspaceID?: string) => void
 }
 
 export const { use: useSDK, provider: SDKProvider } = createSimpleContext({
@@ -17,13 +18,21 @@ export const { use: useSDK, provider: SDKProvider } = createSimpleContext({
     events?: EventSource
   }) => {
     const abort = new AbortController()
-    const sdk = createOpencodeClient({
-      baseUrl: props.url,
-      signal: abort.signal,
-      directory: props.directory,
-      fetch: props.fetch,
-      headers: props.headers,
-    })
+    let workspaceID: string | undefined
+    let sse: AbortController | undefined
+
+    function createSDK() {
+      return createOpencodeClient({
+        baseUrl: props.url,
+        signal: abort.signal,
+        directory: props.directory,
+        fetch: props.fetch,
+        headers: props.headers,
+        experimental_workspaceID: workspaceID,
+      })
+    }
+
+    let sdk = createSDK()
 
     const emitter = createGlobalEmitter<{
       [key in Event["type"]]: Extract<Event, { type: key }>
@@ -61,41 +70,56 @@ export const { use: useSDK, provider: SDKProvider } = createSimpleContext({
       flush()
     }
 
-    onMount(async () => {
-      // If an event source is provided, use it instead of SSE
+    function startSSE() {
+      sse?.abort()
+      const ctrl = new AbortController()
+      sse = ctrl
+      ;(async () => {
+        while (true) {
+          if (abort.signal.aborted || ctrl.signal.aborted) break
+          const events = await sdk.event.subscribe({}, { signal: ctrl.signal })
+
+          for await (const event of events.stream) {
+            if (ctrl.signal.aborted) break
+            handleEvent(event)
+          }
+
+          if (timer) clearTimeout(timer)
+          if (queue.length > 0) flush()
+        }
+      })().catch(() => {})
+    }
+
+    onMount(() => {
       if (props.events) {
         const unsub = props.events.on(handleEvent)
         onCleanup(unsub)
-        return
-      }
-
-      // Fall back to SSE
-      while (true) {
-        if (abort.signal.aborted) break
-        const events = await sdk.event.subscribe(
-          {},
-          {
-            signal: abort.signal,
-          },
-        )
-
-        for await (const event of events.stream) {
-          handleEvent(event)
-        }
-
-        // Flush any remaining events
-        if (timer) clearTimeout(timer)
-        if (queue.length > 0) {
-          flush()
-        }
+      } else {
+        startSSE()
       }
     })
 
     onCleanup(() => {
       abort.abort()
+      sse?.abort()
       if (timer) clearTimeout(timer)
     })
 
-    return { client: sdk, event: emitter, url: props.url }
+    return {
+      get client() {
+        return sdk
+      },
+      directory: props.directory,
+      event: emitter,
+      fetch: props.fetch ?? fetch,
+      setWorkspace(next?: string) {
+        if (workspaceID === next) return
+        workspaceID = next
+        sdk = createSDK()
+        props.events?.setWorkspace?.(next)
+        if (!props.events) startSSE()
+      },
+      url: props.url,
+    }
   },
 })

packages/opencode/src/cli/cmd/tui/context/sync.tsx

@@ -28,6 +28,7 @@ import { useArgs } from "./args"
 import { batch, onMount } from "solid-js"
 import { Log } from "@/util/log"
 import type { Path } from "@opencode-ai/sdk"
+import type { Workspace } from "@opencode-ai/sdk/v2"
 
 export const { use: useSync, provider: SyncProvider } = createSimpleContext({
   name: "Sync",
@@ -73,6 +74,7 @@ export const { use: useSync, provider: SyncProvider } = createSimpleContext({
       formatter: FormatterStatus[]
       vcs: VcsInfo | undefined
       path: Path
+      workspaceList: Workspace[]
     }>({
       provider_next: {
         all: [],
@@ -100,10 +102,17 @@ export const { use: useSync, provider: SyncProvider } = createSimpleContext({
       formatter: [],
       vcs: undefined,
       path: { state: "", config: "", worktree: "", directory: "" },
+      workspaceList: [],
     })
 
     const sdk = useSDK()
 
+    async function syncWorkspaces() {
+      const result = await sdk.client.experimental.workspace.list().catch(() => undefined)
+      if (!result?.data) return
+      setStore("workspaceList", reconcile(result.data))
+    }
+
     sdk.event.listen((e) => {
       const event = e.details
       switch (event.type) {
@@ -413,6 +422,7 @@ export const { use: useSync, provider: SyncProvider } = createSimpleContext({
             sdk.client.provider.auth().then((x) => setStore("provider_auth", reconcile(x.data ?? {}))),
             sdk.client.vcs.get().then((x) => setStore("vcs", reconcile(x.data))),
             sdk.client.path.get().then((x) => setStore("path", reconcile(x.data!))),
+            syncWorkspaces(),
           ]).then(() => {
             setStore("status", "complete")
           })
@@ -481,6 +491,12 @@ export const { use: useSync, provider: SyncProvider } = createSimpleContext({
           fullSyncedSessions.add(sessionID)
         },
       },
+      workspace: {
+        get(workspaceID: string) {
+          return store.workspaceList.find((workspace) => workspace.id === workspaceID)
+        },
+        sync: syncWorkspaces,
+      },
       bootstrap,
     }
     return result

packages/opencode/src/cli/cmd/tui/routes/home.tsx

@@ -1,5 +1,5 @@
 import { Prompt, type PromptRef } from "@tui/component/prompt"
-import { createMemo, Match, onMount, Show, Switch } from "solid-js"
+import { createEffect, createMemo, Match, on, onMount, Show, Switch } from "solid-js"
 import { useTheme } from "@tui/context/theme"
 import { useKeybind } from "@tui/context/keybind"
 import { Logo } from "../component/logo"
@@ -14,6 +14,7 @@ import { usePromptRef } from "../context/prompt"
 import { Installation } from "@/installation"
 import { useKV } from "../context/kv"
 import { useCommandDialog } from "../component/dialog-command"
+import { useLocal } from "../context/local"
 
 // TODO: what is the best way to do this?
 let once = false
@@ -76,6 +77,7 @@ export function Home() {
 
   let prompt: PromptRef
   const args = useArgs()
+  const local = useLocal()
   onMount(() => {
     if (once) return
     if (route.initialPrompt) {
@@ -84,9 +86,21 @@ export function Home() {
     } else if (args.prompt) {
       prompt.set({ input: args.prompt, parts: [] })
       once = true
-      prompt.submit()
     }
   })
+
+  // Wait for sync and model store to be ready before auto-submitting --prompt
+  createEffect(
+    on(
+      () => sync.ready && local.model.ready,
+      (ready) => {
+        if (!ready) return
+        if (!args.prompt) return
+        if (prompt.current?.input !== args.prompt) return
+        prompt.submit()
+      },
+    ),
+  )
   const directory = useDirectory()
 
   const keybind = useKeybind()

packages/opencode/src/cli/cmd/tui/routes/session/header.tsx

@@ -7,6 +7,7 @@ import { SplitBorder } from "@tui/component/border"
 import type { AssistantMessage, Session } from "@opencode-ai/sdk/v2"
 import { useCommandDialog } from "@tui/component/dialog-command"
 import { useKeybind } from "../../context/keybind"
+import { Flag } from "@/flag/flag"
 import { useTerminalDimensions } from "@opentui/solid"
 
 const Title = (props: { session: Accessor<Session> }) => {
@@ -29,6 +30,17 @@ const ContextInfo = (props: { context: Accessor<string | undefined>; cost: Acces
   )
 }
 
+const WorkspaceInfo = (props: { workspace: Accessor<string | undefined> }) => {
+  const { theme } = useTheme()
+  return (
+    <Show when={props.workspace()}>
+      <text fg={theme.textMuted} wrapMode="none" flexShrink={0}>
+        {props.workspace()}
+      </text>
+    </Show>
+  )
+}
+
 export function Header() {
   const route = useRouteData("session")
   const sync = useSync()
@@ -59,6 +71,14 @@ export function Header() {
     return result
   })
 
+  const workspace = createMemo(() => {
+    const id = session()?.workspaceID
+    if (!id) return "Workspace local"
+    const info = sync.workspace.get(id)
+    if (!info) return `Workspace ${id}`
+    return `Workspace ${id} (${info.type})`
+  })
+
   const { theme } = useTheme()
   const keybind = useKeybind()
   const command = useCommandDialog()
@@ -83,9 +103,19 @@ export function Header() {
           <Match when={session()?.parentID}>
             <box flexDirection="column" gap={1}>
               <box flexDirection={narrow() ? "column" : "row"} justifyContent="space-between" gap={narrow() ? 1 : 0}>
-                <text fg={theme.text}>
-                  <b>Subagent session</b>
-                </text>
+                {Flag.OPENCODE_EXPERIMENTAL_WORKSPACES ? (
+                  <box flexDirection="column">
+                    <text fg={theme.text}>
+                      <b>Subagent session</b>
+                    </text>
+                    <WorkspaceInfo workspace={workspace} />
+                  </box>
+                ) : (
+                  <text fg={theme.text}>
+                    <b>Subagent session</b>
+                  </text>
+                )}
+
                 <ContextInfo context={context} cost={cost} />
               </box>
               <box flexDirection="row" gap={2}>
@@ -124,7 +154,14 @@ export function Header() {
           </Match>
           <Match when={true}>
             <box flexDirection={narrow() ? "column" : "row"} justifyContent="space-between" gap={1}>
-              <Title session={session} />
+              {Flag.OPENCODE_EXPERIMENTAL_WORKSPACES ? (
+                <box flexDirection="column">
+                  <Title session={session} />
+                  <WorkspaceInfo workspace={workspace} />
+                </box>
+              ) : (
+                <Title session={session} />
+              )}
               <ContextInfo context={context} cost={cost} />
             </box>
           </Match>

packages/opencode/src/cli/cmd/tui/routes/session/index.tsx

@@ -182,6 +182,12 @@ export function Session() {
     return new CustomSpeedScroll(3)
   })
 
+  createEffect(() => {
+    if (session()?.workspaceID) {
+      sdk.setWorkspace(session()?.workspaceID)
+    }
+  })
+
   createEffect(async () => {
     await sync.session
       .sync(route.sessionID)
@@ -377,7 +383,12 @@ export function Session() {
             sessionID: route.sessionID,
           })
           .then((res) => copy(res.data!.share!.url))
-          .catch(() => toast.show({ message: "Failed to share session", variant: "error" }))
+          .catch((error) => {
+            toast.show({
+              message: error instanceof Error ? error.message : "Failed to share session",
+              variant: "error",
+            })
+          })
         dialog.clear()
       },
     },
@@ -480,7 +491,12 @@ export function Session() {
             sessionID: route.sessionID,
           })
           .then(() => toast.show({ message: "Session unshared successfully", variant: "success" }))
-          .catch(() => toast.show({ message: "Failed to unshare session", variant: "error" }))
+          .catch((error) => {
+            toast.show({
+              message: error instanceof Error ? error.message : "Failed to unshare session",
+              variant: "error",
+            })
+          })
         dialog.clear()
       },
     },

packages/opencode/src/cli/cmd/tui/thread.ts

@@ -42,6 +42,9 @@ function createWorkerFetch(client: RpcClient): typeof fetch {
 function createEventSource(client: RpcClient): EventSource {
   return {
     on: (handler) => client.on<Event>("event", handler),
+    setWorkspace: (workspaceID) => {
+      void client.call("setWorkspace", { workspaceID })
+    },
   }
 }
 

packages/opencode/src/cli/cmd/tui/util/clipboard.ts

@@ -1,9 +1,9 @@
-import { $ } from "bun"
 import { platform, release } from "os"
 import clipboardy from "clipboardy"
 import { lazy } from "../../../../util/lazy.js"
 import { tmpdir } from "os"
 import path from "path"
+import fs from "fs/promises"
 import { Filesystem } from "../../../../util/filesystem"
 import { Process } from "../../../../util/process"
 import { which } from "../../../../util/which"
@@ -34,23 +34,38 @@ export namespace Clipboard {
     if (os === "darwin") {
       const tmpfile = path.join(tmpdir(), "opencode-clipboard.png")
       try {
-        await $`osascript -e 'set imageData to the clipboard as "PNGf"' -e 'set fileRef to open for access POSIX file "${tmpfile}" with write permission' -e 'set eof fileRef to 0' -e 'write imageData to fileRef' -e 'close access fileRef'`
-          .nothrow()
-          .quiet()
+        await Process.run(
+          [
+            "osascript",
+            "-e",
+            'set imageData to the clipboard as "PNGf"',
+            "-e",
+            `set fileRef to open for access POSIX file "${tmpfile}" with write permission`,
+            "-e",
+            "set eof fileRef to 0",
+            "-e",
+            "write imageData to fileRef",
+            "-e",
+            "close access fileRef",
+          ],
+          { nothrow: true },
+        )
         const buffer = await Filesystem.readBytes(tmpfile)
         return { data: buffer.toString("base64"), mime: "image/png" }
       } catch {
       } finally {
-        await $`rm -f "${tmpfile}"`.nothrow().quiet()
+        await fs.rm(tmpfile, { force: true }).catch(() => {})
       }
     }
 
     if (os === "win32" || release().includes("WSL")) {
       const script =
         "Add-Type -AssemblyName System.Windows.Forms; $img = [System.Windows.Forms.Clipboard]::GetImage(); if ($img) { $ms = New-Object System.IO.MemoryStream; $img.Save($ms, [System.Drawing.Imaging.ImageFormat]::Png); [System.Convert]::ToBase64String($ms.ToArray()) }"
-      const base64 = await $`powershell.exe -NonInteractive -NoProfile -command "${script}"`.nothrow().text()
-      if (base64) {
-        const imageBuffer = Buffer.from(base64.trim(), "base64")
+      const base64 = await Process.text(["powershell.exe", "-NonInteractive", "-NoProfile", "-command", script], {
+        nothrow: true,
+      })
+      if (base64.text) {
+        const imageBuffer = Buffer.from(base64.text.trim(), "base64")
         if (imageBuffer.length > 0) {
           return { data: imageBuffer.toString("base64"), mime: "image/png" }
         }
@@ -58,13 +73,15 @@ export namespace Clipboard {
     }
 
     if (os === "linux") {
-      const wayland = await $`wl-paste -t image/png`.nothrow().arrayBuffer()
-      if (wayland && wayland.byteLength > 0) {
-        return { data: Buffer.from(wayland).toString("base64"), mime: "image/png" }
+      const wayland = await Process.run(["wl-paste", "-t", "image/png"], { nothrow: true })
+      if (wayland.stdout.byteLength > 0) {
+        return { data: Buffer.from(wayland.stdout).toString("base64"), mime: "image/png" }
       }
-      const x11 = await $`xclip -selection clipboard -t image/png -o`.nothrow().arrayBuffer()
-      if (x11 && x11.byteLength > 0) {
-        return { data: Buffer.from(x11).toString("base64"), mime: "image/png" }
+      const x11 = await Process.run(["xclip", "-selection", "clipboard", "-t", "image/png", "-o"], {
+        nothrow: true,
+      })
+      if (x11.stdout.byteLength > 0) {
+        return { data: Buffer.from(x11.stdout).toString("base64"), mime: "image/png" }
       }
     }
 
@@ -81,7 +98,7 @@ export namespace Clipboard {
       console.log("clipboard: using osascript")
       return async (text: string) => {
         const escaped = text.replace(/\\/g, "\\\\").replace(/"/g, '\\"')
-        await $`osascript -e 'set the clipboard to "${escaped}"'`.nothrow().quiet()
+        await Process.run(["osascript", "-e", `set the clipboard to "${escaped}"`], { nothrow: true })
       }
     }
 

packages/opencode/src/cli/cmd/tui/worker.ts

@@ -44,7 +44,7 @@ const eventStream = {
   abort: undefined as AbortController | undefined,
 }
 
-const startEventStream = (directory: string) => {
+const startEventStream = (input: { directory: string; workspaceID?: string }) => {
   if (eventStream.abort) eventStream.abort.abort()
   const abort = new AbortController()
   eventStream.abort = abort
@@ -54,12 +54,13 @@ const startEventStream = (directory: string) => {
     const request = new Request(input, init)
     const auth = getAuthorizationHeader()
     if (auth) request.headers.set("Authorization", auth)
-    return Server.App().fetch(request)
+    return Server.Default().fetch(request)
   }) as typeof globalThis.fetch
 
   const sdk = createOpencodeClient({
     baseUrl: "http://opencode.internal",
-    directory,
+    directory: input.directory,
+    experimental_workspaceID: input.workspaceID,
     fetch: fetchFn,
     signal,
   })
@@ -95,7 +96,7 @@ const startEventStream = (directory: string) => {
   })
 }
 
-startEventStream(process.cwd())
+startEventStream({ directory: process.cwd() })
 
 export const rpc = {
   async fetch(input: { url: string; method: string; headers: Record<string, string>; body?: string }) {
@@ -109,7 +110,7 @@ export const rpc = {
       headers,
       body: input.body,
     })
-    const response = await Server.App().fetch(request)
+    const response = await Server.Default().fetch(request)
     const body = await response.text()
     return {
       status: response.status,
@@ -135,6 +136,9 @@ export const rpc = {
     Config.global.reset()
     await Instance.disposeAll()
   },
+  async setWorkspace(input: { workspaceID?: string }) {
+    startEventStream({ directory: process.cwd(), workspaceID: input.workspaceID })
+  },
   async shutdown() {
     Log.Default.info("worker shutting down")
     if (eventStream.abort) eventStream.abort.abort()

packages/opencode/src/cli/cmd/uninstall.ts

@@ -3,11 +3,11 @@ import { UI } from "../ui"
 import * as prompts from "@clack/prompts"
 import { Installation } from "../../installation"
 import { Global } from "../../global"
-import { $ } from "bun"
 import fs from "fs/promises"
 import path from "path"
 import os from "os"
 import { Filesystem } from "../../util/filesystem"
+import { Process } from "../../util/process"
 
 interface UninstallArgs {
   keepConfig: boolean
@@ -192,16 +192,13 @@ async function executeUninstall(method: Installation.Method, targets: RemovalTar
     const cmd = cmds[method]
     if (cmd) {
       spinner.start(`Running ${cmd.join(" ")}...`)
-      const result =
-        method === "choco"
-          ? await $`echo Y | choco uninstall opencode -y -r`.quiet().nothrow()
-          : await $`${cmd}`.quiet().nothrow()
-      if (result.exitCode !== 0) {
-        spinner.stop(`Package manager uninstall failed: exit code ${result.exitCode}`, 1)
-        if (
-          method === "choco" &&
-          result.stdout.toString("utf8").includes("not running from an elevated command shell")
-        ) {
+      const result = await Process.run(method === "choco" ? ["choco", "uninstall", "opencode", "-y", "-r"] : cmd, {
+        nothrow: true,
+      })
+      if (result.code !== 0) {
+        spinner.stop(`Package manager uninstall failed: exit code ${result.code}`, 1)
+        const text = `${result.stdout.toString("utf8")}\n${result.stderr.toString("utf8")}`
+        if (method === "choco" && text.includes("not running from an elevated command shell")) {
           prompts.log.warn(`You may need to run '${cmd.join(" ")}' from an elevated command shell`)
         } else {
           prompts.log.warn(`You may need to run manually: ${cmd.join(" ")}`)

packages/opencode/src/cli/effect/prompt.ts

@@ -0,0 +1,25 @@
+import * as prompts from "@clack/prompts"
+import { Effect, Option } from "effect"
+
+export const intro = (msg: string) => Effect.sync(() => prompts.intro(msg))
+export const outro = (msg: string) => Effect.sync(() => prompts.outro(msg))
+
+export const log = {
+  info: (msg: string) => Effect.sync(() => prompts.log.info(msg)),
+}
+
+export const select = <Value>(opts: Parameters<typeof prompts.select<Value>>[0]) =>
+  Effect.tryPromise(() => prompts.select(opts)).pipe(
+    Effect.map((result) => {
+      if (prompts.isCancel(result)) return Option.none<Value>()
+      return Option.some(result)
+    }),
+  )
+
+export const spinner = () => {
+  const s = prompts.spinner()
+  return {
+    start: (msg: string) => Effect.sync(() => s.start(msg)),
+    stop: (msg: string, code?: number) => Effect.sync(() => s.stop(msg, code)),
+  }
+}

packages/opencode/src/config/config.ts

@@ -12,6 +12,7 @@ import { lazy } from "../util/lazy"
 import { NamedError } from "@opencode-ai/util/error"
 import { Flag } from "../flag/flag"
 import { Auth } from "../auth"
+import { Env } from "../env"
 import {
   type ParseError as JsoncParseError,
   applyEdits,
@@ -32,7 +33,7 @@ import { Glob } from "../util/glob"
 import { PackageRegistry } from "@/bun/registry"
 import { proxied } from "@/util/proxied"
 import { iife } from "@/util/iife"
-import { Control } from "@/control"
+import { Account } from "@/account"
 import { ConfigPaths } from "./paths"
 import { Filesystem } from "@/util/filesystem"
 
@@ -108,10 +109,6 @@ export namespace Config {
       }
     }
 
-    const token = await Control.token()
-    if (token) {
-    }
-
     // Global user config overrides remote config.
     result = mergeConfigConcatArrays(result, await global())
 
@@ -178,6 +175,26 @@ export namespace Config {
       log.debug("loaded custom config from OPENCODE_CONFIG_CONTENT")
     }
 
+    const active = Account.active()
+    if (active?.active_org_id) {
+      const config = await Account.config(active.id, active.active_org_id)
+      const token = await Account.token(active.id)
+      if (token) {
+        process.env["OPENCODE_CONSOLE_TOKEN"] = token
+        Env.set("OPENCODE_CONSOLE_TOKEN", token)
+      }
+
+      if (config) {
+        result = mergeConfigConcatArrays(
+          result,
+          await load(JSON.stringify(config), {
+            dir: path.dirname(`${active.url}/api/config`),
+            source: `${active.url}/api/config`,
+          }),
+        )
+      }
+    }
+
     // Load managed config files last (highest priority) - enterprise admin-controlled
     // Kept separate from directories array to avoid write operations when installing plugins
     // which would fail on system directories requiring elevated permissions

packages/opencode/src/control-plane/workspace-router-middleware.ts

@@ -1,6 +1,5 @@
-import { Instance } from "@/project/instance"
 import type { MiddlewareHandler } from "hono"
-import { Installation } from "../installation"
+import { Flag } from "../flag/flag"
 import { getAdaptor } from "./adaptors"
 import { Workspace } from "./workspace"
 import { WorkspaceContext } from "./workspace-context"
@@ -38,7 +37,7 @@ async function routeRequest(req: Request) {
 
 export const WorkspaceRouterMiddleware: MiddlewareHandler = async (c, next) => {
   // Only available in development for now
-  if (!Installation.isLocal()) {
+  if (!Flag.OPENCODE_EXPERIMENTAL_WORKSPACES) {
     return next()
   }
 

packages/opencode/src/control/index.ts

@@ -1,67 +0,0 @@
-import { eq, and } from "drizzle-orm"
-import { Database } from "@/storage/db"
-import { ControlAccountTable } from "./control.sql"
-import z from "zod"
-
-export * from "./control.sql"
-
-export namespace Control {
-  export const Account = z.object({
-    email: z.string(),
-    url: z.string(),
-  })
-  export type Account = z.infer<typeof Account>
-
-  function fromRow(row: (typeof ControlAccountTable)["$inferSelect"]): Account {
-    return {
-      email: row.email,
-      url: row.url,
-    }
-  }
-
-  export function account(): Account | undefined {
-    const row = Database.use((db) =>
-      db.select().from(ControlAccountTable).where(eq(ControlAccountTable.active, true)).get(),
-    )
-    return row ? fromRow(row) : undefined
-  }
-
-  export async function token(): Promise<string | undefined> {
-    const row = Database.use((db) =>
-      db.select().from(ControlAccountTable).where(eq(ControlAccountTable.active, true)).get(),
-    )
-    if (!row) return undefined
-    if (row.token_expiry && row.token_expiry > Date.now()) return row.access_token
-
-    const res = await fetch(`${row.url}/oauth/token`, {
-      method: "POST",
-      headers: { "Content-Type": "application/x-www-form-urlencoded" },
-      body: new URLSearchParams({
-        grant_type: "refresh_token",
-        refresh_token: row.refresh_token,
-      }).toString(),
-    })
-
-    if (!res.ok) return
-
-    const json = (await res.json()) as {
-      access_token: string
-      refresh_token?: string
-      expires_in?: number
-    }
-
-    Database.use((db) =>
-      db
-        .update(ControlAccountTable)
-        .set({
-          access_token: json.access_token,
-          refresh_token: json.refresh_token ?? row.refresh_token,
-          token_expiry: json.expires_in ? Date.now() + json.expires_in * 1000 : undefined,
-        })
-        .where(and(eq(ControlAccountTable.email, row.email), eq(ControlAccountTable.url, row.url)))
-        .run(),
-    )
-
-    return json.access_token
-  }
-}

packages/opencode/src/effect/runtime.ts

@@ -0,0 +1,4 @@
+import { ManagedRuntime } from "effect"
+import { AccountService } from "@/account/service"
+
+export const runtime = ManagedRuntime.make(AccountService.defaultLayer)

packages/opencode/src/file/index.ts

@@ -1,6 +1,5 @@
 import { BusEvent } from "@/bus/bus-event"
 import z from "zod"
-import { $ } from "bun"
 import { formatPatch, structuredPatch } from "diff"
 import path from "path"
 import fs from "fs"
@@ -11,6 +10,7 @@ import { Instance } from "../project/instance"
 import { Ripgrep } from "./ripgrep"
 import fuzzysort from "fuzzysort"
 import { Global } from "../global"
+import { git } from "@/util/git"
 
 export namespace File {
   const log = Log.create({ service: "file" })
@@ -418,11 +418,11 @@ export namespace File {
     const project = Instance.project
     if (project.vcs !== "git") return []
 
-    const diffOutput = await $`git -c core.fsmonitor=false -c core.quotepath=false diff --numstat HEAD`
-      .cwd(Instance.directory)
-      .quiet()
-      .nothrow()
-      .text()
+    const diffOutput = (
+      await git(["-c", "core.fsmonitor=false", "-c", "core.quotepath=false", "diff", "--numstat", "HEAD"], {
+        cwd: Instance.directory,
+      })
+    ).text()
 
     const changedFiles: Info[] = []
 
@@ -439,12 +439,14 @@ export namespace File {
       }
     }
 
-    const untrackedOutput =
-      await $`git -c core.fsmonitor=false -c core.quotepath=false ls-files --others --exclude-standard`
-        .cwd(Instance.directory)
-        .quiet()
-        .nothrow()
-        .text()
+    const untrackedOutput = (
+      await git(
+        ["-c", "core.fsmonitor=false", "-c", "core.quotepath=false", "ls-files", "--others", "--exclude-standard"],
+        {
+          cwd: Instance.directory,
+        },
+      )
+    ).text()
 
     if (untrackedOutput.trim()) {
       const untrackedFiles = untrackedOutput.trim().split("\n")
@@ -465,12 +467,14 @@ export namespace File {
     }
 
     // Get deleted files
-    const deletedOutput =
-      await $`git -c core.fsmonitor=false -c core.quotepath=false diff --name-only --diff-filter=D HEAD`
-        .cwd(Instance.directory)
-        .quiet()
-        .nothrow()
-        .text()
+    const deletedOutput = (
+      await git(
+        ["-c", "core.fsmonitor=false", "-c", "core.quotepath=false", "diff", "--name-only", "--diff-filter=D", "HEAD"],
+        {
+          cwd: Instance.directory,
+        },
+      )
+    ).text()
 
     if (deletedOutput.trim()) {
       const deletedFiles = deletedOutput.trim().split("\n")
@@ -541,16 +545,14 @@ export namespace File {
     const content = (await Filesystem.readText(full).catch(() => "")).trim()
 
     if (project.vcs === "git") {
-      let diff = await $`git -c core.fsmonitor=false diff ${file}`.cwd(Instance.directory).quiet().nothrow().text()
+      let diff = (await git(["-c", "core.fsmonitor=false", "diff", "--", file], { cwd: Instance.directory })).text()
       if (!diff.trim()) {
-        diff = await $`git -c core.fsmonitor=false diff --staged ${file}`
-          .cwd(Instance.directory)
-          .quiet()
-          .nothrow()
-          .text()
+        diff = (
+          await git(["-c", "core.fsmonitor=false", "diff", "--staged", "--", file], { cwd: Instance.directory })
+        ).text()
       }
       if (diff.trim()) {
-        const original = await $`git show HEAD:${file}`.cwd(Instance.directory).quiet().nothrow().text()
+        const original = (await git(["show", `HEAD:${file}`], { cwd: Instance.directory })).text()
         const patch = structuredPatch(file, file, original, content, "old", "new", {
           context: Infinity,
           ignoreWhitespace: true,

packages/opencode/src/file/ripgrep.ts

@@ -5,7 +5,7 @@ import fs from "fs/promises"
 import z from "zod"
 import { NamedError } from "@opencode-ai/util/error"
 import { lazy } from "../util/lazy"
-import { $ } from "bun"
+
 import { Filesystem } from "../util/filesystem"
 import { Process } from "../util/process"
 import { which } from "../util/which"
@@ -338,7 +338,7 @@ export namespace Ripgrep {
     limit?: number
     follow?: boolean
   }) {
-    const args = [`${await filepath()}`, "--json", "--hidden", "--glob='!.git/*'"]
+    const args = [`${await filepath()}`, "--json", "--hidden", "--glob=!.git/*"]
     if (input.follow) args.push("--follow")
 
     if (input.glob) {
@@ -354,14 +354,16 @@ export namespace Ripgrep {
     args.push("--")
     args.push(input.pattern)
 
-    const command = args.join(" ")
-    const result = await $`${{ raw: command }}`.cwd(input.cwd).quiet().nothrow()
-    if (result.exitCode !== 0) {
+    const result = await Process.text(args, {
+      cwd: input.cwd,
+      nothrow: true,
+    })
+    if (result.code !== 0) {
       return []
     }
 
     // Handle both Unix (\n) and Windows (\r\n) line endings
-    const lines = result.text().trim().split(/\r?\n/).filter(Boolean)
+    const lines = result.text.trim().split(/\r?\n/).filter(Boolean)
     // Parse JSON lines from ripgrep output
 
     return lines

packages/opencode/src/file/watcher.ts

@@ -11,9 +11,9 @@ import { createWrapper } from "@parcel/watcher/wrapper"
 import { lazy } from "@/util/lazy"
 import { withTimeout } from "@/util/timeout"
 import type ParcelWatcher from "@parcel/watcher"
-import { $ } from "bun"
 import { Flag } from "@/flag/flag"
 import { readdir } from "fs/promises"
+import { git } from "@/util/git"
 
 const SUBSCRIBE_TIMEOUT_MS = 10_000
 
@@ -88,13 +88,10 @@ export namespace FileWatcher {
       }
 
       if (Instance.project.vcs === "git") {
-        const vcsDir = await $`git rev-parse --git-dir`
-          .quiet()
-          .nothrow()
-          .cwd(Instance.worktree)
-          .text()
-          .then((x) => path.resolve(Instance.worktree, x.trim()))
-          .catch(() => undefined)
+        const result = await git(["rev-parse", "--git-dir"], {
+          cwd: Instance.worktree,
+        })
+        const vcsDir = result.exitCode === 0 ? path.resolve(Instance.worktree, result.text().trim()) : undefined
         if (vcsDir && !cfgIgnores.includes(".git") && !cfgIgnores.includes(vcsDir)) {
           const gitDirContents = await readdir(vcsDir).catch(() => [])
           const ignoreList = gitDirContents.filter((entry) => entry !== "HEAD")

packages/opencode/src/flag/flag.ts

@@ -57,6 +57,7 @@ export namespace Flag {
   export const OPENCODE_EXPERIMENTAL_LSP_TOOL = OPENCODE_EXPERIMENTAL || truthy("OPENCODE_EXPERIMENTAL_LSP_TOOL")
   export const OPENCODE_DISABLE_FILETIME_CHECK = truthy("OPENCODE_DISABLE_FILETIME_CHECK")
   export const OPENCODE_EXPERIMENTAL_PLAN_MODE = OPENCODE_EXPERIMENTAL || truthy("OPENCODE_EXPERIMENTAL_PLAN_MODE")
+  export const OPENCODE_EXPERIMENTAL_WORKSPACES = OPENCODE_EXPERIMENTAL || truthy("OPENCODE_EXPERIMENTAL_WORKSPACES")
   export const OPENCODE_EXPERIMENTAL_MARKDOWN = !falsy("OPENCODE_EXPERIMENTAL_MARKDOWN")
   export const OPENCODE_MODELS_URL = process.env["OPENCODE_MODELS_URL"]
   export const OPENCODE_MODELS_PATH = process.env["OPENCODE_MODELS_PATH"]

packages/opencode/src/index.ts

@@ -3,7 +3,8 @@ import { hideBin } from "yargs/helpers"
 import { RunCommand } from "./cli/cmd/run"
 import { GenerateCommand } from "./cli/cmd/generate"
 import { Log } from "./util/log"
-import { AuthCommand } from "./cli/cmd/auth"
+import { LoginCommand, LogoutCommand, SwitchCommand, OrgsCommand } from "./cli/cmd/account"
+import { ProvidersCommand } from "./cli/cmd/providers"
 import { AgentCommand } from "./cli/cmd/agent"
 import { UpgradeCommand } from "./cli/cmd/upgrade"
 import { UninstallCommand } from "./cli/cmd/uninstall"
@@ -134,7 +135,11 @@ let cli = yargs(hideBin(process.argv))
   .command(RunCommand)
   .command(GenerateCommand)
   .command(DebugCommand)
-  .command(AuthCommand)
+  .command(LoginCommand)
+  .command(LogoutCommand)
+  .command(SwitchCommand)
+  .command(OrgsCommand)
+  .command(ProvidersCommand)
   .command(AgentCommand)
   .command(UpgradeCommand)
   .command(UninstallCommand)

packages/opencode/src/installation/index.ts

@@ -1,11 +1,12 @@
 import { BusEvent } from "@/bus/bus-event"
 import path from "path"
-import { $ } from "bun"
 import z from "zod"
 import { NamedError } from "@opencode-ai/util/error"
 import { Log } from "../util/log"
 import { iife } from "@/util/iife"
 import { Flag } from "../flag/flag"
+import { Process } from "@/util/process"
+import { buffer } from "node:stream/consumers"
 
 declare global {
   const OPENCODE_VERSION: string
@@ -15,6 +16,38 @@ declare global {
 export namespace Installation {
   const log = Log.create({ service: "installation" })
 
+  async function text(cmd: string[], opts: { cwd?: string; env?: NodeJS.ProcessEnv } = {}) {
+    return Process.text(cmd, {
+      cwd: opts.cwd,
+      env: opts.env,
+      nothrow: true,
+    }).then((x) => x.text)
+  }
+
+  async function upgradeCurl(target: string) {
+    const body = await fetch("https://opencode.ai/install").then((res) => {
+      if (!res.ok) throw new Error(res.statusText)
+      return res.text()
+    })
+    const proc = Process.spawn(["bash"], {
+      stdin: "pipe",
+      stdout: "pipe",
+      stderr: "pipe",
+      env: {
+        ...process.env,
+        VERSION: target,
+      },
+    })
+    if (!proc.stdin || !proc.stdout || !proc.stderr) throw new Error("Process output not available")
+    proc.stdin.end(body)
+    const [code, stdout, stderr] = await Promise.all([proc.exited, buffer(proc.stdout), buffer(proc.stderr)])
+    return {
+      code,
+      stdout,
+      stderr,
+    }
+  }
+
   export type Method = Awaited<ReturnType<typeof method>>
 
   export const Event = {
@@ -65,31 +98,31 @@ export namespace Installation {
     const checks = [
       {
         name: "npm" as const,
-        command: () => $`npm list -g --depth=0`.throws(false).quiet().text(),
+        command: () => text(["npm", "list", "-g", "--depth=0"]),
       },
       {
         name: "yarn" as const,
-        command: () => $`yarn global list`.throws(false).quiet().text(),
+        command: () => text(["yarn", "global", "list"]),
       },
       {
         name: "pnpm" as const,
-        command: () => $`pnpm list -g --depth=0`.throws(false).quiet().text(),
+        command: () => text(["pnpm", "list", "-g", "--depth=0"]),
       },
       {
         name: "bun" as const,
-        command: () => $`bun pm ls -g`.throws(false).quiet().text(),
+        command: () => text(["bun", "pm", "ls", "-g"]),
       },
       {
         name: "brew" as const,
-        command: () => $`brew list --formula opencode`.throws(false).quiet().text(),
+        command: () => text(["brew", "list", "--formula", "opencode"]),
       },
       {
         name: "scoop" as const,
-        command: () => $`scoop list opencode`.throws(false).quiet().text(),
+        command: () => text(["scoop", "list", "opencode"]),
       },
       {
         name: "choco" as const,
-        command: () => $`choco list --limit-output opencode`.throws(false).quiet().text(),
+        command: () => text(["choco", "list", "--limit-output", "opencode"]),
       },
     ]
 
@@ -121,61 +154,70 @@ export namespace Installation {
   )
 
   async function getBrewFormula() {
-    const tapFormula = await $`brew list --formula anomalyco/tap/opencode`.throws(false).quiet().text()
+    const tapFormula = await text(["brew", "list", "--formula", "anomalyco/tap/opencode"])
     if (tapFormula.includes("opencode")) return "anomalyco/tap/opencode"
-    const coreFormula = await $`brew list --formula opencode`.throws(false).quiet().text()
+    const coreFormula = await text(["brew", "list", "--formula", "opencode"])
     if (coreFormula.includes("opencode")) return "opencode"
     return "opencode"
   }
 
   export async function upgrade(method: Method, target: string) {
-    let cmd
+    let result: Awaited<ReturnType<typeof upgradeCurl>> | undefined
     switch (method) {
       case "curl":
-        cmd = $`curl -fsSL https://opencode.ai/install | bash`.env({
-          ...process.env,
-          VERSION: target,
-        })
+        result = await upgradeCurl(target)
         break
       case "npm":
-        cmd = $`npm install -g opencode-ai@${target}`
+        result = await Process.run(["npm", "install", "-g", `opencode-ai@${target}`], { nothrow: true })
         break
       case "pnpm":
-        cmd = $`pnpm install -g opencode-ai@${target}`
+        result = await Process.run(["pnpm", "install", "-g", `opencode-ai@${target}`], { nothrow: true })
         break
       case "bun":
-        cmd = $`bun install -g opencode-ai@${target}`
+        result = await Process.run(["bun", "install", "-g", `opencode-ai@${target}`], { nothrow: true })
         break
       case "brew": {
         const formula = await getBrewFormula()
-        if (formula.includes("/")) {
-          cmd =
-            $`brew tap anomalyco/tap && cd "$(brew --repo anomalyco/tap)" && git pull --ff-only && brew upgrade ${formula}`.env(
-              {
-                HOMEBREW_NO_AUTO_UPDATE: "1",
-                ...process.env,
-              },
-            )
-          break
-        }
-        cmd = $`brew upgrade ${formula}`.env({
+        const env = {
           HOMEBREW_NO_AUTO_UPDATE: "1",
           ...process.env,
-        })
+        }
+        if (formula.includes("/")) {
+          const tap = await Process.run(["brew", "tap", "anomalyco/tap"], { env, nothrow: true })
+          if (tap.code !== 0) {
+            result = tap
+            break
+          }
+          const repo = await Process.text(["brew", "--repo", "anomalyco/tap"], { env, nothrow: true })
+          if (repo.code !== 0) {
+            result = repo
+            break
+          }
+          const dir = repo.text.trim()
+          if (dir) {
+            const pull = await Process.run(["git", "pull", "--ff-only"], { cwd: dir, env, nothrow: true })
+            if (pull.code !== 0) {
+              result = pull
+              break
+            }
+          }
+        }
+        result = await Process.run(["brew", "upgrade", formula], { env, nothrow: true })
         break
       }
+
       case "choco":
-        cmd = $`echo Y | choco upgrade opencode --version=${target}`
+        result = await Process.run(["choco", "upgrade", "opencode", `--version=${target}`, "-y"], { nothrow: true })
         break
       case "scoop":
-        cmd = $`scoop install opencode@${target}`
+        result = await Process.run(["scoop", "install", `opencode@${target}`], { nothrow: true })
         break
       default:
         throw new Error(`Unknown method: ${method}`)
     }
-    const result = await cmd.quiet().throws(false)
-    if (result.exitCode !== 0) {
-      const stderr = method === "choco" ? "not running from an elevated command shell" : result.stderr.toString("utf8")
+    if (!result || result.code !== 0) {
+      const stderr =
+        method === "choco" ? "not running from an elevated command shell" : result?.stderr.toString("utf8") || ""
       throw new UpgradeFailedError({
         stderr: stderr,
       })
@@ -186,7 +228,7 @@ export namespace Installation {
       stdout: result.stdout.toString(),
       stderr: result.stderr.toString(),
     })
-    await $`${process.execPath} --version`.nothrow().quiet().text()
+    await Process.text([process.execPath, "--version"], { nothrow: true })
   }
 
   export const VERSION = typeof OPENCODE_VERSION === "string" ? OPENCODE_VERSION : "local"
@@ -199,7 +241,7 @@ export namespace Installation {
     if (detectedMethod === "brew") {
       const formula = await getBrewFormula()
       if (formula.includes("/")) {
-        const infoJson = await $`brew info --json=v2 ${formula}`.quiet().text()
+        const infoJson = await text(["brew", "info", "--json=v2", formula])
         const info = JSON.parse(infoJson)
         const version = info.formulae?.[0]?.versions?.stable
         if (!version) throw new Error(`Could not detect version for tap formula: ${formula}`)
@@ -215,7 +257,7 @@ export namespace Installation {
 
     if (detectedMethod === "npm" || detectedMethod === "bun" || detectedMethod === "pnpm") {
       const registry = await iife(async () => {
-        const r = (await $`npm config get registry`.quiet().nothrow().text()).trim()
+        const r = (await text(["npm", "config", "get", "registry"])).trim()
         const reg = r || "https://registry.npmjs.org"
         return reg.endsWith("/") ? reg.slice(0, -1) : reg
       })

packages/opencode/src/lsp/server.ts

@@ -4,7 +4,6 @@ import os from "os"
 import { Global } from "../global"
 import { Log } from "../util/log"
 import { BunProc } from "../bun"
-import { $ } from "bun"
 import { text } from "node:stream/consumers"
 import fs from "fs/promises"
 import { Filesystem } from "../util/filesystem"
@@ -13,6 +12,7 @@ import { Flag } from "../flag/flag"
 import { Archive } from "../util/archive"
 import { Process } from "../util/process"
 import { which } from "../util/which"
+import { Module } from "@opencode-ai/util/module"
 
 export namespace LSPServer {
   const log = Log.create({ service: "lsp.server" })
@@ -21,6 +21,8 @@ export namespace LSPServer {
       .stat(p)
       .then(() => true)
       .catch(() => false)
+  const run = (cmd: string[], opts: Process.RunOptions = {}) => Process.run(cmd, { ...opts, nothrow: true })
+  const output = (cmd: string[], opts: Process.RunOptions = {}) => Process.text(cmd, { ...opts, nothrow: true })
 
   export interface Handle {
     process: ChildProcessWithoutNullStreams
@@ -97,7 +99,7 @@ export namespace LSPServer {
     ),
     extensions: [".ts", ".tsx", ".js", ".jsx", ".mjs", ".cjs", ".mts", ".cts"],
     async spawn(root) {
-      const tsserver = await Bun.resolve("typescript/lib/tsserver.js", Instance.directory).catch(() => {})
+      const tsserver = Module.resolve("typescript/lib/tsserver.js", Instance.directory)
       log.info("typescript server", { tsserver })
       if (!tsserver) return
       const proc = spawn(BunProc.which(), ["x", "typescript-language-server", "--stdio"], {
@@ -172,7 +174,7 @@ export namespace LSPServer {
     root: NearestRoot(["package-lock.json", "bun.lockb", "bun.lock", "pnpm-lock.yaml", "yarn.lock"]),
     extensions: [".ts", ".tsx", ".js", ".jsx", ".mjs", ".cjs", ".mts", ".cts", ".vue"],
     async spawn(root) {
-      const eslint = await Bun.resolve("eslint", Instance.directory).catch(() => {})
+      const eslint = Module.resolve("eslint", Instance.directory)
       if (!eslint) return
       log.info("spawning eslint server")
       const serverPath = path.join(Global.Path.bin, "vscode-eslint", "server", "out", "eslintServer.js")
@@ -205,8 +207,8 @@ export namespace LSPServer {
         await fs.rename(extractedPath, finalPath)
 
         const npmCmd = process.platform === "win32" ? "npm.cmd" : "npm"
-        await $`${npmCmd} install`.cwd(finalPath).quiet()
-        await $`${npmCmd} run compile`.cwd(finalPath).quiet()
+        await Process.run([npmCmd, "install"], { cwd: finalPath })
+        await Process.run([npmCmd, "run", "compile"], { cwd: finalPath })
 
         log.info("installed VS Code ESLint server", { serverPath })
       }
@@ -340,7 +342,7 @@ export namespace LSPServer {
       let args = ["lsp-proxy", "--stdio"]
 
       if (!bin) {
-        const resolved = await Bun.resolve("biome", root).catch(() => undefined)
+        const resolved = Module.resolve("biome", root)
         if (!resolved) return
         bin = BunProc.which()
         args = ["x", "biome", "lsp-proxy", "--stdio"]
@@ -602,10 +604,11 @@ export namespace LSPServer {
             recursive: true,
           })
 
-          await $`mix deps.get && mix compile && mix elixir_ls.release2 -o release`
-            .quiet()
-            .cwd(path.join(Global.Path.bin, "elixir-ls-master"))
-            .env({ MIX_ENV: "prod", ...process.env })
+          const cwd = path.join(Global.Path.bin, "elixir-ls-master")
+          const env = { MIX_ENV: "prod", ...process.env }
+          await Process.run(["mix", "deps.get"], { cwd, env })
+          await Process.run(["mix", "compile"], { cwd, env })
+          await Process.run(["mix", "elixir_ls.release2", "-o", "release"], { cwd, env })
 
           log.info(`installed elixir-ls`, {
             path: elixirLsPath,
@@ -706,7 +709,7 @@ export namespace LSPServer {
             })
           if (!ok) return
         } else {
-          await $`tar -xf ${tempPath}`.cwd(Global.Path.bin).quiet().nothrow()
+          await run(["tar", "-xf", tempPath], { cwd: Global.Path.bin })
         }
 
         await fs.rm(tempPath, { force: true })
@@ -719,7 +722,7 @@ export namespace LSPServer {
         }
 
         if (platform !== "win32") {
-          await $`chmod +x ${bin}`.quiet().nothrow()
+          await fs.chmod(bin, 0o755).catch(() => {})
         }
 
         log.info(`installed zls`, { bin })
@@ -831,11 +834,11 @@ export namespace LSPServer {
       // This is specific to macOS where sourcekit-lsp is typically installed with Xcode
       if (!which("xcrun")) return
 
-      const lspLoc = await $`xcrun --find sourcekit-lsp`.quiet().nothrow()
+      const lspLoc = await output(["xcrun", "--find", "sourcekit-lsp"])
 
-      if (lspLoc.exitCode !== 0) return
+      if (lspLoc.code !== 0) return
 
-      const bin = lspLoc.text().trim()
+      const bin = lspLoc.text.trim()
 
       return {
         process: spawn(bin, {
@@ -1010,7 +1013,7 @@ export namespace LSPServer {
         if (!ok) return
       }
       if (tar) {
-        await $`tar -xf ${archive}`.cwd(Global.Path.bin).quiet().nothrow()
+        await run(["tar", "-xf", archive], { cwd: Global.Path.bin })
       }
       await fs.rm(archive, { force: true })
 
@@ -1021,7 +1024,7 @@ export namespace LSPServer {
       }
 
       if (platform !== "win32") {
-        await $`chmod +x ${bin}`.quiet().nothrow()
+        await fs.chmod(bin, 0o755).catch(() => {})
       }
 
       await fs.unlink(path.join(Global.Path.bin, "clangd")).catch(() => {})
@@ -1082,7 +1085,7 @@ export namespace LSPServer {
     extensions: [".astro"],
     root: NearestRoot(["package-lock.json", "bun.lockb", "bun.lock", "pnpm-lock.yaml", "yarn.lock"]),
     async spawn(root) {
-      const tsserver = await Bun.resolve("typescript/lib/tsserver.js", Instance.directory).catch(() => {})
+      const tsserver = Module.resolve("typescript/lib/tsserver.js", Instance.directory)
       if (!tsserver) {
         log.info("typescript not found, required for Astro language server")
         return
@@ -1130,7 +1133,30 @@ export namespace LSPServer {
 
   export const JDTLS: Info = {
     id: "jdtls",
-    root: NearestRoot(["pom.xml", "build.gradle", "build.gradle.kts", ".project", ".classpath"]),
+    root: async (file) => {
+      // Without exclusions, NearestRoot defaults to instance directory so we can't
+      // distinguish between a) no project found and b) project found at instance dir.
+      // So we can't choose the root from (potential) monorepo markers first.
+      // Look for potential subproject markers first while excluding potential monorepo markers.
+      const settingsMarkers = ["settings.gradle", "settings.gradle.kts"]
+      const gradleMarkers = ["gradlew", "gradlew.bat"]
+      const exclusionsForMonorepos = gradleMarkers.concat(settingsMarkers)
+
+      const [projectRoot, wrapperRoot, settingsRoot] = await Promise.all([
+        NearestRoot(
+          ["pom.xml", "build.gradle", "build.gradle.kts", ".project", ".classpath"],
+          exclusionsForMonorepos,
+        )(file),
+        NearestRoot(gradleMarkers, settingsMarkers)(file),
+        NearestRoot(settingsMarkers)(file),
+      ])
+
+      // If projectRoot is undefined we know we are in a monorepo or no project at all.
+      // So can safely fall through to the other roots
+      if (projectRoot) return projectRoot
+      if (wrapperRoot) return wrapperRoot
+      if (settingsRoot) return settingsRoot
+    },
     extensions: [".java"],
     async spawn(root) {
       const java = which("java")
@@ -1138,13 +1164,10 @@ export namespace LSPServer {
         log.error("Java 21 or newer is required to run the JDTLS. Please install it first.")
         return
       }
-      const javaMajorVersion = await $`java -version`
-        .quiet()
-        .nothrow()
-        .then(({ stderr }) => {
-          const m = /"(\d+)\.\d+\.\d+"/.exec(stderr.toString())
-          return !m ? undefined : parseInt(m[1])
-        })
+      const javaMajorVersion = await run(["java", "-version"]).then((result) => {
+        const m = /"(\d+)\.\d+\.\d+"/.exec(result.stderr.toString())
+        return !m ? undefined : parseInt(m[1])
+      })
       if (javaMajorVersion == null || javaMajorVersion < 21) {
         log.error("JDTLS requires at least Java 21.")
         return
@@ -1161,27 +1184,27 @@ export namespace LSPServer {
         const archiveName = "release.tar.gz"
 
         log.info("Downloading JDTLS archive", { url: releaseURL, dest: distPath })
-        const curlResult = await $`curl -L -o ${archiveName} '${releaseURL}'`.cwd(distPath).quiet().nothrow()
-        if (curlResult.exitCode !== 0) {
-          log.error("Failed to download JDTLS", { exitCode: curlResult.exitCode, stderr: curlResult.stderr.toString() })
+        const download = await fetch(releaseURL)
+        if (!download.ok || !download.body) {
+          log.error("Failed to download JDTLS", { status: download.status, statusText: download.statusText })
           return
         }
+        await Filesystem.writeStream(path.join(distPath, archiveName), download.body)
 
         log.info("Extracting JDTLS archive")
-        const tarResult = await $`tar -xzf ${archiveName}`.cwd(distPath).quiet().nothrow()
-        if (tarResult.exitCode !== 0) {
-          log.error("Failed to extract JDTLS", { exitCode: tarResult.exitCode, stderr: tarResult.stderr.toString() })
+        const tarResult = await run(["tar", "-xzf", archiveName], { cwd: distPath })
+        if (tarResult.code !== 0) {
+          log.error("Failed to extract JDTLS", { exitCode: tarResult.code, stderr: tarResult.stderr.toString() })
           return
         }
 
         await fs.rm(path.join(distPath, archiveName), { force: true })
         log.info("JDTLS download and extraction completed")
       }
-      const jarFileName = await $`ls org.eclipse.equinox.launcher_*.jar`
-        .cwd(launcherDir)
-        .quiet()
-        .nothrow()
-        .then(({ stdout }) => stdout.toString().trim())
+      const jarFileName =
+        (await fs.readdir(launcherDir).catch(() => []))
+          .find((item) => /^org\.eclipse\.equinox\.launcher_.*\.jar$/.test(item))
+          ?.trim() ?? ""
       const launcherJar = path.join(launcherDir, jarFileName)
       if (!(await pathExists(launcherJar))) {
         log.error(`Failed to locate the JDTLS launcher module in the installed directory: ${distPath}.`)
@@ -1294,7 +1317,15 @@ export namespace LSPServer {
 
         await fs.mkdir(distPath, { recursive: true })
         const archivePath = path.join(distPath, "kotlin-ls.zip")
-        await $`curl -L -o '${archivePath}' '${releaseURL}'`.quiet().nothrow()
+        const download = await fetch(releaseURL)
+        if (!download.ok || !download.body) {
+          log.error("Failed to download Kotlin Language Server", {
+            status: download.status,
+            statusText: download.statusText,
+          })
+          return
+        }
+        await Filesystem.writeStream(archivePath, download.body)
         const ok = await Archive.extractZip(archivePath, distPath)
           .then(() => true)
           .catch((error) => {
@@ -1304,7 +1335,7 @@ export namespace LSPServer {
         if (!ok) return
         await fs.rm(archivePath, { force: true })
         if (process.platform !== "win32") {
-          await $`chmod +x ${launcherScript}`.quiet().nothrow()
+          await fs.chmod(launcherScript, 0o755).catch(() => {})
         }
         log.info("Installed Kotlin Language Server", { path: launcherScript })
       }
@@ -1468,10 +1499,9 @@ export namespace LSPServer {
             })
           if (!ok) return
         } else {
-          const ok = await $`tar -xzf ${tempPath} -C ${installDir}`
-            .quiet()
-            .then(() => true)
-            .catch((error) => {
+          const ok = await run(["tar", "-xzf", tempPath, "-C", installDir])
+            .then((result) => result.code === 0)
+            .catch((error: unknown) => {
               log.error("Failed to extract lua-language-server archive", { error })
               return false
             })
@@ -1489,11 +1519,15 @@ export namespace LSPServer {
         }
 
         if (platform !== "win32") {
-          const ok = await $`chmod +x ${bin}`.quiet().catch((error) => {
-            log.error("Failed to set executable permission for lua-language-server binary", {
-              error,
+          const ok = await fs
+            .chmod(bin, 0o755)
+            .then(() => true)
+            .catch((error: unknown) => {
+              log.error("Failed to set executable permission for lua-language-server binary", {
+                error,
+              })
+              return false
             })
-          })
           if (!ok) return
         }
 
@@ -1707,7 +1741,7 @@ export namespace LSPServer {
         }
 
         if (platform !== "win32") {
-          await $`chmod +x ${bin}`.quiet().nothrow()
+          await fs.chmod(bin, 0o755).catch(() => {})
         }
 
         log.info(`installed terraform-ls`, { bin })
@@ -1790,7 +1824,7 @@ export namespace LSPServer {
           if (!ok) return
         }
         if (ext === "tar.gz") {
-          await $`tar -xzf ${tempPath}`.cwd(Global.Path.bin).quiet().nothrow()
+          await run(["tar", "-xzf", tempPath], { cwd: Global.Path.bin })
         }
 
         await fs.rm(tempPath, { force: true })
@@ -1803,7 +1837,7 @@ export namespace LSPServer {
         }
 
         if (platform !== "win32") {
-          await $`chmod +x ${bin}`.quiet().nothrow()
+          await fs.chmod(bin, 0o755).catch(() => {})
         }
 
         log.info("installed texlab", { bin })
@@ -1995,7 +2029,7 @@ export namespace LSPServer {
             })
           if (!ok) return
         } else {
-          await $`tar -xzf ${tempPath} --strip-components=1`.cwd(Global.Path.bin).quiet().nothrow()
+          await run(["tar", "-xzf", tempPath, "--strip-components=1"], { cwd: Global.Path.bin })
         }
 
         await fs.rm(tempPath, { force: true })
@@ -2008,7 +2042,7 @@ export namespace LSPServer {
         }
 
         if (platform !== "win32") {
-          await $`chmod +x ${bin}`.quiet().nothrow()
+          await fs.chmod(bin, 0o755).catch(() => {})
         }
 
         log.info("installed tinymist", { bin })

packages/opencode/src/plugin/index.ts

@@ -25,8 +25,7 @@ export namespace Plugin {
     const client = createOpencodeClient({
       baseUrl: "http://localhost:4096",
       directory: Instance.directory,
-      // @ts-ignore - fetch type incompatibility
-      fetch: async (...args) => Server.App().fetch(...args),
+      fetch: async (...args) => Server.Default().fetch(...args),
     })
     const config = await Config.get()
     const hooks: Hooks[] = []
@@ -35,7 +34,9 @@ export namespace Plugin {
       project: Instance.project,
       worktree: Instance.worktree,
       directory: Instance.directory,
-      serverUrl: Server.url(),
+      get serverUrl(): URL {
+        throw new Error("Server URL is no longer supported in plugins")
+      },
       $: Bun.$,
     }
 

packages/opencode/src/project/vcs.ts

@@ -1,11 +1,11 @@
 import { BusEvent } from "@/bus/bus-event"
 import { Bus } from "@/bus"
-import { $ } from "bun"
 import path from "path"
 import z from "zod"
 import { Log } from "@/util/log"
 import { Instance } from "./instance"
 import { FileWatcher } from "@/file/watcher"
+import { git } from "@/util/git"
 
 const log = Log.create({ service: "vcs" })
 
@@ -29,13 +29,13 @@ export namespace Vcs {
   export type Info = z.infer<typeof Info>
 
   async function currentBranch() {
-    return $`git rev-parse --abbrev-ref HEAD`
-      .quiet()
-      .nothrow()
-      .cwd(Instance.worktree)
-      .text()
-      .then((x) => x.trim())
-      .catch(() => undefined)
+    const result = await git(["rev-parse", "--abbrev-ref", "HEAD"], {
+      cwd: Instance.worktree,
+    })
+    if (result.exitCode !== 0) return
+    const text = result.text().trim()
+    if (!text) return
+    return text
   }
 
   const state = Instance.state(

packages/opencode/src/provider/provider.ts

@@ -480,6 +480,7 @@ export namespace Provider {
 
       const aiGatewayHeaders = {
         "User-Agent": `opencode/${Installation.VERSION} gitlab-ai-provider/${GITLAB_PROVIDER_VERSION} (${os.platform()} ${os.release()}; ${os.arch()})`,
+        "anthropic-beta": "context-1m-2025-08-07",
         ...(providerConfig?.options?.aiGatewayHeaders || {}),
       }
 

packages/opencode/src/provider/transform.ts

@@ -440,7 +440,9 @@ export namespace ProviderTransform {
         const copilotEfforts = iife(() => {
           if (id.includes("5.1-codex-max") || id.includes("5.2") || id.includes("5.3"))
             return [...WIDELY_SUPPORTED_EFFORTS, "xhigh"]
-          return WIDELY_SUPPORTED_EFFORTS
+          const arr = [...WIDELY_SUPPORTED_EFFORTS]
+          if (id.includes("gpt-5") && model.release_date >= "2025-12-04") arr.push("xhigh")
+          return arr
         })
         return Object.fromEntries(
           copilotEfforts.map((effort) => [

packages/opencode/src/session/prompt.ts

@@ -31,7 +31,8 @@ import { Flag } from "../flag/flag"
 import { ulid } from "ulid"
 import { spawn } from "child_process"
 import { Command } from "../command"
-import { $, fileURLToPath, pathToFileURL } from "bun"
+import { $ } from "bun"
+import { pathToFileURL, fileURLToPath } from "url"
 import { ConfigMarkdown } from "../config/markdown"
 import { SessionSummary } from "./summary"
 import { NamedError } from "@opencode-ai/util/error"

packages/opencode/src/share/share-next.ts

@@ -1,4 +1,5 @@
 import { Bus } from "@/bus"
+import { Account } from "@/account"
 import { Config } from "@/config/config"
 import { Provider } from "@/provider/provider"
 import { Session } from "@/session"
@@ -11,8 +12,51 @@ import type * as SDK from "@opencode-ai/sdk/v2"
 export namespace ShareNext {
   const log = Log.create({ service: "share-next" })
 
+  type ApiEndpoints = {
+    create: string
+    sync: (shareId: string) => string
+    remove: (shareId: string) => string
+    data: (shareId: string) => string
+  }
+
+  function apiEndpoints(resource: string): ApiEndpoints {
+    return {
+      create: `/api/${resource}`,
+      sync: (shareId) => `/api/${resource}/${shareId}/sync`,
+      remove: (shareId) => `/api/${resource}/${shareId}`,
+      data: (shareId) => `/api/${resource}/${shareId}/data`,
+    }
+  }
+
+  const legacyApi = apiEndpoints("share")
+  const controlApi = apiEndpoints("shares")
+
   export async function url() {
-    return Config.get().then((x) => x.enterprise?.url ?? "https://opncd.ai")
+    const req = await request()
+    return req.baseUrl
+  }
+
+  export async function request(): Promise<{
+    headers: Record<string, string>
+    api: ApiEndpoints
+    baseUrl: string
+  }> {
+    const headers: Record<string, string> = {}
+
+    const active = Account.active()
+    if (!active?.active_org_id) {
+      const baseUrl = await Config.get().then((x) => x.enterprise?.url ?? "https://opncd.ai")
+      return { headers, api: legacyApi, baseUrl }
+    }
+
+    const token = await Account.token(active.id)
+    if (!token) {
+      throw new Error("No active OpenControl token available for sharing")
+    }
+
+    headers["authorization"] = `Bearer ${token}`
+    headers["x-org-id"] = active.active_org_id
+    return { headers, api: controlApi, baseUrl: active.url }
   }
 
   const disabled = process.env["OPENCODE_DISABLE_SHARE"] === "true" || process.env["OPENCODE_DISABLE_SHARE"] === "1"
@@ -68,15 +112,20 @@ export namespace ShareNext {
   export async function create(sessionID: string) {
     if (disabled) return { id: "", url: "", secret: "" }
     log.info("creating share", { sessionID })
-    const result = await fetch(`${await url()}/api/share`, {
+    const req = await request()
+    const response = await fetch(`${req.baseUrl}${req.api.create}`, {
       method: "POST",
-      headers: {
-        "Content-Type": "application/json",
-      },
+      headers: { ...req.headers, "Content-Type": "application/json" },
       body: JSON.stringify({ sessionID: sessionID }),
     })
-      .then((x) => x.json())
-      .then((x) => x as { id: string; url: string; secret: string })
+
+    if (!response.ok) {
+      const message = await response.text().catch(() => response.statusText)
+      throw new Error(`Failed to create share (${response.status}): ${message || response.statusText}`)
+    }
+
+    const result = (await response.json()) as { id: string; url: string; secret: string }
+
     Database.use((db) =>
       db
         .insert(SessionShareTable)
@@ -159,16 +208,19 @@ export namespace ShareNext {
       const share = get(sessionID)
       if (!share) return
 
-      await fetch(`${await url()}/api/share/${share.id}/sync`, {
+      const req = await request()
+      const response = await fetch(`${req.baseUrl}${req.api.sync(share.id)}`, {
         method: "POST",
-        headers: {
-          "Content-Type": "application/json",
-        },
+        headers: { ...req.headers, "Content-Type": "application/json" },
         body: JSON.stringify({
           secret: share.secret,
           data: Array.from(queued.data.values()),
         }),
       })
+
+      if (!response.ok) {
+        log.warn("failed to sync share", { sessionID, shareID: share.id, status: response.status })
+      }
     }, 1000)
     queue.set(sessionID, { timeout, data: dataMap })
   }
@@ -178,15 +230,21 @@ export namespace ShareNext {
     log.info("removing share", { sessionID })
     const share = get(sessionID)
     if (!share) return
-    await fetch(`${await url()}/api/share/${share.id}`, {
+
+    const req = await request()
+    const response = await fetch(`${req.baseUrl}${req.api.remove(share.id)}`, {
       method: "DELETE",
-      headers: {
-        "Content-Type": "application/json",
-      },
+      headers: { ...req.headers, "Content-Type": "application/json" },
       body: JSON.stringify({
         secret: share.secret,
       }),
     })
+
+    if (!response.ok) {
+      const message = await response.text().catch(() => response.statusText)
+      throw new Error(`Failed to remove share (${response.status}): ${message || response.statusText}`)
+    }
+
     Database.use((db) => db.delete(SessionShareTable).where(eq(SessionShareTable.session_id, sessionID)).run())
   }
 

packages/opencode/src/snapshot/index.ts

@@ -1,4 +1,3 @@
-import { $ } from "bun"
 import path from "path"
 import fs from "fs/promises"
 import { Filesystem } from "../util/filesystem"
@@ -9,12 +8,17 @@ import z from "zod"
 import { Config } from "../config/config"
 import { Instance } from "../project/instance"
 import { Scheduler } from "../scheduler"
+import { Process } from "@/util/process"
 
 export namespace Snapshot {
   const log = Log.create({ service: "snapshot" })
   const hour = 60 * 60 * 1000
   const prune = "7.days"
 
+  function args(git: string, cmd: string[]) {
+    return ["--git-dir", git, "--work-tree", Instance.worktree, ...cmd]
+  }
+
   export function init() {
     Scheduler.register({
       id: "snapshot.cleanup",
@@ -34,13 +38,13 @@ export namespace Snapshot {
       .then(() => true)
       .catch(() => false)
     if (!exists) return
-    const result = await $`git --git-dir ${git} --work-tree ${Instance.worktree} gc --prune=${prune}`
-      .quiet()
-      .cwd(Instance.directory)
-      .nothrow()
-    if (result.exitCode !== 0) {
+    const result = await Process.run(["git", ...args(git, ["gc", `--prune=${prune}`])], {
+      cwd: Instance.directory,
+      nothrow: true,
+    })
+    if (result.code !== 0) {
       log.warn("cleanup failed", {
-        exitCode: result.exitCode,
+        exitCode: result.code,
         stderr: result.stderr.toString(),
         stdout: result.stdout.toString(),
       })
@@ -55,27 +59,27 @@ export namespace Snapshot {
     if (cfg.snapshot === false) return
     const git = gitdir()
     if (await fs.mkdir(git, { recursive: true })) {
-      await $`git init`
-        .env({
+      await Process.run(["git", "init"], {
+        env: {
           ...process.env,
           GIT_DIR: git,
           GIT_WORK_TREE: Instance.worktree,
-        })
-        .quiet()
-        .nothrow()
+        },
+        nothrow: true,
+      })
+
       // Configure git to not convert line endings on Windows
-      await $`git --git-dir ${git} config core.autocrlf false`.quiet().nothrow()
-      await $`git --git-dir ${git} config core.longpaths true`.quiet().nothrow()
-      await $`git --git-dir ${git} config core.symlinks true`.quiet().nothrow()
-      await $`git --git-dir ${git} config core.fsmonitor false`.quiet().nothrow()
+      await Process.run(["git", "--git-dir", git, "config", "core.autocrlf", "false"], { nothrow: true })
+      await Process.run(["git", "--git-dir", git, "config", "core.longpaths", "true"], { nothrow: true })
+      await Process.run(["git", "--git-dir", git, "config", "core.symlinks", "true"], { nothrow: true })
+      await Process.run(["git", "--git-dir", git, "config", "core.fsmonitor", "false"], { nothrow: true })
       log.info("initialized")
     }
     await add(git)
-    const hash = await $`git --git-dir ${git} --work-tree ${Instance.worktree} write-tree`
-      .quiet()
-      .cwd(Instance.directory)
-      .nothrow()
-      .text()
+    const hash = await Process.text(["git", ...args(git, ["write-tree"])], {
+      cwd: Instance.directory,
+      nothrow: true,
+    }).then((x) => x.text)
     log.info("tracking", { hash, cwd: Instance.directory, git })
     return hash.trim()
   }
@@ -89,19 +93,32 @@ export namespace Snapshot {
   export async function patch(hash: string): Promise<Patch> {
     const git = gitdir()
     await add(git)
-    const result =
-      await $`git -c core.autocrlf=false -c core.longpaths=true -c core.symlinks=true -c core.quotepath=false --git-dir ${git} --work-tree ${Instance.worktree} diff --no-ext-diff --name-only ${hash} -- .`
-        .quiet()
-        .cwd(Instance.directory)
-        .nothrow()
+    const result = await Process.text(
+      [
+        "git",
+        "-c",
+        "core.autocrlf=false",
+        "-c",
+        "core.longpaths=true",
+        "-c",
+        "core.symlinks=true",
+        "-c",
+        "core.quotepath=false",
+        ...args(git, ["diff", "--no-ext-diff", "--name-only", hash, "--", "."]),
+      ],
+      {
+        cwd: Instance.directory,
+        nothrow: true,
+      },
+    )
 
     // If git diff fails, return empty patch
-    if (result.exitCode !== 0) {
-      log.warn("failed to get diff", { hash, exitCode: result.exitCode })
+    if (result.code !== 0) {
+      log.warn("failed to get diff", { hash, exitCode: result.code })
       return { hash, files: [] }
     }
 
-    const files = result.text()
+    const files = result.text
     return {
       hash,
       files: files
@@ -116,20 +133,37 @@ export namespace Snapshot {
   export async function restore(snapshot: string) {
     log.info("restore", { commit: snapshot })
     const git = gitdir()
-    const result =
-      await $`git -c core.longpaths=true -c core.symlinks=true --git-dir ${git} --work-tree ${Instance.worktree} read-tree ${snapshot} && git -c core.longpaths=true -c core.symlinks=true --git-dir ${git} --work-tree ${Instance.worktree} checkout-index -a -f`
-        .quiet()
-        .cwd(Instance.worktree)
-        .nothrow()
-
-    if (result.exitCode !== 0) {
+    const result = await Process.run(
+      ["git", "-c", "core.longpaths=true", "-c", "core.symlinks=true", ...args(git, ["read-tree", snapshot])],
+      {
+        cwd: Instance.worktree,
+        nothrow: true,
+      },
+    )
+    if (result.code === 0) {
+      const checkout = await Process.run(
+        ["git", "-c", "core.longpaths=true", "-c", "core.symlinks=true", ...args(git, ["checkout-index", "-a", "-f"])],
+        {
+          cwd: Instance.worktree,
+          nothrow: true,
+        },
+      )
+      if (checkout.code === 0) return
       log.error("failed to restore snapshot", {
         snapshot,
-        exitCode: result.exitCode,
-        stderr: result.stderr.toString(),
-        stdout: result.stdout.toString(),
+        exitCode: checkout.code,
+        stderr: checkout.stderr.toString(),
+        stdout: checkout.stdout.toString(),
       })
+      return
     }
+
+    log.error("failed to restore snapshot", {
+      snapshot,
+      exitCode: result.code,
+      stderr: result.stderr.toString(),
+      stdout: result.stdout.toString(),
+    })
   }
 
   export async function revert(patches: Patch[]) {
@@ -139,19 +173,37 @@ export namespace Snapshot {
       for (const file of item.files) {
         if (files.has(file)) continue
         log.info("reverting", { file, hash: item.hash })
-        const result =
-          await $`git -c core.longpaths=true -c core.symlinks=true --git-dir ${git} --work-tree ${Instance.worktree} checkout ${item.hash} -- ${file}`
-            .quiet()
-            .cwd(Instance.worktree)
-            .nothrow()
-        if (result.exitCode !== 0) {
+        const result = await Process.run(
+          [
+            "git",
+            "-c",
+            "core.longpaths=true",
+            "-c",
+            "core.symlinks=true",
+            ...args(git, ["checkout", item.hash, "--", file]),
+          ],
+          {
+            cwd: Instance.worktree,
+            nothrow: true,
+          },
+        )
+        if (result.code !== 0) {
           const relativePath = path.relative(Instance.worktree, file)
-          const checkTree =
-            await $`git -c core.longpaths=true -c core.symlinks=true --git-dir ${git} --work-tree ${Instance.worktree} ls-tree ${item.hash} -- ${relativePath}`
-              .quiet()
-              .cwd(Instance.worktree)
-              .nothrow()
-          if (checkTree.exitCode === 0 && checkTree.text().trim()) {
+          const checkTree = await Process.text(
+            [
+              "git",
+              "-c",
+              "core.longpaths=true",
+              "-c",
+              "core.symlinks=true",
+              ...args(git, ["ls-tree", item.hash, "--", relativePath]),
+            ],
+            {
+              cwd: Instance.worktree,
+              nothrow: true,
+            },
+          )
+          if (checkTree.code === 0 && checkTree.text.trim()) {
             log.info("file existed in snapshot but checkout failed, keeping", {
               file,
             })
@@ -168,23 +220,36 @@ export namespace Snapshot {
   export async function diff(hash: string) {
     const git = gitdir()
     await add(git)
-    const result =
-      await $`git -c core.autocrlf=false -c core.longpaths=true -c core.symlinks=true -c core.quotepath=false --git-dir ${git} --work-tree ${Instance.worktree} diff --no-ext-diff ${hash} -- .`
-        .quiet()
-        .cwd(Instance.worktree)
-        .nothrow()
+    const result = await Process.text(
+      [
+        "git",
+        "-c",
+        "core.autocrlf=false",
+        "-c",
+        "core.longpaths=true",
+        "-c",
+        "core.symlinks=true",
+        "-c",
+        "core.quotepath=false",
+        ...args(git, ["diff", "--no-ext-diff", hash, "--", "."]),
+      ],
+      {
+        cwd: Instance.worktree,
+        nothrow: true,
+      },
+    )
 
-    if (result.exitCode !== 0) {
+    if (result.code !== 0) {
       log.warn("failed to get diff", {
         hash,
-        exitCode: result.exitCode,
+        exitCode: result.code,
         stderr: result.stderr.toString(),
         stdout: result.stdout.toString(),
       })
       return ""
     }
 
-    return result.text().trim()
+    return result.text.trim()
   }
 
   export const FileDiff = z
@@ -205,12 +270,24 @@ export namespace Snapshot {
     const result: FileDiff[] = []
     const status = new Map<string, "added" | "deleted" | "modified">()
 
-    const statuses =
-      await $`git -c core.autocrlf=false -c core.longpaths=true -c core.symlinks=true -c core.quotepath=false --git-dir ${git} --work-tree ${Instance.worktree} diff --no-ext-diff --name-status --no-renames ${from} ${to} -- .`
-        .quiet()
-        .cwd(Instance.directory)
-        .nothrow()
-        .text()
+    const statuses = await Process.text(
+      [
+        "git",
+        "-c",
+        "core.autocrlf=false",
+        "-c",
+        "core.longpaths=true",
+        "-c",
+        "core.symlinks=true",
+        "-c",
+        "core.quotepath=false",
+        ...args(git, ["diff", "--no-ext-diff", "--name-status", "--no-renames", from, to, "--", "."]),
+      ],
+      {
+        cwd: Instance.directory,
+        nothrow: true,
+      },
+    ).then((x) => x.text)
 
     for (const line of statuses.trim().split("\n")) {
       if (!line) continue
@@ -220,26 +297,57 @@ export namespace Snapshot {
       status.set(file, kind)
     }
 
-    for await (const line of $`git -c core.autocrlf=false -c core.longpaths=true -c core.symlinks=true -c core.quotepath=false --git-dir ${git} --work-tree ${Instance.worktree} diff --no-ext-diff --no-renames --numstat ${from} ${to} -- .`
-      .quiet()
-      .cwd(Instance.directory)
-      .nothrow()
-      .lines()) {
+    for (const line of await Process.lines(
+      [
+        "git",
+        "-c",
+        "core.autocrlf=false",
+        "-c",
+        "core.longpaths=true",
+        "-c",
+        "core.symlinks=true",
+        "-c",
+        "core.quotepath=false",
+        ...args(git, ["diff", "--no-ext-diff", "--no-renames", "--numstat", from, to, "--", "."]),
+      ],
+      {
+        cwd: Instance.directory,
+        nothrow: true,
+      },
+    )) {
       if (!line) continue
       const [additions, deletions, file] = line.split("\t")
       const isBinaryFile = additions === "-" && deletions === "-"
       const before = isBinaryFile
         ? ""
-        : await $`git -c core.autocrlf=false -c core.longpaths=true -c core.symlinks=true --git-dir ${git} --work-tree ${Instance.worktree} show ${from}:${file}`
-            .quiet()
-            .nothrow()
-            .text()
+        : await Process.text(
+            [
+              "git",
+              "-c",
+              "core.autocrlf=false",
+              "-c",
+              "core.longpaths=true",
+              "-c",
+              "core.symlinks=true",
+              ...args(git, ["show", `${from}:${file}`]),
+            ],
+            { nothrow: true },
+          ).then((x) => x.text)
       const after = isBinaryFile
         ? ""
-        : await $`git -c core.autocrlf=false -c core.longpaths=true -c core.symlinks=true --git-dir ${git} --work-tree ${Instance.worktree} show ${to}:${file}`
-            .quiet()
-            .nothrow()
-            .text()
+        : await Process.text(
+            [
+              "git",
+              "-c",
+              "core.autocrlf=false",
+              "-c",
+              "core.longpaths=true",
+              "-c",
+              "core.symlinks=true",
+              ...args(git, ["show", `${to}:${file}`]),
+            ],
+            { nothrow: true },
+          ).then((x) => x.text)
       const added = isBinaryFile ? 0 : parseInt(additions)
       const deleted = isBinaryFile ? 0 : parseInt(deletions)
       result.push({
@@ -261,10 +369,22 @@ export namespace Snapshot {
 
   async function add(git: string) {
     await syncExclude(git)
-    await $`git -c core.autocrlf=false -c core.longpaths=true -c core.symlinks=true --git-dir ${git} --work-tree ${Instance.worktree} add .`
-      .quiet()
-      .cwd(Instance.directory)
-      .nothrow()
+    await Process.run(
+      [
+        "git",
+        "-c",
+        "core.autocrlf=false",
+        "-c",
+        "core.longpaths=true",
+        "-c",
+        "core.symlinks=true",
+        ...args(git, ["add", "."]),
+      ],
+      {
+        cwd: Instance.directory,
+        nothrow: true,
+      },
+    )
   }
 
   async function syncExclude(git: string) {
@@ -281,11 +401,10 @@ export namespace Snapshot {
   }
 
   async function excludes() {
-    const file = await $`git rev-parse --path-format=absolute --git-path info/exclude`
-      .quiet()
-      .cwd(Instance.worktree)
-      .nothrow()
-      .text()
+    const file = await Process.text(["git", "rev-parse", "--path-format=absolute", "--git-path", "info/exclude"], {
+      cwd: Instance.worktree,
+      nothrow: true,
+    }).then((x) => x.text)
     if (!file.trim()) return
     const exists = await fs
       .stat(file.trim())

packages/opencode/src/storage/db.ts

@@ -39,7 +39,7 @@ export namespace Database {
   type Schema = typeof schema
   export type Transaction = SQLiteTransaction<"sync", void, Schema>
 
-  type Client = SQLiteBunDatabase<Schema>
+  type Client = SQLiteBunDatabase
 
   type Journal = { sql: string; timestamp: number; name: string }[]
 
@@ -93,7 +93,7 @@ export namespace Database {
     sqlite.run("PRAGMA foreign_keys = ON")
     sqlite.run("PRAGMA wal_checkpoint(PASSIVE)")
 
-    const db = drizzle({ client: sqlite, schema })
+    const db = drizzle({ client: sqlite })
 
     // Apply schema migrations
     const entries =
@@ -124,7 +124,7 @@ export namespace Database {
     Client.reset()
   }
 
-  export type TxOrDb = Transaction | Client
+  export type TxOrDb = SQLiteTransaction<"sync", void, any, any> | Client
 
   const ctx = Context.create<{
     tx: TxOrDb

packages/opencode/src/storage/schema.ts

@@ -1,5 +1,5 @@
-export { ControlAccountTable } from "../control/control.sql"
+export { AccountTable, AccountStateTable, ControlAccountTable } from "../account/account.sql"
+export { ProjectTable } from "../project/project.sql"
 export { SessionTable, MessageTable, PartTable, TodoTable, PermissionTable } from "../session/session.sql"
 export { SessionShareTable } from "../share/share.sql"
-export { ProjectTable } from "../project/project.sql"
 export { WorkspaceTable } from "../control-plane/workspace.sql"

packages/opencode/src/storage/storage.ts

@@ -5,10 +5,10 @@ import { Global } from "../global"
 import { Filesystem } from "../util/filesystem"
 import { lazy } from "../util/lazy"
 import { Lock } from "../util/lock"
-import { $ } from "bun"
 import { NamedError } from "@opencode-ai/util/error"
 import z from "zod"
 import { Glob } from "../util/glob"
+import { git } from "@/util/git"
 
 export namespace Storage {
   const log = Log.create({ service: "storage" })
@@ -49,18 +49,15 @@ export namespace Storage {
           }
           if (!worktree) continue
           if (!(await Filesystem.isDir(worktree))) continue
-          const [id] = await $`git rev-list --max-parents=0 --all`
-            .quiet()
-            .nothrow()
-            .cwd(worktree)
+          const result = await git(["rev-list", "--max-parents=0", "--all"], {
+            cwd: worktree,
+          })
+          const [id] = result
             .text()
-            .then((x) =>
-              x
-                .split("\n")
-                .filter(Boolean)
-                .map((x) => x.trim())
-                .toSorted(),
-            )
+            .split("\n")
+            .filter(Boolean)
+            .map((x) => x.trim())
+            .toSorted()
           if (!id) continue
           projectID = id
 

packages/opencode/src/tool/bash.ts

@@ -7,8 +7,8 @@ import { Log } from "../util/log"
 import { Instance } from "../project/instance"
 import { lazy } from "@/util/lazy"
 import { Language } from "web-tree-sitter"
+import fs from "fs/promises"
 
-import { $ } from "bun"
 import { Filesystem } from "@/util/filesystem"
 import { fileURLToPath } from "url"
 import { Flag } from "@/flag/flag.ts"
@@ -116,12 +116,7 @@ export const BashTool = Tool.define("bash", async () => {
         if (["cd", "rm", "cp", "mv", "mkdir", "touch", "chmod", "chown", "cat"].includes(command[0])) {
           for (const arg of command.slice(1)) {
             if (arg.startsWith("-") || (command[0] === "chmod" && arg.startsWith("+"))) continue
-            const resolved = await $`realpath ${arg}`
-              .cwd(cwd)
-              .quiet()
-              .nothrow()
-              .text()
-              .then((x) => x.trim())
+            const resolved = await fs.realpath(path.resolve(cwd, arg)).catch(() => "")
             log.info("resolved path", { arg, resolved })
             if (resolved) {
               const normalized =

packages/opencode/src/util/archive.ts

@@ -1,5 +1,5 @@
-import { $ } from "bun"
 import path from "path"
+import { Process } from "./process"
 
 export namespace Archive {
   export async function extractZip(zipPath: string, destDir: string) {
@@ -8,9 +8,10 @@ export namespace Archive {
       const winDestDir = path.resolve(destDir)
       // $global:ProgressPreference suppresses PowerShell's blue progress bar popup
       const cmd = `$global:ProgressPreference = 'SilentlyContinue'; Expand-Archive -Path '${winZipPath}' -DestinationPath '${winDestDir}' -Force`
-      await $`powershell -NoProfile -NonInteractive -Command ${cmd}`.quiet()
-    } else {
-      await $`unzip -o -q ${zipPath} -d ${destDir}`.quiet()
+      await Process.run(["powershell", "-NoProfile", "-NonInteractive", "-Command", cmd])
+      return
     }
+
+    await Process.run(["unzip", "-o", "-q", zipPath, "-d", destDir])
   }
 }

packages/opencode/src/util/effect-http-client.ts

@@ -0,0 +1,11 @@
+import { Schedule } from "effect"
+import { HttpClient } from "effect/unstable/http"
+
+export const withTransientReadRetry = <E, R>(client: HttpClient.HttpClient.With<E, R>) =>
+  client.pipe(
+    HttpClient.retryTransient({
+      retryOn: "errors-and-responses",
+      times: 2,
+      schedule: Schedule.exponential(200).pipe(Schedule.jittered),
+    }),
+  )

packages/opencode/src/util/process.ts

@@ -25,6 +25,10 @@ export namespace Process {
     stderr: Buffer
   }
 
+  export interface TextResult extends Result {
+    text: string
+  }
+
   export class RunFailedError extends Error {
     readonly cmd: string[]
     readonly code: number
@@ -114,13 +118,33 @@ export namespace Process {
 
     if (!proc.stdout || !proc.stderr) throw new Error("Process output not available")
 
-    const [code, stdout, stderr] = await Promise.all([proc.exited, buffer(proc.stdout), buffer(proc.stderr)])
-    const out = {
-      code,
-      stdout,
-      stderr,
-    }
+    const out = await Promise.all([proc.exited, buffer(proc.stdout), buffer(proc.stderr)])
+      .then(([code, stdout, stderr]) => ({
+        code,
+        stdout,
+        stderr,
+      }))
+      .catch((err: unknown) => {
+        if (!opts.nothrow) throw err
+        return {
+          code: 1,
+          stdout: Buffer.alloc(0),
+          stderr: Buffer.from(err instanceof Error ? err.message : String(err)),
+        }
+      })
     if (out.code === 0 || opts.nothrow) return out
     throw new RunFailedError(cmd, out.code, out.stdout, out.stderr)
   }
+
+  export async function text(cmd: string[], opts: RunOptions = {}): Promise<TextResult> {
+    const out = await run(cmd, opts)
+    return {
+      ...out,
+      text: out.stdout.toString(),
+    }
+  }
+
+  export async function lines(cmd: string[], opts: RunOptions = {}): Promise<string[]> {
+    return (await text(cmd, opts)).text.split(/\r?\n/).filter(Boolean)
+  }
 }

packages/opencode/src/util/schema.ts

@@ -0,0 +1,17 @@
+import { Schema } from "effect"
+
+/**
+ * Attach static methods to a schema object. Designed to be used with `.pipe()`:
+ *
+ * @example
+ *   export const Foo = fooSchema.pipe(
+ *     withStatics((schema) => ({
+ *       zero: schema.makeUnsafe(0),
+ *       from: Schema.decodeUnknownOption(schema),
+ *     }))
+ *   )
+ */
+export const withStatics =
+  <S extends object, M extends Record<string, unknown>>(methods: (schema: S) => M) =>
+  (schema: S): S & M =>
+    Object.assign(schema, methods(schema))

packages/opencode/src/worktree/index.ts

@@ -1,4 +1,3 @@
-import { $ } from "bun"
 import fs from "fs/promises"
 import path from "path"
 import z from "zod"
@@ -11,6 +10,8 @@ import { Database, eq } from "../storage/db"
 import { ProjectTable } from "../project/project.sql"
 import { fn } from "../util/fn"
 import { Log } from "../util/log"
+import { Process } from "../util/process"
+import { git } from "../util/git"
 import { BusEvent } from "@/bus/bus-event"
 import { GlobalBus } from "@/bus/global"
 
@@ -248,14 +249,14 @@ export namespace Worktree {
   }
 
   async function sweep(root: string) {
-    const first = await $`git clean -ffdx`.quiet().nothrow().cwd(root)
+    const first = await git(["clean", "-ffdx"], { cwd: root })
     if (first.exitCode === 0) return first
 
     const entries = failed(first)
     if (!entries.length) return first
 
     await prune(root, entries)
-    return $`git clean -ffdx`.quiet().nothrow().cwd(root)
+    return git(["clean", "-ffdx"], { cwd: root })
   }
 
   async function canonical(input: string) {
@@ -274,7 +275,9 @@ export namespace Worktree {
       if (await exists(directory)) continue
 
       const ref = `refs/heads/${branch}`
-      const branchCheck = await $`git show-ref --verify --quiet ${ref}`.quiet().nothrow().cwd(Instance.worktree)
+      const branchCheck = await git(["show-ref", "--verify", "--quiet", ref], {
+        cwd: Instance.worktree,
+      })
       if (branchCheck.exitCode === 0) continue
 
       return Info.parse({ name, branch, directory })
@@ -285,9 +288,9 @@ export namespace Worktree {
 
   async function runStartCommand(directory: string, cmd: string) {
     if (process.platform === "win32") {
-      return $`cmd /c ${cmd}`.nothrow().cwd(directory)
+      return Process.run(["cmd", "/c", cmd], { cwd: directory, nothrow: true })
     }
-    return $`bash -lc ${cmd}`.nothrow().cwd(directory)
+    return Process.run(["bash", "-lc", cmd], { cwd: directory, nothrow: true })
   }
 
   type StartKind = "project" | "worktree"
@@ -297,7 +300,7 @@ export namespace Worktree {
     if (!text) return true
 
     const ran = await runStartCommand(directory, text)
-    if (ran.exitCode === 0) return true
+    if (ran.code === 0) return true
 
     log.error("worktree start command failed", {
       kind,
@@ -344,10 +347,9 @@ export namespace Worktree {
   }
 
   export async function createFromInfo(info: Info, startCommand?: string) {
-    const created = await $`git worktree add --no-checkout -b ${info.branch} ${info.directory}`
-      .quiet()
-      .nothrow()
-      .cwd(Instance.worktree)
+    const created = await git(["worktree", "add", "--no-checkout", "-b", info.branch, info.directory], {
+      cwd: Instance.worktree,
+    })
     if (created.exitCode !== 0) {
       throw new CreateFailedError({ message: errorText(created) || "Failed to create git worktree" })
     }
@@ -359,7 +361,7 @@ export namespace Worktree {
 
     return () => {
       const start = async () => {
-        const populated = await $`git reset --hard`.quiet().nothrow().cwd(info.directory)
+        const populated = await git(["reset", "--hard"], { cwd: info.directory })
         if (populated.exitCode !== 0) {
           const message = errorText(populated) || "Failed to populate worktree"
           log.error("worktree checkout failed", { directory: info.directory, message })
@@ -476,10 +478,10 @@ export namespace Worktree {
 
     const stop = async (target: string) => {
       if (!(await exists(target))) return
-      await $`git fsmonitor--daemon stop`.quiet().nothrow().cwd(target)
+      await git(["fsmonitor--daemon", "stop"], { cwd: target })
     }
 
-    const list = await $`git worktree list --porcelain`.quiet().nothrow().cwd(Instance.worktree)
+    const list = await git(["worktree", "list", "--porcelain"], { cwd: Instance.worktree })
     if (list.exitCode !== 0) {
       throw new RemoveFailedError({ message: errorText(list) || "Failed to read git worktrees" })
     }
@@ -496,9 +498,11 @@ export namespace Worktree {
     }
 
     await stop(entry.path)
-    const removed = await $`git worktree remove --force ${entry.path}`.quiet().nothrow().cwd(Instance.worktree)
+    const removed = await git(["worktree", "remove", "--force", entry.path], {
+      cwd: Instance.worktree,
+    })
     if (removed.exitCode !== 0) {
-      const next = await $`git worktree list --porcelain`.quiet().nothrow().cwd(Instance.worktree)
+      const next = await git(["worktree", "list", "--porcelain"], { cwd: Instance.worktree })
       if (next.exitCode !== 0) {
         throw new RemoveFailedError({
           message: errorText(removed) || errorText(next) || "Failed to remove git worktree",
@@ -515,7 +519,7 @@ export namespace Worktree {
 
     const branch = entry.branch?.replace(/^refs\/heads\//, "")
     if (branch) {
-      const deleted = await $`git branch -D ${branch}`.quiet().nothrow().cwd(Instance.worktree)
+      const deleted = await git(["branch", "-D", branch], { cwd: Instance.worktree })
       if (deleted.exitCode !== 0) {
         throw new RemoveFailedError({ message: errorText(deleted) || "Failed to delete worktree branch" })
       }
@@ -535,7 +539,7 @@ export namespace Worktree {
       throw new ResetFailedError({ message: "Cannot reset the primary workspace" })
     }
 
-    const list = await $`git worktree list --porcelain`.quiet().nothrow().cwd(Instance.worktree)
+    const list = await git(["worktree", "list", "--porcelain"], { cwd: Instance.worktree })
     if (list.exitCode !== 0) {
       throw new ResetFailedError({ message: errorText(list) || "Failed to read git worktrees" })
     }
@@ -568,7 +572,7 @@ export namespace Worktree {
       throw new ResetFailedError({ message: "Worktree not found" })
     }
 
-    const remoteList = await $`git remote`.quiet().nothrow().cwd(Instance.worktree)
+    const remoteList = await git(["remote"], { cwd: Instance.worktree })
     if (remoteList.exitCode !== 0) {
       throw new ResetFailedError({ message: errorText(remoteList) || "Failed to list git remotes" })
     }
@@ -587,18 +591,19 @@ export namespace Worktree {
           : ""
 
     const remoteHead = remote
-      ? await $`git symbolic-ref refs/remotes/${remote}/HEAD`.quiet().nothrow().cwd(Instance.worktree)
+      ? await git(["symbolic-ref", `refs/remotes/${remote}/HEAD`], { cwd: Instance.worktree })
       : { exitCode: 1, stdout: undefined, stderr: undefined }
 
     const remoteRef = remoteHead.exitCode === 0 ? outputText(remoteHead.stdout) : ""
     const remoteTarget = remoteRef ? remoteRef.replace(/^refs\/remotes\//, "") : ""
     const remoteBranch = remote && remoteTarget.startsWith(`${remote}/`) ? remoteTarget.slice(`${remote}/`.length) : ""
 
-    const mainCheck = await $`git show-ref --verify --quiet refs/heads/main`.quiet().nothrow().cwd(Instance.worktree)
-    const masterCheck = await $`git show-ref --verify --quiet refs/heads/master`
-      .quiet()
-      .nothrow()
-      .cwd(Instance.worktree)
+    const mainCheck = await git(["show-ref", "--verify", "--quiet", "refs/heads/main"], {
+      cwd: Instance.worktree,
+    })
+    const masterCheck = await git(["show-ref", "--verify", "--quiet", "refs/heads/master"], {
+      cwd: Instance.worktree,
+    })
     const localBranch = mainCheck.exitCode === 0 ? "main" : masterCheck.exitCode === 0 ? "master" : ""
 
     const target = remoteBranch ? `${remote}/${remoteBranch}` : localBranch
@@ -607,7 +612,7 @@ export namespace Worktree {
     }
 
     if (remoteBranch) {
-      const fetch = await $`git fetch ${remote} ${remoteBranch}`.quiet().nothrow().cwd(Instance.worktree)
+      const fetch = await git(["fetch", remote, remoteBranch], { cwd: Instance.worktree })
       if (fetch.exitCode !== 0) {
         throw new ResetFailedError({ message: errorText(fetch) || `Failed to fetch ${target}` })
       }
@@ -619,7 +624,7 @@ export namespace Worktree {
 
     const worktreePath = entry.path
 
-    const resetToTarget = await $`git reset --hard ${target}`.quiet().nothrow().cwd(worktreePath)
+    const resetToTarget = await git(["reset", "--hard", target], { cwd: worktreePath })
     if (resetToTarget.exitCode !== 0) {
       throw new ResetFailedError({ message: errorText(resetToTarget) || "Failed to reset worktree to target" })
     }
@@ -629,22 +634,26 @@ export namespace Worktree {
       throw new ResetFailedError({ message: errorText(clean) || "Failed to clean worktree" })
     }
 
-    const update = await $`git submodule update --init --recursive --force`.quiet().nothrow().cwd(worktreePath)
+    const update = await git(["submodule", "update", "--init", "--recursive", "--force"], { cwd: worktreePath })
     if (update.exitCode !== 0) {
       throw new ResetFailedError({ message: errorText(update) || "Failed to update submodules" })
     }
 
-    const subReset = await $`git submodule foreach --recursive git reset --hard`.quiet().nothrow().cwd(worktreePath)
+    const subReset = await git(["submodule", "foreach", "--recursive", "git", "reset", "--hard"], {
+      cwd: worktreePath,
+    })
     if (subReset.exitCode !== 0) {
       throw new ResetFailedError({ message: errorText(subReset) || "Failed to reset submodules" })
     }
 
-    const subClean = await $`git submodule foreach --recursive git clean -fdx`.quiet().nothrow().cwd(worktreePath)
+    const subClean = await git(["submodule", "foreach", "--recursive", "git", "clean", "-fdx"], {
+      cwd: worktreePath,
+    })
     if (subClean.exitCode !== 0) {
       throw new ResetFailedError({ message: errorText(subClean) || "Failed to clean submodules" })
     }
 
-    const status = await $`git -c core.fsmonitor=false status --porcelain=v1`.quiet().nothrow().cwd(worktreePath)
+    const status = await git(["-c", "core.fsmonitor=false", "status", "--porcelain=v1"], { cwd: worktreePath })
     if (status.exitCode !== 0) {
       throw new ResetFailedError({ message: errorText(status) || "Failed to read git status" })
     }

packages/opencode/test/account/repo.test.ts

@@ -0,0 +1,332 @@
+import { expect } from "bun:test"
+import { Effect, Layer, Option } from "effect"
+
+import { AccountRepo } from "../../src/account/repo"
+import { AccountID, OrgID } from "../../src/account/schema"
+import { resetDatabase } from "../fixture/db"
+import { testEffect } from "../fixture/effect"
+
+const reset = Layer.effectDiscard(Effect.promise(() => resetDatabase()))
+
+const it = testEffect(Layer.merge(AccountRepo.layer, reset))
+
+it.effect(
+  "list returns empty when no accounts exist",
+  Effect.gen(function* () {
+    const accounts = yield* AccountRepo.use((r) => r.list())
+    expect(accounts).toEqual([])
+  }),
+)
+
+it.effect(
+  "active returns none when no accounts exist",
+  Effect.gen(function* () {
+    const active = yield* AccountRepo.use((r) => r.active())
+    expect(Option.isNone(active)).toBe(true)
+  }),
+)
+
+it.effect(
+  "persistAccount inserts and getRow retrieves",
+  Effect.gen(function* () {
+    const id = AccountID.make("user-1")
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "test@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_123",
+        refreshToken: "rt_456",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.some(OrgID.make("org-1")),
+      }),
+    )
+
+    const row = yield* AccountRepo.use((r) => r.getRow(id))
+    expect(Option.isSome(row)).toBe(true)
+    const value = Option.getOrThrow(row)
+    expect(value.id).toBe("user-1")
+    expect(value.email).toBe("test@example.com")
+
+    const active = yield* AccountRepo.use((r) => r.active())
+    expect(Option.getOrThrow(active).active_org_id).toBe(OrgID.make("org-1"))
+  }),
+)
+
+it.effect(
+  "persistAccount sets the active account and org",
+  Effect.gen(function* () {
+    const id1 = AccountID.make("user-1")
+    const id2 = AccountID.make("user-2")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id: id1,
+        email: "first@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_1",
+        refreshToken: "rt_1",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.some(OrgID.make("org-1")),
+      }),
+    )
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id: id2,
+        email: "second@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_2",
+        refreshToken: "rt_2",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.some(OrgID.make("org-2")),
+      }),
+    )
+
+    // Last persisted account is active with its org
+    const active = yield* AccountRepo.use((r) => r.active())
+    expect(Option.isSome(active)).toBe(true)
+    expect(Option.getOrThrow(active).id).toBe(AccountID.make("user-2"))
+    expect(Option.getOrThrow(active).active_org_id).toBe(OrgID.make("org-2"))
+  }),
+)
+
+it.effect(
+  "list returns all accounts",
+  Effect.gen(function* () {
+    const id1 = AccountID.make("user-1")
+    const id2 = AccountID.make("user-2")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id: id1,
+        email: "a@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_1",
+        refreshToken: "rt_1",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.none(),
+      }),
+    )
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id: id2,
+        email: "b@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_2",
+        refreshToken: "rt_2",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.some(OrgID.make("org-1")),
+      }),
+    )
+
+    const accounts = yield* AccountRepo.use((r) => r.list())
+    expect(accounts.length).toBe(2)
+    expect(accounts.map((a) => a.email).sort()).toEqual(["a@example.com", "b@example.com"])
+  }),
+)
+
+it.effect(
+  "remove deletes an account",
+  Effect.gen(function* () {
+    const id = AccountID.make("user-1")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "test@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_1",
+        refreshToken: "rt_1",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.none(),
+      }),
+    )
+
+    yield* AccountRepo.use((r) => r.remove(id))
+
+    const row = yield* AccountRepo.use((r) => r.getRow(id))
+    expect(Option.isNone(row)).toBe(true)
+  }),
+)
+
+it.effect(
+  "use stores the selected org and marks the account active",
+  Effect.gen(function* () {
+    const id1 = AccountID.make("user-1")
+    const id2 = AccountID.make("user-2")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id: id1,
+        email: "first@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_1",
+        refreshToken: "rt_1",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.none(),
+      }),
+    )
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id: id2,
+        email: "second@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_2",
+        refreshToken: "rt_2",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.none(),
+      }),
+    )
+
+    yield* AccountRepo.use((r) => r.use(id1, Option.some(OrgID.make("org-99"))))
+    const active1 = yield* AccountRepo.use((r) => r.active())
+    expect(Option.getOrThrow(active1).id).toBe(id1)
+    expect(Option.getOrThrow(active1).active_org_id).toBe(OrgID.make("org-99"))
+
+    yield* AccountRepo.use((r) => r.use(id1, Option.none()))
+    const active2 = yield* AccountRepo.use((r) => r.active())
+    expect(Option.getOrThrow(active2).active_org_id).toBeNull()
+  }),
+)
+
+it.effect(
+  "persistToken updates token fields",
+  Effect.gen(function* () {
+    const id = AccountID.make("user-1")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "test@example.com",
+        url: "https://control.example.com",
+        accessToken: "old_token",
+        refreshToken: "old_refresh",
+        expiry: 1000,
+        orgID: Option.none(),
+      }),
+    )
+
+    const expiry = Date.now() + 7200_000
+    yield* AccountRepo.use((r) =>
+      r.persistToken({
+        accountID: id,
+        accessToken: "new_token",
+        refreshToken: "new_refresh",
+        expiry: Option.some(expiry),
+      }),
+    )
+
+    const row = yield* AccountRepo.use((r) => r.getRow(id))
+    const value = Option.getOrThrow(row)
+    expect(value.access_token).toBe("new_token")
+    expect(value.refresh_token).toBe("new_refresh")
+    expect(value.token_expiry).toBe(expiry)
+  }),
+)
+
+it.effect(
+  "persistToken with no expiry sets token_expiry to null",
+  Effect.gen(function* () {
+    const id = AccountID.make("user-1")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "test@example.com",
+        url: "https://control.example.com",
+        accessToken: "old_token",
+        refreshToken: "old_refresh",
+        expiry: 1000,
+        orgID: Option.none(),
+      }),
+    )
+
+    yield* AccountRepo.use((r) =>
+      r.persistToken({
+        accountID: id,
+        accessToken: "new_token",
+        refreshToken: "new_refresh",
+        expiry: Option.none(),
+      }),
+    )
+
+    const row = yield* AccountRepo.use((r) => r.getRow(id))
+    expect(Option.getOrThrow(row).token_expiry).toBeNull()
+  }),
+)
+
+it.effect(
+  "persistAccount upserts on conflict",
+  Effect.gen(function* () {
+    const id = AccountID.make("user-1")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "test@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_v1",
+        refreshToken: "rt_v1",
+        expiry: 1000,
+        orgID: Option.some(OrgID.make("org-1")),
+      }),
+    )
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "test@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_v2",
+        refreshToken: "rt_v2",
+        expiry: 2000,
+        orgID: Option.some(OrgID.make("org-2")),
+      }),
+    )
+
+    const accounts = yield* AccountRepo.use((r) => r.list())
+    expect(accounts.length).toBe(1)
+
+    const row = yield* AccountRepo.use((r) => r.getRow(id))
+    const value = Option.getOrThrow(row)
+    expect(value.access_token).toBe("at_v2")
+
+    const active = yield* AccountRepo.use((r) => r.active())
+    expect(Option.getOrThrow(active).active_org_id).toBe(OrgID.make("org-2"))
+  }),
+)
+
+it.effect(
+  "remove clears active state when deleting the active account",
+  Effect.gen(function* () {
+    const id = AccountID.make("user-1")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "test@example.com",
+        url: "https://control.example.com",
+        accessToken: "at_1",
+        refreshToken: "rt_1",
+        expiry: Date.now() + 3600_000,
+        orgID: Option.some(OrgID.make("org-1")),
+      }),
+    )
+
+    yield* AccountRepo.use((r) => r.remove(id))
+
+    const active = yield* AccountRepo.use((r) => r.active())
+    expect(Option.isNone(active)).toBe(true)
+  }),
+)
+
+it.effect(
+  "getRow returns none for nonexistent account",
+  Effect.gen(function* () {
+    const row = yield* AccountRepo.use((r) => r.getRow(AccountID.make("nope")))
+    expect(Option.isNone(row)).toBe(true)
+  }),
+)

packages/opencode/test/account/service.test.ts

@@ -0,0 +1,217 @@
+import { expect } from "bun:test"
+import { Effect, Layer, Option, Ref, Schema } from "effect"
+import { HttpClient, HttpClientResponse } from "effect/unstable/http"
+
+import { AccountRepo } from "../../src/account/repo"
+import { AccountService } from "../../src/account/service"
+import { AccountID, Login, Org, OrgID } from "../../src/account/schema"
+import { resetDatabase } from "../fixture/db"
+import { testEffect } from "../fixture/effect"
+
+const reset = Layer.effectDiscard(Effect.promise(() => resetDatabase()))
+
+const it = testEffect(Layer.merge(AccountRepo.layer, reset))
+
+const live = (client: HttpClient.HttpClient) =>
+  AccountService.layer.pipe(Layer.provide(Layer.succeed(HttpClient.HttpClient, client)))
+
+const json = (req: Parameters<typeof HttpClientResponse.fromWeb>[0], body: unknown, status = 200) =>
+  HttpClientResponse.fromWeb(
+    req,
+    new Response(JSON.stringify(body), {
+      status,
+      headers: { "content-type": "application/json" },
+    }),
+  )
+
+const encodeOrg = Schema.encodeSync(Org)
+
+const org = (id: string, name: string) => encodeOrg(new Org({ id: OrgID.make(id), name }))
+
+it.effect(
+  "orgsByAccount groups orgs per account",
+  Effect.gen(function* () {
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id: AccountID.make("user-1"),
+        email: "one@example.com",
+        url: "https://one.example.com",
+        accessToken: "at_1",
+        refreshToken: "rt_1",
+        expiry: Date.now() + 60_000,
+        orgID: Option.none(),
+      }),
+    )
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id: AccountID.make("user-2"),
+        email: "two@example.com",
+        url: "https://two.example.com",
+        accessToken: "at_2",
+        refreshToken: "rt_2",
+        expiry: Date.now() + 60_000,
+        orgID: Option.none(),
+      }),
+    )
+
+    const seen = yield* Ref.make<string[]>([])
+    const client = HttpClient.make((req) =>
+      Effect.gen(function* () {
+        yield* Ref.update(seen, (xs) => [...xs, `${req.method} ${req.url}`])
+
+        if (req.url === "https://one.example.com/api/orgs") {
+          return json(req, [org("org-1", "One")])
+        }
+
+        if (req.url === "https://two.example.com/api/orgs") {
+          return json(req, [org("org-2", "Two A"), org("org-3", "Two B")])
+        }
+
+        return json(req, [], 404)
+      }),
+    )
+
+    const rows = yield* AccountService.use((s) => s.orgsByAccount()).pipe(Effect.provide(live(client)))
+
+    expect(rows.map((row) => [row.account.id, row.orgs.map((org) => org.id)]).map(([id, orgs]) => [id, orgs])).toEqual([
+      [AccountID.make("user-1"), [OrgID.make("org-1")]],
+      [AccountID.make("user-2"), [OrgID.make("org-2"), OrgID.make("org-3")]],
+    ])
+    expect(yield* Ref.get(seen)).toEqual([
+      "GET https://one.example.com/api/orgs",
+      "GET https://two.example.com/api/orgs",
+    ])
+  }),
+)
+
+it.effect(
+  "token refresh persists the new token",
+  Effect.gen(function* () {
+    const id = AccountID.make("user-1")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "user@example.com",
+        url: "https://one.example.com",
+        accessToken: "at_old",
+        refreshToken: "rt_old",
+        expiry: Date.now() - 1_000,
+        orgID: Option.none(),
+      }),
+    )
+
+    const client = HttpClient.make((req) =>
+      Effect.succeed(
+        req.url === "https://one.example.com/oauth/token"
+          ? json(req, {
+              access_token: "at_new",
+              refresh_token: "rt_new",
+              expires_in: 60,
+            })
+          : json(req, {}, 404),
+      ),
+    )
+
+    const token = yield* AccountService.use((s) => s.token(id)).pipe(Effect.provide(live(client)))
+
+    expect(Option.getOrThrow(token)).toBeDefined()
+    expect(String(Option.getOrThrow(token))).toBe("at_new")
+
+    const row = yield* AccountRepo.use((r) => r.getRow(id))
+    const value = Option.getOrThrow(row)
+    expect(value.access_token).toBe("at_new")
+    expect(value.refresh_token).toBe("rt_new")
+    expect(value.token_expiry).toBeGreaterThan(Date.now())
+  }),
+)
+
+it.effect(
+  "config sends the selected org header",
+  Effect.gen(function* () {
+    const id = AccountID.make("user-1")
+
+    yield* AccountRepo.use((r) =>
+      r.persistAccount({
+        id,
+        email: "user@example.com",
+        url: "https://one.example.com",
+        accessToken: "at_1",
+        refreshToken: "rt_1",
+        expiry: Date.now() + 60_000,
+        orgID: Option.none(),
+      }),
+    )
+
+    const seen = yield* Ref.make<{ auth?: string; org?: string }>({})
+    const client = HttpClient.make((req) =>
+      Effect.gen(function* () {
+        yield* Ref.set(seen, {
+          auth: req.headers.authorization,
+          org: req.headers["x-org-id"],
+        })
+
+        if (req.url === "https://one.example.com/api/config") {
+          return json(req, { config: { theme: "light", seats: 5 } })
+        }
+
+        return json(req, {}, 404)
+      }),
+    )
+
+    const cfg = yield* AccountService.use((s) => s.config(id, OrgID.make("org-9"))).pipe(Effect.provide(live(client)))
+
+    expect(Option.getOrThrow(cfg)).toEqual({ theme: "light", seats: 5 })
+    expect(yield* Ref.get(seen)).toEqual({
+      auth: "Bearer at_1",
+      org: "org-9",
+    })
+  }),
+)
+
+it.effect(
+  "poll stores the account and first org on success",
+  Effect.gen(function* () {
+    const login = new Login({
+      code: "device-code",
+      user: "user-code",
+      url: "https://one.example.com/verify",
+      server: "https://one.example.com",
+      expiry: 600,
+      interval: 5,
+    })
+
+    const client = HttpClient.make((req) =>
+      Effect.succeed(
+        req.url === "https://one.example.com/auth/device/token"
+          ? json(req, {
+              access_token: "at_1",
+              refresh_token: "rt_1",
+              expires_in: 60,
+            })
+          : req.url === "https://one.example.com/api/user"
+            ? json(req, { id: "user-1", email: "user@example.com" })
+            : req.url === "https://one.example.com/api/orgs"
+              ? json(req, [org("org-1", "One")])
+              : json(req, {}, 404),
+      ),
+    )
+
+    const res = yield* AccountService.use((s) => s.poll(login)).pipe(Effect.provide(live(client)))
+
+    expect(res._tag).toBe("PollSuccess")
+    if (res._tag === "PollSuccess") {
+      expect(res.email).toBe("user@example.com")
+    }
+
+    const active = yield* AccountRepo.use((r) => r.active())
+    expect(Option.getOrThrow(active)).toEqual(
+      expect.objectContaining({
+        id: "user-1",
+        email: "user@example.com",
+        active_org_id: "org-1",
+      }),
+    )
+  }),
+)

packages/opencode/test/cli/import.test.ts

@@ -1,5 +1,10 @@
 import { test, expect } from "bun:test"
-import { parseShareUrl, transformShareData, type ShareData } from "../../src/cli/cmd/import"
+import {
+  parseShareUrl,
+  shouldAttachShareAuthHeaders,
+  transformShareData,
+  type ShareData,
+} from "../../src/cli/cmd/import"
 
 // parseShareUrl tests
 test("parses valid share URLs", () => {
@@ -15,6 +20,19 @@ test("rejects invalid URLs", () => {
   expect(parseShareUrl("not-a-url")).toBeNull()
 })
 
+test("only attaches share auth headers for same-origin URLs", () => {
+  expect(shouldAttachShareAuthHeaders("https://control.example.com/share/abc", "https://control.example.com")).toBe(
+    true,
+  )
+  expect(
+    shouldAttachShareAuthHeaders("https://other.example.com/share/abc", "https://control.example.com"),
+  ).toBe(false)
+  expect(shouldAttachShareAuthHeaders("https://control.example.com:443/share/abc", "https://control.example.com")).toBe(
+    true,
+  )
+  expect(shouldAttachShareAuthHeaders("not-a-url", "https://control.example.com")).toBe(false)
+})
+
 // transformShareData tests
 test("transforms share data to storage format", () => {
   const data: ShareData[] = [

packages/opencode/test/cli/plugin-auth-picker.test.ts

@@ -1,5 +1,5 @@
 import { test, expect, describe } from "bun:test"
-import { resolvePluginProviders } from "../../src/cli/cmd/auth"
+import { resolvePluginProviders } from "../../src/cli/cmd/providers"
 import type { Hooks } from "@opencode-ai/plugin"
 
 function hookWithAuth(provider: string): Hooks {

packages/opencode/test/config/config.test.ts

@@ -2,6 +2,7 @@ import { test, expect, describe, mock, afterEach } from "bun:test"
 import { Config } from "../../src/config/config"
 import { Instance } from "../../src/project/instance"
 import { Auth } from "../../src/auth"
+import { AccessToken, Account, AccountID, OrgID } from "../../src/account"
 import { tmpdir } from "../fixture/fixture"
 import path from "path"
 import fs from "fs/promises"
@@ -242,6 +243,52 @@ test("preserves env variables when adding $schema to config", async () => {
   }
 })
 
+test("resolves env templates in account config with account token", async () => {
+  const originalActive = Account.active
+  const originalConfig = Account.config
+  const originalToken = Account.token
+  const originalControlToken = process.env["OPENCODE_CONSOLE_TOKEN"]
+
+  Account.active = mock(() => ({
+    id: AccountID.make("account-1"),
+    email: "user@example.com",
+    url: "https://control.example.com",
+    active_org_id: OrgID.make("org-1"),
+  }))
+
+  Account.config = mock(async () => ({
+    provider: {
+      opencode: {
+        options: {
+          apiKey: "{env:OPENCODE_CONSOLE_TOKEN}",
+        },
+      },
+    },
+  }))
+
+  Account.token = mock(async () => AccessToken.make("st_test_token"))
+
+  try {
+    await using tmp = await tmpdir()
+    await Instance.provide({
+      directory: tmp.path,
+      fn: async () => {
+        const config = await Config.get()
+        expect(config.provider?.["opencode"]?.options?.apiKey).toBe("st_test_token")
+      },
+    })
+  } finally {
+    Account.active = originalActive
+    Account.config = originalConfig
+    Account.token = originalToken
+    if (originalControlToken !== undefined) {
+      process.env["OPENCODE_CONSOLE_TOKEN"] = originalControlToken
+    } else {
+      delete process.env["OPENCODE_CONSOLE_TOKEN"]
+    }
+  }
+})
+
 test("handles file inclusion substitution", async () => {
   await using tmp = await tmpdir({
     init: async (dir) => {

packages/opencode/test/control-plane/session-proxy-middleware.test.ts

@@ -10,12 +10,22 @@ import { Database } from "../../src/storage/db"
 import { resetDatabase } from "../fixture/db"
 import * as adaptors from "../../src/control-plane/adaptors"
 import type { Adaptor } from "../../src/control-plane/types"
+import { Flag } from "../../src/flag/flag"
 
 afterEach(async () => {
   mock.restore()
   await resetDatabase()
 })
 
+const original = Flag.OPENCODE_EXPERIMENTAL_WORKSPACES
+// @ts-expect-error don't do this normally, but it works
+Flag.OPENCODE_EXPERIMENTAL_WORKSPACES = true
+
+afterEach(() => {
+  // @ts-expect-error don't do this normally, but it works
+  Flag.OPENCODE_EXPERIMENTAL_WORKSPACES = original
+})
+
 type State = {
   workspace?: "first" | "second"
   calls: Array<{ method: string; url: string; body?: string }>

packages/opencode/test/fixture/effect.ts

@@ -0,0 +1,7 @@
+import { test } from "bun:test"
+import { Effect, Layer } from "effect"
+
+export const testEffect = <R, E>(layer: Layer.Layer<R, E, never>) => ({
+  effect: <A, E2>(name: string, value: Effect.Effect<A, E2, R>) =>
+    test(name, () => Effect.runPromise(value.pipe(Effect.provide(layer)))),
+})

packages/opencode/test/provider/gitlab-duo.test.ts

@@ -198,6 +198,30 @@ test("GitLab Duo: config apiKey takes precedence over environment variable", asy
   })
 })
 
+test("GitLab Duo: includes context-1m beta header in aiGatewayHeaders", async () => {
+  await using tmp = await tmpdir({
+    init: async (dir) => {
+      await Bun.write(
+        path.join(dir, "opencode.json"),
+        JSON.stringify({
+          $schema: "https://opencode.ai/config.json",
+        }),
+      )
+    },
+  })
+  await Instance.provide({
+    directory: tmp.path,
+    init: async () => {
+      Env.set("GITLAB_TOKEN", "test-token")
+    },
+    fn: async () => {
+      const providers = await Provider.list()
+      expect(providers["gitlab"]).toBeDefined()
+      expect(providers["gitlab"].options?.aiGatewayHeaders?.["anthropic-beta"]).toContain("context-1m-2025-08-07")
+    },
+  })
+})
+
 test("GitLab Duo: supports feature flags configuration", async () => {
   await using tmp = await tmpdir({
     init: async (dir) => {

packages/opencode/test/provider/transform.test.ts

@@ -2002,6 +2002,35 @@ describe("ProviderTransform.variants", () => {
       const result = ProviderTransform.variants(model)
       expect(Object.keys(result)).toEqual(["low", "medium", "high", "xhigh"])
     })
+
+    test("gpt-5.3-codex includes xhigh", () => {
+      const model = createMockModel({
+        id: "gpt-5.3-codex",
+        providerID: "github-copilot",
+        api: {
+          id: "gpt-5.3-codex",
+          url: "https://api.githubcopilot.com",
+          npm: "@ai-sdk/github-copilot",
+        },
+      })
+      const result = ProviderTransform.variants(model)
+      expect(Object.keys(result)).toEqual(["low", "medium", "high", "xhigh"])
+    })
+
+    test("gpt-5.4 includes xhigh", () => {
+      const model = createMockModel({
+        id: "gpt-5.4",
+        release_date: "2026-03-05",
+        providerID: "github-copilot",
+        api: {
+          id: "gpt-5.4",
+          url: "https://api.githubcopilot.com",
+          npm: "@ai-sdk/github-copilot",
+        },
+      })
+      const result = ProviderTransform.variants(model)
+      expect(Object.keys(result)).toEqual(["low", "medium", "high", "xhigh"])
+    })
   })
 
   describe("@ai-sdk/cerebras", () => {

packages/opencode/test/server/project-init-git.test.ts

@@ -19,7 +19,7 @@ afterEach(async () => {
 describe("project.initGit endpoint", () => {
   test("initializes git and reloads immediately", async () => {
     await using tmp = await tmpdir()
-    const app = Server.App()
+    const app = Server.Default()
     const seen: { directory?: string; payload: { type: string } }[] = []
     const fn = (evt: { directory?: string; payload: { type: string } }) => {
       seen.push(evt)
@@ -75,7 +75,7 @@ describe("project.initGit endpoint", () => {
 
   test("does not reload when the project is already git", async () => {
     await using tmp = await tmpdir({ git: true })
-    const app = Server.App()
+    const app = Server.Default()
     const seen: { directory?: string; payload: { type: string } }[] = []
     const fn = (evt: { directory?: string; payload: { type: string } }) => {
       seen.push(evt)

packages/opencode/test/server/session-select.test.ts

@@ -17,7 +17,7 @@ describe("tui.selectSession endpoint", () => {
         const session = await Session.create({})
 
         // #when
-        const app = Server.App()
+        const app = Server.Default()
         const response = await app.request("/tui/select-session", {
           method: "POST",
           headers: { "Content-Type": "application/json" },
@@ -42,7 +42,7 @@ describe("tui.selectSession endpoint", () => {
         const nonExistentSessionID = "ses_nonexistent123"
 
         // #when
-        const app = Server.App()
+        const app = Server.Default()
         const response = await app.request("/tui/select-session", {
           method: "POST",
           headers: { "Content-Type": "application/json" },
@@ -63,7 +63,7 @@ describe("tui.selectSession endpoint", () => {
         const invalidSessionID = "invalid_session_id"
 
         // #when
-        const app = Server.App()
+        const app = Server.Default()
         const response = await app.request("/tui/select-session", {
           method: "POST",
           headers: { "Content-Type": "application/json" },

packages/opencode/test/share/share-next.test.ts

@@ -0,0 +1,76 @@
+import { test, expect, mock } from "bun:test"
+import { ShareNext } from "../../src/share/share-next"
+import { AccessToken, Account, AccountID, OrgID } from "../../src/account"
+import { Config } from "../../src/config/config"
+
+test("ShareNext.request uses legacy share API without active org account", async () => {
+  const originalActive = Account.active
+  const originalConfigGet = Config.get
+
+  Account.active = mock(() => undefined)
+  Config.get = mock(async () => ({ enterprise: { url: "https://legacy-share.example.com" } }))
+
+  try {
+    const req = await ShareNext.request()
+
+    expect(req.api.create).toBe("/api/share")
+    expect(req.api.sync("shr_123")).toBe("/api/share/shr_123/sync")
+    expect(req.api.remove("shr_123")).toBe("/api/share/shr_123")
+    expect(req.api.data("shr_123")).toBe("/api/share/shr_123/data")
+    expect(req.baseUrl).toBe("https://legacy-share.example.com")
+    expect(req.headers).toEqual({})
+  } finally {
+    Account.active = originalActive
+    Config.get = originalConfigGet
+  }
+})
+
+test("ShareNext.request uses org share API with auth headers when account is active", async () => {
+  const originalActive = Account.active
+  const originalToken = Account.token
+
+  Account.active = mock(() => ({
+    id: AccountID.make("account-1"),
+    email: "user@example.com",
+    url: "https://control.example.com",
+    active_org_id: OrgID.make("org-1"),
+  }))
+  Account.token = mock(async () => AccessToken.make("st_test_token"))
+
+  try {
+    const req = await ShareNext.request()
+
+    expect(req.api.create).toBe("/api/shares")
+    expect(req.api.sync("shr_123")).toBe("/api/shares/shr_123/sync")
+    expect(req.api.remove("shr_123")).toBe("/api/shares/shr_123")
+    expect(req.api.data("shr_123")).toBe("/api/shares/shr_123/data")
+    expect(req.baseUrl).toBe("https://control.example.com")
+    expect(req.headers).toEqual({
+      authorization: "Bearer st_test_token",
+      "x-org-id": "org-1",
+    })
+  } finally {
+    Account.active = originalActive
+    Account.token = originalToken
+  }
+})
+
+test("ShareNext.request fails when org account has no token", async () => {
+  const originalActive = Account.active
+  const originalToken = Account.token
+
+  Account.active = mock(() => ({
+    id: AccountID.make("account-1"),
+    email: "user@example.com",
+    url: "https://control.example.com",
+    active_org_id: OrgID.make("org-1"),
+  }))
+  Account.token = mock(async () => undefined)
+
+  try {
+    await expect(ShareNext.request()).rejects.toThrow("No active OpenControl token available for sharing")
+  } finally {
+    Account.active = originalActive
+    Account.token = originalToken
+  }
+})

packages/opencode/test/util/module.test.ts

@@ -0,0 +1,59 @@
+import { describe, expect, test } from "bun:test"
+import path from "path"
+import { Module } from "@opencode-ai/util/module"
+import { Filesystem } from "../../src/util/filesystem"
+import { tmpdir } from "../fixture/fixture"
+
+describe("util.module", () => {
+  test("resolves package subpaths from the provided dir", async () => {
+    await using tmp = await tmpdir()
+    const root = path.join(tmp.path, "proj")
+    const file = path.join(root, "node_modules/typescript/lib/tsserver.js")
+    await Filesystem.write(file, "export {}\n")
+    await Filesystem.writeJson(path.join(root, "node_modules/typescript/package.json"), { name: "typescript" })
+
+    expect(Module.resolve("typescript/lib/tsserver.js", root)).toBe(file)
+  })
+
+  test("resolves packages through ancestor node_modules", async () => {
+    await using tmp = await tmpdir()
+    const root = path.join(tmp.path, "proj")
+    const cwd = path.join(root, "apps/web")
+    const file = path.join(root, "node_modules/eslint/lib/api.js")
+    await Filesystem.write(file, "export {}\n")
+    await Filesystem.writeJson(path.join(root, "node_modules/eslint/package.json"), {
+      name: "eslint",
+      main: "lib/api.js",
+    })
+    await Filesystem.write(path.join(cwd, ".keep"), "")
+
+    expect(Module.resolve("eslint", cwd)).toBe(file)
+  })
+
+  test("resolves relative to the provided dir", async () => {
+    await using tmp = await tmpdir()
+    const a = path.join(tmp.path, "a")
+    const b = path.join(tmp.path, "b")
+    const left = path.join(a, "node_modules/biome/index.js")
+    const right = path.join(b, "node_modules/biome/index.js")
+    await Filesystem.write(left, "export {}\n")
+    await Filesystem.write(right, "export {}\n")
+    await Filesystem.writeJson(path.join(a, "node_modules/biome/package.json"), {
+      name: "biome",
+      main: "index.js",
+    })
+    await Filesystem.writeJson(path.join(b, "node_modules/biome/package.json"), {
+      name: "biome",
+      main: "index.js",
+    })
+
+    expect(Module.resolve("biome", a)).toBe(left)
+    expect(Module.resolve("biome", b)).toBe(right)
+    expect(Module.resolve("biome", a)).not.toBe(Module.resolve("biome", b))
+  })
+
+  test("returns undefined when resolution fails", async () => {
+    await using tmp = await tmpdir()
+    expect(Module.resolve("missing-package", tmp.path)).toBeUndefined()
+  })
+})

packages/opencode/tsconfig.json

@@ -11,6 +11,11 @@
     "paths": {
       "@/*": ["./src/*"],
       "@tui/*": ["./src/cli/cmd/tui/*"]
-    }
+    },
+    "plugins": [{
+      "name": "@effect/language-service",
+      "transform": "@effect/language-service/transform",
+      "namespaceImportPackages": ["effect", "@effect/*"]
+    }]
   }
 }

packages/plugin/package.json

@@ -1,7 +1,7 @@
 {
   "$schema": "https://json.schemastore.org/package.json",
   "name": "@opencode-ai/plugin",
-  "version": "1.2.23",
+  "version": "1.2.24",
   "type": "module",
   "license": "MIT",
   "scripts": {

packages/script/package.json

@@ -2,8 +2,12 @@
   "$schema": "https://json.schemastore.org/package",
   "name": "@opencode-ai/script",
   "license": "MIT",
+  "dependencies": {
+    "semver": "^7.6.3"
+  },
   "devDependencies": {
-    "@types/bun": "catalog:"
+    "@types/bun": "catalog:",
+    "@types/semver": "^7.5.8"
   },
   "exports": {
     ".": "./src/index.ts"